CN117787728B - Coal mine roadway gas explosion risk level evaluation method based on visualization - Google Patents
Coal mine roadway gas explosion risk level evaluation method based on visualization Download PDFInfo
- Publication number
- CN117787728B CN117787728B CN202410211557.3A CN202410211557A CN117787728B CN 117787728 B CN117787728 B CN 117787728B CN 202410211557 A CN202410211557 A CN 202410211557A CN 117787728 B CN117787728 B CN 117787728B
- Authority
- CN
- China
- Prior art keywords
- monitoring
- gas
- monitoring area
- area
- drainage
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000004880 explosion Methods 0.000 title claims abstract description 149
- 239000003245 coal Substances 0.000 title claims abstract description 46
- 238000011156 evaluation Methods 0.000 title claims abstract description 46
- 238000012800 visualization Methods 0.000 title description 6
- 238000012544 monitoring process Methods 0.000 claims abstract description 353
- 238000012795 verification Methods 0.000 claims abstract description 84
- 238000010586 diagram Methods 0.000 claims abstract description 13
- 238000000547 structure data Methods 0.000 claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 claims abstract description 5
- 230000000007 visual effect Effects 0.000 claims abstract 8
- 239000007789 gas Substances 0.000 claims description 279
- 230000007613 environmental effect Effects 0.000 claims description 87
- 238000009825 accumulation Methods 0.000 claims description 36
- 239000002817 coal dust Substances 0.000 claims description 33
- 238000009423 ventilation Methods 0.000 claims description 26
- 238000012937 correction Methods 0.000 claims description 14
- 230000008859 change Effects 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- 238000012216 screening Methods 0.000 claims description 9
- 238000004364 calculation method Methods 0.000 claims description 8
- 238000000605 extraction Methods 0.000 claims description 7
- 101100272279 Beauveria bassiana Beas gene Proteins 0.000 claims description 4
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 238000012790 confirmation Methods 0.000 claims description 3
- 230000003993 interaction Effects 0.000 claims description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 230000007547 defect Effects 0.000 abstract description 8
- 238000012502 risk assessment Methods 0.000 abstract description 3
- 238000005192 partition Methods 0.000 abstract 1
- 238000004458 analytical method Methods 0.000 description 11
- 230000002265 prevention Effects 0.000 description 6
- 230000005856 abnormality Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 101100390768 Neisseria gonorrhoeae (strain ATCC 700825 / FA 1090) fitA gene Proteins 0.000 description 2
- 230000003872 anastomosis Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
Landscapes
- Testing Or Calibration Of Command Recording Devices (AREA)
Abstract
The invention belongs to the technical field of roadway risk analysis, and particularly discloses a visual-based coal mine roadway gas explosion risk level evaluation method, which comprises the following steps: carrying out coal mine roadway partition, and monitoring roadway structure data, operation data and environment data of each monitoring area; analyzing the predicted gas explosion risk level of each monitoring area; carrying out prediction risk accuracy verification through explosion risk verification rules; confirming the gas explosion risk level, manufacturing the gas explosion risk level into a risk prompt tag, and adding the risk prompt tag into a structure layout diagram of a target coal mine roadway to display risks. The invention effectively solves the problem of insufficient accuracy and reliability of the current roadway explosion risk evaluation, fully combines the structural state and the environment running state of the roadway, makes up the defect that the current consideration elements are more conventional and single, and further remarkably improves the reliability of the coal mine roadway gas explosion risk level evaluation result.
Description
Technical Field
The invention belongs to the technical field of roadway risk analysis, and relates to a coal mine roadway gas explosion risk level evaluation method based on visualization.
Background
The gas accumulated in the coal mine tunnel, once reaching the explosive concentration range, may cause explosion due to the existence of ignition points. The gas explosion is the most serious accident in coal mine, and can cause serious consequences such as casualties, equipment damage, production interruption and the like. Therefore, it is an important part of ensuring safe operation of mines to perform gas explosion hazard level evaluation.
At present, the coal mine roadway gas explosion risk level is evaluated mainly according to the gas emission quantity, the temperature, ventilation and the like, and is predicted and evaluated according to historical data and experience summary, and obviously, the current coal mine roadway gas explosion risk level evaluation has the following defects: 1. the evaluation accuracy is insufficient, the explosion risk level is evaluated mainly according to basic parameters such as gas concentration, the comprehensive evaluation is performed without combining with the structure of a roadway, and the reliability of the coal mine roadway gas explosion risk level evaluation result cannot be improved due to the fact that the consideration elements are more conventional and single.
2. The evaluation reliability is insufficient, the working efficiency and the like of an environment regulation terminal in a coal mine roadway are not analyzed at present mainly according to the coal mine gas environment, namely, comprehensive danger evaluation is carried out without combining environment abnormality and processing capacity under danger, so that certain deviation exists in rationality and effectiveness of dangerous alarm setting, and further the feasibility and sufficiency of coal mine roadway gas explosion prevention cannot be improved.
3. The evaluation timeliness is insufficient, the risk evaluation is currently mainly carried out based on key parameters such as the gas concentration in a monitoring period, and the analysis of the coal seam aggregation regularity is not carried out, so that the evaluation result possibly cannot accurately reflect the actual risk, the evaluation timeliness and practicality are reduced, the accuracy of gas explosion prediction is difficult to ensure, and the timeliness and pertinence of the subsequent coal mine roadway gas guarantee prevention cannot be improved.
Disclosure of Invention
In view of this, in order to solve the problems set forth in the background art, a coal mine roadway gas explosion risk level evaluation method based on visualization is now proposed.
The aim of the invention can be achieved by the following technical scheme: the invention provides a coal mine roadway gas explosion risk level evaluation method based on visualization, which comprises the following steps: a1, monitoring coal mine roadway areas: and extracting a structural layout diagram of the target coal mine tunnel from the coal mine monitoring platform, extracting the position of each gas drainage passage opening from the structural layout diagram, dividing the target tunnel into monitoring areas according to the structural layout diagram, and monitoring tunnel structural data, operation data and environment data of the monitoring areas.
A2, evaluating roadway explosion risk: and extracting the average value of the corresponding environmental monitoring indexes of the current monitoring time point from the environmental data of each monitoring area, and analyzing the predicted gas explosion risk level of each monitoring area.
A3, roadway explosion risk verification: and carrying out prediction risk accuracy verification through an explosion risk verification rule, and outputting verification results of all monitoring areas, wherein the verification results are one of consistent and inconsistent.
