DE3241514A1 - Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden - Google Patents
Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfidenInfo
- Publication number
- DE3241514A1 DE3241514A1 DE19823241514 DE3241514A DE3241514A1 DE 3241514 A1 DE3241514 A1 DE 3241514A1 DE 19823241514 DE19823241514 DE 19823241514 DE 3241514 A DE3241514 A DE 3241514A DE 3241514 A1 DE3241514 A1 DE 3241514A1
- Authority
- DE
- Germany
- Prior art keywords
- mol
- aromatic
- formula
- sulfides
- alkali
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- 150000003568 thioethers Chemical class 0.000 title claims 3
- 229920000412 polyarylene Polymers 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 14
- 239000003513 alkali Substances 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 7
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical class O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 claims description 7
- NFTWWHSKWXOTLL-UHFFFAOYSA-N 1,4-dimethylpiperazin-2-one Chemical compound CN1CCN(C)C(=O)C1 NFTWWHSKWXOTLL-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000006184 cosolvent Substances 0.000 claims description 5
- 229940117389 dichlorobenzene Drugs 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052977 alkali metal sulfide Inorganic materials 0.000 claims description 4
- 150000001491 aromatic compounds Chemical class 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 150000004763 sulfides Chemical class 0.000 description 16
- 239000000203 mixture Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000004734 Polyphenylene sulfide Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229920000069 polyphenylene sulfide Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- -1 alkali metal carboxylates Chemical class 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- NAQWICRLNQSPPW-UHFFFAOYSA-N 1,2,3,4-tetrachloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 NAQWICRLNQSPPW-UHFFFAOYSA-N 0.000 description 1
- LHOGNQZQKDZOBP-UHFFFAOYSA-N 1,2,3-trichloro-4-methylbenzene Chemical compound CC1=CC=C(Cl)C(Cl)=C1Cl LHOGNQZQKDZOBP-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- QEPTXDCPBXMWJC-UHFFFAOYSA-N 1,2,3-trichloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(Cl)C(Cl)=CC2=C1 QEPTXDCPBXMWJC-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- FWAJPSIPOULHHH-UHFFFAOYSA-N 1,2,4-tribromobenzene Chemical compound BrC1=CC=C(Br)C(Br)=C1 FWAJPSIPOULHHH-UHFFFAOYSA-N 0.000 description 1
- UZYYBZNZSSNYSA-UHFFFAOYSA-N 1,2,4-trichloro-3-methylbenzene Chemical compound CC1=C(Cl)C=CC(Cl)=C1Cl UZYYBZNZSSNYSA-UHFFFAOYSA-N 0.000 description 1
- MRJBOPVWPORBKZ-UHFFFAOYSA-N 1,2,4-trichloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=CC(Cl)=C21 MRJBOPVWPORBKZ-UHFFFAOYSA-N 0.000 description 1
- KSXFNGRHPAHIQJ-UHFFFAOYSA-N 1,2,4-triiodobenzene Chemical compound IC1=CC=C(I)C(I)=C1 KSXFNGRHPAHIQJ-UHFFFAOYSA-N 0.000 description 1
- AAUJSCRITBXDJH-UHFFFAOYSA-N 1,2,6-trichloronaphthalene Chemical compound ClC1=C(Cl)C=CC2=CC(Cl)=CC=C21 AAUJSCRITBXDJH-UHFFFAOYSA-N 0.000 description 1
- PNHUHPSIWGBXDF-UHFFFAOYSA-N 1,3,5-trichloro-2,4-dihydrotriazine Chemical compound ClN1CC(Cl)=CN(Cl)N1 PNHUHPSIWGBXDF-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- UEMGWPRHOOEKTA-UHFFFAOYSA-N 1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1 UEMGWPRHOOEKTA-UHFFFAOYSA-N 0.000 description 1
- SFPQFQUXAJOWNF-UHFFFAOYSA-N 1,3-diiodobenzene Chemical compound IC1=CC=CC(I)=C1 SFPQFQUXAJOWNF-UHFFFAOYSA-N 0.000 description 1
