CN101565398B - Process for preparing atazanavir bisulfate and novel forms - Google Patents
Process for preparing atazanavir bisulfate and novel forms Download PDFInfo
- Publication number
- CN101565398B CN101565398B CN200910145402XA CN200910145402A CN101565398B CN 101565398 B CN101565398 B CN 101565398B CN 200910145402X A CN200910145402X A CN 200910145402XA CN 200910145402 A CN200910145402 A CN 200910145402A CN 101565398 B CN101565398 B CN 101565398B
- Authority
- CN
- China
- Prior art keywords
- zrivada
- pattern material
- shape crystal
- shape
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- AXRYRYVKAWYZBR-GASGPIRDSA-N atazanavir Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)[C@@H](O)CN(CC=1C=CC(=CC=1)C=1N=CC=CC=1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C1=CC=CC=C1 AXRYRYVKAWYZBR-GASGPIRDSA-N 0.000 title claims abstract description 140
- 108010019625 Atazanavir Sulfate Proteins 0.000 title claims abstract description 43
- AXRYRYVKAWYZBR-UHFFFAOYSA-N Atazanavir Natural products C=1C=C(C=2N=CC=CC=2)C=CC=1CN(NC(=O)C(NC(=O)OC)C(C)(C)C)CC(O)C(NC(=O)C(NC(=O)OC)C(C)(C)C)CC1=CC=CC=C1 AXRYRYVKAWYZBR-UHFFFAOYSA-N 0.000 title abstract description 9
- 229960003277 atazanavir Drugs 0.000 title abstract description 9
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 title abstract 8
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000013078 crystal Substances 0.000 claims abstract description 73
- 239000000463 material Substances 0.000 claims abstract description 61
- 238000000034 method Methods 0.000 claims abstract description 61
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 40
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 26
- 239000011541 reaction mixture Substances 0.000 claims abstract description 20
- 230000015572 biosynthetic process Effects 0.000 claims abstract description 10
- 239000012458 free base Substances 0.000 claims abstract description 9
- 239000003513 alkali Substances 0.000 claims description 57
- 239000000203 mixture Substances 0.000 claims description 56
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 50
- 239000002904 solvent Substances 0.000 claims description 46
- 238000002425 crystallisation Methods 0.000 claims description 36
- 229940107904 reyataz Drugs 0.000 claims description 34
- 230000008025 crystallization Effects 0.000 claims description 33
- 238000002360 preparation method Methods 0.000 claims description 23
- 239000000843 powder Substances 0.000 claims description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 18
- -1 amine salt Chemical class 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 15
- 238000001035 drying Methods 0.000 claims description 14
- 238000005550 wet granulation Methods 0.000 claims description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 12
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 9
- 239000003960 organic solvent Substances 0.000 claims description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 230000001186 cumulative effect Effects 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 239000002994 raw material Substances 0.000 claims description 4
- 238000011081 inoculation Methods 0.000 claims description 3
- 230000004044 response Effects 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 229910019142 PO4 Inorganic materials 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 claims 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims 1
- 150000003840 hydrochlorides Chemical class 0.000 claims 1
- 150000007530 organic bases Chemical class 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims 1
- 239000010452 phosphate Substances 0.000 claims 1
- 230000008569 process Effects 0.000 abstract description 6
- 239000012453 solvate Substances 0.000 abstract description 6
- 229940122440 HIV protease inhibitor Drugs 0.000 abstract description 5
- 239000004030 hiv protease inhibitor Substances 0.000 abstract description 5
- 239000000243 solution Substances 0.000 description 28
- 239000000047 product Substances 0.000 description 22
- 239000003795 chemical substances by application Substances 0.000 description 19
- 125000004429 atom Chemical group 0.000 description 17
- 239000002775 capsule Substances 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 15
- 238000000634 powder X-ray diffraction Methods 0.000 description 15
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 14
- 239000002245 particle Substances 0.000 description 13
- 239000002002 slurry Substances 0.000 description 12
- 239000003814 drug Substances 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 238000000371 solid-state nuclear magnetic resonance spectroscopy Methods 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- 229960004756 ethanol Drugs 0.000 description 9
- 238000001757 thermogravimetry curve Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 8
- 229960000913 crospovidone Drugs 0.000 description 8
- 238000005516 engineering process Methods 0.000 description 8
- 238000005259 measurement Methods 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 8
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 8
- 238000004088 simulation Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000002411 thermogravimetry Methods 0.000 description 8
- 230000004580 weight loss Effects 0.000 description 8
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 7
- 239000008101 lactose Substances 0.000 description 7
- 235000019359 magnesium stearate Nutrition 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 239000011877 solvent mixture Substances 0.000 description 6
- 239000003981 vehicle Substances 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 229920000881 Modified starch Polymers 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 238000002447 crystallographic data Methods 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 239000002351 wastewater Substances 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- 208000030507 AIDS Diseases 0.000 description 3
- 125000003440 L-leucyl group Chemical group O=C([*])[C@](N([H])[H])([H])C([H])([H])C(C([H])([H])[H])([H])C([H])([H])[H] 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 238000002441 X-ray diffraction Methods 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- MEIRRNXMZYDVDW-MQQKCMAXSA-N (2E,4E)-2,4-hexadien-1-ol Chemical compound C\C=C\C=C\CO MEIRRNXMZYDVDW-MQQKCMAXSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- WSVLPVUVIUVCRA-KPKNDVKVSA-N Alpha-lactose monohydrate Chemical compound O.O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O WSVLPVUVIUVCRA-KPKNDVKVSA-N 0.000 description 2
- 108010011485 Aspartame Proteins 0.000 description 2
- 0 C*(C)(C)[C@](C(O)=O)NC(OC)=O Chemical compound C*(C)(C)[C@](C(O)=O)NC(OC)=O 0.000 description 2
- 229920002785 Croscarmellose sodium Polymers 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical group CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000012296 anti-solvent Substances 0.000 description 2
- 239000000605 aspartame Substances 0.000 description 2
- 235000010357 aspartame Nutrition 0.000 description 2
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 2
- 229960003438 aspartame Drugs 0.000 description 2
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000004203 carnauba wax Substances 0.000 description 2
- 235000013869 carnauba wax Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229960001681 croscarmellose sodium Drugs 0.000 description 2
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 2
- 238000000113 differential scanning calorimetry Methods 0.000 description 2
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 239000007902 hard capsule Substances 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 238000007670 refining Methods 0.000 description 2
- 230000001177 retroviral effect Effects 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 238000010900 secondary nucleation Methods 0.000 description 2
- 238000005204 segregation Methods 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 241001430294 unidentified retrovirus Species 0.000 description 2
- 239000008371 vanilla flavor Substances 0.000 description 2
- XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- YTDMTTYOLYTDMS-LLVKDONJSA-N CC(C)(C)[C@@H](C(O[n]1nnc2c1cccc2)=O)NC(OC)=O Chemical compound CC(C)(C)[C@@H](C(O[n]1nnc2c1cccc2)=O)NC(OC)=O YTDMTTYOLYTDMS-LLVKDONJSA-N 0.000 description 1
- 101000898643 Candida albicans Vacuolar aspartic protease Proteins 0.000 description 1
- 101000898783 Candida tropicalis Candidapepsin Proteins 0.000 description 1
- 101000898784 Cryphonectria parasitica Endothiapepsin Proteins 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 235000002723 Dioscorea alata Nutrition 0.000 description 1
- 235000007056 Dioscorea composita Nutrition 0.000 description 1
- 235000009723 Dioscorea convolvulacea Nutrition 0.000 description 1
- 235000005362 Dioscorea floribunda Nutrition 0.000 description 1
- 235000004868 Dioscorea macrostachya Nutrition 0.000 description 1
- 235000005361 Dioscorea nummularia Nutrition 0.000 description 1
- 235000005360 Dioscorea spiculiflora Nutrition 0.000 description 1
- 239000004278 EU approved seasoning Substances 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000713772 Human immunodeficiency virus 1 Species 0.000 description 1
- 235000006350 Ipomoea batatas var. batatas Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- PVNBZINLTCHNCO-NHNZYLEHSA-N N[C@@H](Cc1ccccc1)[C@H](CN(Cc1ccc(C2NC#CC=C2)cc1)N)O Chemical compound N[C@@H](Cc1ccccc1)[C@H](CN(Cc1ccc(C2NC#CC=C2)cc1)N)O PVNBZINLTCHNCO-NHNZYLEHSA-N 0.000 description 1
- 241001597008 Nomeidae Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 101000933133 Rhizopus niveus Rhizopuspepsin-1 Proteins 0.000 description 1
- 101000910082 Rhizopus niveus Rhizopuspepsin-2 Proteins 0.000 description 1
- 101000910079 Rhizopus niveus Rhizopuspepsin-3 Proteins 0.000 description 1
- 101000910086 Rhizopus niveus Rhizopuspepsin-4 Proteins 0.000 description 1
- 101000910088 Rhizopus niveus Rhizopuspepsin-5 Proteins 0.000 description 1
- 101000898773 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) Saccharopepsin Proteins 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 229940022682 acetone Drugs 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001538 azepines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229940043232 butyl acetate Drugs 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 239000011549 crystallization solution Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229960000935 dehydrated alcohol Drugs 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000004807 desolvation Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229940096516 dextrates Drugs 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 235000004879 dioscorea Nutrition 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- MVPICKVDHDWCJQ-UHFFFAOYSA-N ethyl 3-pyrrolidin-1-ylpropanoate Chemical compound CCOC(=O)CCN1CCCC1 MVPICKVDHDWCJQ-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000003203 everyday effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 235000011194 food seasoning agent Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 229920000591 gum Polymers 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 235000012204 lemonade/lime carbonate Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000010907 mechanical stirring Methods 0.000 description 1
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 235000019633 pungent taste Nutrition 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000004445 quantitative analysis Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229940045902 sodium stearyl fumarate Drugs 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000012177 spermaceti Substances 0.000 description 1
- 229940084106 spermaceti Drugs 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000000811 xylitol Substances 0.000 description 1
- 235000010447 xylitol Nutrition 0.000 description 1
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 description 1
- 229960002675 xylitol Drugs 0.000 description 1
Images
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pretreatment Of Seeds And Plants (AREA)
- Medicines Containing Plant Substances (AREA)
Abstract
Description
Stage | mL/kg/h | mL(H 2SO 4)/h | g(H 2SO 4)/h | Time length (min) |
1 | 4.62 | 0.579 | 1.065 | 60 |
2 | 6.93 | 0.868 | 1.597 | 60 |
3 | 16.55 | 2.073 | 3.814 | 60 |
4 | 30.26 | 3.790 | 6.974 | 60 |
5 | 48.47 | 6.071 | 11.171 | 23 |
Atom | x | y | z | B(A2) |
S1 | 0.3230(4) | 0.5467(1) | 0.5608(5) | 8.0(1) |
O100 | 0.431(1) | 0.5060(3) | 0.649(1) | 11.1(3) |
O102 | 0.335(1) | 0.5498(4) | 0.383(1) | 12.0(4) |
O103 | 0.360(1) | 0.5877(4) | 0.655(2) | 12.0(4) |
O104 | 0.176(1) | 0.5384(4) | 0.528(1) | 11.8(4) |
S51 | 0.6177(4) | 0.4505(1) | 0.4003(5) | 7.2(1) |
O150 | 0.596(1) | 0.4430(4) | 0.564(1) | 12.5(4) |
O152 | 0.518(1) | 0.4921(4) | 0.317(1) | 13.8(4) |
O153 | 0.588(1) | 0.4121(3) | 0.289(2) | 12.2(4) |
O154 | 0.768(1) | 0.4587(4) | 0.454(1) | 12.1(4) |
O4 | 0.6985(7) | 0.1753(3) | 0.6456(9) | 5.7(2) |
O7 | 0.1687(8) | 0.1941(3) | 0.3411(9) | 6.5(2) |
O11 | -0.0352(7) | 0.2482(3) | 0.0308(8) | 5.7(2) |
O14 | 0.2280(7) | 0.1769(3) | -0.233(1) | 6.1(2) |
O15 | 0.0399(8) | 0.1335(3) | -0.330(1) | 6.4(2) |
O17 | 0.6169(7) | 0.2821(3) | 0.963(1) | 7.1(2) |
Atom | x | y | z | B(A2) |
O18 | 0.3750(7) | 0.2905(3) | 0.9136(9) | 6.2(2) |
N2 | 0.5015(9) | 0.2182(3) | 0.902(1) | 4.5(2) |
N5 | 0.4642(8) | 0.1647(3) | 0.6001(9) | 4.2(2) |
N9 | 0.2317(9) | 0.2788(3) | 0.256(1) | 5.1(2) |
N10 | 0.1820(9) | 0.2760(3) | 0.069(1) | 4.6(2) |
N13 | -0.0148(8) | 0.2083(3) | -0.280(1) | 4.6(2) |
N39 | -0.087(1) | 0.5265(3) | 0.272(1) | 6.1(3) |
C1 | 0.491(1) | 0.2627(4) | 0.924(1) | 5.5(3) |
C3 | 0.6381(9) | 0.1908(3) | 0.892(1) | 4.0(2) |
C4 | 0.600(1) | 0.1764(4) | 0.702(1) | 4.6(3) |
C6 | 0.420(1) | 0.1551(4) | 0.403(1) | 5.1(3) |
C7 | 0.295(1) | 0.1936(4) | 0.297(1) | 5.1(3) |
C8 | 0.357(1) | 0.2400(4) | 0.346(2) | 5.4(3) |
C11 | 0.051(1) | 0.2592(4) | -0.028(1) | 4.9(3) |
C12 | 0.024(1) | 0.2531(4) | -0.223(1) | 4.5(3) |
C14 | 0.094(1) | 0.1732(4) | -0.280(1) | 4.7(3) |
C16 | 0.146(2) | 0.0943(5) | -0.342(2) | 10.9(5) |
C19 | 0.616(1) | 0.3313(4) | 0.996(2) | 8.1(4) |
C20 | 0.701(1) | 0.1485(4) | 1.025(1) | 5.8(3) |
C21 | 0.842(1) | 0.1219(5) | 1.007(2) | 7.9(4) |
C22 | 0.583(2) | 0.1160(5) | 0.997(2) | 8.0(4) |
C23 | 0.748(2) | 0.1713(5) | 1.215(1) | 8.2(4) |
C24 | 0.365(1) | 0.1079(4) | 0.356(2) | 6.6(4) |
C25 | 0.484(1) | 0.0691(4) | 0.470(1) | 6.5(3) |
C26 | 0.643(2) | 0.0684(5) | 0.520(2) | 8.4(5) |
C27 | 0.753(2) | 0.0293(6) | 0.622(2) | 11.4(6) |
C28 | 0.709(3) | -0.0044(7) | 0.691(3) | 15.0(9) |
C29 | 0.553(2) | -0.0032(5) | 0.644(2) | 14.2(7) |
C30 | 0.441(2) | 0.0343(5) | 0.534(2) | 10.8(4) |
C31 | 0.291(1) | 0.3229(4) | 0.311(2) | 5.7(3) |
C32 | 0.177(1) | 0.3650(4) | 0.259(1) | 5.4(3) |
C33 | 0.224(1) | 0.4064(4) | 0.262(2) | 6.3(3) |
C34 | 0.122(1) | 0.4487(5) | 0.233(2) | 6.9(4) |
C35 | -0.031(1) | 0.4469(4) | 0.189(1) | 4.8(3) |
C36 | -0.081(1) | 0.4043(4) | 0.180(1) | 5.6(3) |
C37 | 0.019(1) | 0.3629(4) | 0.218(1) | 5.4(3) |
C38 | -0.136(1) | 0.4918(4) | 0.170(1) | 5.3(3) |
C40 | -0.170(1) | 0.5683(4) | 0.279(2) | 7.8(4) |
C41 | -0.318(2) | 0.5736(5) | 0.158(2) | 9.1(5) |
C42 | -0.376(2) | 0.5403(5) | 0.035(2) | 9.0(5) |
C43 | -0.283(1) | 0.4964(5) | 0.039(2) | 8.1(4) |
C44 | -0.096(1) | 0.2937(4) | -0.345(1) | 6.2(3) |
C45 | -0.258(1) | 0.2901(5) | -0.366(2) | 8.5(4) |
C46 | -0.085(2) | 0.2890(6) | -0.530(2) | 10.8(5) |
Atom | x | y | z | B(A2) |
C47 | -0.057(2) | 0.3393(5) | -0.265(2) | 8.9(5) |
O54 | 0.2347(7) | 0.8167(3) | 0.8392(8) | 5.3(2) |
O57 | 0.7713(8) | 0.7950(3) | 1.0561(9) | 5.9(2) |
O61 | 0.9725(7) | 0.7436(3) | 0.9141(8) | 5.3(2) |
O64 | 0.7062(7) | 0.8164(3) | 0.427(1) | 5.9(2) |
O65 | 0.8911(8) | 0.8598(2) | 0.535(1) | 6.1(2) |
O67 | 0.3150(8) | 0.7090(3) | 1.184(1) | 6.4(2) |
O68 | 0.5587(9) | 0.6986(3) | 1.377(1) | 6.6(2) |
N52 | 0.4313(9) | 0.7713(3) | 1.271(1) | 4.9(2) |
N55 | 0.4709(8) | 0.8265(3) | 1.0332(9) | 4.2(2) |
N60 | 0.7555(8) | 0.7179(3) | 0.728(1) | 4.6(2) |
N63 | 0.9491(8) | 0.7852(3) | 0.601(1) | 4.4(2) |
N89 | 1.026(1) | 0.4719(3) | 0.711(1) | 6.0(3) |
C51 | 0.442(1) | 0.7247(4) | 1.282(1) | 5.4(3) |
C53 | 0.296(1) | 0.7996(4) | 1.141(1) | 5.1(3) |
C54 | 0.3347(9) | 0.8159(3) | 0.989(1) | 4.1(3) |
C56 | 0.519(1) | 0.8353(4) | 0.887(1) | 4.7(3) |
C57 | 0.644(1) | 0.7959(4) | 0.886(1) | 4.5(3) |
C58 | 0.587(1) | 0.7494(4) | 0.854(1) | 5.2(3) |
C61 | 0.884(1) | 0.7334(4) | 0.766(1) | 4.2(3) |
C62 | 0.914(1) | 0.7392(4) | 0.603(1) | 4.4(3) |
C64 | 0.839(1) | 0.8196(4) | 0.513(1) | 4.6(3) |
C66 | 0.785(2) | 0.8996(5) | 0.433(3) | 12.1(7) |
C69 | 0.323(1) | 0.6588(4) | 1.202(2) | 8.8(5) |
C70 | 0.237(1) | 0.8409(4) | 1.232(1) | 5.6(3) |
C71 | 0.092(1) | 0.8701(5) | 1.080(2) | 7.6(4) |
C72 | 0.352(1) | 0.8744(4) | 1.328(2) | 7.1(4) |
C73 | 0.187(1) | 0.8195(6) | 1.362(1) | 8.9(4) |
C74 | 0.570(1) | 0.8825(4) | 0.907(2) | 6.4(3) |
C75 | 0.450(1) | 0.9206(4) | 0.919(1) | 6.3(3) |
C76 | 0.296(2) | 0.9236(5) | 0.813(2) | 8.1(4) |
C77 | 0.188(2) | 0.9614(6) | 0.826(2) | 11.2(5) |
C78 | 0.244(2) | 0.9942(6) | 0.960(2) | 15.2(7) |
C79 | 0.405(3) | 0.9935(6) | 1.062(2) | 13.9(7) |
C80 | 0.504(2) | 0.9552(4) | 1.043(2) | 9.3(5) |
C81 | 0.644(1) | 0.6672(4) | 0.832(2) | 6.2(3) |
C82 | 0.762(1) | 0.6266(3) | 0.839(1) | 4.7(3) |
C83 | 0.723(1) | 0.5934(4) | 0.696(2) | 6.1(3) |
C84 | 0.822(1) | 0.5547(4) | 0.695(2) | 5.9(3) |
C85 | 0.967(1) | 0.5478(4) | 0.828(1) | 5.0(3) |
C86 | 1.009(1) | 0.5783(4) | 0.971(2) | 6.6(4) |
C87 | 0.908(1) | 0.6184(4) | 0.971(2) | 6.4(4) |
C88 | 1.076(1) | 0.5070(4) | 0.827(1) | 5.5(3) |
C90 | 1.111(1) | 0.4326(4) | 0.690(2) | 7.4(4) |
Atom | x | y | z | B(A2) |
C91 | 1.258(2) | 0.4262(5) | 0.792(2) | 7.8(4) |
C92 | 1.324(2) | 0.4578(5) | 0.918(2) | 8.7(5) |
C93 | 1.230(1) | 0.4994(5) | 0.936(2) | 6.9(4) |
C94 | 1.038(1) | 0.7005(4) | 0.584(1) | 4.8(3) |
C95 | 1.196(1) | 0.7055(4) | 0.717(2) | 6.7(4) |
C96 | 1.021(2) | 0.7049(5) | 0.392(2) | 8.9(4) |
C97 | 0.998(1) | 0.6536(4) | 0.614(2) | 7.6(4) |
N59 | 0.7084(8) | 0.7114(3) | 0.866(1) | 5.1(2) |
H391 | 0.047 | 0.523 | 0.383 | 6.0 * |
H891 | 0.931 | 0.477 | 0.646 | 5.8 * |
H15′ | 0.491 | 0.471 | 0.600 | 3.8 * |
H15″ | 0.440 | 0.512 | 0.322 | 4.6 * |
δ/ppm |
26.9 |
27.5 |
33.9 |
37.7 |
49.2 |
53.5 |
62.7 |
63.3 |
66.0 |
69.2 |
69.5 |
122.6 |
123.7 |
125.3 |
126.1 |
127.6 |
128.5 |
129.4 |
131.1 |
134.4 |
138.8 |
139.7 |
140.6 |
143.2 |
143.9 |
149.9 |
150.3 |
153.9 |
159.3 |
172.0 |
Atom | x | y | z | B(A2) | Occupancy (occupany) (if being not equal to 1) |
S99 | 0.5568(1) | 0.0760(1) | 0.5936(1) | 3.45(2) | |
O1 | 0.4200(5) | 0.5541(4) | 0.8496(5) | 6.9(1) | |
O2 | 0.2889(5) | 0.6016(4) | 1.0066(6) | 8.1(1) | |
O4 | 0.7004(4) | 0.4509(3) | 1.0233(4) | 4.23(8) | |
O8 | 0.2913(4) | 0.2932(3) | 1.1074(4) | 4.23(8) | |
O12 | 0.1057(4) | 0.1088(3) | 0.9299(4) | 4.16(8) | |
O15′ | 0.329(1) | -0.0602(9) | 1.064(1) | 4.8(3) * | .3 |
O15″ | 0.324(2) | -0.156(1) | 1.003(2) | 3.2(3) * | .17 |
Atom | x | y | z | B(A2) | Occupancy (if being not equal to 1) |
O15 | 0.3312(7) | -0.1150(6) | 1.0380(8) | 4.9(1) * | .53 |
O16 | 0.1810(5) | -0.1433(3) | 1.1819(4) | 5.7(1) | |
O86 | 0.391(1) | 0.6646(7) | 0.6196(9) | 11.5(4) | |
O89 | 0.3714(7) | 0.5646(5) | 0.3408(6) | 6.5(2) | |
O90 | 0.7502(4) | 0.2721(3) | 0.8957(5) | 4.99(9) | |
O95 | 0.4984(4) | 0.0446(3) | 0.7188(4) | 4.50(8) | |
O96 | 0.6644(4) | 0.0315(3) | 0.5660(4) | 4.83(8) | |
O97 | 0.4651(4) | 0.0667(3) | 0.4636(4) | 5.08(9) | |
O98 | 0.6112(5) | 0.1957(3) | 0.6332(5) | 5.9(1) | |
N2 | 0.4938(5) | 0.6229(3) | 1.0921(5) | 4.8(1) | |
N5 | 0.5365(4) | 0.4385(3) | 1.1609(4) | 3.16(8) | |
N10 | 0.2952(4) | 0.2239(3) | 0.8056(4) | 3.17(8) | |
N11 | 0.2716(4) | 0.1163(3) | 0.7961(4) | 3.08(8) | |
N14 | 0.1336(5) | -0.0874(4) | 0.9743(5) | 4.9(1) | |
N38 | -0.2764(4) | 0.0574(3) | 0.2878(4) | 3.24(8) | |
C1 | 0.4011(6) | 0.5893(4) | 0.9712(7) | 5.3(1) | |
C3 | 0.6225(5) | 0.6026(4) | 1.0813(5) | 3.9(1) | |
C4 | 0.6231(5) | 0.4896(3) | 1.0873(5) | 3.19(9) | |
C6 | 0.5220(5) | 0.3284(3) | 1.1691(5) | 3.14(9) | |
C8 | 0.4026(5) | 0.2632(3) | 1.0653(5) | 3.21(9) | |
C9 | 0.4165(5) | 0.2747(4) | 0.9050(5) | 3.6(1) | |
C12 | 0.1740(5) | 0.0661(4) | 0.8596(5) | 3.4(1) | |
C13 | 0.1592(5) | -0.0523(4) | 0.8367(5) | 3.8(1) | |
C15 | 0.2248(6) | -0.1124(5) | 1.0627(6) | 4.6(1) | |
C17 | 0.2720(9) | -0.1732(6) | 1.2842(7) | 7.3(2) | |
C18 | 0.1818(9) | 0.5715(9) | 0.894(1) | 11.2(3) | |
C19 | 0.7292(7) | 0.6818(4) | 1.1928(7) | 5.8(2) | |
C20 | 0.725(1) | 0.7914(6) | 1.169(1) | 10.7(3) | |
C21 | 0.8613(9) | 0.6645(8) | 1.165(1) | 10.5(3) | |
C22 | 0.710(1) | 0.6694(7) | 1.3507(8) | 10.2(3) | |
C23 | 0.5158(5) | 0.3135(4) | 1.3298(5) | 3.8(1) | |
C24 | 0.6305(6) | 0.3765(4) | 1.4359(5) | 4.0(1) | |
C25 | 0.7519(7) | 0.3708(6) | 1.4192(7) | 6.1(2) | |
C26 | 0.8581(7) | 0.4279(7) | 1.5213(9) | 7.9(2) | |
C27 | 0.8398(8) | 0.4935(6) | 1.6375(8) | 8.6(2) | |
C28 | 0.715(1) | 0.5002(6) | 1.6576(7) | 8.0(2) | |
C29 | 0.6112(8) | 0.4430(5) | 1.5589(6) | 6.0(2) | |
C30 | 0.3043(5) | 0.2519(4) | 0.6582(5) | 3.6(1) | |
C31 | 0.1813(5) | 0.2051(4) | 0.5532(5) | 3.4(1) | |
C32 | 0.0645(5) | 0.2123(4) | 0.5934(5) | 3.9(1) | |
C33 | -0.0489(5) | 0.1725(4) | 0.4957(5) | 3.8(1) | |
C34 | -0.0441(5) | 0.1243(4) | 0.3503(5) | 3.16(9) | |
C35 | 0.0756(5) | 0.1176(4) | 0.3097(5) | 3.9(1) | |
Atom | x | y | z | B(A2) | Occupancy (if being not equal to 1) |
C36 | 0.1867(5) | 0.1568(4) | 0.4095(5) | 3.9(1) | |
C37 | -0.1615(5) | 0.0853(4) | 0.2417(4) | 3.11(9) | |
C39 | -0.3885(5) | 0.0247(4) | 0.1969(5) | 3.9(1) | |
C40 | -0.3891(5) | 0.0200(4) | 0.0470(5) | 4.2(1) | |
C41 | -0.2737(6) | 0.0469(4) | -0.0057(5) | 4.1(1) | |
C42 | -0.1596(5) | 0.0781(4) | 0.0890(5) | 3.7(1) | |
C43 | 0.0488(6) | -0.1114(4) | 0.7094(6) | 4.6(1) | |
C44 | -0.0819(7) | -0.0958(6) | 0.7378(9) | 6.8(2) | |
C45 | 0.0496(9) | -0.2266(5) | 0.6929(9) | 7.8(2) | |
C46 | 0.0797(8) | -0.0738(5) | 0.5667(7) | 6.2(2) | |
C84 | 0.569(1) | 0.7880(9) | 0.725(1) | 6.3(3) | |
C85 | 0.448(1) | 0.7726(9) | 0.673(2) | 8.4(4) | |
C87 | 0.204(1) | 0.449(1) | 0.405(2) | 10.6(4) | |
C88 | 0.240(1) | 0.517(1) | 0.316(1) | 8.6(3) | |
C91 | 0.8826(7) | 0.2919(5) | 0.8896(8) | 5.8(2) | |
C92 | 0.9613(7) | 0.3439(6) | 1.035(1) | 7.8(2) | |
H381 | -0.275 | 0.053 | 0.403 | 3.2 | |
H891 | 0.397 | 0.602 | 0.446 | 6.6 | |
H981 | 0.658 | 0.219 | 0.717 | 6.6 |
Composition | Feed particles a (%w/w) | 50mg capsule (mg/ capsule) | 100mg capsule (mg/ capsule) | 200mg capsule (mg/ capsule) |
Zrivada | 63.2 | 56.84 b | 113.67 b | 227.34 b |
Lactose, monohydrate, NF | 30.4 | 27.33 c | 54.69 c | 109.35 c |
Crospovidone, NF | 6.0 | 5.39 | 10.79 | 21.58 |
Magnesium Stearate, NF | 0.4 | 0.36 d | 0.72 d | 1.44 d |
Pure water, USP or water for injection, USP | q.s. e | q.s. e | q.s. e | q.s. e |
The #4 capsule | - | Each is 1 years old | - | - |
The #2 capsule | - | - | Each is 1 years old | - |
The #0 capsule | - | - | - | Each is 1 years old |
Total filling weight | 100.0 | 89.9 | 179.9 | 359.7 |
Composition | Amount (%w/w) |
Zrivada A shape | 3.79 |
Aspartame, NF | 10.00 |
Sucrose, NF | 81.21 |
The orange vanilla flavor | 5.00 |
Claims (18)
Applications Claiming Priority (6)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US56804304P | 2004-05-04 | 2004-05-04 | |
US60/568043 | 2004-05-04 | ||
US60753304P | 2004-09-07 | 2004-09-07 | |
US60/607533 | 2004-09-07 | ||
US11/119,558 US7829720B2 (en) | 2004-05-04 | 2005-05-02 | Process for preparing atazanavir bisulfate and novel forms |
US11/119558 | 2005-05-02 |
Related Parent Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN2005800225502A Division CN1980666B (en) | 2004-05-04 | 2005-05-03 | Process for preparing atazanavir bisulfate and novel forms |
Publications (2)
Publication Number | Publication Date |
---|---|
CN101565398A CN101565398A (en) | 2009-10-28 |
CN101565398B true CN101565398B (en) | 2011-12-14 |
Family
ID=38131508
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN200910145402XA Active CN101565398B (en) | 2004-05-04 | 2005-05-03 | Process for preparing atazanavir bisulfate and novel forms |
CN2005800225502A Active CN1980666B (en) | 2004-05-04 | 2005-05-03 | Process for preparing atazanavir bisulfate and novel forms |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN2005800225502A Active CN1980666B (en) | 2004-05-04 | 2005-05-03 | Process for preparing atazanavir bisulfate and novel forms |
Country Status (3)
Country | Link |
---|---|
CN (2) | CN101565398B (en) |
AR (1) | AR099594A2 (en) |
ZA (1) | ZA200609084B (en) |
Families Citing this family (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN102911113B (en) * | 2011-08-05 | 2015-08-19 | 浙江九洲药业股份有限公司 | A kind of preparation method of Reyataz R |
CN103664753B (en) * | 2012-09-04 | 2017-04-26 | 上海迪赛诺化学制药有限公司 | Method for preparing atazanavir disulfate A-type crystal |
CN104163787A (en) * | 2014-08-08 | 2014-11-26 | 山东威智医药工业有限公司 | Preparation methods of Atazanavir and sulfate of Atazanavir |
CN105859611A (en) * | 2016-04-18 | 2016-08-17 | 上海现代制药海门有限公司 | Method for preparing A-type crystal of Atazanavir disulfate |
CN109251165B (en) * | 2018-10-02 | 2022-09-23 | 国药集团川抗制药有限公司 | Atazanavir darby 4-aminobenzenesulfonate and preparation method thereof |
CN115215792A (en) * | 2022-06-27 | 2022-10-21 | 江西富祥药业股份有限公司 | Method for preparing atazanavir or sulfate thereof |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN1283188A (en) * | 1998-01-20 | 2001-02-07 | 布里斯托尔-米尔斯·斯奎布公司 | Bisulfate salt of HIV protease inhibitor |
CN1319587A (en) * | 1996-04-22 | 2001-10-31 | 诺瓦提斯公司 | Heterocyclonitrogen heteroethane derivant with antiviral activity |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US5849911A (en) * | 1996-04-22 | 1998-12-15 | Novartis Finance Corporation | Antivirally active heterocyclic azahexane derivatives |
-
2005
- 2005-05-03 CN CN200910145402XA patent/CN101565398B/en active Active
- 2005-05-03 CN CN2005800225502A patent/CN1980666B/en active Active
-
2006
- 2006-10-31 ZA ZA200609084A patent/ZA200609084B/en unknown
-
2015
- 2015-02-27 AR ARP150100592A patent/AR099594A2/en not_active Application Discontinuation
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN1319587A (en) * | 1996-04-22 | 2001-10-31 | 诺瓦提斯公司 | Heterocyclonitrogen heteroethane derivant with antiviral activity |
CN1283188A (en) * | 1998-01-20 | 2001-02-07 | 布里斯托尔-米尔斯·斯奎布公司 | Bisulfate salt of HIV protease inhibitor |
Also Published As
Publication number | Publication date |
---|---|
CN1980666A (en) | 2007-06-13 |
AR099594A2 (en) | 2016-08-03 |
ZA200609084B (en) | 2008-08-27 |
CN101565398A (en) | 2009-10-28 |
CN1980666B (en) | 2011-03-30 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US11939346B2 (en) | Preparation of psilocybin, different polymorphic forms, intermediates, formulations and their use | |
CN102153505B (en) | n-(4-fluorobenzyl)-n-(1-methylpiperidin-4-yl)-n'-(4-(2-methylpropyloxy)phenylmethyl)carbamide and their preparation and crystalline form of its tartrate | |
AU2010201538B2 (en) | Process for preparing atazanavir bisulfate and novel forms | |
CN101565398B (en) | Process for preparing atazanavir bisulfate and novel forms | |
PT970955E (en) | PAROXETINE METHOSULPHONATE | |
CN102272124B (en) | New crystal form of sunitinib malate | |
TWI445697B (en) | Process for preparing atazanavir bisulfate and novel forms | |
CN101778821A (en) | Synthesizing of N-(4-luorobenzyl)-N-(1-methyl piperidine-4-yl)-N '-(4-(2-methyl propoxy-) phenyl methyl) urea and tartrate and crystal formation | |
CN101102994A (en) | Polymorphs of memantine hydrochloride | |
US7618976B2 (en) | Methods for the production of sildenafil base and citrate salt | |
SI9300542A (en) | Benzofuran derivatives for medical use | |
EA030553B1 (en) | Tapentadol maleate and crystalline forms thereof | |
MXPA01000307A (en) | Paroxetine methanesulfonate | |
NO310073B1 (en) | New polymorphs of lesopitron dichlorohydrate and its hydrated forms, methods of preparation and composition containing them |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
C06 | Publication | ||
PB01 | Publication | ||
C10 | Entry into substantive examination | ||
SE01 | Entry into force of request for substantive examination | ||
C14 | Grant of patent or utility model | ||
GR01 | Patent grant | ||
ASS | Succession or assignment of patent right |
Owner name: BRISTOL-MYERS SQUIBB IRELAND HOLDING CORP. Free format text: FORMER OWNER: BRISTOL-MYERS SQUIBB CO. Effective date: 20140107 |
|
C41 | Transfer of patent application or patent right or utility model | ||
TR01 | Transfer of patent right |
Effective date of registration: 20140107 Address after: Swiss Swiss Patentee after: BRISTOL-MYERS SQUIBB HOLDINGS IRELAND Address before: new jersey Patentee before: Bristol-Myers Squibb Co. |
|
C56 | Change in the name or address of the patentee | ||
CP02 | Change in the address of a patent holder |
Address after: Swiss Stein Hallson Patentee after: BRISTOL-MYERS SQUIBB HOLDINGS IRELAND Address before: Swiss Swiss Patentee before: BRISTOL-MYERS SQUIBB HOLDINGS IRELAND |
|
CP03 | Change of name, title or address | ||
CP03 | Change of name, title or address |
Address after: Swiss Stein Schoenberg Patentee after: Bristol-Squibb Ireland Holdings Limited Address before: Swiss Stein Hallson Patentee before: BRISTOL-MYERS SQUIBB HOLDINGS IRELAND |
|
CP01 | Change in the name or title of a patent holder | ||
CP01 | Change in the name or title of a patent holder |
Address after: Swiss Stein Schoenberg Patentee after: Bristol-Squibb Holdings Ireland Infinite Address before: Swiss Stein Schoenberg Patentee before: Bristol-Squibb Ireland Holdings Limited |