A4, roadway explosion risk confirmation: marking the monitoring area with the inconsistent verification result as a correction area, confirming the corrected gas explosion risk level of the correction area, and confirming the gas explosion risk level of the correction area, wherein when the verification result of a certain monitoring area is consistent, the predicted gas explosion risk level of the monitoring area is used as the confirmed gas explosion risk level.
A5, roadway explosion risk display: and manufacturing the confirmed gas explosion risk level of each monitoring area as a risk prompt tag, and adding the risk prompt tag into the structural layout diagram so as to display the risk.
Preferably, said analyzing the predicted gas explosion hazard level for each monitored area comprises: comparing the average value of the environmental monitoring indexes of each monitoring area at the current monitoring time point with the set dangerous value interval of each environmental monitoring index, and marking the environmental monitoring index as a risk environmental index if the average value of one environmental monitoring index is positioned in the set dangerous value interval of the environmental monitoring index.
Counting the number of current risk environment indexes of each monitoring area, and recording asAnd the number of the environmental monitoring indexes is recorded as。
Setting the corresponding environmental deviation interference weight factors of each monitoring area, and recording as，/>Indicating the number of the monitored area,。
Extracting explosion risk association weight factors corresponding to various risk environment indexes of various monitoring areas from a database, and marking the explosion risk association weight factors as，/>Number of index representing risk environment,/>。
Counting the trend degree of the corresponding gas explosion risk of each monitoring area，/>，Representing a downward rounding symbol,/>And setting a reference explosion risk association weight factor and an environment deviation interference weight factor respectively.
Will beAnd carrying out matching comparison with a defined gas explosion risk trend interval corresponding to the set gas explosion risk levels to obtain the matched gas explosion risk level corresponding to each monitoring area, and using the matched gas explosion risk level as the predicted gas explosion risk level.
Preferably, the setting the environmental bias interference weight factor corresponding to each monitoring area includes: comparing the average value of the environmental monitoring indexes corresponding to the current monitoring time point of each monitoring area with the set proper value interval of each environmental monitoring index, counting the numerical value difference of the environmental monitoring indexes corresponding to each monitoring area, and recording as，/>Indicating the number of environmental monitoring indexes,/>。
Will beAs the corresponding environmental deviation interference weight factor/>, of each monitoring area，/>To set/>And the early warning numerical value of each environment monitoring index is different.
Preferably, the setting manner of the explosion risk verification rule is as follows: and positioning the set drainage flow, the initial drainage time point and the end drainage time point in each gas drainage process from the operation data of each monitoring area.
Locating the gas concentration and the air flow velocity of each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the gas drainage efficiency coincidence degree of each monitoring area。
Extracting the area of each roadway surface and the crack data of each roadway surface from the roadway structure data of each monitoring area, and counting the gas accumulation risk degree of each monitoring area。
Locating the concentration of coal dust monitored by each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the ventilation coincidence degree of each monitoring area。
The gas drainage efficiency matching degree is smaller than the set gas drainage efficiency matching degreeAs verification condition 1.
Setting the gas accumulation risk degree to be greater than or equal to the set gas accumulation risk degreeAs verification condition 2.
The ventilation fit is smaller than the set ventilation fitAs verification condition 3, verification condition 1, verification condition 2, and verification condition 3 are further formed into an explosion risk verification rule.
Preferably, the performing prediction risk accuracy verification includes: will be、/>And/>And (3) importing the gas drainage efficiency consistency degree of a certain monitoring area into an explosion risk verification rule, and taking the non-consistency degree as a verification result of the monitoring area if the gas drainage efficiency consistency degree of the monitoring area accords with the verification condition 1.
If the gas drainage efficiency coincidence degree of a certain monitoring area does not accord with the verification condition 1, judging whether the gas accumulation risk degree of the monitoring area accords with the verification condition 2.
And if so, taking the non-coincidence as a verification result of the monitoring area, and if not, judging whether the ventilation coincidence degree of the monitoring area accords with the verification condition 3.
And when the judgment result is negative, the consistency is used as the verification result of the monitoring area, and the prediction risk accuracy verification is sequentially carried out on each monitoring area.
Preferably, the statistics of the gas drainage efficiency fitness of each monitoring area includes: and screening the highest monitored gas concentration and highest air flow rate of each monitoring time point from the gas concentration and air flow rate monitored by each monitoring time point corresponding to each monitoring point.
And calculating the actual drainage gas flow of each monitoring area corresponding to each gas drainage according to a gas drainage calculation formula based on the initial drainage time point and the end drainage time point of each monitoring area corresponding to each gas drainage.
The actual drainage gas flow and the set drainage gas flow of each monitoring area corresponding to each gas drainage are respectively recorded asAnd/>，/>Indicates the gas drainage sequence number,/>。
Setting the gas drainage efficiency evaluation error factors of all the monitoring areas asStatistics of the gas drainage efficiency coincidence degree/>, of each monitoring area，/>，/>Draw gas flow difference for set reference,/>The gas drainage times are obtained.
Preferably, the setting the gas drainage efficiency evaluation error factor of each monitoring area includes: and recording the difference between the set drainage gas flow and the actual drainage gas flow as the drainage gas flow difference.
Taking the gas drainage order as an abscissa and the drainage gas flow difference as an ordinate, constructing a gas drainage change curve of each monitoring area, extracting the slope and the amplitude from the gas drainage change curve, and respectively marking asAnd/>。
Will beError factor/>, as gas drainage performance evaluation error factor for each monitoring area，/>The extraction change rate and the extraction gas flow extreme value difference of the set reference are respectively set.
Preferably, the counting the risk of gas accumulation in each monitoring area includes: the area of each monitoring area corresponding to each roadway surface is recorded as，/>Represent lane number,/>。
Locating the area and depth of each crack from the crack data of each monitoring area corresponding to each roadway surface, and summing the areas of each crack to obtain the crack area and depth of each monitoring area corresponding to each roadway surface。
Locating the maximum crack depth from the depths of the cracks in the areas of each roadway corresponding to each monitoring areaMeanwhile, the average crack depth/>, corresponding to each roadway surface, of each monitoring area is obtained through mean value calculation。
Will beAs the gas accumulation risk degree of each monitoring area corresponding to each roadway surface, and screening the maximum value from the gas accumulation risk degree as the gas accumulation risk degree/>, of each monitoring area，/>The interference crack depth and the risk crack depth difference of the set reference are respectively.
