DK113715B - Analogifremgangsmåde til fremstilling af theophyllinderivater. - Google Patents
Analogifremgangsmåde til fremstilling af theophyllinderivater.Info
- Publication number
- DK113715B DK113715B DK340267AA DK340267A DK113715B DK 113715 B DK113715 B DK 113715B DK 340267A A DK340267A A DK 340267AA DK 340267 A DK340267 A DK 340267A DK 113715 B DK113715 B DK 113715B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- analogous process
- theophylline derivatives
- theophylline
- derivatives
- Prior art date
Links
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical class O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC0039516 | 1966-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK113715B true DK113715B (da) | 1969-04-21 |
Family
ID=7023769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK340267AA DK113715B (da) | 1966-07-02 | 1967-06-30 | Analogifremgangsmåde til fremstilling af theophyllinderivater. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3399195A (OSRAM) |
| AT (2) | AT272370B (OSRAM) |
| BE (1) | BE700810A (OSRAM) |
| DK (1) | DK113715B (OSRAM) |
| ES (1) | ES342459A1 (OSRAM) |
| FR (1) | FR1530039A (OSRAM) |
| GB (1) | GB1127992A (OSRAM) |
| NL (1) | NL6708817A (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5132638B2 (OSRAM) * | 1972-07-13 | 1976-09-14 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2887486A (en) * | 1956-10-29 | 1959-05-19 | S E Massengill Company | Theophylline derivatives |
-
1967
- 1967-06-23 NL NL6708817A patent/NL6708817A/xx unknown
- 1967-06-28 US US649472A patent/US3399195A/en not_active Expired - Lifetime
- 1967-06-30 GB GB30329/67A patent/GB1127992A/en not_active Expired
- 1967-06-30 BE BE700810D patent/BE700810A/xx unknown
- 1967-06-30 DK DK340267AA patent/DK113715B/da unknown
- 1967-06-30 AT AT692668A patent/AT272370B/de active
- 1967-06-30 FR FR112628A patent/FR1530039A/fr not_active Expired
- 1967-06-30 AT AT611967A patent/AT273160B/de active
- 1967-07-30 ES ES342459A patent/ES342459A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT272370B (de) | 1969-07-10 |
| US3399195A (en) | 1968-08-27 |
| FR1530039A (fr) | 1968-06-21 |
| ES342459A1 (es) | 1968-09-16 |
| NL6708817A (OSRAM) | 1968-01-03 |
| GB1127992A (en) | 1968-09-25 |
| AT273160B (de) | 1969-08-11 |
| BE700810A (OSRAM) | 1968-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133618B (da) | Analogifremgangsmåde til fremstilling af 1-hydroxyaryl-2-aminoalkanoler. | |
| DK118460B (da) | Analogifremgangsmåde til fremstilling af sulfonylurinstofderivater. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK130585B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK117706B (da) | Fremgangsmåde til fremstilling af pyrrolinderivater. | |
| DK114697B (da) | Fremgangsmåde til fremstilling af 25-desacetylderivater af rifamyciner. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK123414B (da) | Analogifremgangsmåde til fremstilling af pteridiner. | |
| DK120392B (da) | Analogifremgangsmåde til fremstilling af quinazolinderivater. | |
| DK117961B (da) | Analogifremgangsmåde til fremstilling af guanidinderivater. | |
| DK123299B (da) | Analogifremgangsmåde til fremstilling af pyridazonderivater. | |
| DK125892B (da) | Analogifremgangsmåde til fremstilling af pteridiner. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK113715B (da) | Analogifremgangsmåde til fremstilling af theophyllinderivater. | |
| DK119830B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylsemicarbazider. | |
| DK126378B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-9α-chlor-11β-hydroxy-progesteroner. | |
| DK120132B (da) | Analogifremgangsmåde til fremstilling af quinolinderivater. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK120239B (da) | Fremgangsmåde til fremstilling af piperazin-fenylætanolderivater. | |
| DK112241B (da) | Fremgangsmåde til fremstilling af pyrazinderivater. | |
| DK119210C (da) | Analogifremgangsmåde til fremstilling af ketoximethere. |