CN118013258B - Information acquisition method of intelligent water-soluble fertilizer production line - Google Patents
Information acquisition method of intelligent water-soluble fertilizer production line Download PDFInfo
- Publication number
- CN118013258B CN118013258B CN202410411075.2A CN202410411075A CN118013258B CN 118013258 B CN118013258 B CN 118013258B CN 202410411075 A CN202410411075 A CN 202410411075A CN 118013258 B CN118013258 B CN 118013258B
- Authority
- CN
- China
- Prior art keywords
- point
- batch
- soluble fertilizer
- water
- peak
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000003337 fertilizer Substances 0.000 title claims abstract description 156
- 238000000034 method Methods 0.000 title claims abstract description 48
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 38
- 238000005070 sampling Methods 0.000 claims abstract description 95
- 238000001228 spectrum Methods 0.000 claims abstract description 28
- 238000012216 screening Methods 0.000 claims abstract description 7
- 238000004458 analytical method Methods 0.000 claims description 98
- 239000005416 organic matter Substances 0.000 claims description 51
- 230000003203 everyday effect Effects 0.000 claims description 9
- 238000004364 calculation method Methods 0.000 claims description 8
- 238000010606 normalization Methods 0.000 claims description 4
- 238000012360 testing method Methods 0.000 abstract description 2
- 230000005540 biological transmission Effects 0.000 description 17
- 230000008859 change Effects 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 238000002189 fluorescence spectrum Methods 0.000 description 5
- 239000011368 organic material Substances 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 230000008054 signal transmission Effects 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000012952 Resampling Methods 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 238000007781 pre-processing Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/17—Systems in which incident light is modified in accordance with the properties of the material investigated
- G01N21/25—Colour; Spectral properties, i.e. comparison of effect of material on the light at two or more different wavelengths or wavelength bands
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N21/00—Investigating or analysing materials by the use of optical means, i.e. using sub-millimetre waves, infrared, visible or ultraviolet light
- G01N21/62—Systems in which the material investigated is excited whereby it emits light or causes a change in wavelength of the incident light
- G01N21/63—Systems in which the material investigated is excited whereby it emits light or causes a change in wavelength of the incident light optically excited
- G01N21/64—Fluorescence; Phosphorescence
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N30/00—Investigating or analysing materials by separation into components using adsorption, absorption or similar phenomena or using ion-exchange, e.g. chromatography or field flow fractionation
- G01N30/02—Column chromatography
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N30/00—Investigating or analysing materials by separation into components using adsorption, absorption or similar phenomena or using ion-exchange, e.g. chromatography or field flow fractionation
- G01N30/02—Column chromatography
- G01N30/62—Detectors specially adapted therefor
- G01N30/74—Optical detectors
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06F—ELECTRIC DIGITAL DATA PROCESSING
- G06F18/00—Pattern recognition
- G06F18/20—Analysing
- G06F18/21—Design or setup of recognition systems or techniques; Extraction of features in feature space; Blind source separation
- G06F18/211—Selection of the most significant subset of features
- G06F18/2113—Selection of the most significant subset of features by ranking or filtering the set of features, e.g. using a measure of variance or of feature cross-correlation
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06F—ELECTRIC DIGITAL DATA PROCESSING
- G06F18/00—Pattern recognition
- G06F18/20—Analysing
- G06F18/21—Design or setup of recognition systems or techniques; Extraction of features in feature space; Blind source separation
- G06F18/213—Feature extraction, e.g. by transforming the feature space; Summarisation; Mappings, e.g. subspace methods
-
- G—PHYSICS
- G06—COMPUTING; CALCULATING OR COUNTING
- G06F—ELECTRIC DIGITAL DATA PROCESSING
- G06F2218/00—Aspects of pattern recognition specially adapted for signal processing
- G06F2218/08—Feature extraction
- G06F2218/10—Feature extraction by analysing the shape of a waveform, e.g. extracting parameters relating to peaks
Landscapes
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Pathology (AREA)
- Immunology (AREA)
- Data Mining & Analysis (AREA)
- Biochemistry (AREA)
- Theoretical Computer Science (AREA)
- Analytical Chemistry (AREA)
- Computer Vision & Pattern Recognition (AREA)
- General Engineering & Computer Science (AREA)
- Artificial Intelligence (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Bioinformatics & Computational Biology (AREA)
- Evolutionary Computation (AREA)
- Evolutionary Biology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Fertilizers (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
Abstract
The invention relates to the technical field of spectrum testing, in particular to an information acquisition method of an intelligent water-soluble fertilizer production line. The method comprises the steps of obtaining the signal stability of each type of organic matters in the water-soluble fertilizer, and obtaining the importance of each type of organic matters at the peak point of a local signal section of each batch; the method comprises the steps of obtaining the priority weight of peak points of a water-soluble fertilizer signal according to the signal stability and importance of organic matters corresponding to a local signal segment where the peak points are located, screening characteristic points in the water-soluble fertilizer signal by combining the distances between adjacent peak points of the data points, selecting the optimal sampling frequency of each batch according to the number of the characteristic points obtained under each sampling frequency to be detected, and further collecting information of the water-soluble fertilizer based on the optimal sampling frequency. According to the invention, the optimal sampling frequency is selected based on the number of important information, namely characteristic data points, acquired by the sampling frequency to be detected, so that the accuracy of information acquisition on the water-soluble fertilizer production line is improved.
Description
Technical Field
The invention relates to the technical field of spectrum testing, in particular to an information acquisition method of an intelligent water-soluble fertilizer production line.
Background
The water-soluble fertilizer contains different types of organic matters, the content of each type of organic matters in the water-soluble fertilizer has a certain standard in the production process, and in order to detect the quality of the water-soluble fertilizer, the relevant concentration data of the water-soluble fertilizer produced on the water-soluble fertilizer production line are usually collected and transmitted to a control system for analysis so as to check whether the water-soluble fertilizer accords with the production quality. In the concentration data transmission process, the sampling frequency can influence the accuracy and the reliability of concentration data, if the sampling frequency is set to be too low, important data points which show the characteristics of the water-soluble fertilizer cannot be obtained effectively when the information of the water-soluble fertilizer is acquired, so that the acquired data cannot accurately reflect the concentration characteristic information of various organic matters in the water-soluble fertilizer, and the accuracy and the integrity of the concentration data of the water-soluble fertilizer are reduced.
