DK112246B - Fremgangsmåde til fremstilling af den terapeutisk virksomme 2-(ethylamino)-2-(2-thienyl)-cyclohexanon eller syreadditionssalte deraf. - Google Patents
Fremgangsmåde til fremstilling af den terapeutisk virksomme 2-(ethylamino)-2-(2-thienyl)-cyclohexanon eller syreadditionssalte deraf.Info
- Publication number
- DK112246B DK112246B DK143466AA DK143466A DK112246B DK 112246 B DK112246 B DK 112246B DK 143466A A DK143466A A DK 143466AA DK 143466 A DK143466 A DK 143466A DK 112246 B DK112246 B DK 112246B
- Authority
- DK
- Denmark
- Prior art keywords
- ethylamino
- cyclohexanone
- thienyl
- preparation
- acid addition
- Prior art date
Links
- QAXBVGVYDCAVLV-UHFFFAOYSA-N tiletamine Chemical compound C=1C=CSC=1C1(NCC)CCCCC1=O QAXBVGVYDCAVLV-UHFFFAOYSA-N 0.000 title 2
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44136865A | 1965-03-19 | 1965-03-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK112246B true DK112246B (da) | 1968-11-25 |
Family
ID=23752605
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK143466AA DK112246B (da) | 1965-03-19 | 1966-03-18 | Fremgangsmåde til fremstilling af den terapeutisk virksomme 2-(ethylamino)-2-(2-thienyl)-cyclohexanon eller syreadditionssalte deraf. |
Country Status (11)
| Country | Link |
|---|---|
| BE (1) | BE678092A (enExample) |
| BR (1) | BR6677981D0 (enExample) |
| CH (2) | CH453384A (enExample) |
| DE (1) | DE1300953B (enExample) |
| DK (1) | DK112246B (enExample) |
| ES (1) | ES324380A1 (enExample) |
| FR (2) | FR1471911A (enExample) |
| GB (1) | GB1065188A (enExample) |
| IL (1) | IL25416A (enExample) |
| NL (1) | NL145238B (enExample) |
| SE (2) | SE325584B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE634208A (enExample) * | 1963-06-28 |
-
1966
- 1966-03-18 BE BE678092D patent/BE678092A/xx not_active IP Right Cessation
- 1966-03-18 SE SE03596/66A patent/SE325584B/xx unknown
- 1966-03-18 DK DK143466AA patent/DK112246B/da unknown
- 1966-03-18 FR FR54138A patent/FR1471911A/fr not_active Expired
- 1966-03-18 GB GB12161/66A patent/GB1065188A/en not_active Expired
- 1966-03-18 IL IL25416A patent/IL25416A/xx unknown
- 1966-03-18 NL NL666603587A patent/NL145238B/xx not_active IP Right Cessation
- 1966-03-18 BR BR177981/66A patent/BR6677981D0/pt unknown
- 1966-03-18 DE DEP39011A patent/DE1300953B/de active Pending
- 1966-03-18 CH CH394366A patent/CH453384A/fr unknown
- 1966-03-18 ES ES0324380A patent/ES324380A1/es not_active Expired
- 1966-03-18 CH CH252468A patent/CH457500A/fr unknown
- 1966-06-14 FR FR65371A patent/FR5589M/fr not_active Expired
-
1968
- 1968-02-15 SE SE01975/68A patent/SE325585B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1471911A (fr) | 1967-03-03 |
| FR5589M (enExample) | 1967-12-04 |
| ES324380A1 (es) | 1967-02-01 |
| NL145238B (nl) | 1975-03-17 |
| CH457500A (fr) | 1968-06-15 |
| CH453384A (fr) | 1968-06-14 |
| BE678092A (enExample) | 1966-09-01 |
| SE325585B (enExample) | 1970-07-06 |
| IL25416A (en) | 1969-09-25 |
| DE1300953B (de) | 1969-08-14 |
| SE325584B (enExample) | 1970-07-06 |
| GB1065188A (en) | 1967-04-12 |
| NL6603587A (enExample) | 1966-09-20 |
| BR6677981D0 (pt) | 1973-09-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK115847B (da) | Fremgangsmåde til fremstilling af terapeutisk aktive 2,4-diamino-5-benzyl-pyrimidinderivater eller syreadditionssalte deraf. | |
