CH397325A - Verwendung von Carbanilhydroxamsäureestern als herbizide Mittel - Google Patents
Verwendung von Carbanilhydroxamsäureestern als herbizide MittelInfo
- Publication number
- CH397325A CH397325A CH63861A CH63861A CH397325A CH 397325 A CH397325 A CH 397325A CH 63861 A CH63861 A CH 63861A CH 63861 A CH63861 A CH 63861A CH 397325 A CH397325 A CH 397325A
- Authority
- CH
- Switzerland
- Prior art keywords
- carbanil
- acid esters
- hydroxamic acid
- herbicidal agents
- herbicidal
- Prior art date
Links
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/64—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups singly-bound to oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL134755D NL134755C (enExample) | 1961-01-19 | ||
| NL273695D NL273695A (enExample) | 1961-01-19 | ||
| BE612773D BE612773A (enExample) | 1961-01-19 | ||
| FR1310269D FR1310269A (enExample) | 1961-01-19 | ||
| CH63861A CH397325A (de) | 1961-01-19 | 1961-01-19 | Verwendung von Carbanilhydroxamsäureestern als herbizide Mittel |
| US166710A US3165549A (en) | 1961-01-19 | 1962-01-16 | Carbanil-hydroxamic acid esters |
| DE1542711A DE1542711C3 (de) | 1961-01-19 | 1962-01-18 | N Phenyl N5 oxyalkyl NP alkylharnstof fe, ihre Verwendung als Herbizide und diese enthaltende herbizide Mittel |
| ES273832A ES273832A1 (es) | 1961-01-19 | 1962-01-18 | Medios para combatir el desarrollo de las plantas indeseables |
| BR135764/62A BR6235764D0 (pt) | 1961-01-19 | 1962-01-19 | Processo para a fabricacao de novos derivados de acido hidroxamico e composicoes herbicidas contendo os mesmos |
| GB2102/62A GB940321A (en) | 1961-01-19 | 1962-01-19 | Carbanil-hydroxamic acid esters and herbicidal preparations containing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH63861A CH397325A (de) | 1961-01-19 | 1961-01-19 | Verwendung von Carbanilhydroxamsäureestern als herbizide Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH397325A true CH397325A (de) | 1965-08-15 |
Family
ID=4191663
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH63861A CH397325A (de) | 1961-01-19 | 1961-01-19 | Verwendung von Carbanilhydroxamsäureestern als herbizide Mittel |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3165549A (enExample) |
| BE (1) | BE612773A (enExample) |
| BR (1) | BR6235764D0 (enExample) |
| CH (1) | CH397325A (enExample) |
| DE (1) | DE1542711C3 (enExample) |
| ES (1) | ES273832A1 (enExample) |
| FR (1) | FR1310269A (enExample) |
| GB (1) | GB940321A (enExample) |
| NL (2) | NL273695A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH398543A (de) * | 1961-05-06 | 1966-03-15 | Ciba Geigy | Verfahren zur Herstellung von Harnstoffderivaten |
| DE1542882A1 (de) * | 1966-07-22 | 1970-06-04 | Hoechst Ag | Mittel zur Bekaempfung von Unkraeutern |
| BE791449A (fr) * | 1971-11-17 | 1973-05-16 | Roussel Uclaf | Nouvelles urees substituees et procede de |
| US3771993A (en) * | 1972-05-15 | 1973-11-13 | Chevron Res | N-aryl-n-alkyl-n{40 -arylthio ureas as herbicides |
| DE2411320A1 (de) * | 1974-03-09 | 1975-09-18 | Bayer Ag | (trifluormethylphenoxy)-phenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| ZA752788B (en) * | 1974-05-02 | 1976-04-28 | Shell Nv | Herbicidally active compounds |