Disclosure of Invention
In order to solve the technical problems that the sampling frequency is unreasonable in the process of data acquisition of the water-soluble fertilizer and the accuracy and the integrity of concentration data of the water-soluble fertilizer are affected, the invention aims to provide an information acquisition method of an intelligent water-soluble fertilizer production line, and the adopted technical scheme is as follows:
the invention provides an information acquisition method of an intelligent water-soluble fertilizer production line, which comprises the following steps:
Acquiring a spectrum signal of each batch of water-soluble fertilizer produced on a water-soluble fertilizer production line every day, and recording the spectrum signal as a water-soluble fertilizer signal of each batch; obtaining a local signal section of each type of organic matters in the water-soluble fertilizer in each batch of water-soluble fertilizer signals;
Acquiring the signal stability of each type of organic matter according to the amplitude difference between the data points of the local signal segments corresponding to any two batches of the organic matter and the discrete degree of the amplitude of the data points of the local signal segments;
combining the difference and the distance between the peak points of the local signal sections corresponding to each batch and the rest batches of each type of organic matters and the amplitude of each peak point of the local signal sections corresponding to each batch of each type of organic matters to obtain the importance of each peak point of the local signal sections corresponding to each batch of each type of organic matters;
acquiring the priority weight of each peak point of the water-soluble fertilizer signals of each batch according to the signal stability and the importance of the organic matters corresponding to the local signal section where each peak point of the water-soluble fertilizer signals of each batch is located; screening out characteristic points in the water-soluble fertilizer signals of each batch based on the distance between each data point of the water-soluble fertilizer signals of each batch and the adjacent peak point and the priority weight of the peak point;
Setting different sampling frequencies to be tested; sampling data points of water-soluble fertilizer signals of each batch according to each sampling frequency to be detected, and selecting the optimal sampling frequency of each batch from the sampling frequencies to be detected according to the number of characteristic points corresponding to each batch obtained under each sampling frequency to be detected;
And acquiring information of the water-soluble fertilizer of each batch on the water-soluble fertilizer production line based on the preferred sampling frequency of each batch.
Further, the calculation formula of the signal stability of each type of organic matter is as follows:
; wherein E is the signal stability of each type of organic matter; m is the total number of batches of the water-soluble fertilizer produced on the water-soluble fertilizer production line every day; /(I) Variance of the magnitudes of all data points of the local signal section corresponding to the a-th batch for each type of organic matter; /(I)Variance of the magnitudes of all data points of the local signal section corresponding to the b-th batch for each type of organic matter; n is the total number of data points in the local signal section corresponding to each type of organic matters; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the a-th batchThe magnitude of the data points; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the b-th batchThe magnitude of the data points; /(I)As a function of absolute value; exp is an exponential function based on a natural constant e.
Further, the method for combining the difference and the distance between the peak points of the local signal segments corresponding to each batch and the rest batches and the amplitude of each peak point of the local signal segments corresponding to each batch by each type of organic matter to obtain the importance of each peak point of the local signal segments corresponding to each batch by each type of organic matter includes:
Selecting any type of organic matters as analysis organic matters, taking a local signal section corresponding to the analysis organic matters in any batch as an analysis signal section, and taking the rest local signal sections except the analysis signal section corresponding to the analysis organic matters as target signal sections; selecting any peak point of the analysis signal section as an analysis point;
For each target signal segment, calculating the absolute value of the difference between the analysis point and the wavelength of each peak point of the target signal segment respectively, and taking the absolute value as the wavelength distance between the analysis point and each peak point of the target signal segment; taking the peak point corresponding to the minimum wavelength distance as a concern point of an analysis point in a target signal segment;
According to the wavelength difference and the amplitude difference of the analysis point and the attention point of the analysis point in each target signal segment, obtaining the characteristic distance between the analysis point and the peak point of each target signal segment;
the method comprises the steps of statistically analyzing the number of peak points of organic matters in local signal sections corresponding to each batch;
And combining the characteristic distance between the analysis point and the peak point of each target signal segment, the amplitude of the analysis point and the difference between the analysis signal segment and the number of the peak points of each target signal segment to acquire the importance of the analysis point.
Further, the calculation formula of the importance degree of the analysis point is as follows:
，
; in the/> -Said importance for said analysis point; p is the analysis point; x is the total number of target signal segments; /(I)Analyzing the total number of extreme points of the signal segment; /(I)The total number of extreme points of the xth target signal segment; /(I)For the characteristic distance between the analysis point and the peak point of the x-th target signal segment; /(I)For the analysis point and the wavelength distance between the analysis point and the point of interest in the x-th target signal segment; /(I)The amplitude of the analysis point; /(I)An amplitude value of the point of interest in the x-th target signal segment for an analysis point; for analyzing a maximum in the magnitudes of the data points of the signal segment; a is a preset positive number; /(I) As a function of absolute value.
Further, the method for obtaining the priority weight of each peak point of each batch of water-soluble fertilizer signals comprises the following steps:
Taking the importance of each peak point of the water-soluble fertilizer signals of each batch as a molecule, and taking the signal stability of the local signal section corresponding to the organic matters at the peak point as a denominator to obtain a ratio as the priority weight of each peak point of the water-soluble fertilizer signals of each batch.
Further, the method for screening out the characteristic points in the water-soluble fertilizer signals of each batch comprises the following steps:
Selecting any one data point except the first data point and the last data point of any batch of water-soluble fertilizer signals as a point to be analyzed, judging whether the priority weight of the adjacent previous peak point of the point to be analyzed is smaller than the priority weight of the adjacent next peak point of the point to be analyzed, and if so, taking the absolute value of the difference value between the wavelengths of the point to be analyzed and the adjacent previous peak point as the wavelength difference degree of the point to be analyzed; if not, taking the absolute value of the difference value between the wavelengths of the point to be analyzed and the next peak value point adjacent to the point to be analyzed as the wavelength difference degree of the point to be analyzed;
According to the wavelength difference degree of the point to be analyzed and the difference between the priority weights of the adjacent peak points of the point to be analyzed, acquiring the priority degree of the point to be analyzed;
And regarding the data points of the water-soluble fertilizer signals of each batch, taking the data points with the priority higher than a preset priority threshold value as the characteristic points in the water-soluble fertilizer signals of each batch.
Further, the calculation formula of the priority of the point to be analyzed is as follows:
; in the/> The priority of the point to be analyzed; s is the point to be analyzed; /(I)The wavelength difference degree is the wavelength difference degree of the point to be analyzed; /(I)The priority weight of the adjacent previous peak point of the point to be analyzed; /(I)The priority weight of the next adjacent peak point of the point to be analyzed; /(I)A peak point adjacent to the previous point to be analyzed; /(I)A peak point next to the point to be analyzed; /(I)The absolute value of the difference between the wavelengths of the adjacent previous peak point and the adjacent next peak point of the point to be analyzed; /(I)As a function of absolute value; norms are normalization functions.
