DK118771B - Analogifremgangsmåde til fremstilling af N-(phenoxyphenyl)sulfamider. - Google Patents
Analogifremgangsmåde til fremstilling af N-(phenoxyphenyl)sulfamider.Info
- Publication number
- DK118771B DK118771B DK346868AA DK346868A DK118771B DK 118771 B DK118771 B DK 118771B DK 346868A A DK346868A A DK 346868AA DK 346868 A DK346868 A DK 346868A DK 118771 B DK118771 B DK 118771B
- Authority
- DK
- Denmark
- Prior art keywords
- sulfamides
- phenoxyphenyl
- preparation
- analogous process
- analogous
- Prior art date
Links
- BMPSCJCTNUIRFS-UHFFFAOYSA-N 1-phenoxy-2-(sulfamoylamino)benzene Chemical class NS(=O)(=O)NC1=CC=CC=C1OC1=CC=CC=C1 BMPSCJCTNUIRFS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65408167A | 1967-07-18 | 1967-07-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118771B true DK118771B (da) | 1970-10-05 |
Family
ID=24623365
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK346868AA DK118771B (da) | 1967-07-18 | 1968-07-17 | Analogifremgangsmåde til fremstilling af N-(phenoxyphenyl)sulfamider. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3531523A (OSRAM) |
| BE (1) | BE718229A (OSRAM) |
| CH (1) | CH489480A (OSRAM) |
| DK (1) | DK118771B (OSRAM) |
| ES (1) | ES355267A1 (OSRAM) |
| FR (1) | FR1586895A (OSRAM) |
| GB (1) | GB1168939A (OSRAM) |
| IL (1) | IL30263A0 (OSRAM) |
| NL (1) | NL6809772A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3114072A1 (de) * | 1981-04-08 | 1982-11-04 | Basf Ag, 6700 Ludwigshafen | Herbizide diphenylether, deren herstellung und verwendung als herbizide |
| HU196055B (en) * | 1985-12-20 | 1988-09-28 | Innofinance Bp Altalanos Innov | Insekticide compositions containing esters of carbaminic acid as active component and process for producing the active components |
| PT86407B (pt) * | 1986-12-31 | 1990-11-20 | Fujisawa Pharmaceutical Co | Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE636655A (OSRAM) * | 1962-09-14 |
-
1967
- 1967-07-18 US US654081A patent/US3531523A/en not_active Expired - Lifetime
-
1968
- 1968-06-13 GB GB28235/68A patent/GB1168939A/en not_active Expired
- 1968-06-20 ES ES355267A patent/ES355267A1/es not_active Expired
- 1968-06-26 IL IL30263A patent/IL30263A0/xx unknown
- 1968-06-27 CH CH959768A patent/CH489480A/de not_active IP Right Cessation
- 1968-07-10 NL NL6809772A patent/NL6809772A/xx unknown
- 1968-07-17 DK DK346868AA patent/DK118771B/da unknown
- 1968-07-17 FR FR1586895D patent/FR1586895A/fr not_active Expired
- 1968-07-18 BE BE718229D patent/BE718229A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1586895A (OSRAM) | 1970-03-06 |
| ES355267A1 (es) | 1969-11-16 |
| NL6809772A (OSRAM) | 1969-01-21 |
| US3531523A (en) | 1970-09-29 |
| BE718229A (OSRAM) | 1969-01-20 |
| CH489480A (de) | 1970-04-30 |
| IL30263A0 (en) | 1968-08-22 |
| GB1168939A (en) | 1969-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK133783B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxy-1-thio-alfa-D-galacto-octopyranosider. | |
| DK124080B (da) | Fremgangsmåde til fremstilling af D-6-metyl-8-cyanmetylergolin. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK124536B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-3-hydroxybutyrohydroxamsyre. | |
| DK124690B (da) | Analogifremgangsmåde til fremstilling af 2-chlorvinyl-methyl-alkylphosphater. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK122758B (da) | Fremgangsmåde til fremstilling af α-methyl-multicyclo-methylaminer. | |
| DK123100B (da) | Fremgangsmåde til fremstilling af N-tritylimidazoler. | |
| DK122522B (da) | Fremgangsmåde til fremstilling af dichlorquinoliner. | |
| DK119663B (da) | Analogifremgangsmåde til fremstilling af 2-benzolsulfonamidopyrimidinforbindelser. | |
| DK118771B (da) | Analogifremgangsmåde til fremstilling af N-(phenoxyphenyl)sulfamider. | |
| DK118558B (da) | Analogifremgangsmåde til fremstilling af N-Pyridylformiminoætere. | |
| DK131821B (da) | Analogifremgangsmåde til fremstilling af en 2-karbalkoksyaminobenzimidazol. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK129197B (da) | Fremgangsmåde til fremstilling af 10-carbonhydridsubstituerede 5-hydroxy-13β-alkyl-Δ<9(11)>-gonener. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK135310B (da) | Analogifremgangsmåde til fremstilling af 1-(2-ethinylphenoxy)-2-hydroxy-3-butylaminopropaner. | |
| DK123476B (da) | Fremgangsmåde til fremstilling af 3-oxo-A-nor-B-homo-estra-5(10)-ener. | |
| DK123602B (da) | Analogifremgangsmåde til fremstilling af sulfonamider. |