Preferably, the counting the ventilation coincidence degree of each monitoring area includes: taking the monitoring time point as an abscissa and the coal dust concentration as an ordinate, constructing a coal dust concentration change curve of each monitoring area corresponding to each monitoring point, extracting the slope, and recording as，/>Representing the number of the monitoring point,/>。
Carrying out interaction difference on the coal dust concentration of each monitoring point corresponding to each monitoring area at the same monitoring time point to obtain the coal dust concentration difference of each monitoring point corresponding to each monitoring area at each monitoring time point, and screening out the maximum coal dust concentration difference of each monitoring area at each monitoring time point，/>Indicates the monitoring time point number,/>。
Counting the consistency of the coal dust state of each monitoring area，，/>、/>The coal dust increase rate and the coal dust concentration difference of the set reference are respectively/>For monitoring the number of points,/>To monitor the number of time points.
According toThe statistics mode of the system is that the gas concentration state coincidence degree/>, of each monitoring area is counted in the same wayWill/>Ventilation compliance/>, as each monitored area。
Preferably, the confirming the corrected gas explosion hazard level of the corrected region includes: extracting the gas drainage efficiency coincidence degree, gas accumulation risk degree and ventilation coincidence degree of the corrected region and respectively marking as、/>And/>。
Statistics of the degree of deviation of the environmental state of the corrected region，/>。
The predicted gas explosion risk level of the corrected area is recorded asAnd will/>As a correction area for correcting the gas explosion hazard level,/>Corresponding compensation danger level for unit environment state deviation degree,/>Representing rounding up symbols.
Compared with the prior art, the invention has the following beneficial effects: (1) According to the invention, the gas explosion risk level prediction analysis is carried out according to the environmental data of each monitoring area, and the roadway explosion risk verification is carried out by combining the structural data, the operation data and the environmental data of each monitoring area, so that the problem that the current roadway explosion risk evaluation accuracy and reliability are insufficient is effectively solved, the structural state and the environmental operation state of the roadway are fully combined, the defect that the current consideration elements are more conventional and single is overcome, and the reliability of the coal mine roadway gas explosion risk level evaluation result is remarkably improved.
(2) According to the invention, the predicted gas explosion risk level of each monitoring area is confirmed by setting the environmental deviation interference weight factor corresponding to each monitoring area and the explosion risk association weight factor of each environmental monitoring index, so that the defect that only the environmental index contrast type analysis is currently carried out is avoided, the detailed analysis of the gas explosion risk level corresponding to each monitoring area is realized, and the reality and normalization of the gas explosion risk level prediction are further improved.
(3) When the roadway explosion risk verification is carried out, the comprehensive risk assessment of the environment abnormality and the processing capacity under the danger is realized by carrying out the gas drainage efficiency fitness analysis, so that the rationality and the effectiveness of the subsequent danger alarm setting are ensured, and the feasibility and the sufficiency of the subsequent coal mine roadway gas explosion prevention are also improved.
(4) When the roadway explosion risk verification is carried out, the gas concentration and the dust concentration at different time points and different monitoring points are analyzed, so that the gas accumulation risk degree and the ventilation coincidence degree are counted, the defect of the current evaluation on the timeliness level is broken, the gas and coal dust accumulation regularity analysis is realized, the evaluation result is ensured to reflect the actual risk as accurately as possible, the timeliness and the practicability of the evaluation are improved, the accuracy of gas explosion prediction is also ensured, and the timeliness and the pertinence of the subsequent coal mine roadway gas guarantee prevention are further improved.
Drawings
In order to more clearly illustrate the technical solutions of the embodiments of the present invention, the drawings that are needed for the description of the embodiments will be briefly described below, and it is obvious that the drawings in the following description are only some embodiments of the present invention, and that other drawings may be obtained according to these drawings without inventive effort for a person skilled in the art.
FIG. 1 is a flow chart of the steps of the method of the present invention.
Detailed Description
The following description of the embodiments of the present invention will be made clearly and completely with reference to the accompanying drawings, in which it is apparent that the embodiments described are only some embodiments of the present invention, but not all embodiments. All other embodiments, which can be made by those skilled in the art based on the embodiments of the invention without making any inventive effort, are intended to be within the scope of the invention.
Referring to fig. 1, the invention provides a coal mine roadway gas explosion risk level evaluation method based on visualization, which comprises the following steps: a1, monitoring coal mine roadway areas: and extracting a structural layout diagram of the target coal mine tunnel from the coal mine monitoring platform, extracting the position of each gas drainage passage opening from the structural layout diagram, dividing the target tunnel into monitoring areas according to the structural layout diagram, and monitoring tunnel structural data, operation data and environment data of the monitoring areas.
Specifically, the roadway structure data includes, but is not limited to, the area of each roadway surface and the crack data of each roadway surface, wherein the crack data is the area and depth of each crack.
Specifically, the operation data includes, but is not limited to, a set drainage flow rate, a start drainage time point and an end drainage time point at each gas drainage.
More specifically, the environmental data includes, but is not limited to, values of respective environmental monitoring indicators corresponding to respective monitoring points at respective monitoring points in time, wherein the environmental monitoring indicators include, but are not limited to, temperature, humidity, gas concentration, wind speed, oxygen content, nitrogen dioxide content, and coal dust concentration.
It is to be added that roadway structure data can be monitored through a laser scanner, operation data are obtained through extraction from a monitoring background of gas drainage equipment, wherein the gas drainage equipment specifically comprises a drainage port, a drainage channel and a drainage fan, environment monitoring data can be monitored by various sensors arranged in a roadway, such as temperature is monitored by a temperature sensor, humidity is monitored by a humidity sensor, wind speed is monitored by a wind speed sensor, gas concentration, oxygen content and nitrogen dioxide content are obtained by monitoring by a gas sensor, and coal dust concentration is obtained by monitoring by a dust sensor.
A2, evaluating roadway explosion risk: and extracting the average value of the corresponding environmental monitoring indexes of the current monitoring time point from the environmental data of each monitoring area, and analyzing the predicted gas explosion risk level of each monitoring area.
Illustratively, analyzing the predicted gas explosion hazard level for each monitored area includes: a21, comparing the average value of each environmental monitoring index of each monitoring area at the current monitoring time point with the set dangerous value interval of each environmental monitoring index, and marking the environmental monitoring index as a risk environmental index if the average value of a certain environmental monitoring index is positioned in the set dangerous value interval of the environmental monitoring index.
