DK118247B - Fremgangsmåde til fremstilling af 3-sulfanilamido-1,2,5-thiadiazolforbindelser. - Google Patents
Fremgangsmåde til fremstilling af 3-sulfanilamido-1,2,5-thiadiazolforbindelser.Info
- Publication number
- DK118247B DK118247B DK2367AA DK2367A DK118247B DK 118247 B DK118247 B DK 118247B DK 2367A A DK2367A A DK 2367AA DK 2367 A DK2367 A DK 2367A DK 118247 B DK118247 B DK 118247B
- Authority
- DK
- Denmark
- Prior art keywords
- sulfanilamido
- preparation
- thiadiazole compounds
- thiadiazole
- compounds
- Prior art date
Links
- RFGKMZUIGDQAPM-UHFFFAOYSA-N 3-amino-N-(1,2,5-thiadiazol-3-yl)benzenesulfonamide Chemical class S(=O)(C1=CC(=CC=C1)N)(=O)NC1=NSN=C1 RFGKMZUIGDQAPM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/10—1,2,5-Thiadiazoles; Hydrogenated 1,2,5-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US400584A US3419572A (en) | 1964-09-30 | 1964-09-30 | Ring synthesis of halo-substituted 1,2,5-thiadiazoles |
| US668982A US3391152A (en) | 1964-09-30 | 1967-08-10 | Methods of preparing thiadiazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118247B true DK118247B (da) | 1970-07-27 |
Family
ID=27017103
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK501865AA DK118880B (da) | 1964-09-30 | 1965-09-29 | Fremgangsmåde til fremstilling af 1,2,5-thiadiazolforbindelser. |
| DK2367AA DK118247B (da) | 1964-09-30 | 1967-01-03 | Fremgangsmåde til fremstilling af 3-sulfanilamido-1,2,5-thiadiazolforbindelser. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK501865AA DK118880B (da) | 1964-09-30 | 1965-09-29 | Fremgangsmåde til fremstilling af 1,2,5-thiadiazolforbindelser. |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US3419572A (da) |
| BE (1) | BE670379A (da) |
| BR (1) | BR6573508D0 (da) |
| CH (1) | CH478830A (da) |
| DE (2) | DE1595957A1 (da) |
| DK (2) | DK118880B (da) |
| FR (1) | FR1448437A (da) |
| GB (2) | GB1124634A (da) |
| IL (1) | IL24284A (da) |
| NL (1) | NL6512711A (da) |
| SE (1) | SE311906B (da) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3440246A (en) * | 1968-07-31 | 1969-04-22 | Merck & Co Inc | Process for preparing 1,2,5-thiadiazoles |
| US4555521A (en) * | 1983-11-16 | 1985-11-26 | Fmc Corporation | Nematicidal 3-substituted-4-phenyl-1,2,5-thiadiazoles |
| US6620940B1 (en) * | 1998-08-20 | 2003-09-16 | Eli Lilly And Company | Palladium-catalyzed cross-coupling chemistry on 3-chloro-4-halo-1,2,5-thiadiazole |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2358031A (en) * | 1944-09-12 | Substituted thiadiazoles | ||
| CA685868A (en) * | 1964-05-05 | Worffel Udo | 1,2,4-thiodiazoles and process for their production | |
| BE575642A (fr) * | 1958-02-13 | 1959-08-12 | Philips Nv | Thiadiazoles. |
| US3115497A (en) * | 1962-10-11 | 1963-12-24 | Du Pont | 3, 4-dichloro-1, 2, 5-thiadiazole and its preparation |
-
1964
- 1964-09-30 US US400584A patent/US3419572A/en not_active Expired - Lifetime
-
1965
- 1965-09-07 IL IL24284A patent/IL24284A/xx unknown
- 1965-09-27 BR BR173508/65A patent/BR6573508D0/pt unknown
- 1965-09-27 GB GB41013/65A patent/GB1124634A/en not_active Expired
- 1965-09-27 GB GB30135/67A patent/GB1124635A/en not_active Expired
- 1965-09-29 DE DE19651595957 patent/DE1595957A1/de active Pending
- 1965-09-29 DK DK501865AA patent/DK118880B/da unknown
- 1965-09-29 CH CH1345565A patent/CH478830A/de not_active IP Right Cessation