Further, the method for selecting the preferred sampling frequency of each batch from the sampling frequencies to be tested comprises the following steps:
For each batch of water-soluble fertilizer signals, sampling data points of the water-soluble fertilizer signals with each sampling frequency to be detected, and counting the total number of the characteristic points in the data points obtained under each sampling frequency to be detected as a judging index of each sampling frequency to be detected;
and taking the sampling frequency to be detected corresponding to the maximum judgment index as the optimal sampling frequency of the water-soluble fertilizer signal.
Further, the preset positive number is 0.1.
Further, the preset priority threshold is 0.6.
The invention has the following beneficial effects:
In the embodiment of the invention, the organic matters with larger concentration fluctuation are particularly important to determining the sampling rate, and the amplitude difference of the data points and the discrete degree of the amplitude of the data points of the organic matters in the local signal sections of different batches are sequentially obtained from the concentration of the organic matters in the different batches and the signal intensity change characteristics of the local signal sections of each batch, so that the obtained signal stability is more accurately represented by the concentration fluctuation degree of the organic matters; because the water-soluble fertilizer has a certain standard on the content of the organic matters in the production process, the fluctuation conditions of the organic matters in the local signal sections of different batches are similar, and because the absorption peaks of the organic matters in the corresponding wavelength intervals in the spectrum reflect the relative important information of the concentration of the organic matters, the fluctuation similarity degree of the organic matters in the local signal sections of different batches is judged through the position distribution and the quantity of the peak points of the local signal sections of different batches, and the importance of the peak points is obtained by combining the amplitude values of the peak points; giving priority to peak points by combining importance of the peak points and signal stability of the corresponding organic matters; the priority weight determines the importance degree of the peak point to the concentration information, wherein the importance degree of the peak point to the concentration information is higher than the importance degree of a data point between two peak points, and the importance degree of the data point to the concentration information is measured through the distance between the data point and the adjacent peak point, so that the screened characteristic points can accurately reflect the concentration information data; and selecting the optimal sampling frequency according to the number of the characteristic points acquired by the sampling frequency to be detected, so that the data points acquired by the optimal sampling frequency can represent the concentration information of the organic matters, and the accuracy and the integrity of information acquisition of the water-soluble fertilizers in each batch on the water-soluble fertilizer production line are improved.
Drawings
In order to more clearly illustrate the embodiments of the invention or the technical solutions and advantages of the prior art, the following description will briefly explain the drawings used in the embodiments or the description of the prior art, and it is obvious that the drawings in the following description are only some embodiments of the invention, and other drawings can be obtained according to the drawings without inventive effort for a person skilled in the art.
Fig. 1 is a flow chart of a method for information collection in an intelligent water-soluble fertilizer production line according to an embodiment of the present invention.
Detailed Description
In order to further explain the technical means and effects adopted by the invention to achieve the preset aim, the following is a detailed description of specific implementation, structure, characteristics and effects of an information acquisition method of an intelligent water-soluble fertilizer production line according to the invention in combination with the accompanying drawings and preferred embodiments. In the following description, different "one embodiment" or "another embodiment" means that the embodiments are not necessarily the same. Furthermore, the particular features, structures, or characteristics of one or more embodiments may be combined in any suitable manner.
Unless defined otherwise, all technical and scientific terms used herein have the same meaning as commonly understood by one of ordinary skill in the art to which this invention belongs.
The invention provides a specific scheme of an information acquisition method of an intelligent water-soluble fertilizer production line, which is specifically described below with reference to the accompanying drawings.
Referring to fig. 1, a method flowchart of an information collecting method of an intelligent water-soluble fertilizer production line according to an embodiment of the present invention is shown, where the method includes:
step S1: acquiring a spectrum signal of each batch of water-soluble fertilizer produced on a water-soluble fertilizer production line every day, and recording the spectrum signal as a water-soluble fertilizer signal of each batch; and obtaining a local signal section of each type of organic matters in the water-soluble fertilizer signal of each batch.
Specifically, in order to ensure the quality of the water-soluble fertilizer, the relevant information monitored by each process on the water-soluble fertilizer production line is generally sampled and screened to obtain water-soluble fertilizers of different batches so as to distinguish the relevant information of the water-soluble fertilizer production of different batches. Acquiring a fluorescence spectrum of each batch of water-soluble fertilizer produced on a water-soluble fertilizer production line every day by a liquid chromatograph and a fluorescence monitor which are arranged at a sampling position at a reference sampling frequency f, wherein the horizontal axis of the fluorescence spectrum is wavelength, and the vertical axis of the fluorescence spectrum is fluorescence intensity; the spectral signal in the fluorescence spectrum is taken as the initial spectral signal. And transmitting the acquired initial spectrum signals to a central control system for processing, and denoising the received initial spectrum signals by a processor to obtain the spectrum signals after denoising the initial spectrum signals of each batch. For convenience of the following description, the spectrum signal of each batch of water-soluble fertilizer is recorded as the water-soluble fertilizer signal of each batch.
It should be noted that, in the embodiment of the present invention, the SG filtering algorithm is selected to perform denoising processing on the initial spectrum signal. The method for obtaining the spectrum signal and preprocessing the signal in the spectrum chart at the specific sampling frequency is known to those skilled in the art, and will not be described herein. The amplitude of the data points in the water-soluble fertilizer signal is the fluorescence intensity of the data points.
The liquid chromatograph is used for separating and measuring the concentration of organic matters in the water-soluble fertilizer, and different organic matters in the water-soluble fertilizer are separated through the chromatographic column according to the affinity and the relative solubility of the organic matters; the fluorescence detector detects fluorescence-labeled organic matters, the organic matters emit specific fluorescence signals after being irradiated by excitation light, and the fluorescence detector measures the fluorescence spectrum of the fluorescence organic matters in the water-soluble fertilizer. Therefore, the abscissa of the water-soluble fertilizer signal of each batch is the wavelength, and the ordinate is the fluorescence intensity; each data point of the water-soluble fertilizer signal represents fluorescence intensity at a specific wavelength, and represents concentration information of organic matters in the water-soluble fertilizer.
All types of organic matters existing in the water-soluble fertilizer have definite corresponding wavelength intervals in the spectrum, and the wavelength intervals of each type of organic matters in the water-soluble fertilizer with different concentrations are generally the same; for each batch of water-soluble fertilizer signals, selecting a left datum point and a right datum point of each type of organic matters from data points of the water-soluble fertilizer signals, wherein the wavelength of the left datum point of each type of organic matters is equal to the wavelength of the left end point of a wavelength interval corresponding to the organic matters in a spectrum, and the wavelength of the right datum point is equal to the wavelength of the right end point of the wavelength interval corresponding to the organic matters in the spectrum. In the water-soluble fertilizer signal, a signal section between a left reference point and a right reference point of each type of organic matters is used as a local signal section of each type of organic matters in the water-soluble fertilizer signal.
So far, the local signal section of each type of organic matters in the water-soluble fertilizer in each batch of water-soluble fertilizer signals produced every day is obtained.