A22, counting the number of current risk environment indexes of each monitoring area, and recording asAnd the number of environmental monitoring indexes is recorded as/>。
A23, setting the corresponding environmental deviation interference weight factors of each monitoring area, and marking as，/>Indicating the number of the monitored area,。
Further, setting the environmental deviation interference weight factor corresponding to each monitoring area, including: d1, comparing the average value of the environment monitoring indexes corresponding to the current monitoring time point of each monitoring area with the set proper value interval of the environment monitoring indexes, counting the numerical value difference of the environment monitoring indexes corresponding to each monitoring area, and recording as，/>Indicating the number of environmental monitoring indexes,/>。
It is to be added that, the numerical value difference of each monitoring area corresponding to each environment monitoring index is counted, including: if the average value of the environmental monitoring index is larger than the upper limit value of the interval of the corresponding set proper value of the environmental monitoring index, the upper limit value is recorded as a comparison value, and the difference value between the average value of the environmental monitoring index and the comparison value is calculated to obtain the numerical value difference of the environmental monitoring index.
And if the average value of the environmental monitoring index is positioned in the range of the corresponding set proper value of the environmental monitoring index, taking 0 as the numerical value difference of the environmental monitoring index.
If the average value of the environmental monitoring index is smaller than the lower limit value of the interval of the corresponding set proper value of the environmental monitoring index, the lower limit value is recorded as a comparison value, and the comparison value of the environmental monitoring index and the average value are subjected to average value calculation to obtain the numerical value difference of the environmental monitoring index, so that the numerical value difference of the environmental monitoring index corresponding to each monitoring area is obtained.
D2, willAs the corresponding environmental deviation interference weight factor/>, of each monitoring area，/>To set/>And the early warning numerical value of each environment monitoring index is different.
A24, extracting explosion risk association weight factors corresponding to the risk environment indexes of each monitoring area from the database, and marking the explosion risk association weight factors as，/>Number of index representing risk environment,/>。
A25, counting trend degree of gas explosion risk corresponding to each monitoring area，，/>Representing a downward rounding symbol,/>And setting a reference explosion risk association weight factor and an environment deviation interference weight factor respectively.
In one embodiment of the present invention, in one embodiment,The values can be respectively 0.3 and 0.4.
In another embodiment, a monitoring area includes a plurality of risk environmental indicators, wherein a probability value of explosion caused by an overproof concentration of a certain risk environmental indicator is used as an explosion risk association weight factor of the risk environmental indicator in the monitoring area.
A26 will beAnd carrying out matching comparison with a defined gas explosion risk trend interval corresponding to the set gas explosion risk levels to obtain the matched gas explosion risk level corresponding to each monitoring area, and using the matched gas explosion risk level as the predicted gas explosion risk level.
According to the embodiment of the invention, the predicted gas explosion risk level of each monitoring area is confirmed by setting the environmental deviation interference weight factor corresponding to each monitoring area and the explosion risk association weight factor of each environmental monitoring index, so that the defect that only the environmental index contrast type analysis is currently carried out is avoided, the detailed analysis of the gas explosion risk level corresponding to each monitoring area is realized, and the reality and standardization of the gas explosion risk level prediction are further improved.
A3, roadway explosion risk verification: and carrying out prediction risk accuracy verification through an explosion risk verification rule, and outputting verification results of all monitoring areas, wherein the verification results are one of consistent and inconsistent.
Illustratively, the explosion risk verification rule is set as follows: u1, locating the set drainage flow, the initial drainage time point and the end drainage time point in each gas drainage from the operation data of each monitoring area.
U2, locating the gas concentration and the air flow velocity of each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the gas drainage efficiency coincidence degree of each monitoring area。
Understandably, the statistics of the gas drainage efficiency fitness of each monitoring area includes: and U21, screening the highest monitored gas concentration and the highest air flow rate of each monitoring time point from the gas concentration and the air flow rate monitored by each monitoring time point corresponding to each monitoring point.
And U22, calculating to obtain the actual gas drainage flow of each monitoring area corresponding to each gas drainage based on the initial drainage time point and the end drainage time point of each monitoring area corresponding to each gas drainage.
It should be noted that, the specific statistical process of the actual drainage flow rate during each gas drainage is as follows: u221, locating the cross section area of the gas drainage channel corresponding to each monitoring area from the roadway structure data of each monitoring area.
U222, respectively marking the initial drainage time point and the final drainage time point of the first gas drainage asAnd/>。
U223, if a certain monitoring time point is locatedThe next monitoring time point before and at this monitoring time point is located at/>And then taking the monitoring time point as an initial reference monitoring time point of the first gas drainage.
U224, if a certain monitoring time point is locatedThereafter and the last monitoring time point of the monitoring time point is at/>Previously, the monitoring time point is taken as the ending reference monitoring time point of the first gas drainage.
And U225, performing difference between the highest monitored gas concentration at the ending reference monitoring time point of the first gas drainage and the highest gas concentration at the starting reference monitoring time point, and taking the difference value as the drainage gas concentration of the first gas drainage.
And U226, carrying out average value calculation on the highest air flow rate corresponding to the initial reference monitoring time point and the ending reference monitoring time point of the first gas drainage, and taking the highest air flow rate as the reference air flow rate of the first gas drainage.
U227, the reference air flow rate of the first gas drainage, the cross section area of the gas drainage channel and the drainage gas concentration are led into a gas drainage calculation formula, and the drainage flow of the first gas drainage is output and recorded as the actual drainage flow.
And U228, sequentially calculating the actual drainage flow of other gas drainage according to the calculation mode of the actual drainage flow of the first gas drainage, so as to obtain the actual drainage flow of each monitoring area corresponding to each gas drainage.
In one embodiment, the drainage gas flow = roadway cross-sectional area x gas flow rate x gas concentration.
U23 respectively marking the actual drainage gas flow and the set drainage gas flow of each monitoring area corresponding to each gas drainage asAnd/>，/>Indicates the gas drainage sequence number,/>。
U24, setting the gas drainage efficiency evaluation error factors of all the monitoring areas, and recording asStatistics of the gas drainage efficiency coincidence degree/>, of each monitoring area，/>，/>Draw gas flow difference for set reference,/>The gas drainage times are obtained.
Further, setting a gas drainage efficiency evaluation error factor of each monitoring area includes: and U241, recording the difference value between the set drainage gas flow and the actual drainage gas flow as the drainage gas flow difference.
U242, taking the gas drainage order as an abscissa and the drainage gas flow difference as an ordinate, constructing a gas drainage change curve of each monitoring area, extracting the slope and the amplitude from the gas drainage change curve, and respectively recording asAnd/>。
U243 willError factor/>, as gas drainage performance evaluation error factor for each monitoring area，/>The extraction change rate and the extraction gas flow extreme value difference of the set reference are respectively set.