| US5036157A (en) * | 1986-03-11 | 1991-07-30 | Burroughs Wellcome Co. | Aryl derivatives |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2705195A (en) * | 1951-09-27 | 1955-03-29 | Du Pont | Herbicidal compositions and methods employing solutions of substituted ureas in monohydric phenols |
| US2663729A (en) * | 1952-11-04 | 1953-12-22 | Du Pont | Haloarylhydroxyalkyl-ureas |
| US2663730A (en) * | 1953-09-16 | 1953-12-22 | Ethyl Corp | N-alkyl-n'-(p-hydroxyphenyl) ureas |
| BE529063A (enExample) * | 1953-10-13 | |||
| US2723192A (en) * | 1954-02-23 | 1955-11-08 | Du Pont | Herbicidal process and product |
| US2960534A (en) * | 1957-06-11 | 1960-11-15 | Hoechst Ag | Nu-(chlorosubstituted aryl)-nu' methoxy-nu' methyl ureas |
| US3000940A (en) * | 1959-02-17 | 1961-09-19 | Du Pont | Perchlorylarylureas |
-
0
- BE BE612773D patent/BE612773A/xx unknown
- FR FR1310269D patent/FR1310269A/fr not_active Expired
- NL NL134755D patent/NL134755C/xx active
- NL NL273695D patent/NL273695A/xx unknown
-
1961
- 1961-01-19 CH CH63861A patent/CH397325A/de unknown
-
1962
- 1962-01-16 US US166710A patent/US3165549A/en not_active Expired - Lifetime
- 1962-01-18 ES ES273832A patent/ES273832A1/es not_active Expired
- 1962-01-18 DE DE1542711A patent/DE1542711C3/de not_active Expired
- 1962-01-19 BR BR135764/62A patent/BR6235764D0/pt unknown
- 1962-01-19 GB GB2102/62A patent/GB940321A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BR6235764D0 (pt) | 1973-05-10 |
| GB940321A (en) | 1963-10-30 |
| US3165549A (en) | 1965-01-12 |
| DE1542711A1 (de) | 1970-03-26 |
| FR1310269A (enExample) | 1963-03-06 |
| DE1542711B2 (de) | 1973-05-10 |
| BE612773A (enExample) | |
| ES273832A1 (es) | 1962-06-01 |
| NL134755C (enExample) | |
| DE1542711C3 (de) | 1973-11-29 |
| NL273695A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH414157A (de) | Verwendung von Monocarbodiimiden als stabilisierendes Mittel | |
| CH423350A (de) | Pestizides Mittel | |
| CH458876A (de) | Verwendung von Bis-benztriazolen als korrosionshemmendes und metalldeaktivierendes Mittel | |
| CH407413A (de) | Kosmetisches Mittel | |
| CH374243A (de) | Verwendung von Dipyridylverbindungen als herbizide Mittel | |
| CH427405A (de) | Herbizides Mittel | |
| CH425330A (de) | Verwendung von halogenierten Thiobenzamiden bzw. -Imiden als Herbizide | |
| CH397325A (de) | Verwendung von Carbanilhydroxamsäureestern als herbizide Mittel | |
| CH430059A (de) | Verwendung von Epoxyorganosiloxanen als Haarbehandlungsmittel | |
| CH398174A (de) | Fungizide Mittel | |
| CH384279A (de) | Fungizides Mittel | |
| AT239593B (de) | Carbanilsäureester enthaltende herbizide Mittel | |
| CH433860A (de) | Herbizides Mittel | |
| CH396857A (de) | Elektrolysesystem und Verwendung desselben | |
| CH393828A (de) | Herbizides oder fungizides Mittel | |
| CH404290A (de) | Herbizides Mittel | |
| CH405004A (de) | Fungizides Mittel | |
| CH393824A (de) | Fungizides Mittel | |
| BE606221A (fr) | Aérosol pour teindre des cheveux vivants | |
| CH389986A (de) | Herbizides Mittel | |
| FR1259182A (fr) | Perfectionnement aux charnières | |
| AT224384B (de) | Fungizides Mittel | |
| CH411450A (de) | Fungizides Mittel | |
| AT229629B (de) | Herbizides Mittel | |
| CH407647A (de) | Herbizides Mittel |