Step S2: and acquiring the signal stability of each type of organic matter according to the amplitude difference between the data points of the local signal segments corresponding to any two batches of the organic matter and the discrete degree of the amplitude of the data points of the local signal segments.
Each type of organic matters in the water-soluble fertilizer is influenced by various parameter errors in an upstream production link, and the concentration of each type of organic matters can fluctuate to different degrees. The sensitivity of the organic matters with relatively stable concentration fluctuation degree to the sampling frequency is low, and the organic matters still have higher fidelity rate to the data in the final data transmission process when the sampling frequency changes; on the contrary, the sensitivity of the organic matters with larger concentration fluctuation to the sampling frequency is higher, and the organic matters are particularly important to determine the sampling frequency. Therefore, it is necessary to judge the degree of fluctuation of each type of organic matter, that is, the signal stability.
The amplitude difference between the data points of the local signal sections corresponding to any two batches of each type of organic matter is analyzed from the concentration of each type of organic matter in different batches to analyze the fluctuation degree of the concentration of the organic matter; analyzing the fluctuation degree of the concentration of the organic matters according to the characteristic of the change of the signal intensity of each type of organic matters in the local signal section of each batch; the two factors are combined for analysis, so that the signal stability shows more accurate fluctuation degree of the concentration of the organic matters.
The signal stability of each type of organic matter is calculated as follows:
wherein E is the signal stability of each type of organic matter; m is the total number of batches of the water-soluble fertilizer produced on the water-soluble fertilizer production line every day; variance of the magnitudes of all data points of the local signal section corresponding to the a-th batch for each type of organic matter; /(I) Variance of the magnitudes of all data points of the local signal section corresponding to the b-th batch for each type of organic matter; n is the total number of data points in the local signal section corresponding to each type of organic matters; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the a-th batchThe magnitude of the data points; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the b-th batchThe magnitude of the data points; /(I)As a function of absolute value; exp is an exponential function based on a natural constant e.
It should be noted that when the liquid chromatograph and the fluorescence monitor collect the spectrum signals of the water-soluble fertilizer, since the wavelength interval of each kind of component in the water-soluble fertilizer with different concentrations is generally the same, the total number of data points of each kind of organic matters in the local signal section corresponding to different batches is the same, and the wavelengths of the data points of each kind of organic matters in the same position of the local signal section corresponding to different batches are the same; for example, the wavelength of the 1 st data point of the local signal segment corresponding to the 1 st lot of the 1 st organic matter is the same as the wavelength of the 1 st data point of the local signal segment corresponding to the 2 nd lot of the 1 st organic matter.
Presenting the difference between the fluorescence intensities of the same wavelength in the local signal section corresponding to the a-th batch and the b-th batch of each type of organic matter when/>The smaller the time, the smaller the signal intensity change of each class of organic matters in the a-th batch and the b-th batch is, the more the concentration fluctuation of each class of organic matters is relatively stable, the larger the signal stability E is; /(I)And/>The signal intensity change characteristics of local signal segments corresponding to the a-th batch and the b-th batch of each type of organic matters are respectively presented; when (when)The smaller the organic concentration stability of each organic material, the higher the organic material concentration stability of each organic material, and the higher the signal stability E. The final signal stability E of each class of organic matters is obtained by analyzing the stability degree of the concentration of the organic matters in the water-soluble fertilizers produced by each class of organic matters in two batches every day and taking the average value, and when the signal stability E is larger, the sensitivity degree of each class of organic matters to the sampling frequency is lower, and the influence degree of each class of organic matters by the sampling frequency is smaller.
The concentration change degree of each type of organic matters is obtained through the signal intensity difference and fluctuation condition of each type of organic matters on the local signal sections of different batches, so that the response condition of the signal data of each type of organic matters to the sampling frequency change in the transmission process is reflected, the accuracy of the sampling frequency is improved through subsequent operation, and the fidelity and the efficiency of data transmission are indirectly improved.
Step S3: and combining the difference and the distance between the peak points of the local signal sections corresponding to each batch and the rest batches of each type of organic matters and the amplitude of each peak point of the local signal sections corresponding to each batch of each type of organic matters to obtain the importance of each peak point of the local signal sections corresponding to each batch of each type of organic matters.
Specifically, each type of organic matter may have a strong absorption peak in a corresponding wavelength range in the spectrum, which indicates that the organic matter has a high absorption capacity for the wavelength of light, and the concentration of the organic matter may be higher, and higher absorbance means that the number of organic matter molecules is more or that more organic matter exists in the water-soluble fertilizer. However, when there are multiple absorption peaks in the corresponding wavelength interval of the spectrum for each type of organic material, it may be indicated that there are multiple conformations or mixtures of isomers, and in addition to the organic material, other reaction products or impurity components may be present in the water-soluble fertilizer, which may contribute to the light absorption in the above wavelength interval, resulting in additional absorption peaks in the spectrum.
In the signal transmission process, the signal data which can most represent the organic matters to be monitored should be compressed and transmitted preferentially, but if the organic matters have too many absorption peaks in the corresponding wavelength interval in the spectrum, too many data points which cannot represent the organic matters information are easily selected by key points, so that the data distortion is caused in the final compressed and transmitted result. Therefore, the importance of peak points of each type of organic matters in each batch of water-soluble fertilizer signals is obtained.
Because the water-soluble fertilizer has a certain standard on the content of each type of organic matters in the production process, the fluctuation condition of the local signal section corresponding to each type of organic matters in different batches is similar in theory; because the absorption peaks of the organic matters in the corresponding wavelength ranges in the spectrum reflect the relative important information of the concentration of the organic matters, the fluctuation similarity degree of the organic matters in the local signal segments of different batches is judged through the position distribution and the quantity of the peak points of the local signal segments corresponding to different batches of each organic matter, and the acquired importance of the peak points is more accurate by combining the amplitude values of the peak points.
Preferably, the specific acquisition method of the importance of the peak point of the water-soluble fertilizer signal comprises the following steps: selecting any type of organic matters as analysis organic matters, taking a local signal section corresponding to the analysis organic matters in any batch as an analysis signal section, and taking the rest local signal sections except the analysis signal section corresponding to the analysis organic matters as target signal sections; selecting any peak point of the analysis signal section as an analysis point; for each target signal segment, calculating the absolute value of the difference between the analysis point and the wavelength of each peak point of the target signal segment respectively, and taking the absolute value as the wavelength distance between the analysis point and each peak point of the target signal segment; taking a peak point corresponding to the minimum wavelength distance as a concern point of an analysis point in the target signal section; according to the wavelength difference and the amplitude difference of the analysis point and the attention point of the analysis point in each target signal segment, acquiring the characteristic distance between the analysis point and the peak point of each target signal segment; the method comprises the steps of statistically analyzing the number of peak points of organic matters in local signal sections corresponding to each batch; and combining the characteristic distance between the analysis point and the peak point of each target signal segment, the amplitude of the analysis point and the difference between the analysis signal segment and the number of the peak points of each target signal segment to acquire the importance of the analysis point.