When the roadway explosion risk verification is carried out, the comprehensive danger assessment of the environment abnormality and the processing capacity under the danger is realized by carrying out the gas drainage efficiency fitness analysis, so that the rationality and the effectiveness of the subsequent danger alarm setting are ensured, and the feasibility and the sufficiency of the subsequent coal mine roadway gas explosion prevention are also improved.
U3, extracting the area of each roadway surface and the crack data of each roadway surface from the roadway structure data of each monitoring area, and counting the gas accumulation risk degree of each monitoring area。
Understandably, counting the risk of gas accumulation in each monitored area includes: u31, the area of each monitoring area corresponding to each roadway surface is recorded as，/>Represent lane number,/>。
In one embodiment of the present invention, in one embodiment,The value can be specifically 4.
U32, locating the area and depth of each crack from the crack data corresponding to each roadway surface in each monitoring area, and summing the areas of each crack to obtain the crack area and depth of each roadway surface corresponding to each monitoring area。
U33, locating the maximum crack depth from the depths of the cracks in the areas of the roadways corresponding to the monitoring areasMeanwhile, the average crack depth/>, corresponding to each roadway surface, of each monitoring area is obtained through mean value calculation。
U34 is toAs the gas accumulation risk degree of each monitoring area corresponding to each roadway surface, and screening the maximum value from the gas accumulation risk degree as the gas accumulation risk degree/>, of each monitoring area，/>The interference crack depth and the risk crack depth difference of the set reference are respectively.
It is added that the existence of tunnel cracks can increase the migration passage of gas in the mine. Gas may enter the roadway through the roadway cracks and propagate along the cracks to other areas. This may lead to an increased range of gas accumulation, increasing the risk of mine gas explosion, while tunnel cracking may also lead to gas accumulation in the coal seam. When cracks or faults exist in the coal bed around the roadway, gas can leak from the coal bed into the roadway, and coal bed accumulation is formed. This increases the extent of gas accumulation in the mine and increases the risk of explosion accidents.
U4, locating the coal dust concentration monitored by each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the ventilation coincidence degree of each monitoring area。
Understandably, counting ventilation fitness of each monitoring area includes: u41, taking the monitoring time point as an abscissa and the coal dust concentration as an ordinate, constructing a coal dust concentration change curve of each monitoring area corresponding to each monitoring point, extracting the slope, and recording as，/>Representing the number of the monitoring point,/>。
The step of extracting the slope from the curve refers to extracting the slope of the regression line corresponding to the curve.
U42, carrying out interaction difference on the coal dust concentration of each monitoring area corresponding to each monitoring point at the same monitoring time point to obtain the coal dust concentration difference of each monitoring area corresponding to each monitoring point at each monitoring time point, and screening out the maximum coal dust concentration difference of each monitoring area at each monitoring time point，/>Indicates the monitoring time point number,/>。
U43, statistics of the consistency of the coal dust state of each monitoring area，，/>、/>The coal dust increase rate and the coal dust concentration difference of the set reference are respectively/>For monitoring the number of points,/>To monitor the number of time points.
U44 according toThe statistics mode of the system is that the gas concentration state coincidence degree/>, of each monitoring area is counted in the same wayWill beVentilation compliance/>, as each monitored area。
When the roadway explosion risk verification is carried out, the gas concentration and the dust concentration at different time points and different monitoring points are analyzed, so that the gas accumulation risk degree and the ventilation fitness are counted, the defect of the current evaluation on the timeliness level is overcome, the analysis of the gas and coal dust accumulation regularity is realized, the evaluation result is ensured to reflect the actual risk as accurately as possible, the timeliness and the practicability of the evaluation are improved, the accuracy of gas explosion prediction is also ensured, and the timeliness and pertinence of the subsequent coal mine roadway gas guarantee prevention are further improved.
It is necessary to supplement that the ventilation system aims to maintain a good state of air quality in the mine by delivering fresh air and exhausting gas and coal dust. However, if the ventilation state is abnormal, it tends to cause accumulation of gas and soot and dispersion variation to be large.
U5, setting the gas drainage efficiency anastomosis degree smaller than the set gas drainage efficiency anastomosis degreeAs verification condition 1.
U6, setting the gas accumulation risk degree to be greater than or equal to the set gas accumulation risk degreeAs verification condition 2.
U7, the ventilation fit is smaller than the set ventilation fitAs verification condition 3, verification condition 1, verification condition 2, and verification condition 3 are further formed into an explosion risk verification rule.
Still another exemplary, performing prediction risk accuracy verification includes: l1, will、/>And/>And (3) importing the gas drainage efficiency consistency degree of a certain monitoring area into an explosion risk verification rule, and taking the non-consistency degree as a verification result of the monitoring area if the gas drainage efficiency consistency degree of the monitoring area accords with the verification condition 1.
And L2, if the gas drainage efficiency coincidence degree of a certain monitoring area does not accord with the verification condition 1, judging whether the gas accumulation risk degree of the monitoring area accords with the verification condition 2.
And L3, when the judgment result is yes, taking the non-coincidence as a verification result of the monitoring area, and when the judgment result is no, judging whether the ventilation coincidence degree of the monitoring area accords with the verification condition 3.
And L4, when the judgment result is yes, taking the non-coincidence as a verification result of the monitoring area, and when the judgment result is no, taking the coincidence as a verification result of the monitoring area, so as to sequentially carry out prediction risk accuracy verification on each monitoring area.
A4, roadway explosion risk confirmation: marking the monitoring area with the inconsistent verification result as a correction area, confirming the corrected gas explosion risk level of the correction area, and confirming the gas explosion risk level of the correction area, wherein when the verification result of a certain monitoring area is consistent, the predicted gas explosion risk level of the monitoring area is used as the confirmed gas explosion risk level.
Specifically, confirming the corrected gas explosion hazard level of the corrected region includes: a41, extracting the gas drainage efficiency coincidence degree, the gas accumulation risk degree and the ventilation coincidence degree of the corrected region, and respectively marking as、/>And/>。
A42, counting the deviation degree of the environmental state of the correction area，/>。
A43, marking the predicted gas explosion risk level of the corrected region asAnd will/>As a correction area for correcting the gas explosion hazard level,/>Corresponding compensation danger level for unit environment state deviation degree,/>Representing rounding up symbols.
