DK109207C - Fremgangsmåde til fremstilling af disulfamylanilinforbindelser. - Google Patents
Fremgangsmåde til fremstilling af disulfamylanilinforbindelser.Info
- Publication number
- DK109207C DK109207C DK217758AA DK217758A DK109207C DK 109207 C DK109207 C DK 109207C DK 217758A A DK217758A A DK 217758AA DK 217758 A DK217758 A DK 217758A DK 109207 C DK109207 C DK 109207C
- Authority
- DK
- Denmark
- Prior art keywords
- disulfamylaniline
- compounds
- preparation
- disulfamylaniline compounds
- Prior art date
Links
- QLGJNQICDRXXGG-UHFFFAOYSA-N (disulfamoylamino)benzene Chemical class NS(=O)(=O)N(S(N)(=O)=O)C1=CC=CC=C1 QLGJNQICDRXXGG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/37—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US666212A US3161675A (en) | 1957-06-17 | 1957-06-17 | Process for preparing sulfonamide compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK109207C true DK109207C (da) | 1968-04-01 |
Family
ID=24673274
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK217758AA DK109207C (da) | 1957-06-17 | 1958-06-13 | Fremgangsmåde til fremstilling af disulfamylanilinforbindelser. |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3161675A (da) |
| CH (1) | CH371128A (da) |
| DK (1) | DK109207C (da) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4062952A (en) * | 1975-11-24 | 1977-12-13 | Merck & Co., Inc. | Substituted benzenedisulfonamides as anthelmintics |
| JP2004519557A (ja) * | 2001-02-23 | 2004-07-02 | 株式会社荏原製作所 | 銅めっき液、めっき方法及びめっき装置 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE446402A (da) * | ||||
| US1867088A (en) * | 1932-07-12 | New water soluble diazo akino compounds | ||
| CH230438A (de) * | 1938-04-23 | 1943-12-31 | Ig Farbenindustrie Ag | Verfahren zur Herstellung einer Benzolsulfonsäureamidverbindung. |
| DE752572C (de) * | 1941-07-14 | 1954-01-04 | Chem Fab Von Heyden A G | Verfahren zur Herstellung von Acetylsulfanilsaeurechlorid |
| US2402611A (en) * | 1942-06-04 | 1946-06-25 | Eastman Kodak Co | Cyclic diazo compounds |
| US2422359A (en) * | 1942-08-07 | 1947-06-17 | Du Pont | Diazoamino compounds |
| US2643244A (en) * | 1948-04-16 | 1953-06-23 | Libbey Owens Ford Glass Co | Epichlorhydrin-sulfonamide resins |
| US2618655A (en) * | 1948-05-01 | 1952-11-18 | Eastman Kodak Co | Sulfonamidostyrenes |
| CH277023A (de) * | 1949-05-03 | 1951-08-15 | Ciba Geigy | Verfahren zur Herstellung eines Zwischenproduktes. |
| US2730534A (en) * | 1952-12-31 | 1956-01-10 | Gen Aniline & Film Corp | Anthraquinone dyestuffs |
| US2910488A (en) * | 1958-01-22 | 1959-10-27 | Merck & Co Inc | Aniline derivatives |
-
1957
- 1957-06-17 US US666212A patent/US3161675A/en not_active Expired - Lifetime
-
1958
- 1958-06-13 DK DK217758AA patent/DK109207C/da active
- 1958-06-17 CH CH6066058A patent/CH371128A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3161675A (en) | 1964-12-15 |
| CH371128A (de) | 1963-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK109207C (da) | Fremgangsmåde til fremstilling af disulfamylanilinforbindelser. | |
| DK101475C (da) | Fremgangsmåde til fremstilling af reserpinlignende forbindelser. | |
| DK103514C (da) | Fremgangsmåde til fremstilling af benzothiadiazin-1-1-dioxid-forbindelser. | |
| DK85302C (da) | Fremgangsmåde til fremstilling af 3-mercuri-2-methoxy-1-succinimidopropan-forbindelser. | |
| DK93075C (da) | Fremgangsmåde til fremstilling af camphidiniumforbindelser. | |
| DK93844C (da) | Fremgangsmåde til fremstilling af disulfamylanilinforbindelser. | |
| DK93898C (da) | Fremgangsmåde til fremstilling af disulfamylanilinforbindelser. | |
| DK99077C (da) | Fremgangsmåde til fremstilling af alkylaminopropio-o-toluididforbindelser. | |
| DK92401C (da) | Fremgangsmåde til fremstilling af 3β-hydroksy-6-metyl-25D-spirost-5-en. | |
| DK98693C (da) | Fremgangsmåde til fremstilling af phenyloxymethyl-2-oxazolidinoner. | |
| DK88064C (da) | Fremgangsmåde til fremstilling af 3-cyanfentiazin. | |
| DK88676C (da) | Fremgangsmåde til fremstilling af benzthiazol-2-sulfonylurinstoffer. | |
| DK89749C (da) | Fremgangsmåde til fremstilling af dimethylaminopropyloxy-5-propenylbenzener. | |
| DK89788C (da) | Fremgangsmåde til fremstilling af dimethylaminopropyloxy-5-propenylbenzener. | |
| DK89840C (da) | Fremgangsmåde til fremstilling af isothiocyanatosteroider. | |
| DK89877C (da) | Fremgangsmåde til fremstilling af L-arginin-L-glutamat. | |
| DK90055C (da) | Fremgangsmåde til fremstilling af flavon-7-ætyl-oxyacetat. | |
| DK90355C (da) | Fremgangsmåde til fremstilling af bis-sulfonylurinstoffer. | |
| DK90396C (da) | Fremgangsmåde til fremstilling af 3-metansulfonylfentiazin. | |
| DK90562C (da) | Fremgangsmåde til fremstilling af bis-sulfonylurinstoffer. | |
| DK90602C (da) | Fremgangsmåde til fremstilling af m-aminobenzolsulfonylurinstoffer. | |
| DK90762C (da) | Fremgangsmåde til fremstilling af 2-aryl-3-amino-pyrazoler. | |
| DK91221C (da) | Fremgangsmåde til fremstilling af 16-halogenandrostendioner. | |
| DK91466C (da) | Fremgangsmåde til fremstilling af 17α-alkynyl-17β-hydrosky-19-norandrost-4-en-3-oner. | |
| DK91773C (da) | Fremgangsmåde til fremstilling af scopinethere. |