- OMHJVVBCCMLFMY-UHFFFAOYSA-N 1,4-dibromo-2-ethylbenzene Chemical compound CCC1=CC(Br)=CC=C1Br OMHJVVBCCMLFMY-UHFFFAOYSA-N 0.000 description 1
- MHQCPXUMZCNOSF-UHFFFAOYSA-N 1,4-dibromo-2-phenylbenzene Chemical compound BrC1=CC=C(Br)C(C=2C=CC=CC=2)=C1 MHQCPXUMZCNOSF-UHFFFAOYSA-N 0.000 description 1
- PZPSDDYNMXBZOA-UHFFFAOYSA-N 1,4-dichloro-2-ethylbenzene Chemical compound CCC1=CC(Cl)=CC=C1Cl PZPSDDYNMXBZOA-UHFFFAOYSA-N 0.000 description 1
- GAHDDNITQFTXQC-UHFFFAOYSA-N 1,4-dichloro-2-hexylbenzene Chemical compound CCCCCCC1=CC(Cl)=CC=C1Cl GAHDDNITQFTXQC-UHFFFAOYSA-N 0.000 description 1
- KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
- QUGUFLJIAFISSW-UHFFFAOYSA-N 1,4-difluorobenzene Chemical compound FC1=CC=C(F)C=C1 QUGUFLJIAFISSW-UHFFFAOYSA-N 0.000 description 1
- LFMWZTSOMGDDJU-UHFFFAOYSA-N 1,4-diiodobenzene Chemical compound IC1=CC=C(I)C=C1 LFMWZTSOMGDDJU-UHFFFAOYSA-N 0.000 description 1
- GEWNALKLLNCUMR-UHFFFAOYSA-N 1,5-dichloro-2,3,5,6-tetramethylcyclohexa-1,3-diene Chemical compound CC1C(Cl)=C(C)C(C)=CC1(C)Cl GEWNALKLLNCUMR-UHFFFAOYSA-N 0.000 description 1
- QDFKKJYEIFBEFC-UHFFFAOYSA-N 1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1 QDFKKJYEIFBEFC-UHFFFAOYSA-N 0.000 description 1
- CTPUUDQIXKUAMO-UHFFFAOYSA-N 1-bromo-3-iodobenzene Chemical compound BrC1=CC=CC(I)=C1 CTPUUDQIXKUAMO-UHFFFAOYSA-N 0.000 description 1
- BTGSQYQDTHZFCM-UHFFFAOYSA-N 1-bromo-4-chloro-2-ethylbenzene Chemical compound CCC1=CC(Cl)=CC=C1Br BTGSQYQDTHZFCM-UHFFFAOYSA-N 0.000 description 1
- UCCUXODGPMAHRL-UHFFFAOYSA-N 1-bromo-4-iodobenzene Chemical compound BrC1=CC=C(I)C=C1 UCCUXODGPMAHRL-UHFFFAOYSA-N 0.000 description 1
- VZHJIJZEOCBKRA-UHFFFAOYSA-N 1-chloro-3-fluorobenzene Chemical compound FC1=CC=CC(Cl)=C1 VZHJIJZEOCBKRA-UHFFFAOYSA-N 0.000 description 1
- JMLWXCJXOYDXRN-UHFFFAOYSA-N 1-chloro-3-iodobenzene Chemical compound ClC1=CC=CC(I)=C1 JMLWXCJXOYDXRN-UHFFFAOYSA-N 0.000 description 1
- RJCGZNCCVKIBHO-UHFFFAOYSA-N 1-chloro-4-fluorobenzene Chemical compound FC1=CC=C(Cl)C=C1 RJCGZNCCVKIBHO-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- GWCFTYITFDWLAY-UHFFFAOYSA-N 1-ethylazepan-2-one Chemical compound CCN1CCCCCC1=O GWCFTYITFDWLAY-UHFFFAOYSA-N 0.000 description 1
- VSKSBSORLCDRHS-UHFFFAOYSA-N 1-fluoro-3-iodobenzene Chemical compound FC1=CC=CC(I)=C1 VSKSBSORLCDRHS-UHFFFAOYSA-N 0.000 description 1
- FUNUTBJJKQIVSY-UHFFFAOYSA-N 2,4-Dichlorotoluene Chemical compound CC1=CC=C(Cl)C=C1Cl FUNUTBJJKQIVSY-UHFFFAOYSA-N 0.000 description 1
- CWZVGUOYTWYNJC-UHFFFAOYSA-N 2,4-dibromo-1-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(Br)C=C1Br CWZVGUOYTWYNJC-UHFFFAOYSA-N 0.000 description 1
- UADLUJIUAQAUHR-UHFFFAOYSA-N 2,5-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=C(Cl)C=CC1(C)Cl UADLUJIUAQAUHR-UHFFFAOYSA-N 0.000 description 1
- KKQWHYGECTYFIA-UHFFFAOYSA-N 2,5-dichlorobiphenyl Chemical compound ClC1=CC=C(Cl)C(C=2C=CC=CC=2)=C1 KKQWHYGECTYFIA-UHFFFAOYSA-N 0.000 description 1
- MZDTUPMGADIXBA-UHFFFAOYSA-N 2,6-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=CC(Cl)=CC1(C)Cl MZDTUPMGADIXBA-UHFFFAOYSA-N 0.000 description 1
- ZXONXKTYRSSVKY-UHFFFAOYSA-N 2-benzyl-1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C(CC=2C=CC=CC=2)=C1 ZXONXKTYRSSVKY-UHFFFAOYSA-N 0.000 description 1
- XWUCFAJNVTZRLE-UHFFFAOYSA-N 7-thiabicyclo[2.2.1]hepta-1,3,5-triene Chemical compound C1=C(S2)C=CC2=C1 XWUCFAJNVTZRLE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- DMSZORWOGDLWGN-UHFFFAOYSA-N ctk1a3526 Chemical compound NP(N)(N)=O DMSZORWOGDLWGN-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- XNFVGEUMTFIVHQ-UHFFFAOYSA-N disodium;sulfide;hydrate Chemical compound O.[Na+].[Na+].[S-2] XNFVGEUMTFIVHQ-UHFFFAOYSA-N 0.000 description 1