In a specific embodiment, the invention takes a scene with higher grade and higher danger as an example, namely, the higher the gas explosion danger grade is, the higher the explosion danger is, the higher the danger degree of the grade is, and the danger degree of the value is presented to be increased, such as: first-level gas explosion hazard level < second-level gas explosion risk level < three-level gas explosion risk level </No. > </No. >Class gas explosion hazard class,/>As the upper limit value of the gas explosion risk level, when the risk level is lower and more dangerous in an actual scene, the risk level of the value to which the level belongs is decreased, namely, the first-level gas explosion risk level > the second-level gas explosion risk level > the third-level gas explosion risk level >In the case of the level gas explosion hazard level, the gas explosion hazard level of the correction area can be expressed as/>。
A5, roadway explosion risk display: and manufacturing the confirmed gas explosion risk level of each monitoring area as a risk prompt tag, and adding the risk prompt tag into the structural layout diagram so as to display the risk.
According to the embodiment of the invention, the gas explosion risk level prediction analysis is carried out according to the environmental data of each monitoring area, and the roadway explosion risk verification is carried out by combining the structural data, the operation data and the environmental data of each monitoring area, so that the problem that the current roadway explosion risk evaluation accuracy and reliability are insufficient is effectively solved, the structural state and the environmental operation state of the roadway are fully combined, the defect that the current consideration elements are more conventional and single is overcome, and the reliability of the coal mine roadway gas explosion risk level evaluation result is remarkably improved.
The foregoing is merely illustrative and explanatory of the principles of this invention, as various modifications and additions may be made to the specific embodiments described, or similar arrangements may be substituted by those skilled in the art, without departing from the principles of this invention or beyond the scope of this invention as defined in the claims.
Claims (7)
1. The visual coal mine roadway gas explosion risk level evaluation method is characterized by comprising the following steps of: the method comprises the following steps:
A1, monitoring coal mine roadway areas: extracting a structural layout diagram of a target coal mine tunnel from a coal mine monitoring platform, extracting the position of each gas drainage channel opening from the structural layout diagram, dividing the target tunnel into monitoring areas according to the structural layout diagram, and monitoring tunnel structural data, operation data and environment data of the monitoring areas; the roadway structure data comprise the area of each roadway surface and crack data of each roadway surface, wherein the crack data are the area and the depth of each crack; the operation data comprise set drainage flow, a starting drainage time point and an ending drainage time point when the gas is drained for each time; the environmental data comprises values of environmental monitoring indexes corresponding to the monitoring points at the monitoring time points, wherein the environmental monitoring indexes comprise temperature, humidity, gas concentration, wind speed, oxygen content, nitrogen dioxide content and coal dust concentration;
a2, evaluating roadway explosion risk: extracting average values of the corresponding environmental monitoring indexes of the current monitoring time points from the environmental data of each monitoring area, and analyzing the predicted gas explosion risk level of each monitoring area;
A3, roadway explosion risk verification: carrying out prediction risk accuracy verification through an explosion risk verification rule, and outputting verification results of all monitoring areas, wherein the verification results are one of consistent and inconsistent;
a4, roadway explosion risk confirmation: marking a monitoring area with a non-uniform verification result as a correction area, confirming the corrected gas explosion risk level of the correction area, and confirming the gas explosion risk level of the correction area, wherein when the verification result of a certain monitoring area is uniform, the predicted gas explosion risk level of the monitoring area is used as the confirmed gas explosion risk level;
A5, roadway explosion risk display: manufacturing the confirmed gas explosion risk level of each monitoring area as a risk prompt tag, and adding the risk prompt tag into the structure layout diagram so as to display risks;
the analyzing the predicted gas explosion hazard level of each monitoring area comprises the following steps:
Comparing the average value of each environmental monitoring index of each monitoring area at the current monitoring time point with the set dangerous value interval of each environmental monitoring index, and marking the environmental monitoring index as a risk environmental index if the average value of a certain environmental monitoring index is positioned in the set dangerous value interval of the environmental monitoring index;
Counting the number of current risk environment indexes of each monitoring area, and recording as And the number of environmental monitoring indexes is recorded as/>；
Setting the corresponding environmental deviation interference weight factors of each monitoring area, and recording as，/>Representing the monitoring area number,/>；
Extracting explosion risk association weight factors corresponding to various risk environment indexes of various monitoring areas from a database, and marking the explosion risk association weight factors as，Number of index representing risk environment,/>；
Counting the trend degree of the corresponding gas explosion risk of each monitoring area，/>，Representing a downward rounding symbol,/>Setting a reference explosion risk association weight factor and an environment deviation interference weight factor respectively;
Will be Matching and comparing the set gas explosion risk levels with the defined gas explosion risk trend intervals to obtain the corresponding matched gas explosion risk levels of the monitoring areas, and predicting the gas explosion risk levels;
Setting the corresponding environment deviation interference weight factors of each monitoring area, comprising:
comparing the average value of the environmental monitoring indexes corresponding to the current monitoring time point of each monitoring area with the set proper value interval of each environmental monitoring index, counting the numerical value difference of the environmental monitoring indexes corresponding to each monitoring area, and recording as ，/>Indicating the number of environmental monitoring indexes,/>；
Will beAs the corresponding environmental deviation interference weight factor of each monitoring area，/>To set/>Early warning numerical differences of the individual environmental monitoring indexes;
The setting mode of the explosion risk verification rule is as follows:
positioning the set drainage flow, the initial drainage time point and the end drainage time point of each gas drainage from the operation data of each monitoring area;
locating the gas concentration and the air flow velocity of each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the gas drainage efficiency coincidence degree of each monitoring area ；
Extracting the area of each roadway surface and the crack data of each roadway surface from the roadway structure data of each monitoring area, and counting the gas accumulation risk degree of each monitoring area；
Locating the concentration of coal dust monitored by each monitoring point corresponding to each monitoring point at each monitoring time point from the environmental data of each monitoring area, and counting the ventilation coincidence degree of each monitoring area；
The gas drainage efficiency matching degree is smaller than the set gas drainage efficiency matching degreeAs the verification condition 1;
Setting the gas accumulation risk degree to be greater than or equal to the set gas accumulation risk degree As verification condition 2;
The ventilation fit is smaller than the set ventilation fit As verification condition 3, verification condition 1, verification condition 2, and verification condition 3 are further formed into an explosion risk verification rule.
