CS192697B1 - Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition engines - Google Patents
Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition enginesInfo
- Publication number
- CS192697B1 CS192697B1 CS766146A CS614676A CS192697B1 CS 192697 B1 CS192697 B1 CS 192697B1 CS 766146 A CS766146 A CS 766146A CS 614676 A CS614676 A CS 614676A CS 192697 B1 CS192697 B1 CS 192697B1
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- exhaut
- appliance
- gases
- fraction
- reducing
- Prior art date
Links
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 title 1
- 239000007789 gas Substances 0.000 title 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS766146A CS192697B1 (en) | 1976-09-22 | 1976-09-22 | Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition engines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS766146A CS192697B1 (en) | 1976-09-22 | 1976-09-22 | Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition engines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS192697B1 true CS192697B1 (en) | 1979-09-17 |
Family
ID=5407825
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS766146A CS192697B1 (en) | 1976-09-22 | 1976-09-22 | Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition engines |
Country Status (1)
| Country | Link |
|---|---|
| CS (1) | CS192697B1 (cs) |
-
1976
- 1976-09-22 CS CS766146A patent/CS192697B1/cs unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1558263A (en) | Gas liquefaction | |
| GB1541894A (en) | Gas turbine engines | |
| JPS528245A (en) | High temrature gas engine | |
| JPS5395410A (en) | Controller of gas turbine engine | |
| JPS52121005A (en) | Cracked gas generator | |
| HU173354B (hu) | Chetyrjokhtaknyj gazovoj dvigatel' s naruzhnym zazhiganiem | |
| JPS52153049A (en) | Heat gas engine | |
| JPS5330378A (en) | Infrared gas analyzer | |
| JPS52154481A (en) | Gas lighter | |
| JPS5374969A (en) | Gas lighter | |
| JPS52139573A (en) | Gas lighter | |
| JPS5331011A (en) | Gas turbine engine | |
| CS192697B1 (en) | Appliance for reducing the fraction of the nitrogen dioxide in the exhaut gases of the ignition engines | |
| JPS5364203A (en) | Cracked gas generator | |
| GB1546542A (en) | Gas turbine engine | |
| JPS5220449A (en) | Method of reducing nitrogen oxides in combustion gas | |
| GB1541841A (en) | Compressed gas engines | |
| JPS5344405A (en) | Gas | |
| JPS52130036A (en) | Gas combustion device | |
| JPS53442A (en) | Auxiliary gas combustion device | |
| GB1556893A (en) | Gas lighter | |
| JPS5385807A (en) | Desulfurization of gas | |
| GB1552121A (en) | Steam and compressed gas engines | |
| JPS5368307A (en) | Gas turbine engine | |
| JPS5363605A (en) | Gas compressor |