DK114127B - Fremgangsmåde til fremstilling af N-(2-chlor-5-trifluormethyl-phenyl)-N'-methyl-urinstof. - Google Patents
Fremgangsmåde til fremstilling af N-(2-chlor-5-trifluormethyl-phenyl)-N'-methyl-urinstof.Info
- Publication number
- DK114127B DK114127B DK155665AA DK155665A DK114127B DK 114127 B DK114127 B DK 114127B DK 155665A A DK155665A A DK 155665AA DK 155665 A DK155665 A DK 155665A DK 114127 B DK114127 B DK 114127B
- Authority
- DK
- Denmark
- Prior art keywords
- trifluoromethyl
- chloro
- urea
- phenyl
- methyl
- Prior art date
Links
- BOIIXGFYKTYRPY-UHFFFAOYSA-N 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-methylurea Chemical compound CNC(=O)NC1=CC(C(F)(F)F)=CC=C1Cl BOIIXGFYKTYRPY-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Polyurethanes Or Polyureas (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH397764A CH430687A (de) | 1964-03-26 | 1964-03-26 | Verfahren zur Herstellung des neuen N'-Methyl-N-(2-chlor-5-trifluormethyl)-harnstoffes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK114127B true DK114127B (da) | 1969-06-02 |
Family
ID=4267487
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK155665AA DK114127B (da) | 1964-03-26 | 1965-03-25 | Fremgangsmåde til fremstilling af N-(2-chlor-5-trifluormethyl-phenyl)-N'-methyl-urinstof. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3344181A (enExample) |
| AT (1) | AT254208B (enExample) |
| BE (1) | BE661638A (enExample) |
| BR (1) | BR6568162D0 (enExample) |
| CH (1) | CH430687A (enExample) |
| DE (1) | DE1288589B (enExample) |
| DK (1) | DK114127B (enExample) |
| ES (5) | ES310982A1 (enExample) |
| FI (1) | FI42535B (enExample) |
| FR (1) | FR4583M (enExample) |
| GB (1) | GB1064357A (enExample) |
| IL (1) | IL23216A (enExample) |
| NL (2) | NL6503821A (enExample) |
| NO (1) | NO118217B (enExample) |
| SE (1) | SE304266B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4146645A (en) * | 1974-04-27 | 1979-03-27 | Boehringer Ingelheim Gmbh | Hypertensive phenylalkylamines and salts thereof |
| ATE103589T1 (de) * | 1989-11-10 | 1994-04-15 | Agrolinz Agrarchemikalien | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe. |
| DE3940261A1 (de) * | 1989-12-06 | 1991-06-13 | Agrolinz Agrarchemikalien Muen | Verfahren zur herstellung reiner, unsymmetrisch disubstituierter harnstoffe |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1102722B (de) * | 1959-04-18 | 1961-03-23 | Thomae Gmbh Dr K | Verfahren zur Herstellung von substituierten Harnstoffen |
| BE594228A (enExample) * | 1959-08-21 |
-
0
- NL NL129423D patent/NL129423C/xx active
-
1964
- 1964-03-26 CH CH397764A patent/CH430687A/de unknown
-
1965
- 1965-03-24 US US442537A patent/US3344181A/en not_active Expired - Lifetime
- 1965-03-24 FI FI0713/65A patent/FI42535B/fi active
- 1965-03-25 NO NO157390A patent/NO118217B/no unknown
- 1965-03-25 ES ES0310982A patent/ES310982A1/es not_active Expired
- 1965-03-25 AT AT275065A patent/AT254208B/de active
- 1965-03-25 SE SE3883/65A patent/SE304266B/xx unknown
- 1965-03-25 BE BE661638D patent/BE661638A/xx unknown
- 1965-03-25 NL NL6503821A patent/NL6503821A/xx unknown
- 1965-03-25 ES ES0310981A patent/ES310981A1/es not_active Expired
- 1965-03-25 IL IL23216A patent/IL23216A/xx unknown
- 1965-03-25 ES ES0310979A patent/ES310979A1/es not_active Expired
- 1965-03-25 BR BR168162/65A patent/BR6568162D0/pt unknown
- 1965-03-25 DE DEG43176A patent/DE1288589B/de active Pending
- 1965-03-25 ES ES0310983A patent/ES310983A1/es not_active Expired
- 1965-03-25 GB GB12598/65A patent/GB1064357A/en not_active Expired
