CN117345596B - Efficient energy-saving circulating water utilization system - Google Patents
Efficient energy-saving circulating water utilization system Download PDFInfo
- Publication number
- CN117345596B CN117345596B CN202311128638.9A CN202311128638A CN117345596B CN 117345596 B CN117345596 B CN 117345596B CN 202311128638 A CN202311128638 A CN 202311128638A CN 117345596 B CN117345596 B CN 117345596B
- Authority
- CN
- China
- Prior art keywords
- water
- point
- time point
- acquisition time
- target
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims abstract description 728
- 238000012544 monitoring process Methods 0.000 claims abstract description 29
- 238000004458 analytical method Methods 0.000 claims abstract description 11
- 238000011156 evaluation Methods 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 27
- 238000004364 calculation method Methods 0.000 claims description 22
- 230000002159 abnormal effect Effects 0.000 claims description 18
- 238000012797 qualification Methods 0.000 claims description 17
- 102100037651 AP-2 complex subunit sigma Human genes 0.000 claims description 3
- 101000806914 Homo sapiens AP-2 complex subunit sigma Proteins 0.000 claims description 3
- 238000003672 processing method Methods 0.000 claims description 2
- 238000004064 recycling Methods 0.000 claims 2
- 230000000694 effects Effects 0.000 description 6
- 238000004134 energy conservation Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 238000007792 addition Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F04—POSITIVE - DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS FOR LIQUIDS OR ELASTIC FLUIDS
- F04B—POSITIVE-DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS
- F04B49/00—Control, e.g. of pump delivery, or pump pressure of, or safety measures for, machines, pumps, or pumping installations, not otherwise provided for, or of interest apart from, groups F04B1/00 - F04B47/00
- F04B49/06—Control using electricity
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F04—POSITIVE - DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS FOR LIQUIDS OR ELASTIC FLUIDS
- F04B—POSITIVE-DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS
- F04B49/00—Control, e.g. of pump delivery, or pump pressure of, or safety measures for, machines, pumps, or pumping installations, not otherwise provided for, or of interest apart from, groups F04B1/00 - F04B47/00
- F04B49/06—Control using electricity
- F04B49/065—Control using electricity and making use of computers
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F04—POSITIVE - DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS FOR LIQUIDS OR ELASTIC FLUIDS
- F04B—POSITIVE-DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS
- F04B49/00—Control, e.g. of pump delivery, or pump pressure of, or safety measures for, machines, pumps, or pumping installations, not otherwise provided for, or of interest apart from, groups F04B1/00 - F04B47/00
- F04B49/10—Other safety measures
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F04—POSITIVE - DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS FOR LIQUIDS OR ELASTIC FLUIDS
- F04B—POSITIVE-DISPLACEMENT MACHINES FOR LIQUIDS; PUMPS
- F04B51/00—Testing machines, pumps, or pumping installations
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Control Of Positive-Displacement Pumps (AREA)
Abstract
The invention discloses a high-efficiency energy-saving circulating water utilization system, which relates to the technical field of water resource management, and comprises a water use monitoring module, a water use monitoring analysis module, an equipment energy-saving judging module, an early warning terminal and a database.
Description
Technical Field
The invention relates to the technical field of water resource management, in particular to a high-efficiency energy-saving circulating water utilization system.
Background
The circulating water system can realize the efficient utilization of circulating water, reduce the waste of water resources and achieve the purposes of energy conservation and environmental protection. In the aspect of energy conservation, the energy loss is reduced mainly through the variable-frequency water pump and the reduction of the friction resistance of the pipeline. The system can be widely applied to various fields of industry, agriculture, city construction and the like, and promotes sustainable development and environmental protection.
The current circulating water system mainly adjusts the rotating speed of the water pump according to the water quantity of the water consumption point, but the length of a water supply pipeline between the water consumption point and the water pump is not considered when the rotating speed of the water pump is confirmed, so that the water loss of the water supply pipeline cannot be eliminated when the water is supplied to the water consumption point, the water quantity supply of the water consumption point is reduced, on the other hand, when the water is supplied to the water consumption point, the accuracy of water pump control and the loss and the water quality safety of the water supply pipeline cannot be monitored, the accuracy of water pump control and the reliability of water supply of the water supply pipeline cannot be guaranteed, the accuracy and the safety of water consumption point water consumption control cannot be improved, the utilization effect and the experience sense of the circulating water system are reduced, and meanwhile, the energy saving effect of the water pump and the pipeline cannot be improved.
Disclosure of Invention
The invention aims to provide a high-efficiency energy-saving circulating water utilization system which solves the problems existing in the background technology.
In order to solve the technical problems, the invention adopts the following technical scheme: the invention provides a high-efficiency energy-saving circulating water utilization system, which comprises: the system comprises a water use monitoring module, a water supply monitoring analysis module, an equipment energy-saving judging module, an early warning terminal and a database.
The water consumption monitoring module is used for acquiring water flow corresponding to each water consumption point at each acquisition time point, judging whether the water flow corresponding to each water consumption point at each acquisition time point is normal or not, sending a signal to the early warning terminal when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal, marking the water consumption point as a target water consumption point, marking the acquisition time point as a target acquisition time point, analyzing the target water flow corresponding to each target water consumption point at each target acquisition time point, and further calculating the preset rotating speed corresponding to each acquisition time point of the water pump;
the water supply monitoring and analyzing module comprises a water pump monitoring and analyzing unit, a pipeline monitoring and analyzing unit and a comprehensive loss analyzing unit;
the water pump monitoring and analyzing unit is used for correspondingly running the water pump according to the preset rotating speed corresponding to each acquisition time point, so that the actual electric energy, the actual rotating speed and the actual water pressure of the water pump at each acquisition time point are monitored, and therefore the running qualification value corresponding to the water pump is calculated;
the pipeline monitoring and analyzing unit is used for monitoring the information of the water supply pipeline corresponding to each water consumption point at each acquisition time point, and further calculating the pipeline operation qualification value corresponding to each water consumption point;
the equipment energy-saving judging module is used for judging the pipeline running states corresponding to the water pump and the water points according to the running qualification value corresponding to the water pump and the pipeline running qualification value corresponding to the water points;
the early warning terminal is used for carrying out early warning prompt when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal and the running state of the water pump or the pipeline corresponding to the certain water consumption point is in an abnormal state.
Preferably, the determining whether the water flow corresponding to each water consumption point at each collection time point is normal or not includes the following specific determining process: recording the water flow corresponding to each water point at each collecting time point as vs it Wherein i represents the number corresponding to each water point, i=1, 2....n, t represents the number corresponding to each acquisition time point, t=1, 2. The term p is used herein, extracting the historical maximum water flow corresponding to each water point from the database, and recording the historical maximum water flow as vs imax Thereby substituting into the calculation formulaObtaining the water flow evaluation coefficient corresponding to each water point at each acquisition time point>Wherein Deltavs is the set allowable water flow difference, and epsilon is the compensation factor corresponding to the set water flow evaluation coefficient;
comparing the water flow evaluation coefficient corresponding to each water use point at each collection time point with the water flow evaluation coefficient threshold stored in the database, if the water flow evaluation coefficient corresponding to a certain water use point at a certain collection time point is smaller than the water flow evaluation coefficient threshold stored in the database, judging that the water flow corresponding to the water use point at the collection time point is abnormal, otherwise, judging that the water flow corresponding to the water use point at the collection time point is normal, and judging whether the water flow corresponding to each water use point at each collection time point is normal or not in the mode.
Preferably, the calculating the preset rotation speed of the water pump at each collecting time point comprises the following specific calculating process: removing the water flow corresponding to each target water point at each acquisition time point from the water flow corresponding to each target water point at each acquisition time point, and further calculating to obtain the average water flow change rate corresponding to each target water point, so as to obtain the target water flow corresponding to each target water point at each target acquisition time point, and replacing the corresponding water flow with the target water flow corresponding to each target water point at each target acquisition time point, so as to obtain the actual water flow corresponding to each target water point at each acquisition time point;
the method comprises the steps of obtaining the corresponding length of a water supply pipeline corresponding to each water consumption point from a database, calculating to obtain a water pressure influence factor corresponding to each water consumption point, obtaining a reference water pump rotating speed corresponding to each collection time point of each target water consumption point based on a reference water pump rotating speed corresponding to each water flow interval stored in the database, multiplying the reference water pump rotating speed corresponding to each collection time point of each target water consumption point by the water pressure influence factor corresponding to each water consumption point to obtain a water pump rotating speed corresponding to each collection time point of each target water consumption point, comparing the water pump rotating speeds corresponding to each collection time point of each target water consumption point with each other, and taking the maximum rotating speed of each collection time point as a preset rotating speed corresponding to each collection time point of a water pump.
Preferably, the operation qualification value corresponding to the water pump is calculated, and the specific calculation process is as follows: comparing the preset rotating speed corresponding to each collecting time point of the water pump with the reference electric energy corresponding to each rotating speed of the water pump stored in the database to obtain the reference electric energy corresponding to each collecting time point of the water pump, and recording as W t T represents the corresponding number of each acquisition time point, t=1, 2..p., in the same way, the processing method comprises the steps of, comparing the preset rotating speed corresponding to each collecting time point of the water pump with the reference water pressure corresponding to each rotating speed of the water pump stored in the database to obtain the reference water pressure corresponding to each collecting time point of the water pump, and recording as F t Thereby substituting into the calculation formulaObtaining a corresponding operation qualified value alpha of the water pump, wherein W t ′、v t ′、F t ' respectively represents the actual electric energy, the actual rotating speed and the actual water pressure corresponding to the water pump at the t-th acquisition time point, wherein DeltaW, deltav and DeltaF are respectively set allowable electric energy difference, allowable rotating speed difference and allowable water pressure difference, and gamma 1, gamma 2 and gamma 3 are respectively set weighting factors corresponding to the actual electric energy, the actual rotating speed and the actual water pressure of the water pump.
Preferably, the water supply pipeline information comprises inlet water pressure, inlet water flow, inlet water quality information, outlet water pressure, outlet water flow and outlet water quality information; the water quality information includes water turbidity, water pH value, water hardness and water conductivity.
Preferably, the calculating the pipeline operation fit value corresponding to each water consumption point comprises the following specific calculating process: obtaining standard water quality information corresponding to each water point from a database, analyzing and obtaining water quality safety coefficients corresponding to each water point according to inlet water quality information, outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point, and recording asi represents the number corresponding to each water point, i=1, 2. Once again, n is,
calculating according to the inlet water pressure, the inlet water flow, the outlet water pressure and the outlet water flow corresponding to each water point at each acquisition time point to obtain the state evaluation coefficient of the water supply pipeline corresponding to each water point, and recording as
According to the statistical formulaObtaining the pipeline operation qualification value corresponding to each water consumption pointWherein mu 1 and mu 2 are respectively set weight factors corresponding to the water quality safety coefficient and the state evaluation coefficient of the water supply pipeline.
Preferably, the analysis obtains the water quality safety coefficient corresponding to each water consumption point, and the specific analysis process is as follows: the turbidity of the inlet water, the pH value of the inlet water, the hardness of the inlet water, the water inlet water conductivity, the turbidity of the outlet water, the pH value of the outlet water, the hardness of the outlet water and the conductivity of the outlet water corresponding to each water point at each collecting time point are respectively recorded as z1 it 、pH1 it 、y1 it 、d1 it 、z2 it 、pH2 it 、y2 it 、d2 it T represents the number corresponding to each acquisition time point, t=1, 2
Obtaining a first water quality safety coefficient corresponding to each water pointWherein Δz, Δph, Δy, Δd are respectively set allowable water turbidity difference, allowable pH difference, allowable water hardness difference, allowable water conductivity difference, μ1, μ2, μ3, μ4 are respectively set weight factors corresponding to water turbidity difference, pH difference, water hardness difference, water conductivity difference, e represents a natural constant;
calculating outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point according to the calculation mode of the first water quality safety coefficient corresponding to each water point to obtain a second water quality safety coefficient corresponding to each water point, and marking asWhereby ∈10 according to the statistical formula>Obtaining the water quality safety coefficient corresponding to each water pointWherein sigma 1 and sigma 2 are respectively set weight factors corresponding to the first water quality safety coefficient and the second water quality safety coefficient.
Preferably, the calculation formula of the state evaluation coefficient of each water consumption point corresponding to the water supply pipeline is as follows:wherein F1 it 、v1 it 、F2 it 、v2 it Respectively representing inlet water pressure, inlet water flow, outlet water pressure and outlet water flow corresponding to the ith water point at the t collecting time point, wherein DeltaF ', deltav' are respectively set allowable water pressure drop values and allowable water flow drop values, and tau 1 and tau 2 are respectively set weight factors corresponding to the water pressure drop values and the water flow drop values。
Preferably, the judging of the running states of the water pump and the pipelines corresponding to the water points comprises the following specific judging process: comparing the operation qualified value corresponding to the water pump with the water pump operation qualified value threshold stored in the database, if the operation qualified value corresponding to the water pump is greater than or equal to the water pump operation qualified value threshold, judging that the operation state corresponding to the water pump is in a normal state, otherwise, judging that the operation state corresponding to the water pump is in an abnormal state;
comparing the pipeline operation qualified value corresponding to each water point with the water point pipeline operation qualified value threshold stored in the database, if the pipeline operation qualified value corresponding to a certain water point is greater than or equal to the water point pipeline operation qualified value threshold, judging that the pipeline operation state corresponding to the water point is in a normal state, otherwise, judging that the pipeline operation state corresponding to the water point is in an abnormal state, and judging the pipeline operation state corresponding to each water point in this way.
The invention has the beneficial effects that: according to the high-efficiency energy-saving circulating water utilization system provided by the invention, the rotating speed of the water pump is confirmed according to the corresponding water flow of each water point and the length of the water supply pipeline between each water point and the water pump, the running state of the water pump and the running state of the water supply pipeline are monitored in the water supply process, the control accuracy of the water pump is effectively ensured, the water loss of the water supply pipeline is eliminated, the water supply quantity of the water points is ensured to be sufficient, the water supply reliability of the water supply pipeline is improved, the water consumption control accuracy and safety of the water points are also improved, the utilization effect and the experience of the circulating water system are greatly improved, and the energy-saving effect of the water pump and the pipeline is also effectively improved.
Drawings
In order to more clearly illustrate the embodiments of the invention or the technical solutions in the prior art, the drawings that are required in the embodiments or the description of the prior art will be briefly described, it being obvious that the drawings in the following description are only some embodiments of the invention, and that other drawings may be obtained according to these drawings without inventive effort for a person skilled in the art.
FIG. 1 is a schematic diagram of the system structure of the present invention.
Detailed Description
The following description of the embodiments of the present invention will be made clearly and completely with reference to the accompanying drawings, in which it is apparent that the embodiments described are only some embodiments of the present invention, but not all embodiments. All other embodiments, which can be made by those skilled in the art based on the embodiments of the invention without making any inventive effort, are intended to be within the scope of the invention.
Referring to fig. 1, an efficient energy-saving circulating water utilization system comprises a water use monitoring module, a water supply monitoring analysis module, an equipment energy-saving judging module, an early warning terminal and a database.
The water consumption monitoring module is used for acquiring water flow corresponding to each water consumption point at each acquisition time point, judging whether the water flow corresponding to each water consumption point at each acquisition time point is normal or not, sending a signal to the early warning terminal when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal, marking the water consumption point as a target water consumption point, marking the acquisition time point as a target acquisition time point, analyzing the target water flow corresponding to each target water consumption point at each target acquisition time point, and further calculating the preset rotating speed corresponding to each acquisition time point of the water pump;
the water flow meters are installed at all water points, and then the water flow meters are used for collecting the water flow rates corresponding to all water points at all collecting time points.
In a specific embodiment, the specific determining process includes the following steps: recording the water flow corresponding to each water point at each collecting time point as vs it Wherein i represents the number corresponding to each water point, i=1, 2....n, t represents the number corresponding to each acquisition time point, t=1, 2. The term p is used herein, extracting the historical maximum water flow corresponding to each water point from the database, and recording the historical maximum water flow as vs imax Thereby substituting into the calculation formulaObtaining the water flow evaluation coefficient corresponding to each water point at each acquisition time point>Wherein Deltavs is the set allowable water flow difference, and epsilon is the compensation factor corresponding to the set water flow evaluation coefficient;
comparing the water flow evaluation coefficient corresponding to each water use point at each collection time point with the water flow evaluation coefficient threshold stored in the database, if the water flow evaluation coefficient corresponding to a certain water use point at a certain collection time point is smaller than the water flow evaluation coefficient threshold stored in the database, judging that the water flow corresponding to the water use point at the collection time point is abnormal, otherwise, judging that the water flow corresponding to the water use point at the collection time point is normal, and judging whether the water flow corresponding to each water use point at each collection time point is normal or not in the mode.
In another specific embodiment, the calculating the preset rotation speed of the water pump at each collection time point includes the following specific calculation process: removing the water flow corresponding to each target water point at each acquisition time point from the water flow corresponding to each target water point at each acquisition time point, and further calculating to obtain the average water flow change rate corresponding to each target water point, so as to obtain the target water flow corresponding to each target water point at each target acquisition time point, and replacing the corresponding water flow with the target water flow corresponding to each target water point at each target acquisition time point, so as to obtain the actual water flow corresponding to each target water point at each acquisition time point;
in the above, the analysis process of the target water flow corresponding to each target water point at each target acquisition time point is as follows: the water flow of each target water point at each collecting time point is removed, the water flow of each target water point at each collecting time point is obtained, the water flow corresponding to each target water point at each residual collecting time point is recorded as vjr, j represents the number corresponding to each target water point, j=1, 2..m, r represents the number corresponding to each residual collecting time point, r=1, 2..x, and then the water flow is substituted into a calculation formulaObtaining the average water flow change rate kappa corresponding to each target water point j Wherein v is j(r-1) Representing the water flow corresponding to the jth target water point at the (r-1) th residual acquisition time point, T jr 、T j(r-1) Indicating the corresponding time of the jth target water point at the (r) th and (r-1) th residual acquisition time points,/for>The compensation factor corresponding to the set average water flow change rate is used, and x represents the number of the residual acquisition time points;
obtaining the corresponding time of each target water point at each target acquisition time point, further obtaining the duration of each target water point between each target acquisition time point and the r-th residual acquisition time point based on the corresponding time of each target water point at the r-th residual acquisition time point, multiplying the water flow corresponding to each target water point at the r-th residual acquisition time point by the average water flow change rate corresponding to each target water point, and adding the water flow corresponding to each target water point at the r-th residual acquisition time point to obtain the target water flow corresponding to each target water point at each target acquisition time point.
The method comprises the steps of obtaining the corresponding length of a water supply pipeline corresponding to each water consumption point from a database, calculating to obtain a water pressure influence factor corresponding to each water consumption point, obtaining a reference water pump rotating speed corresponding to each collection time point of each target water consumption point based on a reference water pump rotating speed corresponding to each water flow interval stored in the database, multiplying the reference water pump rotating speed corresponding to each collection time point of each target water consumption point by the water pressure influence factor corresponding to each water consumption point to obtain a water pump rotating speed corresponding to each collection time point of each target water consumption point, comparing the water pump rotating speeds corresponding to each collection time point of each target water consumption point with each other, and taking the maximum rotating speed of each collection time point as a preset rotating speed corresponding to each collection time point of a water pump.
The water pressure influence factors corresponding to all water points are calculated, and the specific calculation process is as follows: the water points are pairedThe corresponding length of the corresponding water supply pipeline is recorded as L i And then substitutes into the calculation formulaObtaining the water pressure influence factor lambda corresponding to each water point i Wherein L is the set length of the reference water supply pipeline, and ζ is the compensation factor corresponding to the set water pressure influence factor.
The water supply monitoring and analyzing module comprises a water pump monitoring and analyzing unit, a pipeline monitoring and analyzing unit and a comprehensive loss analyzing unit;
the water pump monitoring and analyzing unit is used for correspondingly running the water pump according to the preset rotating speed corresponding to each acquisition time point, so that the actual electric energy, the actual rotating speed and the actual water pressure of the water pump at each acquisition time point are monitored, and therefore the running qualification value corresponding to the water pump is calculated;
the method comprises the steps of acquiring actual electric energy corresponding to each acquisition time point of a water pump from a water pump control center, installing a rotation speed sensor in an impeller of the water pump, further acquiring actual rotation speed corresponding to each acquisition time point of the water pump, installing a water pressure sensor at an outlet pipe of the water pump, and further acquiring actual water pressure corresponding to each acquisition time point of the water pump.
In a specific embodiment, the operation fit value corresponding to the water pump is calculated, and the specific calculation process is as follows:
comparing the preset rotating speed corresponding to each collecting time point of the water pump with the reference electric energy corresponding to each rotating speed of the water pump stored in the database to obtain the reference electric energy corresponding to each collecting time point of the water pump, and recording as W t Similarly, comparing the preset rotation speed corresponding to each acquisition time point of the water pump with the reference water pressure corresponding to each rotation speed of the water pump stored in the database to obtain the reference water pressure corresponding to each acquisition time point of the water pump, and marking as F t Thereby substituting into the calculation formula
In the process, the operation corresponding to the water pump is obtainedLine pass value α, where W t ′、v t ′、F t ' respectively represents the actual electric energy, the actual rotating speed and the actual water pressure corresponding to the water pump at the t-th acquisition time point, wherein DeltaW, deltav and DeltaF are respectively set allowable electric energy difference, allowable rotating speed difference and allowable water pressure difference, and gamma 1, gamma 2 and gamma 3 are respectively set weighting factors corresponding to the actual electric energy, the actual rotating speed and the actual water pressure of the water pump.
The pipeline monitoring and analyzing unit is used for monitoring the information of the water supply pipeline corresponding to each water consumption point at each acquisition time point, and further calculating the pipeline operation qualification value corresponding to each water consumption point;
the water supply pipeline information comprises inlet water pressure, inlet water flow, inlet water quality information, outlet water pressure, outlet water flow and outlet water quality information;
the water quality information includes water turbidity, water pH value, water hardness and water conductivity.
The water pressure sensor, the water flowmeter and the water quality tester are arranged at the inlet and the outlet of the water supply pipeline corresponding to each water consumption point, so that the inlet water pressure, the inlet water flow, the inlet water quality information, the outlet water pressure, the outlet water flow and the outlet water quality information corresponding to each water consumption point at each acquisition time point are acquired.
In a specific embodiment, the pipeline operation fit value corresponding to each water point is calculated, and the specific calculation process is as follows: obtaining standard water quality information corresponding to each water point from a database, analyzing and obtaining water quality safety coefficients corresponding to each water point according to inlet water quality information, outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point, and recording as
Calculating according to the inlet water pressure, the inlet water flow, the outlet water pressure and the outlet water flow corresponding to each water point at each acquisition time point to obtain the state evaluation coefficient of the water supply pipeline corresponding to each water point, and recording as
According to the statistical formulaObtaining the pipeline operation qualification value corresponding to each water consumption pointWherein mu 1 and mu 2 are respectively set weight factors corresponding to the water quality safety coefficient and the state evaluation coefficient of the water supply pipeline.
In another specific embodiment, the analysis obtains the water quality safety coefficient corresponding to each water point, and the specific analysis process is as follows: the turbidity of the inlet water, the pH value of the inlet water, the hardness of the inlet water, the water inlet water conductivity, the turbidity of the outlet water, the pH value of the outlet water, the hardness of the outlet water and the conductivity of the outlet water corresponding to each water point at each collecting time point are respectively recorded as z1 it 、pH1 it 、y1 it 、d1 it 、z2 it 、pH2 it 、y2 it 、d2 it And then substitutes into the calculation formula
Obtaining a first water quality safety coefficient corresponding to each water pointWherein Δz, Δph, Δy, Δd are respectively set allowable water turbidity difference, allowable pH difference, allowable water hardness difference, allowable water conductivity difference, μ1, μ2, μ3, μ4 are respectively set weight factors corresponding to water turbidity difference, pH difference, water hardness difference, water conductivity difference, e represents a natural constant;
calculating outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point according to the calculation mode of the first water quality safety coefficient corresponding to each water point to obtain a second water quality safety coefficient corresponding to each water point, and marking asWhereby ∈10 according to the statistical formula>Obtaining the water quality safety coefficient corresponding to each water pointWherein sigma 1 and sigma 2 are respectively set weight factors corresponding to the first water quality safety coefficient and the second water quality safety coefficient.
In a specific embodiment, the calculation formula of the state evaluation coefficient of each water consumption point corresponding to the water supply pipeline is as follows:wherein F1 it 、v1 it 、F2 it 、v2 it The water pressure sensor respectively represents inlet water pressure, inlet water flow, outlet water pressure and outlet water flow corresponding to the ith water point at the t collecting time point, delta F ', delta v' are respectively set allowable water pressure drop values and allowable water flow drop values, and tau 1 and tau 2 are respectively set weight factors corresponding to the water pressure drop values and the water flow drop values.
The equipment energy-saving judging module is used for judging the pipeline running states corresponding to the water pump and the water points according to the running qualification value corresponding to the water pump and the pipeline running qualification value corresponding to the water points;
in a specific embodiment, the judging of the running states of the water pump and the pipelines corresponding to the water points specifically comprises the following steps: comparing the operation qualified value corresponding to the water pump with the water pump operation qualified value threshold stored in the database, if the operation qualified value corresponding to the water pump is greater than or equal to the water pump operation qualified value threshold, judging that the operation state corresponding to the water pump is in a normal state, otherwise, judging that the operation state corresponding to the water pump is in an abnormal state;
comparing the pipeline operation qualified value corresponding to each water point with the water point pipeline operation qualified value threshold stored in the database, if the pipeline operation qualified value corresponding to a certain water point is greater than or equal to the water point pipeline operation qualified value threshold, judging that the pipeline operation state corresponding to the water point is in a normal state, otherwise, judging that the pipeline operation state corresponding to the water point is in an abnormal state, and judging the pipeline operation state corresponding to each water point in this way.
The early warning terminal is used for carrying out early warning prompt when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal and the running state of the water pump or the pipeline corresponding to the certain water consumption point is in an abnormal state.
The database is used for storing historical maximum water flow and standard water quality information corresponding to each water consumption point, storing a water flow evaluation coefficient threshold, a water pump operation qualified value threshold and a water consumption point pipeline operation qualified value threshold, storing the length corresponding to a water supply pipeline corresponding to each water consumption point, storing the reference water pump rotating speed corresponding to each water flow interval, storing reference electric energy corresponding to the water pump at each rotating speed and storing the reference water pressure corresponding to the water pump at each rotating speed.
According to the embodiment of the invention, the rotating speed of the water pump is confirmed according to the corresponding water flow of each water consumption point and the length of the water supply pipeline between each water consumption point and the water pump, the running state of the water pump and the running state of the water supply pipeline are monitored in the water supply process, the control accuracy of the water pump is effectively ensured, the water loss of the water supply pipeline is eliminated, the water consumption of the water consumption points is ensured, the water supply reliability of the water supply pipeline is improved, the control accuracy and safety of the water consumption points are also improved, the utilization effect and experience of a circulating water system are greatly improved, and the energy saving effect of the water pump and the pipeline is also effectively improved.
The foregoing is merely illustrative and explanatory of the principles of the invention, as various modifications and additions may be made to the specific embodiments described, or similar thereto, by those skilled in the art, without departing from the principles of the invention or beyond the scope of the appended claims.
Claims (4)
1. An efficient energy-saving water recycling system, comprising: the system comprises a water use monitoring module, a water supply monitoring analysis module, an equipment energy-saving judging module, an early warning terminal and a database;
the water consumption monitoring module is used for acquiring water flow corresponding to each water consumption point at each acquisition time point, judging whether the water flow corresponding to each water consumption point at each acquisition time point is normal or not, sending a signal to the early warning terminal when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal, marking the water consumption point as a target water consumption point, marking the acquisition time point as a target acquisition time point, analyzing the target water flow corresponding to each target water consumption point at each target acquisition time point, and further calculating the preset rotating speed corresponding to each acquisition time point of the water pump;
the water supply monitoring and analyzing module comprises a water pump monitoring and analyzing unit, a pipeline monitoring and analyzing unit and a comprehensive loss analyzing unit;
the water pump monitoring and analyzing unit is used for correspondingly running the water pump according to the preset rotating speed corresponding to each acquisition time point, so that the actual electric energy, the actual rotating speed and the actual water pressure of the water pump at each acquisition time point are monitored, and therefore the running qualification value corresponding to the water pump is calculated;
the operation qualification value corresponding to the water pump is calculated, and the specific calculation process is as follows:
comparing the preset rotating speed corresponding to each collecting time point of the water pump with the reference electric energy corresponding to each rotating speed of the water pump stored in the database to obtain the reference electric energy corresponding to each collecting time point of the water pump, and recording as W t T represents the corresponding number of each acquisition time point, t=1, 2..p., in the same way, the processing method comprises the steps of, comparing the preset rotating speed corresponding to each collecting time point of the water pump with the reference water pressure corresponding to each rotating speed of the water pump stored in the database to obtain the reference water pressure corresponding to each collecting time point of the water pump, and recording as F t Thereby substituting into the calculation formulaObtaining a corresponding operation qualified value alpha of the water pump, wherein W t ′、v′ t 、F t ' respectively represents the actual electric energy, the actual rotating speed, the actual water pressure, the DeltaW, the actual water pressure, the water pressure and the actual water pressure of the water pump, which correspond to the t-th acquisition time point,Deltav and DeltaF are respectively set allowable electric energy difference, allowable rotation speed difference and allowable water pressure difference, and gamma 1, gamma 2 and gamma 3 are respectively set weighting factors corresponding to actual electric energy, actual rotation speed and actual water pressure of the water pump;
the pipeline monitoring and analyzing unit is used for monitoring the information of the water supply pipeline corresponding to each water consumption point at each acquisition time point, and further calculating the pipeline operation qualification value corresponding to each water consumption point;
the water supply pipeline information comprises inlet water pressure, inlet water flow, inlet water quality information, outlet water pressure, outlet water flow and outlet water quality information;
the water quality information comprises water turbidity, water pH value, water hardness and water conductivity;
the pipeline operation qualification value corresponding to each water consumption point is calculated, and the concrete calculation process is as follows:
obtaining standard water quality information corresponding to each water point from a database, analyzing and obtaining water quality safety coefficients corresponding to each water point according to inlet water quality information, outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point, and recording asi represents the number corresponding to each water point, i=1, 2. Once again, n is,
calculating according to the inlet water pressure, the inlet water flow, the outlet water pressure and the outlet water flow corresponding to each water point at each acquisition time point to obtain the state evaluation coefficient of the water supply pipeline corresponding to each water point, and recording as
According to the statistical formulaObtaining the pipeline operation qualified value corresponding to each water point>Wherein mu 1 and mu 2 are respectively set water quality safetyThe total coefficient and the weight factor corresponding to the state evaluation coefficient of the water supply pipeline;
the water quality safety coefficient corresponding to each water consumption point is obtained through analysis, and the specific analysis process is as follows:
the turbidity of the inlet water, the pH value of the inlet water, the hardness of the inlet water, the water inlet water conductivity, the turbidity of the outlet water, the pH value of the outlet water, the hardness of the outlet water and the conductivity of the outlet water corresponding to each water point at each collecting time point are respectively recorded as z1 it 、pH1 it 、y1 it 、d1 it 、z2 it 、pH2 it 、y2 it 、d2 it T represents the number corresponding to each acquisition time point, t=1, 2
Obtaining a first water quality safety coefficient corresponding to each water pointWherein Δz, Δph, Δy, Δd are respectively set allowable water turbidity difference, allowable pH difference, allowable water hardness difference, allowable water conductivity difference, μ1, μ2, μ3, μ4 are respectively set weight factors corresponding to water turbidity difference, pH difference, water hardness difference, water conductivity difference, e represents a natural constant;
calculating outlet water quality information and standard water quality information corresponding to each water point at each acquisition time point according to the calculation mode of the first water quality safety coefficient corresponding to each water point to obtain a second water quality safety coefficient corresponding to each water point, and marking asWhereby ∈10 according to the statistical formula>Obtaining the water quality safety coefficient corresponding to each water point>Wherein sigma 1 and sigma 2 are respectively set weight factors corresponding to the first water quality safety coefficient and the second water quality safety coefficient;
the calculation formula of the state evaluation coefficient of each water consumption point corresponding to the water supply pipeline is as follows:wherein F1 it 、v1 it 、F2 it 、v2 it Respectively representing inlet water pressure, inlet water flow, outlet water pressure and outlet water flow corresponding to the ith water point at the t acquisition time point, wherein DeltaF ', deltav' are respectively set allowable water pressure drop values and allowable water flow drop values, and tau 1 and tau 2 are respectively set weight factors corresponding to the water pressure drop values and the water flow drop values;
the equipment energy-saving judging module is used for judging the pipeline running states corresponding to the water pump and the water points according to the running qualification value corresponding to the water pump and the pipeline running qualification value corresponding to the water points;
the early warning terminal is used for carrying out early warning prompt when the water flow corresponding to a certain water consumption point at a certain acquisition time point is abnormal and the running state of the water pump or the pipeline corresponding to the certain water consumption point is in an abnormal state.
2. The system of claim 1, wherein the specific determining process is as follows:
recording the water flow corresponding to each water point at each collecting time point as vs it Wherein i represents the number corresponding to each water point, i=1, 2....n, t represents the number corresponding to each acquisition time point, t=1, 2. The term p is used herein, extracting the historical maximum water flow corresponding to each water point from the database, and recording the historical maximum water flow as vs imax Thereby substituting into the calculation formulaIn the process, each water point is obtainedWater flow evaluation coefficient corresponding to acquisition time point +.>Wherein Deltavs is the set allowable water flow difference, and epsilon is the compensation factor corresponding to the set water flow evaluation coefficient;
comparing the water flow evaluation coefficient corresponding to each water use point at each collection time point with the water flow evaluation coefficient threshold stored in the database, if the water flow evaluation coefficient corresponding to a certain water use point at a certain collection time point is smaller than the water flow evaluation coefficient threshold stored in the database, judging that the water flow corresponding to the water use point at the collection time point is abnormal, otherwise, judging that the water flow corresponding to the water use point at the collection time point is normal, and judging whether the water flow corresponding to each water use point at each collection time point is normal or not in the mode.
3. The efficient and energy-saving circulating water utilization system according to claim 1, wherein the calculating the preset rotation speed of the water pump corresponding to each collecting time point comprises the following specific calculating process:
removing the water flow corresponding to each target water point at each acquisition time point from the water flow corresponding to each target water point at each acquisition time point, and further calculating to obtain the average water flow change rate corresponding to each target water point, so as to obtain the target water flow corresponding to each target water point at each target acquisition time point, and replacing the corresponding water flow with the target water flow corresponding to each target water point at each target acquisition time point, so as to obtain the actual water flow corresponding to each target water point at each acquisition time point;
the method comprises the steps of obtaining the corresponding length of a water supply pipeline corresponding to each water consumption point from a database, calculating to obtain a water pressure influence factor corresponding to each water consumption point, obtaining a reference water pump rotating speed corresponding to each collection time point of each target water consumption point based on a reference water pump rotating speed corresponding to each water flow interval stored in the database, multiplying the reference water pump rotating speed corresponding to each collection time point of each target water consumption point by the water pressure influence factor corresponding to each water consumption point to obtain a water pump rotating speed corresponding to each collection time point of each target water consumption point, comparing the water pump rotating speeds corresponding to each collection time point of each target water consumption point with each other, and taking the maximum rotating speed of each collection time point as a preset rotating speed corresponding to each collection time point of a water pump.
4. The efficient and energy-saving water recycling system according to claim 1, wherein the judging of the running states of the water pump and the pipelines corresponding to the water points comprises the following specific judging process: comparing the operation qualified value corresponding to the water pump with the water pump operation qualified value threshold stored in the database, if the operation qualified value corresponding to the water pump is greater than or equal to the water pump operation qualified value threshold, judging that the operation state corresponding to the water pump is in a normal state, otherwise, judging that the operation state corresponding to the water pump is in an abnormal state;
comparing the pipeline operation qualified value corresponding to each water point with the water point pipeline operation qualified value threshold stored in the database, if the pipeline operation qualified value corresponding to a certain water point is greater than or equal to the water point pipeline operation qualified value threshold, judging that the pipeline operation state corresponding to the water point is in a normal state, otherwise, judging that the pipeline operation state corresponding to the water point is in an abnormal state, and judging the pipeline operation state corresponding to each water point in this way.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202311128638.9A CN117345596B (en) | 2023-09-04 | 2023-09-04 | Efficient energy-saving circulating water utilization system |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN202311128638.9A CN117345596B (en) | 2023-09-04 | 2023-09-04 | Efficient energy-saving circulating water utilization system |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CN117345596A CN117345596A (en) | 2024-01-05 |
| CN117345596B true CN117345596B (en) | 2024-04-16 |
Family
ID=89354729
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN202311128638.9A Active CN117345596B (en) | 2023-09-04 | 2023-09-04 | Efficient energy-saving circulating water utilization system |
Country Status (1)
| Country | Link |
|---|---|
| CN (1) | CN117345596B (en) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN117928656B (en) * | 2024-03-22 | 2024-05-28 | 吉林东大天然气有限公司 | Informationized control platform based on natural gas safety production |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR101464087B1 (en) * | 2013-11-04 | 2014-11-21 | 복상흠 | Test system for vehicle pump |
| CN110716978A (en) * | 2019-08-23 | 2020-01-21 | 生态环境部华南环境科学研究所 | Mountain reservoir type water source intelligent management method |
| CN112502952A (en) * | 2020-11-23 | 2021-03-16 | 湖北佳狮盾智能技术有限公司 | Be used for long-range accurate control system of water pump |
| CN113945699A (en) * | 2021-10-25 | 2022-01-18 | 沈阳和同科技有限公司 | Intelligent water quality analysis and assay management system |
-
2023
- 2023-09-04 CN CN202311128638.9A patent/CN117345596B/en active Active
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR101464087B1 (en) * | 2013-11-04 | 2014-11-21 | 복상흠 | Test system for vehicle pump |
| CN110716978A (en) * | 2019-08-23 | 2020-01-21 | 生态环境部华南环境科学研究所 | Mountain reservoir type water source intelligent management method |
| CN112502952A (en) * | 2020-11-23 | 2021-03-16 | 湖北佳狮盾智能技术有限公司 | Be used for long-range accurate control system of water pump |
| CN113945699A (en) * | 2021-10-25 | 2022-01-18 | 沈阳和同科技有限公司 | Intelligent water quality analysis and assay management system |
Also Published As
| Publication number | Publication date |
|---|---|
| CN117345596A (en) | 2024-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN117345596B (en) | Efficient energy-saving circulating water utilization system | |
| CN104083936A (en) | Method for monitoring state of filter element of water purification device, monitoring device and water purification device | |
| CN112730938B (en) | Electricity larceny user judging method based on electricity utilization acquisition big data | |
| CN112070353B (en) | Method and system for accurately detecting energy efficiency of data center | |
| CN112903052A (en) | Water leakage monitoring method and system based on abnormal water consumption of water meter | |
| CN111210083A (en) | Pipe network abnormity analysis method | |
| CN107942969A (en) | A kind of water plant automation monitoring system | |
| CN114358972A (en) | Intelligent water affair comprehensive intelligent management method, cloud system and storage medium | |
| CN116816654B (en) | Intelligent control system of concrete delivery pump | |
| CN107767292B (en) | Intelligent water supply management system and method thereof | |
| CN112099458A (en) | Artificial intelligence sewage operation system | |
| CN115128991A (en) | Sewage pump station monitoring method based on OPC UA | |
| CN115132389A (en) | Method, device, equipment and storage medium for predicting seawater leakage of condenser of nuclear power plant | |
| CN113309173B (en) | Water supply system optimization method and adjustment method for community water supply system | |
| CN115165253A (en) | Water valve water leakage detection method and device, water valve and storage medium | |
| CN114116843A (en) | Village and town small sewage treatment facility operation monitoring method based on electricity consumption data | |
| CN117494941B (en) | Household water data processing method, device and equipment | |
| CN115472277B (en) | Medical water remote monitoring management and control system | |
| CN111027751B (en) | Method and device for predicting maintenance time of evaporator | |
| CN214427823U (en) | Combined control device for reducing salt content of raw water of power plant during seawater backflow | |
| CN107192091A (en) | Pump of hospital's air-conditioning and secondary pump energy-saving control method and system | |
| CN117979667B (en) | Circulating cooling water control system, method, equipment and medium for large-scale machine room | |
| TW201802752A (en) | Smart water supply management system and method thereof capable of preventing frequent water pumping during the electricity peak time | |
| CN107728661B (en) | Control method, system, terminal equipment and medium for seawater desalination and water production | |
| CN115539850A (en) | Water leakage self-monitoring method for water supply pipe network of user side |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PB01 | Publication | ||
| PB01 | Publication | ||
| SE01 | Entry into force of request for substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| GR01 | Patent grant | ||
| GR01 | Patent grant |