- 1965-09-29 SE SE12635/65A patent/SE311906B/xx unknown
- 1965-09-29 DE DE19651795463 patent/DE1795463A1/de active Pending
- 1965-09-30 NL NL6512711A patent/NL6512711A/xx unknown
- 1965-09-30 BE BE670379D patent/BE670379A/xx unknown
-
1966
- 1966-09-21 FR FR32178A patent/FR1448437A/fr not_active Expired
-
1967
- 1967-01-03 DK DK2367AA patent/DK118247B/da unknown
- 1967-08-10 US US668982A patent/US3391152A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1595957A1 (de) | 1970-02-26 |
| GB1124634A (en) | 1968-08-21 |
| DK118880B (da) | 1970-10-19 |
| GB1124635A (en) | 1968-08-21 |
| BE670379A (da) | 1966-03-30 |
| SE311906B (da) | 1969-06-30 |
| DE1795463A1 (de) | 1972-03-02 |
| BR6573508D0 (pt) | 1973-09-11 |
| NL6512711A (da) | 1966-03-31 |
| US3391152A (en) | 1968-07-02 |
| US3419572A (en) | 1968-12-31 |
| IL24284A (en) | 1969-11-12 |
| FR1448437A (fr) | 1966-08-05 |
| CH478830A (de) | 1969-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125553B (da) | Fremgangsmåde til fremstilling af substituerede 2,4-diamino-5-benzylpyrimidiner. | |
| DK115704B (da) | Fremgangsmåde til fremstilling af 2-aryl-nitroimidazolforbindelser. | |
| DK116441B (da) | Fremgangsmåde til fremstilling af 10,11-dihydro-dibenzo-(b,f)-thiepinderivater. | |
| DK125856B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepiner. | |
| DK113434B (da) | Fremgangsmåde til fremstilling af 5-nitro-imidazolforbindelser. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK118018B (da) | Fremgangsmåde til fremstilling af diorganoantimonforbindelser. | |
| DK118019B (da) | Fremgangsmåde til fremstilling af diorganoantimonforbindelser. | |
| DK120752B (da) | Fremgangsmåde til fremstilling af 5-aryl-3H-1,4-benzodiazepin-4-oxider. | |
| DK108921C (da) | Fremgangsmåde til fremstilling af tetrahydro-1,3,5-thiadiazin-2-thioner. | |
| DK115547B (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-16-methyl-9α-flour-Δ<1,4>-pregnadien-3,20-dioner. | |
| DK112033B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethinylgona-5(10),9(11)-diener. | |
| DK114273B (da) | Fremgangsmåde til fremstilling af α-methyl-α-amino-β-(3,4-disubstituerede-phenyl)-propionitriler. | |
| DK118247B (da) | Fremgangsmåde til fremstilling af 3-sulfanilamido-1,2,5-thiadiazolforbindelser. | |
| DK116219B (da) | Fremgangsmåde til fremstilling af 1,2,4-triazoler. | |
| DK131903B (da) | Fremgangsmåde til fremstilling af L-(-)-beta-(3,4-dihydroxyphenyl)-alfa-methylalanin. | |
| DK105471C (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-3H-forbindelser. | |
| DK112031B (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-17α-methyl-19-nor-pregna-4,9,11-trien. | |
| DK120085B (da) | Fremgangsmåde til fremstilling af mitosanforbindelser. | |
| DK115918B (da) | Fremgangsmåde til fremstilling af 4-sulfanilamido-1,2,5-thiadiazolforbindelser. | |
| DK113917B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetrachlorcyclohexanon. | |
| DK115774B (da) | Fremgangsmåde til fremstilling af 3-sulfanilamido-1,2,5-thiadiazolforbindelser. | |
| DK109639C (da) | Fremgangsmåde til fremstilling af 3-oxo-17β-hydroxy-17α-methylestra-4,9,11-trien. | |
| DK118017B (da) | Fremgangsmåde til fremstilling af diorganoantimonforbindelser. | |
| DK105068C (da) | Fremgangsmåde til fremstilling af 5-(3,4-dihydroxybenzyl)-5-methylhydantoin. |