2. The visual coal mine roadway gas explosion risk level evaluation method based on claim 1, wherein the method comprises the following steps of: the predicting risk accuracy verification includes:
Will be 、/>And/>Leading in an explosion risk verification rule, and if the gas drainage efficiency coincidence degree of a certain monitoring area accords with a verification condition 1, taking the non-coincidence as a verification result of the monitoring area;
If the gas drainage efficiency coincidence degree of a certain monitoring area does not accord with the verification condition 1, judging whether the gas accumulation risk degree of the monitoring area accords with the verification condition 2;
if the judgment result is yes, the non-coincidence is taken as a verification result of the monitoring area, and if the judgment result is no, whether the ventilation coincidence degree of the monitoring area accords with the verification condition 3 is judged;
And when the judgment result is negative, the consistency is used as the verification result of the monitoring area, and the prediction risk accuracy verification is sequentially carried out on each monitoring area.
3. The visual coal mine roadway gas explosion risk level evaluation method based on claim 1, wherein the method comprises the following steps of: the statistics of the gas drainage efficiency coincidence degree of each monitoring area comprises the following steps:
Screening the highest monitored gas concentration and highest air flow rate of each monitoring time point from the gas concentration and air flow rate monitored by each monitoring time point corresponding to each monitoring point;
calculating actual drainage gas flow of each monitoring area corresponding to each gas drainage based on the initial drainage time point and the end drainage time point of each monitoring area corresponding to each gas drainage;
The actual drainage gas flow and the set drainage gas flow of each monitoring area corresponding to each gas drainage are respectively recorded as And/>，/>Indicates the gas drainage sequence number,/>；
Setting the gas drainage efficiency evaluation error factors of all the monitoring areas asStatistics of the gas drainage efficiency coincidence degree/>, of each monitoring area，/>，/>Draw gas flow difference for set reference,/>The gas drainage times are obtained.
4. The visual coal mine roadway gas explosion risk level evaluation method based on claim 3, wherein the method comprises the following steps of: the setting of the gas drainage efficiency evaluation error factors of each monitoring area comprises the following steps:
recording the difference between the set drainage gas flow and the actual drainage gas flow as the drainage gas flow difference;
Taking the gas drainage order as an abscissa and the drainage gas flow difference as an ordinate, constructing a gas drainage change curve of each monitoring area, extracting the slope and the amplitude from the gas drainage change curve, and respectively marking as And/>；
Will beError factor/>, as gas drainage performance evaluation error factor for each monitoring area，/>The extraction change rate and the extraction gas flow extreme value difference of the set reference are respectively set.
5. The visual coal mine roadway gas explosion risk level evaluation method based on claim 1, wherein the method comprises the following steps of: the statistics of the gas accumulation risk degree of each monitoring area comprises the following steps:
the area of each monitoring area corresponding to each roadway surface is recorded as ，/>Represent lane number,/>；
Locating the area and depth of each crack from the crack data of each monitoring area corresponding to each roadway surface, and summing the areas of each crack to obtain the crack area and depth of each monitoring area corresponding to each roadway surface；
Locating the maximum crack depth from the depths of the cracks in the areas of each roadway corresponding to each monitoring areaMeanwhile, the average crack depth/>, corresponding to each roadway surface, of each monitoring area is obtained through mean value calculation；
Will beAs the gas accumulation risk degree of each monitoring area corresponding to each roadway surface, and screening the maximum value from the gas accumulation risk degree as the gas accumulation risk degree/>, of each monitoring area，/>The interference crack depth and the risk crack depth difference of the set reference are respectively.
6. The visual coal mine roadway gas explosion risk level evaluation method based on claim 1, wherein the method comprises the following steps of: the statistics of ventilation fitness of each monitoring area comprises the following steps:
Taking the monitoring time point as an abscissa and the coal dust concentration as an ordinate, constructing a coal dust concentration change curve of each monitoring area corresponding to each monitoring point, extracting the slope, and recording as ，/>Representing the number of the monitoring point,/>；
Carrying out interaction difference on the coal dust concentration of each monitoring point corresponding to each monitoring area at the same monitoring time point to obtain the coal dust concentration difference of each monitoring point corresponding to each monitoring area at each monitoring time point, and screening out the maximum coal dust concentration difference of each monitoring area at each monitoring time point，/>Indicates the monitoring time point number,/>；
Counting the consistency of the coal dust state of each monitoring area，，/>、/>The coal dust increase rate and the coal dust concentration difference of the set reference are respectively/>For monitoring the number of points,/>To monitor the number of time points;
According to The statistics mode of the system is that the gas concentration state coincidence degree/>, of each monitoring area is counted in the same wayWill/>Ventilation compliance/>, as each monitored area。
7. The visual coal mine roadway gas explosion risk level evaluation method based on claim 1, wherein the method comprises the following steps of: the confirming the corrected gas explosion hazard level of the corrected area comprises:
extracting the gas drainage efficiency coincidence degree, gas accumulation risk degree and ventilation coincidence degree of the corrected region and respectively marking as 、/>And/>；
Statistics of the degree of deviation of the environmental state of the corrected region，/>；
The predicted gas explosion risk level of the corrected area is recorded asAnd will/>As a correction area for correcting the gas explosion hazard level,/>Corresponding compensation danger level for unit environment state deviation degree,/>Representing rounding up symbols.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202410211557.3A CN117787728B (en) | 2024-02-27 | 2024-02-27 | Coal mine roadway gas explosion risk level evaluation method based on visualization |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202410211557.3A CN117787728B (en) | 2024-02-27 | 2024-02-27 | Coal mine roadway gas explosion risk level evaluation method based on visualization |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CN117787728A CN117787728A (en) | 2024-03-29 |
