CN101128425A - Dimeric IAP inhibitors - Google Patents
Dimeric IAP inhibitors Download PDFInfo
- Publication number
- CN101128425A CN101128425A CNA2006800053464A CN200680005346A CN101128425A CN 101128425 A CN101128425 A CN 101128425A CN A2006800053464 A CNA2006800053464 A CN A2006800053464A CN 200680005346 A CN200680005346 A CN 200680005346A CN 101128425 A CN101128425 A CN 101128425A
- Authority
- CN
- China
- Prior art keywords
- alkyl
- group
- independently
- aryl
- alkenylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000003112 inhibitor Substances 0.000 title description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 91
- 238000000034 method Methods 0.000 claims abstract description 72
- 125000000217 alkyl group Chemical group 0.000 claims description 272
- -1 amino, carboxyl Chemical group 0.000 claims description 177
- 125000001118 alkylidene group Chemical group 0.000 claims description 141
- 229910052799 carbon Inorganic materials 0.000 claims description 120
- 125000003118 aryl group Chemical group 0.000 claims description 117
- 125000001072 heteroaryl group Chemical group 0.000 claims description 106
- 125000004450 alkenylene group Chemical group 0.000 claims description 105
- 125000004432 carbon atom Chemical group C* 0.000 claims description 100
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 96
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 90
- 125000003545 alkoxy group Chemical group 0.000 claims description 79
- 125000004419 alkynylene group Chemical group 0.000 claims description 79
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 79
- 229910052760 oxygen Inorganic materials 0.000 claims description 77
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 73
- 229910052717 sulfur Inorganic materials 0.000 claims description 70
- 229910052757 nitrogen Inorganic materials 0.000 claims description 62
- 229910052736 halogen Inorganic materials 0.000 claims description 59
- 150000002367 halogens Chemical class 0.000 claims description 59
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 55
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 44
- 125000001188 haloalkyl group Chemical group 0.000 claims description 38
- 229910052794 bromium Inorganic materials 0.000 claims description 36
- 229910052731 fluorine Inorganic materials 0.000 claims description 36
- 229910052801 chlorine Inorganic materials 0.000 claims description 35
- 229910052739 hydrogen Inorganic materials 0.000 claims description 34
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 30
- 125000003368 amide group Chemical group 0.000 claims description 24
- 125000003282 alkyl amino group Chemical group 0.000 claims description 22
- 230000001640 apoptogenic effect Effects 0.000 claims description 22
- 125000004104 aryloxy group Chemical group 0.000 claims description 22
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 22
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 22
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 21
- 125000004414 alkyl thio group Chemical group 0.000 claims description 20
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 20
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 20
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 19
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 19
- 125000001691 aryl alkyl amino group Chemical group 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 17
- 125000004429 atom Chemical group 0.000 claims description 11
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 11
- 125000004475 heteroaralkyl group Chemical group 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 8
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 8
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 8
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000003205 fragrance Substances 0.000 claims description 5
- 125000006574 non-aromatic ring group Chemical group 0.000 claims description 4
- 239000000710 homodimer Substances 0.000 claims description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- ZRNSSRODJSSVEJ-UHFFFAOYSA-N 2-methylpentacosane Chemical group CCCCCCCCCCCCCCCCCCCCCCCC(C)C ZRNSSRODJSSVEJ-UHFFFAOYSA-N 0.000 claims 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N monofluoromethane Chemical group FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 claims 1
- 102100033189 Diablo IAP-binding mitochondrial protein Human genes 0.000 abstract description 151
- 101710101225 Diablo IAP-binding mitochondrial protein Proteins 0.000 abstract description 141
- 108091007065 BIRCs Proteins 0.000 abstract description 70
- 230000006907 apoptotic process Effects 0.000 abstract description 60
- 239000002246 antineoplastic agent Substances 0.000 abstract description 39
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 abstract description 27
- 229940127089 cytotoxic agent Drugs 0.000 abstract description 19
- 229910052697 platinum Inorganic materials 0.000 abstract description 19
- 230000001225 therapeutic effect Effects 0.000 abstract description 18
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 abstract description 8
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 abstract description 8
- 239000000816 peptidomimetic Substances 0.000 abstract description 6
- 102000055031 Inhibitor of Apoptosis Proteins Human genes 0.000 abstract description 5
- 239000000539 dimer Substances 0.000 abstract description 5
- 108091000080 Phosphotransferase Proteins 0.000 abstract description 4
- 102000020233 phosphotransferase Human genes 0.000 abstract description 4
- 101000871228 Homo sapiens Diablo IAP-binding mitochondrial protein Proteins 0.000 abstract description 3
- 229940123237 Taxane Drugs 0.000 abstract description 3
- 230000001413 cellular effect Effects 0.000 abstract description 3
- 230000003993 interaction Effects 0.000 abstract description 3
- 229940075439 smac mimetic Drugs 0.000 abstract description 2
- 102000014914 Carrier Proteins Human genes 0.000 abstract 1
- 108091008324 binding proteins Proteins 0.000 abstract 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 abstract 1
- 239000000178 monomer Substances 0.000 abstract 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 165
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 113
- 239000002585 base Substances 0.000 description 108
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 94
- 239000000243 solution Substances 0.000 description 87
- 108090000765 processed proteins & peptides Proteins 0.000 description 82
- 235000019439 ethyl acetate Nutrition 0.000 description 81
- 210000004027 cell Anatomy 0.000 description 77
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 75
- 150000001721 carbon Chemical group 0.000 description 63
- 238000005406 washing Methods 0.000 description 60
- 239000011541 reaction mixture Substances 0.000 description 56
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 47
- 239000011734 sodium Substances 0.000 description 46
- 238000001035 drying Methods 0.000 description 43
- 238000005160 1H NMR spectroscopy Methods 0.000 description 42
- 101100369992 Homo sapiens TNFSF10 gene Proteins 0.000 description 41
- 108700012411 TNFSF10 Proteins 0.000 description 41
- 150000003254 radicals Chemical class 0.000 description 41
- 150000003839 salts Chemical class 0.000 description 40
- 238000011282 treatment Methods 0.000 description 36
- 239000007787 solid Substances 0.000 description 35
- 229920006395 saturated elastomer Polymers 0.000 description 34
- 239000012043 crude product Substances 0.000 description 33
- 230000000694 effects Effects 0.000 description 33
- 239000007864 aqueous solution Substances 0.000 description 31
- 239000000203 mixture Substances 0.000 description 30
- 239000000047 product Substances 0.000 description 30
- 230000000973 chemotherapeutic effect Effects 0.000 description 29
- 230000008569 process Effects 0.000 description 28
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 27
- 125000002393 azetidinyl group Chemical group 0.000 description 27
- 108020004414 DNA Proteins 0.000 description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 26
- 206010028980 Neoplasm Diseases 0.000 description 25
- 239000003814 drug Substances 0.000 description 25
- 102000011727 Caspases Human genes 0.000 description 23
- 108010076667 Caspases Proteins 0.000 description 23
- 239000000284 extract Substances 0.000 description 22
- 238000001959 radiotherapy Methods 0.000 description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000003795 chemical substances by application Substances 0.000 description 20
- 125000000623 heterocyclic group Chemical group 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 239000000126 substance Substances 0.000 description 19
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 101710183280 Topoisomerase Proteins 0.000 description 18
- 102100037024 E3 ubiquitin-protein ligase XIAP Human genes 0.000 description 17
- 108700031544 X-Linked Inhibitor of Apoptosis Proteins 0.000 description 17
- 229940034982 antineoplastic agent Drugs 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- 230000006378 damage Effects 0.000 description 15
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 15
- 201000010099 disease Diseases 0.000 description 14
- 239000002532 enzyme inhibitor Substances 0.000 description 14
- 238000000605 extraction Methods 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- 229940125532 enzyme inhibitor Drugs 0.000 description 13
- 230000005855 radiation Effects 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- 229960001866 silicon dioxide Drugs 0.000 description 13
- 238000004088 simulation Methods 0.000 description 13
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 12