Since the organic species is determined by the wavelength, the wavelength distance, which is the difference between the wavelengths of the analysis point p and each peak point of the target signal segment, is obtained, and the peak point corresponding to the smallest wavelength distance is regarded as the attention point of the analysis point as the higher the possibility that the peak point corresponding to the smallest wavelength distance and the organic substance corresponding to the analysis point are the same components. And measuring the similarity degree of the position distribution of the peak points of the organic matters in the local signal segments of different batches by analyzing the position distribution of the points and the attention points in the target signal segments.
The calculation formula of the importance of the analysis point is as follows:
In the method, in the process of the invention, Importance for the analysis point; p is the analysis point; x is the total number of target signal segments; /(I)Analyzing the total number of extreme points of the signal segment; /(I)The total number of extreme points of the xth target signal segment; /(I)Characteristic distances between the analysis points and peak points of the xth target signal segment; /(I)For the analysis point and the wavelength distance between the analysis point and the point of interest in the x-th target signal segment; /(I)The amplitude of the analysis point; /(I)The amplitude of the point of interest in the x-th target signal segment for the analysis point; /(I)For analyzing a maximum in the magnitudes of the data points of the signal segment; a is a preset positive number, and a tested value of 0.1 is taken as a protection factor of 0, so that the meaning of the division is nonsensical; /(I)As a function of absolute value.
It should be noted that, because the water-soluble fertilizer has a certain standard for the content of each type of organic matters in the production process, the fluctuation condition of the local signal sections corresponding to different batches of each type of organic matters should be similar, that is, the closer the positions of the peak points of the local signal sections corresponding to different batches of each type of organic matters are and the smaller the number difference of the peak points is.
When (when)And when the water-soluble fertilizer concentration is smaller, the concentration of the water-soluble fertilizer in the batch to which the analysis point belongs and the concentration of the water-soluble fertilizer in the rest batches are closer to each other, and the content of the analysis organic matters in the water-soluble fertilizers in different batches is closer to the standard content, the information of the corresponding peak point of the batch to which the analysis point belongs is more important. /(I)Presenting the similarity degree of the position distribution of the analysis point and the peak point of the x-th target signal section, acquiring the wavelength difference and the amplitude difference of the analysis point and the attention point of the analysis point in the x-th target signal section, and when/>The smaller the analysis point is, the closer the analysis point is to the attention point in the x-th target signal section, which shows that the more similar the concentration of the water-soluble fertilizer of the batch to which the analysis point belongs to and the rest batches is, the higher the authenticity of the organic matter content of the water-soluble fertilizer of the batch to which the analysis point belongs to, the more accurate the analysis point shows the condition of analyzing the organic matter concentration, the more important the information reflected by the analysis point is, the importance/>The larger. Utilization/>Pair/>Normalization is performed when/>More time, let/>The larger the analysis point is, the more prominently the analysis point is in a wavelength range corresponding to the spectrum of the analysis organic matter, which shows that the higher the authenticity of the analysis point to express the content of the analysis organic matter is, the importance/>The larger.
According to the method for acquiring the importance of the analysis points, the importance of the peak point of the local signal section corresponding to each batch of each type of organic matter is acquired.
Step S4: acquiring the priority weight of each peak point of the water-soluble fertilizer signals of each batch according to the signal stability and importance of the corresponding organic matters of the local signal section where each peak point of the water-soluble fertilizer signals of each batch is located; and screening out characteristic points in the water-soluble fertilizer signals of each batch based on the distance between each data point of the water-soluble fertilizer signals of each batch and the adjacent peak point and the priority weight of the peak point.
The signal stability reflects the influence degree of the sampling frequency on the organic matters, the importance degree reflects the importance degree of the organic matters corresponding to the peak point in the water-soluble fertilizer content, and the signal stability and the importance degree of the organic matters corresponding to the local signal section where the peak point is located are comprehensively analyzed, so that the priority weight given by the peak point is more accurate.
Preferably, the method for acquiring the priority weight comprises the following steps: the importance of each peak point of the water-soluble fertilizer signals of each batch is taken as a molecule, the signal stability of the local signal section corresponding to the organic matters where the peak point is positioned is taken as a denominator to obtain a ratio, and the ratio is taken as the priority weight of each peak point of the water-soluble fertilizer signals of each batch.
It should be noted that, when the importance T of a peak point is greater, the more important the peak point corresponds to the organic matter concentration information, and the greater the acquisition requirement of the data point near the peak point is, the greater the priority weight of the peak point is; when the signal stability E of the local signal segment corresponding to the organic matter at the peak point is smaller, the sensitivity degree of the organic matter to the sampling frequency is higher, the influence degree of the organic matter on the sampling frequency is larger, the acquisition requirement of the data point near the peak point is larger, and the priority weight of the peak point is larger.
The method for determining the priority of the data points of the water-soluble fertilizer signal comprises the following steps: selecting any one data point except the first data point and the last data point of any batch of water-soluble fertilizer signals as a point to be analyzed, judging whether the priority weight of the adjacent previous peak point of the point to be analyzed is smaller than the priority weight of the adjacent next peak point of the point to be analyzed, if so, taking the absolute value of the difference between the wavelengths of the point to be analyzed and the adjacent previous peak point as the wavelength difference degree of the point to be analyzed; if not, taking the absolute value of the difference value between the wavelengths of the point to be analyzed and the next peak value point adjacent to the point to be analyzed as the wavelength difference degree of the point to be analyzed; and acquiring the priority of the point to be analyzed according to the difference between the wavelength difference of the point to be analyzed and the priority weight of the adjacent peak value point of the point to be analyzed.
It should be noted that, in the embodiment of the present invention, the preference degree of the first data point and the last data point of the water-soluble fertilizer signal of each batch is set to be 0; if the wavelength interval corresponding to the local signal section where the data point is located in the spectrum does not refer to any organic matter, the preference of the data point is set to be 0, and an implementer can set the data point according to specific situations.
The calculation formula of the priority of the points to be analyzed is as follows:
In the method, in the process of the invention, The priority of the point to be analyzed; s is the point to be analyzed; /(I)The wavelength difference degree of the point to be analyzed; The absolute value of the difference value between the wavelength of the point to be analyzed and the wavelength of the point adjacent to the point of the previous peak; /(I) The absolute value of the difference value between the wavelength of the point to be analyzed and the wavelength of the next peak value adjacent to the point to be analyzed; /(I)The priority weight of the adjacent previous peak value point of the point to be analyzed; /(I)The priority weight of the next adjacent peak value point of the point to be analyzed is given; /(I)A peak point adjacent to the previous point to be analyzed; /(I)A peak point next to the point to be analyzed; /(I)The absolute value of the difference between the wavelengths of the adjacent previous peak point and the adjacent next peak point of the point to be analyzed; /(I)As a function of absolute value; norms are normalization functions.