- TWKKUWBBCHHMLT-UHFFFAOYSA-N disodium;sulfide;trihydrate Chemical compound O.O.O.[Na+].[Na+].[S-2] TWKKUWBBCHHMLT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- IAQLJCYTGRMXMA-UHFFFAOYSA-M lithium;acetate;dihydrate Chemical compound [Li+].O.O.CC([O-])=O IAQLJCYTGRMXMA-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- AHKSSQDILPRNLA-UHFFFAOYSA-N rubidium(1+);sulfide Chemical compound [S-2].[Rb+].[Rb+] AHKSSQDILPRNLA-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/0231—Polyarylenethioethers containing chain-terminating or chain-branching agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/025—Preparatory processes
- C08G75/0254—Preparatory processes using metal sulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Sealing Material Composition (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823241514 DE3241514A1 (de) | 1982-11-10 | 1982-11-10 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| EP83110783A EP0108978B1 (de) | 1982-11-10 | 1983-10-28 | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden |
| DE8383110783T DE3365890D1 (en) | 1982-11-10 | 1983-10-28 | Process for preparing poly(arylene sulfides) which can be branched |
| US06/546,883 US4501884A (en) | 1982-11-10 | 1983-10-31 | Process for the production of optionally branched polyarylene sulphide with piperazinone solvent |
| JP58207646A JPS59102927A (ja) | 1982-11-10 | 1983-11-07 | 枝分れしていることもあるポリ硫化アリ−レンの製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823241514 DE3241514A1 (de) | 1982-11-10 | 1982-11-10 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3241514A1 true DE3241514A1 (de) | 1984-05-10 |
Family
ID=6177737
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823241514 Withdrawn DE3241514A1 (de) | 1982-11-10 | 1982-11-10 | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| DE8383110783T Expired DE3365890D1 (en) | 1982-11-10 | 1983-10-28 | Process for preparing poly(arylene sulfides) which can be branched |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383110783T Expired DE3365890D1 (en) | 1982-11-10 | 1983-10-28 | Process for preparing poly(arylene sulfides) which can be branched |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4501884A (enExample) |
| EP (1) | EP0108978B1 (enExample) |
| JP (1) | JPS59102927A (enExample) |
| DE (2) | DE3241514A1 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3317820A1 (de) * | 1983-05-17 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
| DE3338501A1 (de) * | 1983-10-22 | 1985-05-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3410642A1 (de) * | 1984-03-23 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3426918A1 (de) * | 1984-07-21 | 1986-01-23 | Bayer Ag, 5090 Leverkusen | Faserverstaerktes polyphenylensulfid |
| DE3428984A1 (de) * | 1984-08-07 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| US5015702A (en) * | 1989-10-06 | 1991-05-14 | Phillips Petroleum Company | Treatment of poly(arylene sulfide/sulfone) polymers |
| US5350834A (en) * | 1989-11-06 | 1994-09-27 | Phillips Petroleum Company | Treatment of polyarylene sulfide/sulfone polymers |
| US5235034A (en) * | 1989-11-06 | 1993-08-10 | Phillips Petroleum Company | Treatment of polyarylene sulfide/sulfone polymers with zinc compound and acidic solution |