- 1965-03-25 ES ES0310980A patent/ES310980A1/es not_active Expired
- 1965-03-25 DK DK155665AA patent/DK114127B/da unknown
- 1965-06-25 FR FR22276A patent/FR4583M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6503821A (enExample) | 1965-09-27 |
| ES310980A1 (es) | 1966-01-16 |
| AT254208B (de) | 1967-05-10 |
| ES310979A1 (es) | 1966-01-16 |
| BE661638A (enExample) | 1965-09-27 |
| BR6568162D0 (pt) | 1973-08-07 |
| FR4583M (enExample) | 1966-11-14 |
| NL129423C (enExample) | |
| IL23216A (en) | 1968-10-24 |
| ES310983A1 (es) | 1966-01-16 |
| CH430687A (de) | 1967-02-28 |
| NO118217B (enExample) | 1969-12-01 |
| DE1288589B (de) | 1969-02-06 |
| ES310982A1 (es) | 1966-01-16 |
| FI42535B (enExample) | 1970-06-01 |
| GB1064357A (en) | 1967-04-05 |
| SE304266B (enExample) | 1968-09-23 |
| ES310981A1 (es) | 1966-01-16 |
| US3344181A (en) | 1967-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK127364C (da) | Anvendelse af n-(3-chlor-4-methylphenyl)-n',n'-dimethylurinstof som herbicid | |
| DK132075B (da) | Analogifremgangsmåde til fremstilling af N-(4-aminophenyl)-N',N'-dimethylacetamidiner. | |
| DK112736B (da) | Fremgangsmåde til fremstilling af N-(3-aminopyrazinoyl)-benzamidiner. | |
| IT1149234B (it) | Procedimento per la preparazione di peptidi aciclici aventi attivita' terapeutica | |
| DK104052C (da) | Fremgangsmåde til fremstilling af N-(p-chlorbenzensulfonyl)-N'-propylurinstof. | |
| CH456623A (de) | Verfahren zur Herstellung von N-(N-Acyl-aminoacyl)-aminoacetonitrilen | |
| DK114127B (da) | Fremgangsmåde til fremstilling af N-(2-chlor-5-trifluormethyl-phenyl)-N'-methyl-urinstof. | |
| DK105064C (da) | Fremgangsmåde til fremstilling af N-substituerede phenylsulfonyl-N'-cycloalkylurinstoffer. | |
| DK114980B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyreamider. | |
| DK121861B (da) | Analogifremgangsmåde til fremstilling af N-(7-2'-tienylacetamidoceph-3-em-3-ylmetyl)-pyridinium-4-karboxylat. | |
| FI45655C (fi) | Menetelmä alfa-metyyli-alfa-amino-beta-(3,4-disubstituoitu-fenyyli)pro pionitriilien valmistamiseksi. | |
| DK111447B (da) | Fremgangsmåde til fremstilling af 17α-vinyl-5(10)-østren-17β-ol-3-on. | |
| BE784638A (fr) | N-(3-aminocarbonyloxy-phenyl)-n'-methyl-urees | |
| AT277477B (de) | Verfahren zur Herstellung von N-(D-6-Methyl-8-isoergolenyl)-N',N'-diäthylharnstoff | |
| DK121853B (da) | Analogifremgangsmåde til fremstilling af diphenoxyeddikesyreamider. | |
| BR6914663D0 (pt) | Novos processos para a preparacao de n-(dietil aminoetil)-4 amino-5-cloro-2-metoxi benzamida | |
| DK102521C (da) | Fremgangsmåde til fremstilling af N-(D-1,6-dimetyl-isoergolenyl-8)-N',N'-dialkylurinstoffer. | |
| DK103884C (da) | Fremgangsmåde til fremstilling af N-(5'-nitro-2'-furfuryliden)-3-amino-5-substitueret-2-oxazolidinoner. | |
| DK107426C (da) | Fremgangsmåde til fremstilling af N-(metylkarbamyl)-5-nitro-2-furamidoxim. | |
| FI40898C (fi) | Menetelmä hypoglykeemisesti vaikuttavien N'-adamantyyli-N-aryylisulfonyyli-virtsa-aineiden valmistamiseksi | |
| DK115407B (da) | Fremgangsmåde til fremstilling af N-substituerede 1,6-dimethyl-Δ<8,9>-ergolen-8-carboxylsyreamider. | |
| DK103999C (da) | Fremgangsmåde til fremstilling af α-hydroxyethyl- eller α-alkoxyethylderivater af dihydro-D-lysergsyreamid. | |
| DK107283C (da) | Fremgangsmåde til fremstilling af L-glutaminsyre. | |
| DK121232B (da) | Analogifremgangsmåde til fremstilling af N,N'-bis-halogenalkylfosforsyreesteramider. | |
| CH430738A (de) | Verfahren zur Herstellung von N-(D-1,6-Dimethyl-isoergolenyl-8)-N',N'-dialkyl-harnstoffen |