By the way, byThe priority weight is evenly distributed to each data point in a section formed by the adjacent previous peak point s1 and the adjacent next peak point s2 of the point s to be analyzed; when (when)The larger the factor/>Is a fixed value, and the wavelength difference degree of the point to be analyzed is at the momentThe larger the difference of the wavelength/>, the more the wavelength is used in the embodiment of the inventionMeasuring sampling requirement, namely priority/>, of points to be analyzed; When priority/>The larger the sampling requirement of the point to be analyzed, the higher the priority.
When (when)When the data transmission priority of the peak point s2 is higher, namely the importance is higher, and the signal stability of the corresponding organic matters is lower compared with the peak point s 1; the sensitivity degree of the signal data with larger fluctuation to the sampling frequency is higher, and the influence degree of the sampling frequency is larger; when the point to be analyzed s is closer to the point s1, the importance of the point to be analyzed s is small and the influence on the sampling frequency is smaller, the transmission priority of the point to be analyzed s is measured through the difference between the wavelengths of the point to be analyzed s and the peak point s1, so that the wavelength difference/>, when the point to be analyzed s is closer to the peak point s2 with higher transmission priority, the transmission priority is realizedThe larger the point to be analyzed s, the larger the priority transmission requirement is, so that the priority/>, of the point to be analyzed sThe larger the purpose. It should be noted that, the preferential transmission requirement of the peak points must be greater than the data points between adjacent peak points, so as to ensure that a certain range of data characteristics remain intact for any one peak point and its periphery when transmitting data.
When (when)When the point to be analyzed s is closer to the point s1, the importance of the point to be analyzed s is greater and the influence on the sampling frequency is greater, and the transmission priority of the point to be analyzed s is measured by the difference between the wavelengths of the point to be analyzed s and the point s2, so as to realize that the closer to the point s1 with higher transmission priority, the wavelength difference/>The greater the priority/>, the more the point s to be analyzed isThe larger the purpose.
For the data points of the water-soluble fertilizer signals of each batch, taking the data points with the priority higher than a preset priority threshold value as the characteristic points in the water-soluble fertilizer signals of each batch; the more important the feature points correspond to the concentration data and the greater the influence on the determination of the sampling frequency, the higher the transmission requirement in data transmission.
In the embodiment of the invention, the preset priority threshold takes an experience value of 0.6, and an implementer can set the preset priority threshold according to specific situations.
Step S5: setting different sampling frequencies to be tested; and sampling the data points of the water-soluble fertilizer signals of each batch according to each sampling frequency to be detected, and selecting the optimal sampling frequency of each batch from the sampling frequencies to be detected according to the number of the characteristic points corresponding to each batch acquired under each sampling frequency to be detected.
According to the Nyquist theorem, a digital signal can be accurately restored to an analog signal only when the sampling frequency is higher than twice the highest frequency of the original signal, and in the embodiment of the invention, at least 2 sampling frequencies to be detected are selected on the basis of half of the reference sampling frequency f, namely the sampling frequencies to be detectedThe number and the size of the sampling frequencies to be tested can be set by an implementer according to specific conditions.
Preferably, the specific acquisition method of the preferred sampling frequency is as follows: for each batch of water-soluble fertilizer signals, sampling data points of the water-soluble fertilizer signals with each sampling frequency to be detected, and counting the total number of characteristic points in the data points obtained under each sampling frequency to be detected as a judging index of each sampling frequency to be detected; and taking the sampling frequency to be detected corresponding to the maximum judgment index as the preferable sampling frequency of the water-soluble fertilizer signal. The preferred sampling frequency can both increase the rate and reduce power consumption in the signal transmission process, and make transmission of critical signal data more timely and efficient.
It should be noted that, when the total number of feature points in the data points acquired under the sampling frequency to be detected is more, the more important concentration information is included in the data acquired under the sampling frequency to be detected, the important concentration information of the organic matters is not easy to lose when the data is acquired under the sampling frequency to be detected, and the data acquired by the water-soluble fertilizer information is more complete and accurate.
So far, the preferred sampling frequency of the water-soluble fertilizer signal of each batch is obtained.
Step S6: and acquiring information of the water-soluble fertilizer of each batch on the water-soluble fertilizer production line based on the preferred sampling frequency of each batch.
Resampling data points of the water-soluble fertilizer signals of each batch at the optimal sampling frequency of the water-soluble fertilizer signals of the batch to obtain sampling points of each batch; and compressing the sampling points of each batch by using a Huffman coding algorithm, then transmitting the concentration data according to a communication protocol, decoding the received concentration data by a PLC remote control center, and analyzing and storing the data. The grouting concentration of the grouting pump is regulated and controlled according to the real-time change of the concentration data and the environment change, the data transmission rate is improved, and the real-time performance and the data readability in the data transmission process are ensured.
The huffman coding algorithm is a well-known technique for the skilled person in the art, and will not be described here.
The present invention has been completed.
In summary, in the embodiment of the present invention, the signal stability of each type of organic matter in the water-soluble fertilizer is obtained, and the importance of each type of organic matter at the peak point of the local signal section of each batch is obtained; the method comprises the steps of obtaining the priority weight of peak points of a water-soluble fertilizer signal according to the signal stability and importance of organic matters corresponding to a local signal segment where the peak points are located, screening characteristic points in the water-soluble fertilizer signal by combining the distances between adjacent peak points of the data points, selecting the optimal sampling frequency of each batch according to the number of the characteristic points obtained under each sampling frequency to be detected, and further collecting information of the water-soluble fertilizer based on the optimal sampling frequency. According to the invention, the optimal sampling frequency is selected based on the number of important information, namely characteristic data points, acquired by the sampling frequency to be detected, so that the accuracy of information acquisition on the water-soluble fertilizer production line is improved.
It should be noted that: the sequence of the embodiments of the present invention is only for description, and does not represent the advantages and disadvantages of the embodiments. The processes depicted in the accompanying drawings do not necessarily require the particular order shown, or sequential order, to achieve desirable results. In some embodiments, multitasking and parallel processing are also possible or may be advantageous.
In this specification, each embodiment is described in a progressive manner, and identical and similar parts of each embodiment are all referred to each other, and each embodiment mainly describes differences from other embodiments.