| US5066774A (en) * | 1989-12-28 | 1991-11-19 | Phillips Petroleum Company | Method for the production of light colored aromatic sulfide/sulfone polymers with 1,3-dialkyl-2-imidazolidinone diluent |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3354129A (en) * | 1963-11-27 | 1967-11-21 | Phillips Petroleum Co | Production of polymers from aromatic compounds |
| US4024118A (en) * | 1975-05-27 | 1977-05-17 | Phillips Petroleum Company | P-Phenylene sulfide polymers |
| US4116947A (en) * | 1977-04-29 | 1978-09-26 | Phillips Petroleum Company | Branched arylene sulfide polymer production |
| US4297497A (en) * | 1978-06-19 | 1981-10-27 | The B. F. Goodrich Company | Synthesis of 2-keto-1,4-diazacycloalkanes |
| US4282347A (en) * | 1979-08-14 | 1981-08-04 | Phillips Petroleum Company | Preparation of branched polymers of arylene sulfide |
| DE3120538A1 (de) * | 1981-05-22 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
-
1982
- 1982-11-10 DE DE19823241514 patent/DE3241514A1/de not_active Withdrawn
-
1983
- 1983-10-28 EP EP83110783A patent/EP0108978B1/de not_active Expired
- 1983-10-28 DE DE8383110783T patent/DE3365890D1/de not_active Expired
- 1983-10-31 US US06/546,883 patent/US4501884A/en not_active Expired - Fee Related
- 1983-11-07 JP JP58207646A patent/JPS59102927A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0108978A3 (en) | 1984-11-07 |
| DE3365890D1 (en) | 1986-10-09 |
| US4501884A (en) | 1985-02-26 |
| EP0108978A2 (de) | 1984-05-23 |
| JPH0367095B2 (enExample) | 1991-10-21 |
| JPS59102927A (ja) | 1984-06-14 |
| EP0108978B1 (de) | 1986-09-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0109637B1 (de) | Verfahren zur Herstellung von hochmolekularen gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0164639A2 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit funktionellen Endgruppen | |
| EP0126369B2 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0142024B1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0065689B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0121206B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| DE2930797A1 (de) | Verfahren zur herstellung von polyarylensulfiden | |
| DE3428984A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| EP0108978B1 (de) | Verfahren zur Herstellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| EP0125600A1 (de) | Verfahren zur Herstellung von Polyarylensulfiden | |
| EP0121205B1 (de) | Verfahren zur Hestellung von gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3428986C2 (enExample) | ||
| DE3339233C2 (enExample) | ||
| DE3410642A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| EP0087045B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit erhöhter thermischer und chemischer Belastbarkeit und verbesserter Farbqualität | |
| EP0193827B1 (de) | Verfahren zur Herstellung von hochmolekularen Polyarylensulfiden | |
| DE3426918A1 (de) | Faserverstaerktes polyphenylensulfid | |
| EP0092723B1 (de) | Verfahren zur Herstellung von hochmolekularen, gegebenenfalls verzweigten Polyarylensulfiden | |
| DE3738142A1 (de) | Verfahren zur herstellung von polyarylensulfiden mit definiert einstellbaren schmelzviskositaeten | |
| EP0279217B1 (de) | Verfahren zur Herstellung von Polyarylensulfiden mit regelbaren Schmelzviskositäten | |
| DE3739340A1 (de) | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden | |
| DE3428985C2 (enExample) | ||
| EP0305815A2 (de) | Faserverstärktes Polyphenylensulfid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |