DK114125B - Fremgangsmåde til fremstilling af trimethyladipinsyredinitril. - Google Patents
Fremgangsmåde til fremstilling af trimethyladipinsyredinitril.Info
- Publication number
- DK114125B DK114125B DK63864AA DK63864A DK114125B DK 114125 B DK114125 B DK 114125B DK 63864A A DK63864A A DK 63864AA DK 63864 A DK63864 A DK 63864A DK 114125 B DK114125 B DK 114125B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- trimethyladipic acid
- acid dinitrile
- dinitrile
- trimethyladipic
- Prior art date
Links
- GBURUDXSBYGPBL-UHFFFAOYSA-N 2,2,3-trimethylhexanedioic acid Chemical compound OC(=O)C(C)(C)C(C)CCC(O)=O GBURUDXSBYGPBL-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/22—Preparation of carboxylic acid nitriles by reaction of ammonia with carboxylic acids with replacement of carboxyl groups by cyano groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/02—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C255/04—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton containing two cyano groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESC032753 | 1963-02-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK114125B true DK114125B (da) | 1969-06-02 |
Family
ID=7432556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK63864AA DK114125B (da) | 1963-02-11 | 1964-02-10 | Fremgangsmåde til fremstilling af trimethyladipinsyredinitril. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3297736A (enExample) |
| AT (1) | AT243238B (enExample) |
| BE (1) | BE643642A (enExample) |
| CH (1) | CH425758A (enExample) |
| DE (1) | DE1249850B (enExample) |
| DK (1) | DK114125B (enExample) |
| GB (1) | GB1051311A (enExample) |
| LU (1) | LU45308A1 (enExample) |
| NL (2) | NL6401075A (enExample) |
| SE (1) | SE219747C1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4040253A1 (de) * | 1990-12-17 | 1992-06-25 | Huels Chemische Werke Ag | Verfahren zur nitrilierung aliphatischer dicarbonsaeuren in der fluessigphase |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2132849A (en) * | 1936-12-02 | 1938-10-11 | Du Pont | Process for preparing aliphatic dinitriles |
| US2794043A (en) * | 1955-01-13 | 1957-05-28 | Goodrich Co B F | Preparation of aliphatic nitriles |
| US2808426A (en) * | 1956-01-26 | 1957-10-01 | Armour & Co | Preparation of nitriles |
| LU38674A1 (enExample) * | 1959-07-25 |
-
0
- GB GB1051311D patent/GB1051311A/en active Active
- NL NL124845D patent/NL124845C/xx active
- DE DENDAT1249850D patent/DE1249850B/de active Pending
-
1964
- 1964-01-28 LU LU45308D patent/LU45308A1/xx unknown
- 1964-01-31 AT AT79064A patent/AT243238B/de active
- 1964-02-06 CH CH143764A patent/CH425758A/de unknown
- 1964-02-10 DK DK63864AA patent/DK114125B/da unknown
- 1964-02-10 US US343458A patent/US3297736A/en not_active Expired - Lifetime
- 1964-02-10 NL NL6401075A patent/NL6401075A/xx unknown
- 1964-02-10 SE SE158264A patent/SE219747C1/sv unknown
- 1964-02-11 BE BE643642A patent/BE643642A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE219747C1 (enExample) | 1968-04-02 |
| NL124845C (enExample) | |
| US3297736A (en) | 1967-01-10 |
| LU45308A1 (enExample) | 1964-03-28 |
| DE1249850B (de) | 1967-09-14 |
| AT243238B (de) | 1965-10-25 |
| GB1051311A (enExample) | |
| BE643642A (enExample) | 1964-05-29 |
| NL6401075A (enExample) | 1964-08-12 |
| CH425758A (de) | 1966-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK117068B (da) | Fremgangsmåde til fremstilling af N-1-aroylindolyleddikesyreforbindelser. | |
| DK108500C (da) | Fremgangsmåde til fremstilling af 1-glykosyl-5-azacytosiner. | |
| DK111113B (da) | Fremgangsmåde til fremstilling af 3-methylflavon-8-carboxylsyre. | |
| DK111889B (da) | Fremgangsmåde til fremstilling af 3-N-substituerede tricycloundecaner. | |
| DK120596B (da) | Fremgangsmåde til fremstilling af acetoxymethylbenzylpenicillinat. | |
| DK104461C (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazoler. | |
| DK107031C (da) | Fremgangsmåde til fremstilling af 2-halogenmethyl-quinazolin-3-oxider. | |
| DK105592C (da) | Fremgangsmåde til fremstilling af substituerede 5-fluor-pyrimidiner. | |
| DK107548C (da) | Fremgangsmåde til fremstilling af carboxylsyrenitriler. | |
| DK121022B (da) | Analogifremgangsmåde til fremstilling af γ -resorcylsyreanilider. | |
| DK104571C (da) | Fremgangsmåde til fremstilling af trans-2-phenyl-3-methylmorpholin. | |
| DK115327B (da) | Fremgangsmåde til fremstilling af hydroxyphenylalkylphosphonater. | |
| DK114125B (da) | Fremgangsmåde til fremstilling af trimethyladipinsyredinitril. | |
| DK113149B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK109034C (da) | Fremgangsmåde til kontinuerlig fremstilling af trimethyladipinsyredinitril. | |
| DK136644B (da) | Fremgangsmåde til fremstilling af 1-p-chlorbenzoyl-2-methyl-3-indolyl-eddikesyre-forbindelser. | |
| DK111143B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK120764B (da) | Fremgangsmåde til fremstilling af 2-amino-5-nitro-benzophenoner. | |
| DK122883B (da) | Fremgangsmåde til fremstilling af ω-lactamer. | |
| DK113991B (da) | Fremgangsmåde til fremstilling af 2-chlor-3-oxo-butanamider. | |
| DK118240B (da) | Fremgangsmåde til fremstilling af 1-p-chlorbenzoyl-2-methyl-5-methoxy- eller dimethylamino-3-indolyl-eddikesyre. | |
| DK115398B (da) | Fremgangsmåde til fremstilling af N-sulfonyl-chlormyresyreamidiner. | |
| DK108499C (da) | Fremgangsmåde til fremstilling af 1-alkyl- eller 1-hydroxyalkyl-5-nitro-imidazol-2-carboxamider. | |
| DK114126B (da) | Fremgangsmåde til fremstilling af substituereded benzamider. | |
| DK127724B (da) | Fremgangsmåde til fremstilling af trans-40-aminomethylcyclohexan-1-carboxylsyre. |