Claims (6)
1. An information acquisition method of an intelligent water-soluble fertilizer production line is characterized by comprising the following steps:
Acquiring a spectrum signal of each batch of water-soluble fertilizer produced on a water-soluble fertilizer production line every day, and recording the spectrum signal as a water-soluble fertilizer signal of each batch; obtaining a local signal section of each type of organic matters in the water-soluble fertilizer in each batch of water-soluble fertilizer signals;
Acquiring the signal stability of each type of organic matter according to the amplitude difference between the data points of the local signal segments corresponding to any two batches of the organic matter and the discrete degree of the amplitude of the data points of the local signal segments;
combining the difference and the distance between the peak points of the local signal sections corresponding to each batch and the rest batches of each type of organic matters and the amplitude of each peak point of the local signal sections corresponding to each batch of each type of organic matters to obtain the importance of each peak point of the local signal sections corresponding to each batch of each type of organic matters;
acquiring the priority weight of each peak point of the water-soluble fertilizer signals of each batch according to the signal stability and the importance of the organic matters corresponding to the local signal section where each peak point of the water-soluble fertilizer signals of each batch is located; screening out characteristic points in the water-soluble fertilizer signals of each batch based on the distance between each data point of the water-soluble fertilizer signals of each batch and the adjacent peak point and the priority weight of the peak point;
Setting different sampling frequencies to be tested; sampling data points of water-soluble fertilizer signals of each batch according to each sampling frequency to be detected, and selecting the optimal sampling frequency of each batch from the sampling frequencies to be detected according to the number of characteristic points corresponding to each batch obtained under each sampling frequency to be detected;
information acquisition is carried out on the water-soluble fertilizer of each batch on the water-soluble fertilizer production line based on the optimal sampling frequency of each batch;
the calculation formula of the signal stability of each type of organic matter is as follows:
; wherein E is the signal stability of each type of organic matter; m is the total number of batches of the water-soluble fertilizer produced on the water-soluble fertilizer production line every day; /(I) Variance of the magnitudes of all data points of the local signal section corresponding to the a-th batch for each type of organic matter; /(I)Variance of the magnitudes of all data points of the local signal section corresponding to the b-th batch for each type of organic matter; n is the total number of data points in the local signal section corresponding to each type of organic matters; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the a-th batchThe magnitude of the data points; /(I)The first/>, for each type of organic matter, in the local signal section corresponding to the b-th batchThe magnitude of the data points; /(I)As a function of absolute value; exp is an exponential function based on a natural constant e;
The method for combining the difference and the distance between the peak value points of the local signal sections corresponding to each batch and the rest batches of each type of organic matters and the amplitude value of each peak value point of the local signal sections corresponding to each batch of each type of organic matters to obtain the importance degree of each peak value point of the local signal sections corresponding to each batch of each type of organic matters comprises the following steps:
Selecting any type of organic matters as analysis organic matters, taking a local signal section corresponding to the analysis organic matters in any batch as an analysis signal section, and taking the rest local signal sections except the analysis signal section corresponding to the analysis organic matters as target signal sections; selecting any peak point of the analysis signal section as an analysis point;
For each target signal segment, calculating the absolute value of the difference between the analysis point and the wavelength of each peak point of the target signal segment respectively, and taking the absolute value as the wavelength distance between the analysis point and each peak point of the target signal segment; taking the peak point corresponding to the minimum wavelength distance as a concern point of an analysis point in a target signal segment;
According to the wavelength difference and the amplitude difference of the analysis point and the attention point of the analysis point in each target signal segment, obtaining the characteristic distance between the analysis point and the peak point of each target signal segment;
the method comprises the steps of statistically analyzing the number of peak points of organic matters in local signal sections corresponding to each batch;
Combining the characteristic distance between the analysis point and the peak point of each target signal segment, the amplitude of the analysis point and the difference between the number of the analysis signal segments and the peak point of each target signal segment to acquire the importance of the analysis point;
The calculation formula of the importance degree of the analysis point is as follows:
，
; in the/> -Said importance for said analysis point; p is the analysis point; x is the total number of target signal segments; /(I)Analyzing the total number of extreme points of the signal segment; /(I)The total number of extreme points of the xth target signal segment; /(I)For the characteristic distance between the analysis point and the peak point of the x-th target signal segment; /(I)For the analysis point and the wavelength distance between the analysis point and the point of interest in the x-th target signal segment; /(I)The amplitude of the analysis point; /(I)An amplitude value of the point of interest in the x-th target signal segment for an analysis point; for analyzing a maximum in the magnitudes of the data points of the signal segment; a is a preset positive number; /(I) As a function of absolute value;
the method for acquiring the priority weight of each peak point of the water-soluble fertilizer signals of each batch comprises the following steps:
Taking the importance of each peak point of the water-soluble fertilizer signals of each batch as a molecule, and taking the signal stability of the local signal section corresponding to the organic matters at the peak point as a denominator to obtain a ratio as the priority weight of each peak point of the water-soluble fertilizer signals of each batch.
2. The method for collecting information on an intelligent water-soluble fertilizer production line according to claim 1, wherein the method for screening out characteristic points in water-soluble fertilizer signals of each batch comprises the following steps:
Selecting any one data point except the first data point and the last data point of any batch of water-soluble fertilizer signals as a point to be analyzed, judging whether the priority weight of the adjacent previous peak point of the point to be analyzed is smaller than the priority weight of the adjacent next peak point of the point to be analyzed, and if so, taking the absolute value of the difference value between the wavelengths of the point to be analyzed and the adjacent previous peak point as the wavelength difference degree of the point to be analyzed; if not, taking the absolute value of the difference value between the wavelengths of the point to be analyzed and the next peak value point adjacent to the point to be analyzed as the wavelength difference degree of the point to be analyzed;
According to the wavelength difference degree of the point to be analyzed and the difference between the priority weights of the adjacent peak points of the point to be analyzed, acquiring the priority degree of the point to be analyzed;
And regarding the data points of the water-soluble fertilizer signals of each batch, taking the data points with the priority higher than a preset priority threshold value as the characteristic points in the water-soluble fertilizer signals of each batch.
3. The information acquisition method of the intelligent water-soluble fertilizer production line according to claim 2, wherein the calculation formula of the priority of the points to be analyzed is as follows:
; in the/> The priority of the point to be analyzed; s is the point to be analyzed; /(I)The wavelength difference degree is the wavelength difference degree of the point to be analyzed; /(I)The priority weight of the adjacent previous peak point of the point to be analyzed; /(I)The priority weight of the next adjacent peak point of the point to be analyzed; /(I)A peak point adjacent to the previous point to be analyzed; /(I)A peak point next to the point to be analyzed; /(I)The absolute value of the difference between the wavelengths of the adjacent previous peak point and the adjacent next peak point of the point to be analyzed; /(I)As a function of absolute value; norms are normalization functions.
