CH555325A - Verfahren zur herstellung von amidinophenylharnstoffen. - Google Patents
Verfahren zur herstellung von amidinophenylharnstoffen.Info
- Publication number
- CH555325A CH555325A CH1371A CH1371A CH555325A CH 555325 A CH555325 A CH 555325A CH 1371 A CH1371 A CH 1371A CH 1371 A CH1371 A CH 1371A CH 555325 A CH555325 A CH 555325A
- Authority
- CH
- Switzerland
- Prior art keywords
- amidinophenyl
- urea
- production
- amidinophenyl urea
- Prior art date
Links
- FVWJDGCUZMFFES-UHFFFAOYSA-N 1-carbamimidoyl-1-phenylurea Chemical compound NC(=N)N(C(N)=O)C1=CC=CC=C1 FVWJDGCUZMFFES-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32370 | 1970-01-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH555325A true CH555325A (de) | 1974-10-31 |
Family
ID=9702371
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1371A CH555325A (de) | 1970-01-02 | 1971-01-04 | Verfahren zur herstellung von amidinophenylharnstoffen. |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE761075A (show.php) |
| CH (1) | CH555325A (show.php) |
| DK (1) | DK128494C (show.php) |
| ES (1) | ES386969A1 (show.php) |
| GB (1) | GB1336871A (show.php) |
| NL (1) | NL7019013A (show.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL37047A0 (en) * | 1970-06-30 | 1971-08-25 | Wellcome Found | Substituted amidines,their preparation and pharmaceutical compositions containing them |
| US5681794A (en) * | 1993-08-18 | 1997-10-28 | Bayer Aktiengesellschaft | N-cyanoaryl-nitrogen heterocycles |
| DE4412079A1 (de) * | 1993-08-18 | 1995-02-23 | Bayer Ag | N-Cyanoaryl-Stickstoffheterocyclen |
| EP0648749B1 (de) * | 1993-08-18 | 1997-12-10 | Bayer Ag | N-Cyanoaryl-Stickstoffheterocyclen |
| DE19737463A1 (de) * | 1997-08-28 | 1999-03-04 | Hoechst Marion Roussel De Gmbh | Verwendung von Inhibitoren des Natrium-Wasserstoff-Austauschers zur Herstellung eines Arzneimittels zur Behandlung von Erkrankungen, die durch Protozoen verursacht werden |
-
1970
- 1970-12-23 GB GB1336871D patent/GB1336871A/en not_active Expired
- 1970-12-29 DK DK661770A patent/DK128494C/da active
- 1970-12-30 NL NL7019013A patent/NL7019013A/xx unknown
- 1970-12-30 BE BE761075A patent/BE761075A/xx unknown
- 1970-12-31 ES ES386969A patent/ES386969A1/es not_active Expired
-
1971
- 1971-01-04 CH CH1371A patent/CH555325A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE761075A (fr) | 1971-06-30 |
| DK128494C (da) | 1974-09-23 |
| DK128494B (show.php) | 1974-05-13 |
| ES386969A1 (es) | 1973-04-16 |
| GB1336871A (en) | 1973-11-14 |
| NL7019013A (show.php) | 1971-07-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH558395A (de) | Verfahren zur herstellung von verseifungsbestaendigen polycarbonaten. | |
| CH555813A (de) | Verfahren zur herstellung von perfluoralkyl-alkylensulfonamido-alkylendialkylaminen. | |
| CH546805A (de) | Verfahren zur herstellung von polyphenylenoxyden. | |
| CH549029A (de) | Verfahren zur herstellung von dihydrobenzodiazepinonen. | |
| CH557345A (de) | Verfahren zur herstellung von tetrahydropyranolen. | |
| CH550771A (de) | Verfahren zur herstellung von phenaethylaminderivaten. | |
| AT317910B (de) | Verfahren zur Herstellung von Harnstoff | |
| CH557844A (de) | Verfahren zur herstellung von styrol-acrylnitril-copolymeren. | |
| CH550133A (de) | Verfahren zur herstellung von 4-methyl-pentanol-2-crotonat. | |
| CH547298A (de) | Verfahren zur herstellung von pyrimidopyridazinen. | |
| CH555325A (de) | Verfahren zur herstellung von amidinophenylharnstoffen. | |
| CH550214A (de) | Verfahren zur herstellung von cyclocopolymerisaten. | |
| CH550797A (de) | Verfahren zur herstellung von tetrahydroisochinolinderivaten. | |
| CH557830A (de) | Verfahren zur herstellung von 1-aminosiochinolinen. | |
| CH558800A (de) | Verfahren zur herstellung von chinazolinonen. | |
| CH547775A (de) | Verfahren zur herstellung von diaethylaminopropionaniliden. | |
| CH549567A (de) | Verfahren zur herstellung von 8-cyano-5-octanolid. | |
| CH553185A (de) | Verfahren zur herstellung von lumilysergol-derivaten. | |
| CH558809A (de) | Verfahren zur herstellung von penicillinen. | |
| CH547261A (de) | Verfahren zur herstellung von alkanolaminderivaten. | |
| CH551450A (de) | Verfahren zur herstellung von formylnitrilderivaten. | |
| CH557796A (de) | Verfahren zur herstellung von cyclopropylmethylalkylaminen. | |
| CH547802A (de) | Verfahren zur herstellung von tetrahydropyridinderivaten. | |
| AT311307B (de) | Verfahren zur Herstellung von Methacrolein | |
| CH557370A (de) | Verfahren zur herstellung von isoxazolylaethyl-tetrahydropyranolen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |