DK115992B - Fremgangsmåde til fremstilling af aminometylderivater af rifamycin SV eller N-oxyder deraf. - Google Patents
Fremgangsmåde til fremstilling af aminometylderivater af rifamycin SV eller N-oxyder deraf.Info
- Publication number
- DK115992B DK115992B DK156965AA DK156965A DK115992B DK 115992 B DK115992 B DK 115992B DK 156965A A DK156965A A DK 156965AA DK 156965 A DK156965 A DK 156965A DK 115992 B DK115992 B DK 115992B
- Authority
- DK
- Denmark
- Prior art keywords
- rifamycin
- oxides
- preparation
- aminomethyl derivatives
- aminomethyl
- Prior art date
Links
- 150000001204 N-oxides Chemical class 0.000 title 1
- HJYYPODYNSCCOU-ZDHWWVNNSA-N Rifamycin SV Natural products COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C)cc(O)c4c3C2=O HJYYPODYNSCCOU-ZDHWWVNNSA-N 0.000 title 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 title 1
- 229940109171 rifamycin sv Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB13653/64A GB1090115A (en) | 1964-04-02 | 1964-04-02 | Mannich bases of rifamycin sv |
| GB4418064 | 1964-10-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK115992B true DK115992B (da) | 1969-12-01 |
Family
ID=26249901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK156965AA DK115992B (da) | 1964-04-02 | 1965-03-26 | Fremgangsmåde til fremstilling af aminometylderivater af rifamycin SV eller N-oxyder deraf. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3349082A (enExample) |
| AT (1) | AT259136B (enExample) |
| BE (1) | BE661982A (enExample) |
| BR (1) | BR6568430D0 (enExample) |
| CH (1) | CH476010A (enExample) |
| DE (1) | DE1595876A1 (enExample) |
| DK (1) | DK115992B (enExample) |
| ES (1) | ES311202A1 (enExample) |
| FI (1) | FI44399B (enExample) |
| GB (1) | GB1090115A (enExample) |
| IL (1) | IL23157A (enExample) |
| NL (1) | NL6504053A (enExample) |
| SE (2) | SE316479B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1165179A (en) * | 1966-10-25 | 1969-09-24 | Lepetit Spa | Derivatives of Rifamycin SV |
| CH536851A (de) * | 1966-10-25 | 1973-05-15 | Ciba Geigy Ag | Verfahren zur Herstellung neuer antibiotisch wirksamer Verbindungen der Rifamycinreihen |
| GB1159267A (en) * | 1966-11-03 | 1969-07-23 | Lepetit Spa | Rifamycin Derivatives |
| GB1172155A (en) * | 1967-03-01 | 1969-11-26 | Lepetit Spa | New Rifamycins |
| CH484898A (de) * | 1967-05-29 | 1970-01-31 | Ciba Geigy | Verfahren zur Herstellung von 3-Formylrifamycin SV |
| NL145554B (nl) * | 1967-06-07 | 1975-04-15 | Lepetit Spa | Werkwijze voor het bereiden van een 3-formylrifamycine sv-derivaat |
| FR2059967A1 (enExample) * | 1969-08-06 | 1971-06-11 | Lepetit Spa | |
| AR207763A1 (es) * | 1973-07-25 | 1976-10-29 | Archifar Ind Chim Trentino | Metodo para la preparacion de 1,3-oxacino(5,6-c)rifamicinas |
| IT1090772B (it) * | 1977-12-20 | 1985-06-26 | Alfa Farmaceutici Spa | Derivati della rifamicina e procedimento per la loro preparazione |
| IT1090771B (it) * | 1977-12-20 | 1985-06-26 | Alfa Farmaceutici Spa | Derivati delle 3 carbossirifamicines ed sv e procedimento per la loro preparazione |
| EP2136626A4 (en) * | 2007-03-19 | 2011-02-23 | Oregon State | Mannich base n-oxide drugs |
| US20100152267A1 (en) * | 2008-12-11 | 2010-06-17 | Macielag Mark J | Novel rifamycin 3,4-(3-substituted aminomethyl) fused pyrrolo derivatives |
-
1964
- 1964-04-02 GB GB13653/64A patent/GB1090115A/en not_active Expired
-
1965
- 1965-03-15 IL IL6523157A patent/IL23157A/xx unknown
- 1965-03-23 US US442166A patent/US3349082A/en not_active Expired - Lifetime
- 1965-03-24 FI FI0715/65A patent/FI44399B/fi active