| CN117787728B true CN117787728B (en) | 2024-04-30 |
Family
ID=90380156
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN202410211557.3A Active CN117787728B (en) | 2024-02-27 | 2024-02-27 | Coal mine roadway gas explosion risk level evaluation method based on visualization |
Country Status (1)
| Country | Link |
|---|---|
| CN (1) | CN117787728B (en) |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104850897A (en) * | 2015-02-25 | 2015-08-19 | 中国矿业大学 | Prediction method for coal and gas outburst based on seismic information |
| CN105909299A (en) * | 2016-04-19 | 2016-08-31 | 陈凤平 | Coal seam potential energy body physics blast control method |
| CN107818425A (en) * | 2017-11-23 | 2018-03-20 | 辽宁工程技术大学 | A kind of dangerous evaluation method of gas explosion at longwall face |
| CN109145440A (en) * | 2018-08-21 | 2019-01-04 | 天地（常州）自动化股份有限公司 | The determination method of goaf gas and coal spontaneous combustion multi- scenarios method danger zone |
| CN109886600A (en) * | 2019-03-06 | 2019-06-14 | 绍兴文理学院 | The method of monitoring and warning bifurcation of coal seam assembly section bump risk |
| CN110751337A (en) * | 2019-10-22 | 2020-02-04 | 中煤科工集团重庆研究院有限公司 | Prediction method for coal and gas outburst and secondary disaster danger area range thereof |
| CN111353687A (en) * | 2020-01-16 | 2020-06-30 | 黑龙江科技大学 | Coal mine emergency rescue command information management system and method thereof |
| CN114565193A (en) * | 2022-04-15 | 2022-05-31 | 西安科技大学 | Coal spontaneous combustion tendency prediction method based on machine learning |
| CN115526422A (en) * | 2022-10-19 | 2022-12-27 | 中国矿业大学 | Coal mine gas explosion risk prediction method |
| CN115596509A (en) * | 2022-09-21 | 2023-01-13 | 贵州安和矿业科技工程股份有限公司（Cn） | Gas early warning method in coal mine roadway tunneling process |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102604640B1 (en) * | 2019-01-31 | 2023-11-23 | 한국전자통신연구원 | System for monitoring gas in closed space and operating method thereof |
-
2024
- 2024-02-27 CN CN202410211557.3A patent/CN117787728B/en active Active
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN104850897A (en) * | 2015-02-25 | 2015-08-19 | 中国矿业大学 | Prediction method for coal and gas outburst based on seismic information |
| CN105909299A (en) * | 2016-04-19 | 2016-08-31 | 陈凤平 | Coal seam potential energy body physics blast control method |
| CN107818425A (en) * | 2017-11-23 | 2018-03-20 | 辽宁工程技术大学 | A kind of dangerous evaluation method of gas explosion at longwall face |
| CN109145440A (en) * | 2018-08-21 | 2019-01-04 | 天地（常州）自动化股份有限公司 | The determination method of goaf gas and coal spontaneous combustion multi- scenarios method danger zone |
| CN109886600A (en) * | 2019-03-06 | 2019-06-14 | 绍兴文理学院 | The method of monitoring and warning bifurcation of coal seam assembly section bump risk |
| CN110751337A (en) * | 2019-10-22 | 2020-02-04 | 中煤科工集团重庆研究院有限公司 | Prediction method for coal and gas outburst and secondary disaster danger area range thereof |
| CN111353687A (en) * | 2020-01-16 | 2020-06-30 | 黑龙江科技大学 | Coal mine emergency rescue command information management system and method thereof |
| CN114565193A (en) * | 2022-04-15 | 2022-05-31 | 西安科技大学 | Coal spontaneous combustion tendency prediction method based on machine learning |
| CN115596509A (en) * | 2022-09-21 | 2023-01-13 | 贵州安和矿业科技工程股份有限公司（Cn） | Gas early warning method in coal mine roadway tunneling process |
| CN115526422A (en) * | 2022-10-19 | 2022-12-27 | 中国矿业大学 | Coal mine gas explosion risk prediction method |
Non-Patent Citations (5)
| Title |
|---|
| Risk assessment of coal mine gas explosion based on cloud integrated similarity and fuzzy DEMATEL;Kun Xu 等;《Process Safety and Environmental Protection》;20230718;第177卷;第1211-1224页 * |
| Risk assessment of gas explosion in coal mines based on fuzzy AHP and bayesian network;Min Li 等;《Process Safety and Environmental Protection》;20200111;第135卷;第207-218页 * |
| 基于本质安全的煤矿管理体系及安全评价研究;周天;《中国优秀硕士学位论文全文数据库 工程科技Ⅰ辑》;20200315(第3期);第B021-269页 * |
| 煤矿瓦斯爆炸事故致因选取与风险等级预测;郝秦霞 等;《煤矿安全》;20231031;第54卷(第10期);第243-249页 * |
| 煤矿瓦斯爆炸灾害风险评价与预测;高玉翠;《科技创新导报》;20190221;第16卷(第6期);第242-246, 248页 * |
Also Published As
| Publication number | Publication date |
|---|---|
| CN117787728A (en) | 2024-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN112378445A (en) | Building construction environment intelligence real-time monitoring system based on big data analysis | |
| CN101649751B (en) | Monitoring method of coal mine safety monitoring system | |
| CN107490479B (en) | Method and device for predicting residual life of bearing | |
| CN113849998B (en) | BIM-based tunnel fire early warning processing method and system | |
| CN116257811B (en) | Abnormality processing method based on gas flow detection deep learning | |
| CN116105802B (en) | Underground facility safety monitoring and early warning method based on Internet of things | |
| CN117787728B (en) | Coal mine roadway gas explosion risk level evaluation method based on visualization | |
| CN114781657B (en) | Power equipment maintenance system and method based on artificial intelligence | |
| CN201496105U (en) | Colliery safety monitoring system | |
| CN113757093A (en) | Fault diagnosis method for flash steam compressor unit | |
| CN117198019B (en) | Intelligent archive storehouse intelligent early warning system based on multiple sensors | |
| CN116380496B (en) | Automobile door fatigue endurance test method, system and medium | |
| CN112177811B (en) | Remote online monitoring method for flow of EGR (exhaust gas Recirculation) system of electric control diesel engine | |
| CN113111056A (en) | Cleaning method for urban flood water monitoring data | |
| CN116562712A (en) | System and method for predicting air quality | |
| CN110555188A (en) | analysis method for wheel parameter abrasion trend of motor train unit | |
| CN115083123B (en) | Mine coal spontaneous combustion intelligent grading early warning method driven by measured data | |
| CN114582083B (en) | Tunnel monitoring multi-sensor data fusion fire disaster early warning method | |
| CN116380468A (en) | Fault detection system for intelligent wharf and construction method | |
| CN111461456B (en) | Method for early warning outburst danger based on gas monitoring data instantaneous change characteristics | |
| CN114118785A (en) | Urban cell carbon neutralization amount calculation method | |
| CN117808274B (en) | Colliery is intelligent system of patrolling and examining of gas safety in pit | |
| CN115270532B (en) | Data processing method and system based on mine intellectualization | |
| CN114854920B (en) | GRU self-encoder blast furnace abnormity monitoring method embedded by Gaussian mixture model | |
| CN111060209B (en) | Compensation and measurement method for blast furnace hearth temperature sensor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PB01 | Publication | ||
| PB01 | Publication | ||
| SE01 | Entry into force of request for substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| GR01 | Patent grant | ||
| GR01 | Patent grant |