| DK114981B (da) | Fremgangsmåde til fremstilling af basisk substituerede phthalaner eller iso-chromaner eller syreadditionssalte deraf. | |
| DK123022B (da) | Analogifremgangsmåde til fremstilling af amino-monohalogen-phenylethanolaminer eller syreadditionssalte deraf. | |
| DK133372B (da) | Analogifremgangsmåde til fremstilling af terapeutisk aktive hydroxy-cyclohexyl-aminer eller syreadditionssalte deraf. | |
| DK134222B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme aminer eller syreadditionssalte deraf. | |
| DK114200B (da) | Fremgangsmåde til fremstilling af terapeutisk virksomme, basisk substituerede cycloalkenderivater eller syreadditionssalte deraf. | |
| DK120400B (da) | Analogifremgangsmåde til fremstilling af 1-(3,5-dihalogen-4-hydroxyphenyl)-2-(2-phenoxy- eller 2-phenylalkyl-isopropylamino)-propanoler eller syreadditionssalte deraf. | |
| DK127599B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme 2,4-diaminosubstituerede quinazolin-forbindelser eller syreadditionssalte heraf. | |
| DK117427B (da) | Fremgangsmåde til fremstilling af phenoxypropanolaminer eller syreadditionssalte deraf. | |
| DK119059B (da) | Fremgangsmåde til fremstilling af 2-nitro-imidazolderivater eller syreadditionssalte deraf. | |
| DK119768B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme pyridinsubstituerede malonater eller farmaceutisk acceptable syreadditionssalte deraf. | |
| DK119774B (da) | Fremgangsmåde til fremstilling af antitussivt aktive 4-substituerede 2-benzhydryl-2-butanol-derivater eller syreadditionssalte deraf. | |
| DK117835B (da) | Fremgangsmåde til fremstilling af terapeutisk virksomme N-4-pyrimidinyl-anthranilsyreforbindelser eller salte deraf. | |
| DK121236B (da) | Analogifremgangsmåde til fremstilling af terapeutisk aktive, basisk substituerede amider af N-substituerede antranilsyrer, eller syreadditionssalte deraf. | |
| DK116062B (da) | Fremgangsmåde til fremstilling af højredrejende propanolaminderivater eller syreadditionssalte deraf. | |
| DK114207B (da) | Fremgangsmåde til fremstilling af terapeutisk virksomme phenylalaninderivater eller syreadditionssalte deraf. | |
| DK114062B (da) | Fremgangsmåde til fremstilling af 3-(5-nitro-2-thenylidenamino)-2-oxazolidinforbindelser eller syreadditionssalte deraf. | |
| DK115842B (da) | Fremgangsmåde til fremstilling af terapeutisk aktive substituerede 4-aminobutynylsuccinimider eller 4-aminobutynylglutarimider eller syreadditionssalte deraf. | |
| DK118613B (da) | Fremgangsmåde til fremstilling af terapeutisk aktive 3,4-dihydroxyphenyl-alkanolaminer eller syreadditionssalte heraf. | |
| DK112246B (da) | Fremgangsmåde til fremstilling af den terapeutisk virksomme 2-(ethylamino)-2-(2-thienyl)-cyclohexanon eller syreadditionssalte deraf. | |
| DK115840B (da) | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. | |
| DK114059B (da) | Fremgangsmåde til fremstilling af terapeutisk aktive benzamidoacetamidinderivater med antidepressiv virkning eller syreadditionssalte deraf. | |
| DK130587B (da) | Analogifremgangsmåde til fremstilling af difenylpyridazoner eller syreadditionssalt deraf. | |
| DK124614B (da) | Fremgangsmåde til fremstilling af 3-(3-piperidino- eller morpholinopropionyl)-5-phenylisoxazolderivater eller syreadditionssalte deraf. | |
| DK115776B (da) | Analogifremgangsmåde til fremstilling af 2-(thrichlorbenzyl)-2-imidazoliner eller syreadditionssalte deraf. |