- 1965-03-25 DE DE19651595876 patent/DE1595876A1/de active Pending
- 1965-03-26 DK DK156965AA patent/DK115992B/da unknown
- 1965-03-29 AT AT283565A patent/AT259136B/de active
- 1965-03-30 ES ES0311202A patent/ES311202A1/es not_active Expired
- 1965-03-31 NL NL6504053A patent/NL6504053A/xx unknown
- 1965-03-31 BR BR168430/65A patent/BR6568430D0/pt unknown
- 1965-04-01 SE SE4216/65A patent/SE316479B/xx unknown
- 1965-04-01 CH CH456365A patent/CH476010A/de not_active IP Right Cessation
- 1965-04-01 SE SE8164/67A patent/SE313309B/xx unknown
- 1965-04-02 BE BE661982D patent/BE661982A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3349082A (en) | 1967-10-24 |
| BE661982A (enExample) | 1965-08-02 |
| ES311202A1 (es) | 1965-07-01 |
| BR6568430D0 (pt) | 1973-08-07 |
| FI44399B (enExample) | 1971-08-02 |
| DE1595876A1 (de) | 1970-03-26 |
| IL23157A (en) | 1969-01-29 |
| SE316479B (enExample) | 1969-10-27 |
| CH476010A (de) | 1969-07-31 |
| GB1090115A (en) | 1967-11-08 |
| SE313309B (enExample) | 1969-08-11 |
| NL6504053A (enExample) | 1965-10-04 |
| AT259136B (de) | 1967-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK115993B (da) | Fremgangsmåde til fremstilling af derivater af rifamycin SV. | |
| DK112949B (da) | Fremgangsmåde til fremstilling af O-mycaminosyl-tylonolid eller dihydro-O-mycaminosyl-tylonolid. | |
| DK115924B (da) | Fremgangsmåde til fremstilling af β-karbolinderivater. | |
| DK115992B (da) | Fremgangsmåde til fremstilling af aminometylderivater af rifamycin SV eller N-oxyder deraf. | |
| DK120194B (da) | Fremgangsmåde til fremstilling af azirindinderivater. | |
| DK114699B (da) | Fremgangsmåde til fremstilling af furylbenzofuranderivater. | |
| DK117229B (da) | Fremgangsmåde til fremstilling af 2-substituerede 4-aryl-quinazolin-3-oxider. | |
| DK130583B (da) | Analogifremgangsmåde til fremstilling af N-acyl-p-aminophenylacylsalicylater. | |
| DK107095C (da) | Fremgangsmåde til fremstilling af azcycloalkanderivater eller salte deraf. | |
| DK120195B (da) | Fremgangsmåde til fremstilling af 2-substituerede cycloheptimidazol-derivater. | |
| DK122455B (da) | Analogifremgangsmåde til fremstilling af hydroxymethylpyridin-carbamat- eller -thioncarbamatderivater eller pyridin-N-oxider heraf. | |
| DK108283C (da) | Fremgangsmåde til fremstilling af kromanyl- eller benzofuranyl-ætanol-aminderivater. | |
| DK118945B (da) | Fremgangsmåde til fremstilling af 3-phenylpyrrol-derivater. | |
| DK115392B (da) | Fremgangsmåde til fremstilling af allylpiperidinderivater. | |
| DK115694B (da) | Fremgangsmåde til fremstilling af α-dithioler. | |
| DK112318B (da) | Fremgangsmåde til fremstilling af 2-benzensulfonylamidopyrimidiner. | |
| DK111891B (da) | Fremgangsmåde til fremstilling af 5-oxo-17α-methyl-20-hydroxy-(des-A)-19-nor-pregna-9-en. | |
| DK112528B (da) | Fremgangsmåde til fremstilling af tropanyl-2-phenylacrylatderivater eller salte deraf. | |
| DK109140C (da) | Fremgangsmåde til fremstilling af 1-hydroksy-3-aminopyrrolidon-2-derivater. | |
| DK108974C (da) | Fremgangsmåde til fremstilling af azepinderivater eller salte deraf. | |
| DK109871C (da) | Fremgangsmåde til fremstilling af 2-aminometyl-3,4-dihydro-2H-pyraner eller derivater deraf. | |
| DK115117B (da) | Fremgangsmåde til fremstilling af pyrimidinderivater. | |
| DK117627B (da) | Fremgangsmåde til fremstilling af rifamycin SV. | |
| DK116869B (da) | Fremgangsmåde til fremstilling af 6-methyl-16-fluormethylen-4-pregnen-3,20-dionderivater. | |
| DK106186C (da) | Fremgangsmåde til fremstilling af 17α-ethoxy-6-chlor-6-dehydro-progesteron. |