- 210000004881 tumor cell Anatomy 0.000 description 12
- 230000004913 activation Effects 0.000 description 11
- 201000011510 cancer Diseases 0.000 description 11
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 238000002512 chemotherapy Methods 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 229910004373 HOAc Inorganic materials 0.000 description 9
- 239000000370 acceptor Substances 0.000 description 9
- 230000027455 binding Effects 0.000 description 9
- 239000012266 salt solution Substances 0.000 description 9
- 230000035945 sensitivity Effects 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 238000010792 warming Methods 0.000 description 9
- 206010005003 Bladder cancer Diseases 0.000 description 8
- 239000007821 HATU Substances 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 8
- 229940088013 hycamtin Drugs 0.000 description 8
- 230000007246 mechanism Effects 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 8
- 238000004007 reversed phase HPLC Methods 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 210000001519 tissue Anatomy 0.000 description 8
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 8
- 208000023275 Autoimmune disease Diseases 0.000 description 7
- 102100027522 Baculoviral IAP repeat-containing protein 7 Human genes 0.000 description 7
- 101150082208 DIABLO gene Proteins 0.000 description 7
- 101000936083 Homo sapiens Baculoviral IAP repeat-containing protein 7 Proteins 0.000 description 7
- 229930012538 Paclitaxel Natural products 0.000 description 7
- 102000018594 Tumour necrosis factor Human genes 0.000 description 7
- 108050007852 Tumour necrosis factor Proteins 0.000 description 7
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 7
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 238000010790 dilution Methods 0.000 description 7
- 239000012895 dilution Substances 0.000 description 7
- 230000003203 everyday effect Effects 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- 238000001819 mass spectrum Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 7
- 229960001592 paclitaxel Drugs 0.000 description 7
- 235000018102 proteins Nutrition 0.000 description 7
- 102000004169 proteins and genes Human genes 0.000 description 7
- 230000000452 restraining effect Effects 0.000 description 7
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 7
- 238000012546 transfer Methods 0.000 description 7
- 201000005112 urinary bladder cancer Diseases 0.000 description 7
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 6
- AIDLAEPHWROGFI-UHFFFAOYSA-N 2-methylbenzene-1,3-dicarboxylic acid Chemical compound CC1=C(C(O)=O)C=CC=C1C(O)=O AIDLAEPHWROGFI-UHFFFAOYSA-N 0.000 description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000000259 anti-tumor effect Effects 0.000 description 6
- 238000013459 approach Methods 0.000 description 6
- 150000003851 azoles Chemical class 0.000 description 6
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 6
- BJDCWCLMFKKGEE-CMDXXVQNSA-N chembl252518 Chemical compound C([C@@](OO1)(C)O2)C[C@H]3[C@H](C)CC[C@@H]4[C@@]31[C@@H]2O[C@H](O)[C@@H]4C BJDCWCLMFKKGEE-CMDXXVQNSA-N 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 230000001976 improved effect Effects 0.000 description 6
- 230000001965 increasing effect Effects 0.000 description 6
- 150000002475 indoles Chemical class 0.000 description 6
- 201000001441 melanoma Diseases 0.000 description 6
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 6
- 229960001756 oxaliplatin Drugs 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 102000004196 processed proteins & peptides Human genes 0.000 description 6
- 230000003439 radiotherapeutic effect Effects 0.000 description 6
- 238000002560 therapeutic procedure Methods 0.000 description 6
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 5
- 206010006187 Breast cancer Diseases 0.000 description 5
- 208000026310 Breast neoplasm Diseases 0.000 description 5
- 102100030497 Cytochrome c Human genes 0.000 description 5
- 108010075031 Cytochromes c Proteins 0.000 description 5
- 108010049207 Death Domain Receptors Proteins 0.000 description 5
- 102000009058 Death Domain Receptors Human genes 0.000 description 5
- 102000010911 Enzyme Precursors Human genes 0.000 description 5
- 108010062466 Enzyme Precursors Proteins 0.000 description 5
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 5
- 102000000588 Interleukin-2 Human genes 0.000 description 5
- 108010002350 Interleukin-2 Proteins 0.000 description 5
- 102000029749 Microtubule Human genes 0.000 description 5
- 108091022875 Microtubule Proteins 0.000 description 5
- 241000283973 Oryctolagus cuniculus Species 0.000 description 5
- 150000001336 alkenes Chemical class 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 230000001028 anti-proliverative effect Effects 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- NWFNSTOSIVLCJA-UHFFFAOYSA-L copper;diacetate;hydrate Chemical compound O.[Cu+2].CC([O-])=O.CC([O-])=O NWFNSTOSIVLCJA-UHFFFAOYSA-L 0.000 description 5
- 231100000135 cytotoxicity Toxicity 0.000 description 5
- 230000003013 cytotoxicity Effects 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 229960004768 irinotecan Drugs 0.000 description 5
- 229940098779 methanesulfonic acid Drugs 0.000 description 5
- 210000004688 microtubule Anatomy 0.000 description 5
- 125000002098 pyridazinyl group Chemical group 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 230000009466 transformation Effects 0.000 description 5
- 125000001425 triazolyl group Chemical group 0.000 description 5
- 239000003981 vehicle Substances 0.000 description 5
- VOZZDEROHZMDEQ-UHFFFAOYSA-N C(=O)(O)CC1=C(C=C(C(=O)O)C=C1C)C(=O)O Chemical compound C(=O)(O)CC1=C(C=C(C(=O)O)C=C1C)C(=O)O VOZZDEROHZMDEQ-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 230000008836 DNA modification Effects 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- 101000610605 Homo sapiens Tumor necrosis factor receptor superfamily member 10A Proteins 0.000 description 4
- 101000610604 Homo sapiens Tumor necrosis factor receptor superfamily member 10B Proteins 0.000 description 4
- 229940083346 IAP antagonist Drugs 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- 102000014150 Interferons Human genes 0.000 description 4
- 108010050904 Interferons Proteins 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- 229940121849 Mitotic inhibitor Drugs 0.000 description 4
- AYDQIZKZTQHYIY-UHFFFAOYSA-N OC(=O)C1(C)CC(C(O)=O)=CC=C1 Chemical compound OC(=O)C1(C)CC(C(O)=O)=CC=C1 AYDQIZKZTQHYIY-UHFFFAOYSA-N 0.000 description 4
- 206010033128 Ovarian cancer Diseases 0.000 description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 239000005864 Sulphur Substances 0.000 description 4
- 102100040113 Tumor necrosis factor receptor superfamily member 10A Human genes 0.000 description 4
- 102100040112 Tumor necrosis factor receptor superfamily member 10B Human genes 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 229940100198 alkylating agent Drugs 0.000 description 4
- 239000002168 alkylating agent Substances 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 229940024606 amino acid Drugs 0.000 description 4
- 235000001014 amino acid Nutrition 0.000 description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 4
- 239000003242 anti bacterial agent Substances 0.000 description 4
- 230000002424 anti-apoptotic effect Effects 0.000 description 4
- 229940088710 antibiotic agent Drugs 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000005784 autoimmunity Effects 0.000 description 4
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 4
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 4
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 4
- BQFCCCIRTOLPEF-UHFFFAOYSA-N chembl1976978 Chemical compound CC1=CC=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 BQFCCCIRTOLPEF-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 229960005420 etoposide Drugs 0.000 description 4
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 230000036541 health Effects 0.000 description 4
- 239000007943 implant Substances 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 229940079322 interferon Drugs 0.000 description 4
- 238000007918 intramuscular administration Methods 0.000 description 4
- 150000002632 lipids Chemical class 0.000 description 4
- 230000002503 metabolic effect Effects 0.000 description 4
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 4
- 229960001156 mitoxantrone Drugs 0.000 description 4
- 238000004305 normal phase HPLC Methods 0.000 description 4
- 230000037361 pathway Effects 0.000 description 4
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 4
- 230000004083 survival effect Effects 0.000 description 4
- 230000002195 synergetic effect Effects 0.000 description 4
- 229940124597 therapeutic agent Drugs 0.000 description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 4
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 4
- HTJUGFRVVFGETK-UHFFFAOYSA-N 1,5-difluoropentan-3-one Chemical class FCCC(=O)CCF HTJUGFRVVFGETK-UHFFFAOYSA-N 0.000 description 3
- QKNFFJHHPCWXTH-UHFFFAOYSA-N 2-(methylamino)propanamide Chemical compound CNC(C)C(N)=O QKNFFJHHPCWXTH-UHFFFAOYSA-N 0.000 description 3
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 3
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 102000000412 Annexin Human genes 0.000 description 3
- 108050008874 Annexin Proteins 0.000 description 3
- 102000004039 Caspase-9 Human genes 0.000 description 3
- 108090000566 Caspase-9 Proteins 0.000 description 3
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 3
- 102000004127 Cytokines Human genes 0.000 description 3
- 108090000695 Cytokines Proteins 0.000 description 3
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 3
- 108010035042 Osteoprotegerin Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- 108091005804 Peptidases Proteins 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- CWHJIJJSDGEHNS-MYLFLSLOSA-N Senegenin Chemical compound C1[C@H](O)[C@H](O)[C@@](C)(C(O)=O)[C@@H]2CC[C@@]3(C)C(CC[C@]4(CCC(C[C@H]44)(C)C)C(O)=O)=C4[C@@H](CCl)C[C@@H]3[C@]21C CWHJIJJSDGEHNS-MYLFLSLOSA-N 0.000 description 3
- 102100032236 Tumor necrosis factor receptor superfamily member 11B Human genes 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229960000473 altretamine Drugs 0.000 description 3
- 125000000539 amino acid group Chemical group 0.000 description 3
- 230000001093 anti-cancer Effects 0.000 description 3
- 229960000190 bacillus calmette–guérin vaccine Drugs 0.000 description 3
- 229960003328 benzoyl peroxide Drugs 0.000 description 3
- 125000002837 carbocyclic group Chemical group 0.000 description 3
- 230000004663 cell proliferation Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 229960000975 daunorubicin Drugs 0.000 description 3
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 3
- 230000002950 deficient Effects 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000012636 effector Substances 0.000 description 3
- 229960001904 epirubicin Drugs 0.000 description 3
- 238000007710 freezing Methods 0.000 description 3
- 230000008014 freezing Effects 0.000 description 3
- 239000003862 glucocorticoid Substances 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- 238000009169 immunotherapy Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 3
- 230000007774 longterm Effects 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 230000002438 mitochondrial effect Effects 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- AFFLGGQVNFXPEV-UHFFFAOYSA-N n-decene Natural products CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- XXUPLYBCNPLTIW-UHFFFAOYSA-N octadec-7-ynoic acid Chemical compound CCCCCCCCCCC#CCCCCCC(O)=O XXUPLYBCNPLTIW-UHFFFAOYSA-N 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- XJMOSONTPMZWPB-UHFFFAOYSA-M propidium iodide Chemical compound [I-].[I-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CCC[N+](C)(CC)CC)=C1C1=CC=CC=C1 XJMOSONTPMZWPB-UHFFFAOYSA-M 0.000 description 3
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 230000001568 sexual effect Effects 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 230000008685 targeting Effects 0.000 description 3
- 239000009871 tenuigenin Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- 125000002769 thiazolinyl group Chemical group 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 230000004614 tumor growth Effects 0.000 description 3
- 241000701447 unidentified baculovirus Species 0.000 description 3
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 2
- IAKHMKGGTNLKSZ-INIZCTEOSA-N (S)-colchicine Chemical compound C1([C@@H](NC(C)=O)CC2)=CC(=O)C(OC)=CC=C1C1=C2C=C(OC)C(OC)=C1OC IAKHMKGGTNLKSZ-INIZCTEOSA-N 0.000 description 2
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 2
- HFDVRLIODXPAHB-UHFFFAOYSA-N 1-tetradecene Chemical compound CCCCCCCCCCCCC=C HFDVRLIODXPAHB-UHFFFAOYSA-N 0.000 description 2
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- MMFMTASDTOCTLC-UHFFFAOYSA-N 4-methylbenzene-1,2,3-tricarboxylic acid Chemical compound CC1=CC=C(C(O)=O)C(C(O)=O)=C1C(O)=O MMFMTASDTOCTLC-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 108090000672 Annexin A5 Proteins 0.000 description 2
- 102000004121 Annexin A5 Human genes 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 108700003785 Baculoviral IAP Repeat-Containing 3 Proteins 0.000 description 2
- 102100021662 Baculoviral IAP repeat-containing protein 3 Human genes 0.000 description 2
- 108010006654 Bleomycin Proteins 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 102000003952 Caspase 3 Human genes 0.000 description 2
- 108090000397 Caspase 3 Proteins 0.000 description 2
- 102100026548 Caspase-8 Human genes 0.000 description 2
- 108090000538 Caspase-8 Proteins 0.000 description 2
- 102000019034 Chemokines Human genes 0.000 description 2
- 108010012236 Chemokines Proteins 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 2
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 2
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 2
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229930192392 Mitomycin Natural products 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 208000006265 Renal cell carcinoma Diseases 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000029662 T-helper 1 type immune response Effects 0.000 description 2
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 2
- JZFICWYCTCCINF-UHFFFAOYSA-N Thiadiazin Chemical compound S=C1SC(C)NC(C)N1CCN1C(=S)SC(C)NC1C JZFICWYCTCCINF-UHFFFAOYSA-N 0.000 description 2
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 2
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 description 2
- 102000004243 Tubulin Human genes 0.000 description 2
- 108090000704 Tubulin Proteins 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
- 229940122803 Vinca alkaloid Drugs 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 230000000118 anti-neoplastic effect Effects 0.000 description 2
- 230000000692 anti-sense effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960001561 bleomycin Drugs 0.000 description 2
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 2
- 238000002725 brachytherapy Methods 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 238000010523 cascade reaction Methods 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 230000022534 cell killing Effects 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 229940044683 chemotherapy drug Drugs 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 231100000433 cytotoxic Toxicity 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- 238000013016 damping Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 229960003668 docetaxel Drugs 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- CTSPAMFJBXKSOY-UHFFFAOYSA-N ellipticine Chemical compound N1=CC=C2C(C)=C(NC=3C4=CC=CC=3)C4=C(C)C2=C1 CTSPAMFJBXKSOY-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- YJGVMLPVUAXIQN-UHFFFAOYSA-N epipodophyllotoxin Natural products COC1=C(OC)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YJGVMLPVUAXIQN-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229960002949 fluorouracil Drugs 0.000 description 2
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 2
- 229960005277 gemcitabine Drugs 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 125000005908 glyceryl ester group Chemical group 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 239000003102 growth factor Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 208000006454 hepatitis Diseases 0.000 description 2
- 231100000283 hepatitis Toxicity 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229960000908 idarubicin Drugs 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 239000002955 immunomodulating agent Substances 0.000 description 2
- 229940121354 immunomodulator Drugs 0.000 description 2
- 230000002584 immunomodulator Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 206010025135 lupus erythematosus Diseases 0.000 description 2
- RVFGKBWWUQOIOU-NDEPHWFRSA-N lurtotecan Chemical compound O=C([C@]1(O)CC)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC=2OCCOC=2C=C1C=4CN1CCN(C)CC1 RVFGKBWWUQOIOU-NDEPHWFRSA-N 0.000 description 2
- 229950002654 lurtotecan Drugs 0.000 description 2
- 230000010534 mechanism of action Effects 0.000 description 2
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- CFCUWKMKBJTWLW-BKHRDMLASA-N mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 description 2
- 229960004857 mitomycin Drugs 0.000 description 2
- 230000000394 mitotic effect Effects 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000000346 nonvolatile oil Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 230000001766 physiological effect Effects 0.000 description 2
- 125000004193 piperazinyl group Chemical group 0.000 description 2
- 125000005936 piperidyl group Chemical group 0.000 description 2
- 229960003171 plicamycin Drugs 0.000 description 2
- 230000010287 polarization Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 230000006659 positive regulation of apoptotic process Effects 0.000 description 2
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 2
- 229960000624 procarbazine Drugs 0.000 description 2
- 125000001500 prolyl group Chemical class [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000017854 proteolysis Effects 0.000 description 2
- 230000002797 proteolythic effect Effects 0.000 description 2
- 230000006337 proteolytic cleavage Effects 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000008263 repair mechanism Effects 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- 102200082402 rs751610198 Human genes 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- 238000005728 strengthening Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 238000005987 sulfurization reaction Methods 0.000 description 2
- 208000014794 superficial urinary bladder carcinoma Diseases 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 125000001730 thiiranyl group Chemical group 0.000 description 2
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 230000009107 upstream regulation Effects 0.000 description 2
- 229960005486 vaccine Drugs 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- UJHSIDUUJPTLDY-UHFFFAOYSA-N (2-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 UJHSIDUUJPTLDY-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- VLHQXRIIQSTJCQ-LURJTMIESA-N (2s)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid Chemical compound OC(=O)[C@H](C)N(C)C(=O)OC(C)(C)C VLHQXRIIQSTJCQ-LURJTMIESA-N 0.000 description 1
- SZXBQTSZISFIAO-ZETCQYMHSA-N (2s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)OC(C)(C)C SZXBQTSZISFIAO-ZETCQYMHSA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- UIVHJEKZRQNSEB-UHFFFAOYSA-N (3-hydroxy-4-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(O)=CC(C(=O)C=2C=CC=CC=2)=C1 UIVHJEKZRQNSEB-UHFFFAOYSA-N 0.000 description 1
- MFYLRNKOXORIPK-UHFFFAOYSA-N (3-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 MFYLRNKOXORIPK-UHFFFAOYSA-N 0.000 description 1
- ZYMCBJWUWHHVRX-UHFFFAOYSA-N (4-nitrophenyl)-phenylmethanone Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CC=C1 ZYMCBJWUWHHVRX-UHFFFAOYSA-N 0.000 description 1
- YJGVMLPVUAXIQN-LGWHJFRWSA-N (5s,5ar,8ar,9r)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5h-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one Chemical compound COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YJGVMLPVUAXIQN-LGWHJFRWSA-N 0.000 description 1
- FPVKHBSQESCIEP-UHFFFAOYSA-N (8S)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol Natural products C1C(O)C(CO)OC1N1C(NC=NCC2O)=C2N=C1 FPVKHBSQESCIEP-UHFFFAOYSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- OTPDWCMLUKMQNO-UHFFFAOYSA-N 1,2,3,4-tetrahydropyrimidine Chemical compound C1NCC=CN1 OTPDWCMLUKMQNO-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 1
- IDWHSUSIOBKSKI-UHFFFAOYSA-N 2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid Chemical compound CC(C)(C)OC(=O)N(CC(O)=O)C1CCCCC1 IDWHSUSIOBKSKI-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- PNWSHHILERSSLF-UHFFFAOYSA-N 4-methylbenzene-1,3-dicarboxylic acid Chemical compound CC1=CC=C(C(O)=O)C=C1C(O)=O PNWSHHILERSSLF-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IDPUKCWIGUEADI-UHFFFAOYSA-N 5-[bis(2-chloroethyl)amino]uracil Chemical compound ClCCN(CCCl)C1=CNC(=O)NC1=O IDPUKCWIGUEADI-UHFFFAOYSA-N 0.000 description 1
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical group N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 208000030507 AIDS Diseases 0.000 description 1
- PITHJRRCEANNKJ-UHFFFAOYSA-N Aclacinomycin A Natural products C12=C(O)C=3C(=O)C4=CC=CC=C4C(=O)C=3C=C2C(C(=O)OC)C(CC)(O)CC1OC(OC1C)CC(N(C)C)C1OC(OC1C)CC(O)C1OC1CCC(=O)C(C)O1 PITHJRRCEANNKJ-UHFFFAOYSA-N 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 206010001935 American trypanosomiasis Diseases 0.000 description 1
- 229940088872 Apoptosis inhibitor Drugs 0.000 description 1
- 102100021569 Apoptosis regulator Bcl-2 Human genes 0.000 description 1
- 206010003591 Ataxia Diseases 0.000 description 1
- 102100021663 Baculoviral IAP repeat-containing protein 5 Human genes 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 208000008439 Biliary Liver Cirrhosis Diseases 0.000 description 1
- 208000033222 Biliary cirrhosis primary Diseases 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 201000002829 CREST Syndrome Diseases 0.000 description 1
- 208000004434 Calcinosis Diseases 0.000 description 1
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 1
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- 208000009458 Carcinoma in Situ Diseases 0.000 description 1
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 1
- 102000004018 Caspase 6 Human genes 0.000 description 1
- 108090000425 Caspase 6 Proteins 0.000 description 1
- 108090000567 Caspase 7 Proteins 0.000 description 1
- 102100038902 Caspase-7 Human genes 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- 208000024699 Chagas disease Diseases 0.000 description 1
- GXGJIOMUZAGVEH-UHFFFAOYSA-N Chamazulene Chemical group CCC1=CC=C(C)C2=CC=C(C)C2=C1 GXGJIOMUZAGVEH-UHFFFAOYSA-N 0.000 description 1
- JWBOIMRXGHLCPP-UHFFFAOYSA-N Chloditan Chemical compound C=1C=CC=C(Cl)C=1C(C(Cl)Cl)C1=CC=C(Cl)C=C1 JWBOIMRXGHLCPP-UHFFFAOYSA-N 0.000 description 1
- 206010008609 Cholangitis sclerosing Diseases 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 208000027932 Collagen disease Diseases 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 102000003915 DNA Topoisomerases Human genes 0.000 description 1
- 108090000323 DNA Topoisomerases Proteins 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- 206010048768 Dermatosis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010058314 Dysplasia Diseases 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 206010014989 Epidermolysis bullosa Diseases 0.000 description 1
- 208000000289 Esophageal Achalasia Diseases 0.000 description 1
- 208000030644 Esophageal Motility disease Diseases 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 102100026693 FAS-associated death domain protein Human genes 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 108010029961 Filgrastim Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- 206010018370 Glomerulonephritis membranoproliferative Diseases 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 1
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 1
- ZIXGXMMUKPLXBB-UHFFFAOYSA-N Guatambuinine Natural products N1C2=CC=CC=C2C2=C1C(C)=C1C=CN=C(C)C1=C2 ZIXGXMMUKPLXBB-UHFFFAOYSA-N 0.000 description 1
- 208000001204 Hashimoto Disease Diseases 0.000 description 1
- 208000030836 Hashimoto thyroiditis Diseases 0.000 description 1
- 208000035186 Hemolytic Autoimmune Anemia Diseases 0.000 description 1
- 206010019939 Herpes gestationis Diseases 0.000 description 1
- 101000971171 Homo sapiens Apoptosis regulator Bcl-2 Proteins 0.000 description 1
- 101000911074 Homo sapiens FAS-associated death domain protein Proteins 0.000 description 1
- 101000610602 Homo sapiens Tumor necrosis factor receptor superfamily member 10C Proteins 0.000 description 1
- 101000610609 Homo sapiens Tumor necrosis factor receptor superfamily member 10D Proteins 0.000 description 1
- 206010020850 Hyperthyroidism Diseases 0.000 description 1
- 102000040104 IAP family Human genes 0.000 description 1
- 108091069885 IAP family Proteins 0.000 description 1
- 206010021245 Idiopathic thrombocytopenic purpura Diseases 0.000 description 1
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 1
- 102000006992 Interferon-alpha Human genes 0.000 description 1
- 108010047761 Interferon-alpha Proteins 0.000 description 1
- 208000026492 Isaac syndrome Diseases 0.000 description 1
- 208000000209 Isaacs syndrome Diseases 0.000 description 1
- 241001506304 Kadsura japonica Species 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- IFQSXNOEEPCSLW-DKWTVANSSA-N L-cysteine hydrochloride Chemical compound Cl.SC[C@H](N)C(O)=O IFQSXNOEEPCSLW-DKWTVANSSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- HLFSDGLLUJUHTE-SNVBAGLBSA-N Levamisole Chemical compound C1([C@H]2CN3CCSC3=N2)=CC=CC=C1 HLFSDGLLUJUHTE-SNVBAGLBSA-N 0.000 description 1
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- 208000002720 Malnutrition Diseases 0.000 description 1
- 208000004451 Membranoproliferative Glomerulonephritis Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 108010058682 Mitochondrial Proteins Proteins 0.000 description 1
- 102000006404 Mitochondrial Proteins Human genes 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 206010028424 Myasthenic syndrome Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- 206010028665 Myxoedema Diseases 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 108091093105 Nuclear DNA Proteins 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 206010030136 Oesophageal achalasia Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 108091034117 Oligonucleotide Proteins 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 206010034277 Pemphigoid Diseases 0.000 description 1
- 208000008223 Pemphigoid Gestationis Diseases 0.000 description 1
- 201000011152 Pemphigus Diseases 0.000 description 1
- 208000031845 Pernicious anaemia Diseases 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 208000012654 Primary biliary cholangitis Diseases 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000003782 Raynaud disease Diseases 0.000 description 1
- 208000012322 Raynaud phenomenon Diseases 0.000 description 1
- 208000015634 Rectal Neoplasms Diseases 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- SUYXJDLXGFPMCQ-INIZCTEOSA-N SJ000287331 Natural products CC1=c2cnccc2=C(C)C2=Nc3ccccc3[C@H]12 SUYXJDLXGFPMCQ-INIZCTEOSA-N 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 102000013275 Somatomedins Human genes 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- 206010072148 Stiff-Person syndrome Diseases 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 108010002687 Survivin Proteins 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 102000046283 TNF-Related Apoptosis-Inducing Ligand Human genes 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010043189 Telangiectasia Diseases 0.000 description 1
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 1
- DPOPAJRDYZGTIR-UHFFFAOYSA-N Tetrazine Chemical compound C1=CN=NN=N1 DPOPAJRDYZGTIR-UHFFFAOYSA-N 0.000 description 1
- 208000031981 Thrombocytopenic Idiopathic Purpura Diseases 0.000 description 1
- 241000223109 Trypanosoma cruzi Species 0.000 description 1
- 102100040115 Tumor necrosis factor receptor superfamily member 10C Human genes 0.000 description 1
- 102100040110 Tumor necrosis factor receptor superfamily member 10D Human genes 0.000 description 1
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 description 1
- 101710187743 Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 206010047115 Vasculitis Diseases 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- OYGQPOAFJKEAFN-UHFFFAOYSA-N [O].C1CCOCC1 Chemical compound [O].C1CCOCC1 OYGQPOAFJKEAFN-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- YAXGXEOYWAIEER-UHFFFAOYSA-N acetic acid;triethylphosphane Chemical compound CC([O-])=O.CC[PH+](CC)CC YAXGXEOYWAIEER-UHFFFAOYSA-N 0.000 description 1
- 201000000621 achalasia Diseases 0.000 description 1
- USZYSDMBJDPRIF-SVEJIMAYSA-N aclacinomycin A Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1CCC(=O)[C@H](C)O1 USZYSDMBJDPRIF-SVEJIMAYSA-N 0.000 description 1
- 229960004176 aclarubicin Drugs 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000012082 adaptor molecule Substances 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229960001220 amsacrine Drugs 0.000 description 1
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001454 anthracenes Chemical class 0.000 description 1
- 239000003817 anthracycline antibiotic agent Substances 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000002927 anti-mitotic effect Effects 0.000 description 1
- 239000000074 antisense oligonucleotide Substances 0.000 description 1
- 238000012230 antisense oligonucleotides Methods 0.000 description 1
- 239000000158 apoptosis inhibitor Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000003305 autocrine Effects 0.000 description 1
- 208000018093 autoimmune cholangitis Diseases 0.000 description 1
- 201000000448 autoimmune hemolytic anemia Diseases 0.000 description 1
- 201000003710 autoimmune thrombocytopenic purpura Diseases 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 1
- 229960002170 azathioprine Drugs 0.000 description 1
- 108700000711 bcl-X Proteins 0.000 description 1
- 102000055104 bcl-X Human genes 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004622 benzoxazinyl group Chemical group O1NC(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- PNPBGYBHLCEVMK-UHFFFAOYSA-L benzylidene(dichloro)ruthenium;tricyclohexylphosphane Chemical compound Cl[Ru](Cl)=CC1=CC=CC=C1.C1CCCCC1P(C1CCCCC1)C1CCCCC1.C1CCCCC1P(C1CCCCC1)C1CCCCC1 PNPBGYBHLCEVMK-UHFFFAOYSA-L 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000006287 biotinylation Effects 0.000 description 1
- 238000007413 biotinylation Methods 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 201000001531 bladder carcinoma Diseases 0.000 description 1
- 201000011199 bladder lymphoma Diseases 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 208000000594 bullous pemphigoid Diseases 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 239000003560 cancer drug Substances 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 229960004117 capecitabine Drugs 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 229960005243 carmustine Drugs 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 230000025084 cell cycle arrest Effects 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000030833 cell death Effects 0.000 description 1
- 230000019522 cellular metabolic process Effects 0.000 description 1
- 230000036755 cellular response Effects 0.000 description 1
- 208000025434 cerebellar degeneration Diseases 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000012829 chemotherapy agent Substances 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 150000001840 cholesterol esters Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229960001338 colchicine Drugs 0.000 description 1
- 201000010989 colorectal carcinoma Diseases 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- POADTFBBIXOWFJ-VWLOTQADSA-N cositecan Chemical compound C1=CC=C2C(CC[Si](C)(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 POADTFBBIXOWFJ-VWLOTQADSA-N 0.000 description 1
- 229940111134 coxibs Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000009109 curative therapy Methods 0.000 description 1
- 125000004367 cycloalkylaryl group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 108010057085 cytokine receptors Proteins 0.000 description 1
- 102000003675 cytokine receptors Human genes 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 201000001981 dermatomyositis Diseases 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- LFQCJSBXBZRMTN-OAQYLSRUSA-N diflomotecan Chemical compound CC[C@@]1(O)CC(=O)OCC(C2=O)=C1C=C1N2CC2=CC3=CC(F)=C(F)C=C3N=C21 LFQCJSBXBZRMTN-OAQYLSRUSA-N 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- OBISXEJSEGNNKL-UHFFFAOYSA-N dinitrogen-n-sulfide Chemical compound [N-]=[N+]=S OBISXEJSEGNNKL-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 210000001840 diploid cell Anatomy 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- MNQDKWZEUULFPX-UHFFFAOYSA-M dithiazanine iodide Chemical compound [I-].S1C2=CC=CC=C2[N+](CC)=C1C=CC=CC=C1N(CC)C2=CC=CC=C2S1 MNQDKWZEUULFPX-UHFFFAOYSA-M 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- 229940000406 drug candidate Drugs 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 201000011191 dyskinesia of esophagus Diseases 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 208000030172 endocrine system disease Diseases 0.000 description 1
- 230000001076 estrogenic effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- ZVYVPGLRVWUPMP-FYSMJZIKSA-N exatecan Chemical compound C1C[C@H](N)C2=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC3=CC(F)=C(C)C1=C32 ZVYVPGLRVWUPMP-FYSMJZIKSA-N 0.000 description 1
- 229950009429 exatecan Drugs 0.000 description 1
- 208000021045 exocrine pancreatic carcinoma Diseases 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 229960004177 filgrastim Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 238000002875 fluorescence polarization Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229940060037 fluorine Drugs 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- JKFAIQOWCVVSKC-UHFFFAOYSA-N furazan Chemical compound C=1C=NON=1 JKFAIQOWCVVSKC-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- UIVFUQKYVFCEKJ-OPTOVBNMSA-N gimatecan Chemical compound C1=CC=C2C(\C=N\OC(C)(C)C)=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UIVFUQKYVFCEKJ-OPTOVBNMSA-N 0.000 description 1
- 229950009073 gimatecan Drugs 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 208000005017 glioblastoma Diseases 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 1
- 239000003163 gonadal steroid hormone Substances 0.000 description 1
- 230000012447 hatching Effects 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 208000014951 hematologic disease Diseases 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JISVIRFOSOKJIU-UHFFFAOYSA-N hexylidene Chemical group [CH2+]CCCC[CH-] JISVIRFOSOKJIU-UHFFFAOYSA-N 0.000 description 1
- 125000000487 histidyl group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C([H])=N1 0.000 description 1
- 230000013632 homeostatic process Effects 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 230000036039 immunity Effects 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 201000004933 in situ carcinoma Diseases 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 108091006086 inhibitor proteins Proteins 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 229940043355 kinase inhibitor Drugs 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 229960001614 levamisole Drugs 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 208000019423 liver disease Diseases 0.000 description 1
- 208000014018 liver neoplasm Diseases 0.000 description 1
- 229960002247 lomustine Drugs 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 210000001165 lymph node Anatomy 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 208000026037 malignant tumor of neck Diseases 0.000 description 1
- 230000001071 malnutrition Effects 0.000 description 1
- 235000000824 malnutrition Nutrition 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 230000029115 microtubule polymerization Effects 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 229960000350 mitotane Drugs 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 206010028417 myasthenia gravis Diseases 0.000 description 1
- 208000003786 myxedema Diseases 0.000 description 1
- UPSFMJHZUCSEHU-JYGUBCOQSA-N n-[(2s,3r,4r,5s,6r)-2-[(2r,3s,4r,5r,6s)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide Chemical compound CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](NC(C)=O)[C@H](OC=2C=C3OC(=O)C=C(C)C3=CC=2)O[C@@H]1CO UPSFMJHZUCSEHU-JYGUBCOQSA-N 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000000822 natural killer cell Anatomy 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 230000006654 negative regulation of apoptotic process Effects 0.000 description 1
- IXOXBSCIXZEQEQ-UHTZMRCNSA-N nelarabine Chemical compound C1=NC=2C(OC)=NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O IXOXBSCIXZEQEQ-UHTZMRCNSA-N 0.000 description 1
- 229960000801 nelarabine Drugs 0.000 description 1
- CTMCWCONSULRHO-UHQPFXKFSA-N nemorubicin Chemical compound C1CO[C@H](OC)CN1[C@@H]1[C@H](O)[C@H](C)O[C@@H](O[C@@H]2C3=C(O)C=4C(=O)C5=C(OC)C=CC=C5C(=O)C=4C(O)=C3C[C@](O)(C2)C(=O)CO)C1 CTMCWCONSULRHO-UHQPFXKFSA-N 0.000 description 1
- 229950010159 nemorubicin Drugs 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 230000009223 neuronal apoptosis Effects 0.000 description 1
- 230000007823 neuropathy Effects 0.000 description 1
- 201000001119 neuropathy Diseases 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- OSTGTTZJOCZWJG-UHFFFAOYSA-N nitrosourea Chemical compound NC(=O)N=NO OSTGTTZJOCZWJG-UHFFFAOYSA-N 0.000 description 1
- 239000002661 non steroidal estrogen Substances 0.000 description 1
- 230000004987 nonapoptotic effect Effects 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 208000015380 nutritional deficiency disease Diseases 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 238000011275 oncology therapy Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 238000002638 palliative care Methods 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229960005079 pemetrexed Drugs 0.000 description 1
- WBXPDJSOTKVWSJ-ZDUSSCGKSA-N pemetrexed Chemical compound C=1NC=2NC(N)=NC(=O)C=2C=1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 WBXPDJSOTKVWSJ-ZDUSSCGKSA-N 0.000 description 1
- 201000001976 pemphigus vulgaris Diseases 0.000 description 1
- 229960002340 pentostatin Drugs 0.000 description 1
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 1
- 208000033808 peripheral neuropathy Diseases 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 1
- 238000002428 photodynamic therapy Methods 0.000 description 1
- 230000010399 physical interaction Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- YJGVMLPVUAXIQN-XVVDYKMHSA-N podophyllotoxin Chemical compound COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YJGVMLPVUAXIQN-XVVDYKMHSA-N 0.000 description 1
- 229960001237 podophyllotoxin Drugs 0.000 description 1
- YVCVYCSAAZQOJI-UHFFFAOYSA-N podophyllotoxin Natural products COC1=C(O)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YVCVYCSAAZQOJI-UHFFFAOYSA-N 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 1
- 239000012985 polymerization agent Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 239000008057 potassium phosphate buffer Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 201000000742 primary sclerosing cholangitis Diseases 0.000 description 1
- 239000000583 progesterone congener Substances 0.000 description 1
- 238000004393 prognosis Methods 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000941 radioactive substance Substances 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 108700015048 receptor decoy activity proteins Proteins 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 201000001275 rectum cancer Diseases 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 229960000371 rofecoxib Drugs 0.000 description 1
- RZJQGNCSTQAWON-UHFFFAOYSA-N rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229960002530 sargramostim Drugs 0.000 description 1
- 108010038379 sargramostim Proteins 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 208000010157 sclerosing cholangitis Diseases 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000011218 segmentation Effects 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229940126586 small molecule drug Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000014347 soups Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 201000000498 stomach carcinoma Diseases 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical compound S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 230000007474 system interaction Effects 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 229960001603 tamoxifen Drugs 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 208000009056 telangiectasis Diseases 0.000 description 1
- 229960004964 temozolomide Drugs 0.000 description 1
- 125000001935 tetracenyl group Chemical group C1(=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C12)* 0.000 description 1
- 229940095068 tetradecene Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229960003433 thalidomide Drugs 0.000 description 1
- YGNGABUJMXJPIJ-UHFFFAOYSA-N thiatriazole Chemical compound C1=NN=NS1 YGNGABUJMXJPIJ-UHFFFAOYSA-N 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 229960003087 tioguanine Drugs 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- AYNNSCRYTDRFCP-UHFFFAOYSA-N triazene Chemical compound NN=N AYNNSCRYTDRFCP-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000002476 tumorcidal effect Effects 0.000 description 1
- 229960001055 uracil mustard Drugs 0.000 description 1
- 208000010570 urinary bladder carcinoma Diseases 0.000 description 1
- 230000001196 vasorelaxation Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- HHJUWIANJFBDHT-KOTLKJBCSA-N vindesine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(N)=O)N4C)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 HHJUWIANJFBDHT-KOTLKJBCSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- MECHNRXZTMCUDQ-RKHKHRCZSA-N vitamin D2 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1\C[C@@H](O)CCC1=C MECHNRXZTMCUDQ-RKHKHRCZSA-N 0.000 description 1
- 235000001892 vitamin D2 Nutrition 0.000 description 1
- 239000011653 vitamin D2 Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000002424 x-ray crystallography Methods 0.000 description 1
- 230000004572 zinc-binding Effects 0.000 description 1
- 229960000641 zorubicin Drugs 0.000 description 1
- FBTUMDXHSRTGRV-ALTNURHMSA-N zorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\NC(=O)C=1C=CC=CC=1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 FBTUMDXHSRTGRV-ALTNURHMSA-N 0.000 description 1
Images
Classifications
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
Description
Numbering | R8a | R7a | R5a | *) stereochemistry of position | X | Y | R11 | Wa-Wb | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope, |
1 | H | S-Me | S-iPr | S | O | O | na | 1, the 4-phenyl | H | H | S-iPr | S-Me | H | H | H | H | A |
2 | H | S-Me | S-iPr | S | O | O | na | Instead-(CH=CH) | H | H | S-iPr | S-Me | H | H | H | H | A |
3 | H | S-Me | S-iPr | S | O | O | na | CH2CH2 | H | H | S-iPr | S-Me | H | H | H | H | A |
4 | H | S-Me | S-iPr | S | O | O | na | 1, the 4-phenyl | H | H | S-iPr | H | H | H | H | H | A |
6 | H | S-Me | S-iPr | S | N | N | NH | 1, the 4-phenyl | H | H | S-iPr | S-Me | H | H | H | H | A |
7 | H | S-Me | S-tBu | S | O | O | na | 1, the 4-phenyl | H | H | S-tBu | S-Me | H | H | H | H | A |
8 | Me | S-Me | S-tBu | S | O | O | na | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | H | H | A |
9 | H | S-Et | S-tBu | S | O | O | na | 1, the 4-phenyl | H | H | S-tBu | S-Et | H | H | H | H | B |
10 | Me | S-Me | S-iPr | S | O | O | na | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | H | H | A |
11 | H | S-Et | S-iPr | S | O | O | na | 1, the 4-phenyl | H | H | S-iPr | S-Et | H | H | H | H | A |
12 | H | S-Me | S-cHex | S | O | O | na | 1, the 4-phenyl | H | H | S- cHex | S-Me | H | H | H | H | A |
13 | Me | S-Me | S-cHex | S | O | O | na | 1, the 4-phenyl | H | H | S- cHex | S-Me | Me | H | H | H | A |
14 | H | S-Et | S-cHex | S | O | O | na | 1, the 4-phenyl | H | H | S- cHex | S-Et | H | H | H | H | B |
15 | Me | S-Me | S-(2R-Et OH) | S | O | O | na | 1, the 4-phenyl | H | H | S-(2R- EtOH ) | S-Me | Me | H | H | H | A |
16 | Me | S-Me | S-iPr | S | N | N | H | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
17 | H | S-Me | S-iPr | S | N | N | H | 2, the 5-thiophene | H | H | S-iPr | S-Me | H | H | F | H | A |
18 | Me | S-Me | S-cHex | S | N | N | H | 2, the 5-thiophene | H | H | S- cHex | S-Me | Me | H | F | H | A |
19 | H | S-Me | S-cHex | S | N | N | H | 1, the 4-phenyl | H | H | S- cHex | S-Me | H | H | F | H | A |
20 | Me | S-Me | S-cHex | S | N | N | H | 1, the 4-phenyl | H | H | S- cHex | S-Me | Me | H | F | H | A |
21 | Me | S-Me | S-iPr | R | N | N | H | 1, the 4-phenyl | R-OH | R-OH | S-iPr | S-Me | Me | H | H | H | B |
22 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | R-OH | R-OH | S-tBu | S- Me | Me | H | H | H | B |
23 | Me | S-Me | S-iPr | S | N | N | H | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | F | H | H | A |
24 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-tBu | S-Me | Me | H | H | H | A |
25 | Me | S-Me | S-(2R-Et OBn) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOB n) | S-Me | Me | H | F | H | A |
26 | Me | S-Me | S-(2R-Et OH) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOB n) | S-Me | Me | H | F | H | A |
27 | Me | S-Me | S-(2R-Et OH) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOH | S-Me | Me | H | F | H | A |
) | |||||||||||||||||
28 | Me | S-Me | S-(2R-Et OH) | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-(2R- EtOH ) | S-Me | Me | H | F | H | A |
29 | Me | S-Me | S-iPr | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-iPr | S-Me | Me | H | F | H | A |
30 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-tBu | S-Me | Me | H | F | H | A |
31 | Me | S-Me | S-(2R-Et OH) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOH ) | S-Me | Me | H | F | H | A |
32 | Me | S-Me | S-(2R-Et OH) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOB n) | S-Me | Me | H | F | H | A |
33 | Me | S-Me | S-(2R-Et OBn) | S | N | N | H | 1, the 4-phenyl | H | H | S-(2R- EtOB n) | S-Me | Me | H | F | H | A |
34 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-tBu | S-Me | Me | H | H | H | A |
35 | Me | S-Me | S-iPr | S | N | N | H | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | F | H | H | A |
36 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | R-OH | R-OH | S-tBu | S-Me | Me | H | H | H | B |
37 | Me | S-Me | S-iPr | R | N | N | H | 1, the 4-phenyl | R-OH | R-OH | S-iPr | S-Me | Me | H | H | H | B |
38 | Me | S-Me | S-cHex | S | N | N | H | 1, the 4-phenyl | H | H | S- cHex | S-Me | Me | H | F | H | A |
39 | H | S-Me | S-cHex | S | N | N | H | 1, the 4-phenyl | H | H | S- cHex | S-Me | H | H | F | H | A |
40 | Me | S-Me | S-iPr | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-iPr | S-Me | Me | F | H | H | B |
41 | Me | S-Me | S-tBu | R | N | N | H | 1, the 4-phenyl | S-OH | S-OH | S-tBu | S-Me | Me | F | H | H | A |
42 | H | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-(2R- EtOB n) | S-Me | Me | H | F | H | A |
43 | H | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
44 | Me | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
45 | H | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OAc | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
46 | Me | S-Me | S-iPr | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
47 | Me | S-Me | S-iPr | S | N | N | CH 2 CH 2 OAc | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
487 | Me | S-Me | S-tBu | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
49 | Me | S-Me | S-tBu | S | N | N | CH 2 CH 2 OAc | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
50 | Me | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OMe | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
51 | Me | S-Me | S-tBu | S | N | N | CH 2 CH 2 OMe | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
52 | Me | S-Me | S-iPr | S | N | N | CH 2 CH 2 OMe | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
53 | H | S-Me | S-iPr | S | N | N | CH 2 CH 2 OMe | 1, the 4-phenyl | H | H | S-iPr | S-Me | H | H | F | H | A |
54 | Me | S-Me | S-tBu | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | F | H | H | A |
55 | Me | S-Me | S-iPr | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | F | H | H | A |
56 | Me | S-Me | S-(2R-Et OH) | S | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | F | H | H | A |
57 | Me | S-Me | S-iPr | S | N | N | Me | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
58 | Me | S-Me | S-(2R-Et OH) | S | N | N | Me | 1, the 4-phenyl | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
59 | Me | S-Me | S-tBu | S | N | N | Me | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
60 | Me | R-Me | R-tBu | R | N | N | CH 2 CH 2 OH | 1, the 4-phenyl | H | H | R-tBu | R- Me | Me | H | F | H | C |
61 | H | R-Me | R-iPr | R | O | O | na | 1, the 4-phenyl | H | H | R-iPr | R- Me | H | H | H | H | D |
Numbering | R8a | R7a | R5a | ( *) of position body putting is upright | X | Y | R | Wa-Wb | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope, |
62 | H | H | S-iPr | S | O | O | na | 1, the 4-phenyl | H | H | S-iPr | H | H | H | H | H | B |
62 | H | H | S-tBu | S | N | N | CH 2CH 2 OH | 1, the 4-phenyl | H | H | S-tBu | H | H | H | F | H | B |
63 | H | Me | S-tBu | S | N | N | CH 2CH 2 OAc | 1, the 4-phenyl | H | H | S-tBu | Me | H | H | F | H | B |
Numbering | R8a | R7a | R5a | ( *) of putting of standing body | X | R11a | Wa-Wb | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope |
64 | Me | S- Me | S- iPr | S | N | CH 2CH 2O Ac | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
65 | H | H | S- iPr | S | N | CH 2CH 2O Ac | 1, the 4-phenyl | H | H | S-iPr | H | H | H | F | H | B |
66 | Me | S- Me | S- tBu | S | N | CH 2CH 2O Ac | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
67 | Me | S- Me | S- iPr | S | N | CH 2CH 2O H | 1, the 4-phenyl | H | H | S-iPr | S-Me | Me | H | F | H | A |
68 | H | H | S- iPr | S | N | CH 2CH 2O H | 1, the 4-phenyl | H | H | S-iPr | H | H | H | F | H | C |
69 | Me | S- Me | S- tBu | S | N | CH 2CH 2O H | 1, the 4-phenyl | H | H | S-tBu | S-Me | Me | H | F | H | A |
70 | Me | R- Me | S- iPr | S | N | CH 2CH 2O Ac | 1, the 4-phenyl | H | H | S-iPr | R-Me | Me | H | F | H | A |
71 | Me | R- Me | S- tBu | S | N | CH 2CH 2O H | 1, the 4-phenyl | H | H | S-tBu | R-Me | Me | H | F | H | B |
Numbering | R8a | R7a | R5a | ( *) of putting of standing body | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope, |
72 | Me | S-Me | S-(2R-Et OH) | S | H | H | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
73 | Me | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | H | F | H | A |
74 | H | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | H | F | H | A |
75 | Me | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | F | H | H | A |
76 | Me | S-Me | H | S | H | H | H | S-Me | Me | H | F | H | B |
77 | Me | S-Me | S-Me | S | H | H | S-Me | S-Me | Me | H | F | H | B |
78 | Me | S-Me | S-(2S-Et OH) | S | H | H | S-(2S-EtO H) | S-Me | Me | H | F | H | A |
79 | Me | S-Me | S-Et | S | H | H | S-Et | S-Me | Me | H | F | H | A |
80 | Me | S-Me | S-(2S-Et OH) | S | H | H | S-(2S-EtO H) | S-Me | Me | F | H | H | A |
81 | H | H | S-iPr | S | H | H | S-iPr | H | H | H | F | H | B |
82 | Me | S-Me | S-sBu | S | H | H | S-sBu | S-Me | Me | F | H | H | A |
83 | Me | S-Me | S-cHex | S | H | H | S-cHex | S-Me | Me | F | H | H | A |
84 | Me | S-Me | S-tBu | S | H | H | S-tBu | S-Me | Me | H | F | H | A |
85 | Me | S-Me | S-cHex | S | H | H | S-cHex | S-Me | Me | H | F | H | A |
86 | Me | S-Me | S-(2R-Et OH) | R | S-OH | S-OH | S-(2R-Et OH) | S-Me | Me | H | F | H | A |
87 | Me | S-Me | S-iPr | R | S-OH | S-OH | S-iPr | S-Me | Me | H | F | H | A |
88 | Me | S-Me | S-(2R-Et OMe) | R | S-OH | S-OH | S-(2R-Et OMe) | S-Me | Me | H | F | H | A |
89 | Me | S-Me | S-(2R-Et OtBu) | R | S-OH | S-OH | S-(2R-Et OtBu) | S-Me | Me | H | F | H | B |
90 | Me | S-Me | S-(2S-Et OH) | R | S-OH | S-OH | S-(2S-EtO H) | S-Me | Me | H | F | H | A |
91 | Me | R-Me | S-iPr | S | H | H | S-iPr | R-Me | Me | H | F | H | B |
92 | Me | S-Me | R-iPr | S | H | H | R-iPr | S-Me | Me | H | F | H | C |
93 | Me | R-Me | R-iPr | S | H | H | R-iPr | R-Me | Me | H | F | H | C |
Numbering | R8a | R7a | R5a | ( *) stereochemistry of position | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope |
94 | Me | S-Me | S-(2R-EtOH) | S | H | H | S-(2R-EtOH) | S-Me | Me | H | H | H | A |
Numbering | R8a | R7a | m | n | Z | R3a | R3b | R7b | R8b | R12 | R13 | R14 | K DRange, μ M | |
95 | Me | Me | 1 | 1 | Z-CH=CH- | H | H | Me | Me | H | F | H | A | |
96 | Me | Me | 1 | 1 | E-CH=CH- | H | H | Me | Me | H | F | H | A | |
97 | Me | Me | 1 | 1 | -CH 2CH 2- | H | H | Me | Me | F | H | H | A | |
98 | Me | Me | 1 | 1 | -CH 2CH 2- | H | H | Me | Me | H | F | H | A | |
99 | H | Me | 1 | 1 | -SS- | H | H | Me | H | H | | H | A | |
100 | Me | Me | 1 | 1 | -CH(OH)CH(OH)- | H | H | Me | Me | H | H | H | A | |
101 | Me | Me | 1 | 1 | -CH 2CH 2- | S-OH | S-OH | Me | Me | H | F | H | A |
Numbering | R8a | R7a | R5a | (*) stereochemistry of position | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope |
102 | H | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | H | F | H | A |
103 | Me | S-Me | S-(2R-EtO H) | S | H | H | S-(2R-EtO H) | S-Me | Me | H | F | H | A |
104 | H | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | H | H | H | A |
105 | Me | S-Me | S-(2R-EtO H) | S | H | H | S-(2R-EtO H) | S-Me | Me | H | H | H | A |
106 | H | S-Me | S-(2R-EtO H) | S | H | H | S-(2R-EtO H) | S-Me | H | H | H | H | A |
107 | Me | S-Me | S-iPr | S | H | H | S-iPr | S-Me | Me | H | H | H | A |
108 | H | S-Et | S-iPr | S | H | H | S-iPr | S-Et | H | H | H | H | A |
109 | Me | S-Et | S-iPr | S | H | H | S-iPr | S-Et | Me | H | H | H | A |
110 | Me | S-Me | S-(2S-EtO H) | S | H | H | S-(2S-EtO H) | S-Me | Me | H | F | H | A |
111 | Me | S-Me | S-Allyl | S | H | H | S-Allyl | S-Me | Me | H | F | H | A |
112 | Me | S-Me | S-iPr | R | S- OH | S- OH | S-iPr | S-Me | Me | H | F | H | A |
113 | Me | S-Me | S-sBu | R | S- OH | S- OH | S-sBu | S-Me | Me | H | F | H | A |
114 | Me | S-Me | S-(2S-EtOt Bu) | R | S- OH | S- OH | S-(2S-EtOt Bu) | S-Me | Me | H | F | H | A |
115 | Me | S-Me | S-(2S-EtO H) | R | S- OH | S- OH | S-(2S-EtO H) | S-Me | Me | H | F | H | A |
116 | Me | S-Me | S-(2R-EtO Me) | R | S- OH | S- OH | S-(2R-EtO Me) | S-Me | Me | H | F | H | A |
117 | Me | S-Me | S-(2S-EtO Me) | R | S- OH | S- OH | S-(2S-EtO Me) | S-Me | Me | H | F | H | A |
118 | Me | S-Me | S-(2R-EtO H) | R | S- OH | S- OH | S-(2R-EtO H) | S-Me | Me | H | F | H | A |
Numbering | R8a | R7a | R5a | ( *) of position body putting is upright | Wa | Wb | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | The KD scope |
119 | Me | S-Me | S-tBu | S | H | H | H | H | S-tBu | S-Me | Me | H | H | H | A |
120 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | Me | H | H | H | A |
121 | Me | S-Me | S-iPr | S | H | H | H | H | S-iPr | S-Me | Me | H | H | H | A |
Numbering | R8a | R7a | R5a | ( *) of position body putting is upright | Wa | Wb | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope, |
122 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | Me | H | H | H | A |
123 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | Me | H | F | H | A |
124 | Me | S-Me | S-(2R-EtOH) | S | H | H | H | H | S-(2R-EtOH) | S-Me | Me | H | F | H | A |
125 | Me | S-Et | S-(2R-EtOH) | S | H | H | H | H | S-(2R-EtOH) | S-Et | Me | F | H | H | B |
126 | Me | S-Me | S-cHex | S | H | H | H | H | S-eHex | S-Me | Me | F | H | H | A |
127 | Me | S-Me | S-cHex | S | Me | Me | H | H | S-cHex | S-Me | Me | F | H | H | A |
128 | Me | S-Et | S-cHex | S | Me | Me | H | H | S-cHex | S-Et | Me | F | H | H | A |
129 | H | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | H | Cl | H | H | A |
130 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | Me | Cl | H | H | A |
131 | H | S-Me | S-iPr | S | H | H | H | H | S-iPr | S-Me | H | Cl | H | H | A |
132 | Me | S-Me | S-iPr | S | H | H | H | H | S-iPr | S-Me | Me | Cl | H | H | A |
133 | Me | S-Me | S-iPr | S | H | H | H | H | S-iPr | S-Me | Me | F | H | H | A |
134 | H | H | S-cHex | S | H | H | H | H | S-cHex | H | H | H | F | H | C |
135 | Me | S-Me | H | S | H | H | H | H | H | S-Me | Me | H | F | H | C |
136 | Me | S-Et | S-(2R-EtOH) | S | H | H | H | H | S-(2R-EtOH) | S-Et | Me | H | F | H | C |
137 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | Me | Me | H | H | A |
138 | H | H | S-cHex | S | H | H | H | H | S-cHex | H | H | H | H | H | B |
139 | H | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | H | H | H | H | A |
140 | Me | S-Me | S-tBu | S | H | H | H | H | S-tBu | S-Me | Me | H | F | H | A |
141 | Me | S-Me | S-tBu | S | H | H | H | H | S-tBu | S-Me | Me | H | H | H | A |
142 | H | S-Me | S-tBu | S | H | H | H | H | S-tBu | S-Me | H | H | H | H | A |
143 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | S-Me | H | H | H | H | A |
144 | Me | S-Me | S-cHex | S | H | H | H | H | S-cHex | H | H | H | H | H | A |
145 | Me | S-Me | S-(2R-EtOH) | S | H | H | H | H | S-(2R-EtOH) | S-Me | Me | H | H | H | B |
146 | Me | S-Me | S-(CH 2) 4NH 2 | S | H | H | H | H | S-(CH 2) 4NH 2 | S-Me | Me | Me | H | H | A |
Numbering | R8a | R7a | R5a | Wa | Wb | ( *) positionization put learn three-dimensional | R11a-R11b | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DScope, |
147 | H | S-Me | S-iPr | H | H | S | CH 2CH 2CH 2 CH 2CH 2CH 2 | H | H | S-iPr | S-Me | H | H | H | H | A |
148 | Me | S-Me | S-cHe x | H | H | S | CH 2CH 2CH 2 CH 2CH 2CH 2 | H | H | S-cHe x | S-Me | Me | H | H | H | A |
149 | Me | S-Me | S-tBu | H | H | S | CH 2CH 2CH 2 CH 2CH 2CH 2 | H | H | S-tBu | S-Me | Me | H | H | H | A |
150 | H | S-Me | iPr | H | H | S | (R,R)-CH 2C H(OH)CH(O H)CH 2 | H | H | iPr | S-Me | H | H | F | H | A |
151 | Me | S-Me | 2R-Et OH | H | H | S | (R,R)-CH 2C H(OH)CH(O H)CH 2 | H | H | 2R-Et OH | S-Me | Me | H | F | H | A |
152 | Me | S-M e | 2R-Et OH | H | H | S | (S,S)-CH 2CH (OH)CH(OH )CH 2 | H | H | 2R-Et OH | S-Me | Me | H | F | H | A |
153 | Me | S-M e | cHex | H | H | S | CH 2CH 2CH 2 | H | H | cHex | S-Me | Me | H | H | H | B |
154 | Me | S-Me | cHex | H | H | S | CH 2CH 2OCH 2 | H | H | cHex | S-Me | Me | H | H | H | A |
CH 2OCH 2CH 2 | ||||||||||||||||
155 | Me | S-Et | cHex | H | H | S | CH 2CH 2OCH 2 CH 2OCH 2CH 2 | H | H | cHex | S-Et | Me | H | H | H | B |
156 | Me | S-Me | 2R-Et OH | H | H | S | CH 2CH 2OCH 2 CH 2OCH 2CH 2 | H | H | 2R-Et OH | S-Me | Me | H | H | H | A |
157 | Me | S-Et | 2R-Et OH | H | H | S | CH 2CH 2OCH 2 CH 2OCH 2CH 2 | H | H | 2R-Et OH | S-Et | Me | H | H | H | B |
158 | Me | S-Me | cHex | H | H | S | C(O)CH 2CH 2C H 2C(O) | H | H | cHex | S-Me | Me | H | H | H | A |
159 | Me | S-Me | cHex | H | H | S | C(O)C 6H 4C(O) | H | H | cHex | S-Me | Me | H | H | H | A |
160 | Me | S-Me | 2R-Et OH | H | H | S | CH 2CH 2 | H | H | 2R-Et OH | S-Me | Me | H | H | H | A |
161 | Me | S-Me | 2R-Et OH | H | H | S | CH 2CH 2CH 2 CH 2 | H | H | 2R-Et OH | S-Me | Me | H | H | H | B |
Numbering | R8a | R7a | R5a | Wa | R11b | ( *) upright of position body putting | X | Wb-R11a | R3a | R3b | R5b | R7b | R8b | R12 | R13 | R14 | K DPαvγε |
162 | Me | S-Me | S-(2R- EtOH) | H | - | S | O | CH 2CH 2CH 2 | H | H | S-(2R- EtOH | S-Me | Me | H | H | H | D |
163 | Me | S-Me | S-cHex | H | - | S | O | CH 2CH 2CH 2 | H | H | S-cHex | S-Me | Me | H | H | H | A |
Claims (21)
Applications Claiming Priority (11)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US65620105P | 2005-02-25 | 2005-02-25 | |
US60/656,201 | 2005-02-25 | ||
US66834405P | 2005-04-05 | 2005-04-05 | |
US60/668,344 | 2005-04-05 | ||
US69211105P | 2005-06-20 | 2005-06-20 | |
US60/692,111 | 2005-06-20 | ||
US70664905P | 2005-08-09 | 2005-08-09 | |
US60/706,649 | 2005-08-09 | ||
US72985305P | 2005-10-25 | 2005-10-25 | |
US60/729,853 | 2005-10-25 | ||
PCT/US2006/007068 WO2006091972A2 (en) | 2005-02-25 | 2006-02-27 | Dimeric iap inhibitors |
Related Child Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN201210418582.6A Division CN103083644B (en) | 2005-02-25 | 2006-02-27 | Dimeric iap inhibitors |
Publications (2)
Publication Number | Publication Date |
---|---|
CN101128425A true CN101128425A (en) | 2008-02-20 |
CN101128425B CN101128425B (en) | 2012-12-26 |
Family
ID=39096015
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN2006800053464A Active CN101128425B (en) | 2005-02-25 | 2006-02-27 | Dimeric IAP inhibitors |
Country Status (2)
Country | Link |
---|---|
CN (1) | CN101128425B (en) |
ZA (1) | ZA200707023B (en) |
Cited By (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN102471275A (en) * | 2009-07-02 | 2012-05-23 | 泰特拉洛吉克药业公司 | SMAC mimetic |
CN104718209A (en) * | 2012-08-23 | 2015-06-17 | 密执安大学评议会 | Bivalent inhibitors of IAP proteins and therapeutic methods using the same |
CN104870441A (en) * | 2012-10-19 | 2015-08-26 | 阿斯特克斯治疗有限公司 | Bicyclic heterocycle compounds and their uses in therapy |
CN108290867A (en) * | 2016-04-28 | 2018-07-17 | 江苏恒瑞医药股份有限公司 | A method of preparing tyrosine kinase inhibitor and its derivative |
CN108440507A (en) * | 2017-02-16 | 2018-08-24 | 南京圣和药业股份有限公司 | Compound as apoptosis protein inhibitor and its application |
WO2019154053A1 (en) * | 2018-02-09 | 2019-08-15 | 广东东阳光药业有限公司 | Iap inhibitor and use of same in medicine |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2002096930A2 (en) * | 2001-05-31 | 2002-12-05 | The Trustees Of Princeton University | Iap binding peptides and assays for identifying compounds that bind iap |
-
2006
- 2006-02-27 CN CN2006800053464A patent/CN101128425B/en active Active
-
2007
- 2007-08-21 ZA ZA200707023A patent/ZA200707023B/en unknown
Cited By (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN102471275B (en) * | 2009-07-02 | 2014-05-28 | 泰特拉洛吉克药业公司 | SMAC mimetic |
CN102471275A (en) * | 2009-07-02 | 2012-05-23 | 泰特拉洛吉克药业公司 | SMAC mimetic |
CN109485662B (en) * | 2012-08-23 | 2021-12-21 | 密歇根大学董事会 | Bivalent inhibitors of IAP proteins and therapeutic methods using the same |
CN104718209A (en) * | 2012-08-23 | 2015-06-17 | 密执安大学评议会 | Bivalent inhibitors of IAP proteins and therapeutic methods using the same |
CN109485662A (en) * | 2012-08-23 | 2019-03-19 | 密歇根大学董事会 | The bivalent inhibitor of IAP albumen and the treatment method for using it |
CN104870441A (en) * | 2012-10-19 | 2015-08-26 | 阿斯特克斯治疗有限公司 | Bicyclic heterocycle compounds and their uses in therapy |
CN104870441B (en) * | 2012-10-19 | 2017-09-29 | 阿斯特克斯治疗有限公司 | Bicyclic heterocycles and its therapeutical uses |
CN108290867A (en) * | 2016-04-28 | 2018-07-17 | 江苏恒瑞医药股份有限公司 | A method of preparing tyrosine kinase inhibitor and its derivative |
CN108290867B (en) * | 2016-04-28 | 2022-02-08 | 江苏恒瑞医药股份有限公司 | Method for preparing tyrosine kinase inhibitor and derivative thereof |
CN108440507A (en) * | 2017-02-16 | 2018-08-24 | 南京圣和药业股份有限公司 | Compound as apoptosis protein inhibitor and its application |
CN108440507B (en) * | 2017-02-16 | 2022-10-18 | 南京圣和药物研发有限公司 | Compound as apoptosis protein inhibitor and application thereof |
CN111655713A (en) * | 2018-02-09 | 2020-09-11 | 广东东阳光药业有限公司 | IAP inhibitors and their use in medicine |
WO2019154053A1 (en) * | 2018-02-09 | 2019-08-15 | 广东东阳光药业有限公司 | Iap inhibitor and use of same in medicine |
CN111655713B (en) * | 2018-02-09 | 2023-06-27 | 广东东阳光药业有限公司 | IAP inhibitor and application thereof in medicines |
Also Published As
Publication number | Publication date |
---|---|
ZA200707023B (en) | 2009-06-24 |
CN101128425B (en) | 2012-12-26 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CN103083644B (en) | Dimeric iap inhibitors | |
TWI822827B (en) | IL-2Rγc ligands, compounds containing IL-2Rγc ligands and uses thereof | |
CN105473140B (en) | To the instantaneous protection of normal cell during chemotherapy | |
CN102112467B (en) | Pyrimidine derivative as kinase inhibitors | |
CN104854101B (en) | Alk kinase inhibitors | |
CN104540385B (en) | Pyrimidine radicals tyrosine kinase inhibitor | |
CN1329392C (en) | Substituted pyrazoles | |
CN102271681B (en) | Modulators of cxcr7 | |
CN103497188B (en) | The compound of regulation c fms and/or c kit activity and its application | |
CN102741241B (en) | Benzimidazole-imidazole derivatives | |
JP2022531801A (en) | Phenylaminopyrimidine amide autophagy inhibitor and how to use it | |
DE69830806T2 (en) | INTEGRIN RECEPTOR ANTAGONISTS | |
CN101128425B (en) | Dimeric IAP inhibitors | |
CN109219604A (en) | Tetrahydroisoquinoline estrogenic agents and application thereof | |
CN104379575A (en) | Compounds and compositions for modulating egfr activity | |
CN102458116A (en) | Iap inhibitors | |
CN101516904A (en) | Dimeric IAP antagonists | |
CN108699057A (en) | 2- (morpholine -4- bases) -1,7- naphthyridines of 5- substitutions | |
CN101790524A (en) | Antiviral compound | |
CN102939292A (en) | Spirocyclic compounds and their use as therapeutic agents and diagnostic probes | |
RU2694624C2 (en) | Pyrrolidinone derivatives as methar-2 inhibitors | |
CN102791697A (en) | Amino-pyrimidine compounds as inhibitors of TBKL and/or IKK epsilon | |
CN106220623A (en) | Compounds and methods for and indication thereof for kinases regulation | |
CN105189484A (en) | Cxcr7 antagonists | |
CN105934248A (en) | Substituted pyroolopyridines and pyrrolopyrazines for treating cancer or inflammatory diseases |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
C06 | Publication | ||
PB01 | Publication | ||
C10 | Entry into substantive examination | ||
SE01 | Entry into force of request for substantive examination | ||
REG | Reference to a national code |
Ref country code: HK Ref legal event code: DE Ref document number: 1118044 Country of ref document: HK |
|
C14 | Grant of patent or utility model | ||
GR01 | Patent grant | ||
CI01 | Correction of invention patent gazette |
Correction item: Description Correct: Correct False: Error Number: 52 Volume: 28 |
|
CI03 | Correction of invention patent |
Correction item: Description Correct: Correct False: Error Number: 52 Page: Description Volume: 28 |
|
ERR | Gazette correction |
Free format text: CORRECT: DESCRIPTION; FROM: ERROR TO: CORRECT |
|
RECT | Rectification | ||
REG | Reference to a national code |
Ref country code: HK Ref legal event code: GR Ref document number: 1118044 Country of ref document: HK |
|
TR01 | Transfer of patent right |
Effective date of registration: 20171019 Address after: West Midlands Patentee after: Tate jeek bilina Lalo pant UK Ltd Address before: American Pennsylvania Patentee before: Tetralogic Pharmaceuticals |
|
TR01 | Transfer of patent right | ||
CP02 | Change in the address of a patent holder |
Address after: England Patentee after: Tate jeek bilina Lalo pant UK Ltd Address before: West Midlands Patentee before: Tate jeek bilina Lalo pant UK Ltd |
|
CP02 | Change in the address of a patent holder | ||
TR01 | Transfer of patent right |
Effective date of registration: 20190923 Address after: Hu Dinge, Sweden Patentee after: Medville Co., Ltd. Address before: England Patentee before: Tate jeek bilina Lalo pant UK Ltd |
|
TR01 | Transfer of patent right |