4. The method for collecting information on an intelligent water-soluble fertilizer production line according to claim 1, wherein the method for selecting the preferred sampling frequency of each batch from the sampling frequencies to be tested comprises the following steps:
For each batch of water-soluble fertilizer signals, sampling data points of the water-soluble fertilizer signals with each sampling frequency to be detected, and counting the total number of the characteristic points in the data points obtained under each sampling frequency to be detected as a judging index of each sampling frequency to be detected;
and taking the sampling frequency to be detected corresponding to the maximum judgment index as the optimal sampling frequency of the water-soluble fertilizer signal.
5. The information acquisition method of an intelligent water-soluble fertilizer production line according to claim 1, wherein the preset positive number is 0.1.
6. The information acquisition method of the intelligent water-soluble fertilizer production line according to claim 2, wherein the preset priority threshold is 0.6.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202410411075.2A CN118013258B (en) | 2024-04-08 | 2024-04-08 | Information acquisition method of intelligent water-soluble fertilizer production line |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202410411075.2A CN118013258B (en) | 2024-04-08 | 2024-04-08 | Information acquisition method of intelligent water-soluble fertilizer production line |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CN118013258A CN118013258A (en) | 2024-05-10 |
| CN118013258B true CN118013258B (en) | 2024-06-14 |
Family
ID=90954945
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN202410411075.2A Active CN118013258B (en) | 2024-04-08 | 2024-04-08 | Information acquisition method of intelligent water-soluble fertilizer production line |
Country Status (1)
| Country | Link |
|---|---|
| CN (1) | CN118013258B (en) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN118348891B (en) * | 2024-06-06 | 2024-10-29 | 杭州吉越智能科技有限公司 | Intelligent conference centralized control method and system based on information enhancement |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN114971259A (en) * | 2022-05-20 | 2022-08-30 | 中国海洋大学 | Method for analyzing quality consistency of formula product by using near infrared spectrum |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10539540B2 (en) * | 2016-06-10 | 2020-01-21 | Hitachi High-Tech Science Corporation | Liquid chromatograph and method for correcting detector output value fluctuation of liquid chromatograph |
| KR102587823B1 (en) * | 2021-03-30 | 2023-10-10 | 한밭대학교 산학협력단 | Stability analysis method of organic semiconductor using electrochemical spectroscopy and system therefor |
| CN114199777A (en) * | 2021-11-02 | 2022-03-18 | 华中科技大学 | Photoacoustic spectrum gas concentration detection system modulated by nonlinear scanning wavelength |
| CN115046942A (en) * | 2022-07-05 | 2022-09-13 | 同济大学 | Liquid organic matter identification method and system, storage medium and terminal |
| CN115372309A (en) * | 2022-08-17 | 2022-11-22 | 中国计量科学研究院 | Associated effective characteristic spectrum selection method and oil product index content quick detection method |
| CN115479905B (en) * | 2022-11-11 | 2023-03-14 | 季华实验室 | Spectral analysis method, spectral analysis device, terminal equipment and medium |
| CN116625978A (en) * | 2023-03-30 | 2023-08-22 | 青岛啤酒股份有限公司 | Method for rapidly evaluating stability of raw material wheat making process and application thereof |
| CN116738153B (en) * | 2023-08-15 | 2023-10-17 | 中国科学院东北地理与农业生态研究所 | Organic fertilizer utilization effect evaluation method based on spectral analysis |
| CN117309831A (en) * | 2023-09-25 | 2023-12-29 | 浙江清华长三角研究院 | Pollution tracing method for river channel organic matters based on three-dimensional fluorescent LPP-SVM |
-
2024
- 2024-04-08 CN CN202410411075.2A patent/CN118013258B/en active Active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN114971259A (en) * | 2022-05-20 | 2022-08-30 | 中国海洋大学 | Method for analyzing quality consistency of formula product by using near infrared spectrum |
Non-Patent Citations (1)
| Title |
|---|
| 千瓦级微波等离子炬-原子发射光谱(MPT-AES)在油液分析中的应用;鄢雨微;金伟;朱旦;张涛;应仰威;单锦;张旭晨;于丙文;陈挺;刘超;金钦汉;;高等学校化学学报;20181210(第12期);第51-57页 * |
Also Published As
| Publication number | Publication date |
|---|---|
| CN118013258A (en) | 2024-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN118013258B (en) | Information acquisition method of intelligent water-soluble fertilizer production line | |
| Steffen et al. | A comparison of data quality control protocols for atmospheric mercury speciation measurements | |
| CN103234922A (en) | Rapid soil organic matter detection method based on large sample soil visible-near infrared spectrum classification | |
| CN106918567B (en) | A kind of method and apparatus measuring trace metal ion concentration | |
| CN112345759B (en) | Method for detecting fluorescence intensity peak | |
| CN102636454A (en) | Method for quickly measuring content of low carbon number fatty acid in edible oil by near infrared spectrum | |
| CN101825567A (en) | Screening method for near infrared spectrum wavelength and Raman spectrum wavelength | |
| CN107247033B (en) | Identify the method for Huanghua Pear maturity based on rapid decay formula life cycle algorithm and PLSDA | |
| CN105044024A (en) | Method for nondestructive testing of grape berries based on near infrared spectrum technology | |
| CN111693487A (en) | Fruit sugar degree detection method and system based on genetic algorithm and extreme learning machine | |
| CN112098357A (en) | Strawberry sensory quality grade evaluation method based on near infrared spectrum | |
| CN117990628B (en) | Intelligent water quality monitoring method and system based on internet traffic (IoT) | |
| CN117112514A (en) | Recording and storing method based on p-chloromethyl styrene production data | |
| CN111257452A (en) | Method for detecting synthetic acetic acid added in Zhenjiang aromatic vinegar | |
| CN117129466A (en) | Water content detection method for hydraulic engineering material | |
| CN117589697A (en) | Detection method for pH value of plant soil | |
| CN111401794A (en) | Feed quality control method based on near infrared spectrum | |
| CN116307242A (en) | Construction method of larch site quality and productivity model | |
| CN113984708B (en) | Maintenance method and device for chemical index detection model | |
| CN115619022A (en) | Coke quality prediction method based on support vector machine and application thereof | |
| CN114018861B (en) | Spectral reconstruction method based on characteristic peaks | |
| CN101650306A (en) | Method for quickly testing and analyzing quality of sericite | |
| CN104181125A (en) | Method for rapidly determining Kol-bach value of beer malt | |
| CN115078327A (en) | Rapid detection method for dangerous chemicals based on neural network architecture search | |
| CN117250183B (en) | Gas component analysis method, apparatus, device, and storage medium |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PB01 | Publication | ||
| PB01 | Publication | ||
| SE01 | Entry into force of request for substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| GR01 | Patent grant | ||
| GR01 | Patent grant |