CS191658B1 - Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-x - Google Patents
Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-xInfo
- Publication number
- CS191658B1 CS191658B1 CS190677A CS190677A CS191658B1 CS 191658 B1 CS191658 B1 CS 191658B1 CS 190677 A CS190677 A CS 190677A CS 190677 A CS190677 A CS 190677A CS 191658 B1 CS191658 B1 CS 191658B1
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- cdsxse1
- steamed
- activation
- semiconductive layers
- cadmium sulfoselenide
- Prior art date
Links
- 230000004913 activation Effects 0.000 title 1
- PGWFQHBXMJMAPN-UHFFFAOYSA-N ctk4b5078 Chemical compound [Cd].OS(=O)(=O)[Se]S(O)(=O)=O PGWFQHBXMJMAPN-UHFFFAOYSA-N 0.000 title 1
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS190677A CS191658B1 (en) | 1977-03-22 | 1977-03-22 | Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-x |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS190677A CS191658B1 (en) | 1977-03-22 | 1977-03-22 | Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-x |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS191658B1 true CS191658B1 (en) | 1979-07-31 |
Family
ID=5354579
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS190677A CS191658B1 (en) | 1977-03-22 | 1977-03-22 | Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-x |
Country Status (1)
| Country | Link |
|---|---|
| CS (1) | CS191658B1 (cs) |
-
1977
- 1977-03-22 CS CS190677A patent/CS191658B1/cs unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2008747B (en) | Immunoassay method | |
| JPS57199856A (en) | Mat like formation | |
| GB1556596A (en) | Floor covering installation | |
| JPS5623369A (en) | Vapor bonding method | |
| JPS5424319A (en) | Fluidized layer combustion apparatus | |
| JPS5456197A (en) | Semiconductive component | |
| NO812487L (no) | Fremgangsmaate til overvaakning av mellomregeneratorer | |
| CS191658B1 (en) | Method of activation of the steamed semiconductive layers of the cadmium sulfoselenide cdsxse1-x | |
| JPS52120182A (en) | Fixing method of mycelium enzime | |
| JPS531733A (en) | Noise preventing apparatus for ignition energy augument apparatus | |
| JPS5399615A (en) | Floor assembly method | |
| GB1544064A (en) | Controllable rectifier elements | |
| JPS5232072A (en) | Laminating method | |
| GB1551295A (en) | Floor covering | |
| JPS52148605A (en) | Laminating method | |
| GB2011710B (en) | Semiconductor structures | |
| JPS53142521A (en) | Radioimmunoassay method | |
| JPS5467086A (en) | Mycellium producing method | |
| JPS52104572A (en) | Spraying method | |
| JPS52124716A (en) | Noise controller | |
| JPS5493365A (en) | Composite semiconductor | |
| JPS52139676A (en) | Fluidized layer apparatus | |
| JPS5223178A (en) | Laminating method | |
| JPS5318599A (en) | Bicyclic compound | |
| ZA773018B (en) | Bicyclic compounds |