CA985289A - 4-hydroxy-2h-benzothiopyran-3-carboxamide 1,1-dioxides - Google Patents
4-hydroxy-2h-benzothiopyran-3-carboxamide 1,1-dioxidesInfo
- Publication number
- CA985289A CA985289A CA147,204A CA147204A CA985289A CA 985289 A CA985289 A CA 985289A CA 147204 A CA147204 A CA 147204A CA 985289 A CA985289 A CA 985289A
- Authority
- CA
- Canada
- Prior art keywords
- benzothiopyran
- dioxides
- carboxamide
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BTXJBTFMAXWCQO-UHFFFAOYSA-N 4-hydroxy-1,1-dioxo-2h-thiochromene-3-carboxamide Chemical class C1=CC=C2S(=O)(=O)CC(C(=O)N)=C(O)C2=C1 BTXJBTFMAXWCQO-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16307671A | 1971-07-15 | 1971-07-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA985289A true CA985289A (en) | 1976-03-09 |
Family
ID=22588383
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA147,204A Expired CA985289A (en) | 1971-07-15 | 1972-07-14 | 4-hydroxy-2h-benzothiopyran-3-carboxamide 1,1-dioxides |
Country Status (7)
| Country | Link |
|---|---|
| JP (2) | JPS51118B1 (esLanguage) |
| AU (1) | AU463811B2 (esLanguage) |
| CA (1) | CA985289A (esLanguage) |
| DE (1) | DE2264938A1 (esLanguage) |
| DK (1) | DK132629C (esLanguage) |
| FR (1) | FR2145691A1 (esLanguage) |
| SE (1) | SE394677B (esLanguage) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3769292A (en) * | 1972-04-28 | 1973-10-30 | Warner Lambert Co | N-(pyridyl)2h 1-benzothiopyran-3-carboxamide-4-hydroxy 1,1-dioxides |
| US4226998A (en) * | 1974-09-26 | 1980-10-07 | Ciba-Geigy Corporation | 1-Benzothiepin-4-carboxamides |
| US4166126A (en) * | 1974-09-26 | 1979-08-28 | Ciba-Geigy Corporation | 1-benzothiepin-4-carboxamides |
| SE420725B (sv) * | 1974-09-26 | 1981-10-26 | Ciba Geigy Ag | Sett att framstella 2,3-dihydro-1-benstiepin-4-karboxylsyraamider |
| US4242266A (en) * | 1974-09-26 | 1980-12-30 | Ciba-Geigy Corporation | 1-Benzothiepin-4-carboxylic acid derivatives |
| SE418932B (sv) * | 1977-12-16 | 1981-07-06 | Nederman Bill P Ph | Med rorlig gaspassageenhet forsedd, gasgenomstrommningskanal bildande bana |
-
1972
- 1972-05-30 DE DE19722264938 patent/DE2264938A1/de active Pending
- 1972-07-10 AU AU44413/72A patent/AU463811B2/en not_active Expired
- 1972-07-12 JP JP6917372A patent/JPS51118B1/ja active Pending
- 1972-07-13 FR FR7225504A patent/FR2145691A1/fr active Granted
- 1972-07-14 CA CA147,204A patent/CA985289A/en not_active Expired
- 1972-07-14 DK DK354472A patent/DK132629C/da not_active IP Right Cessation
- 1972-07-14 SE SE934472A patent/SE394677B/xx unknown
-
1974
- 1974-10-18 JP JP12021174A patent/JPS50116614A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2226298B2 (de) | 1975-08-21 |
| DK132629C (da) | 1976-07-19 |
| DK132629B (da) | 1976-01-12 |
| JPS51118B1 (esLanguage) | 1976-01-05 |
| FR2145691A1 (en) | 1973-02-23 |
| AU463811B2 (en) | 1975-08-07 |
| JPS50116614A (esLanguage) | 1975-09-12 |
| FR2145691B1 (esLanguage) | 1976-04-16 |
| AU4441372A (en) | 1974-01-17 |
| SE394677B (sv) | 1977-07-04 |
| DE2226298A1 (de) | 1973-02-15 |
| DE2264938A1 (de) | 1975-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA962666A (en) | 1,25-dihydroxycholecaliferol | |
| AU463690B2 (en) | 1, 3, 4-oxadiazolone derivatives | |
| CA988092A (en) | 4,5-dihalopyrrole-2-carbonitriles | |
| AU463873B2 (en) | 1, 4-bis-ACYLPIPERAZINES | |
| CA985289A (en) | 4-hydroxy-2h-benzothiopyran-3-carboxamide 1,1-dioxides | |
| CA997763A (en) | 2,4,diamino-5-benzylpyrimidine | |
| AU468410B2 (en) | 2, 4-diamino-5-benzyl-pyrimidines | |
| AU468447B2 (en) | 2, 4-diamino-5-benzyl-pyrimidines | |
| AU4281672A (en) | 2-chloroallyl 2,5-dimethyl-1-pyrrolidine-carbodithioate | |
| AU468307B2 (en) | 1, 2-biguanides | |
| CA975378A (en) | 5-hydoxymethyl-(1,3-dioxa-2-silacyclohexanes) | |
| CA976543A (en) | 4,6,8(14)-triene-steroids | |
| AU459270B2 (en) | 3, 2-benzoxazepine derivatives | |
| CA862104A (en) | 1,2,5-thiadiazoles | |
| CA880325A (en) | 1,3,4-thiadiazoles | |
| CA874360A (en) | Thiophene 1,1-dioxides | |
| CA872219A (en) | 16,17-alkylidenediazopregnanes | |
| CA882143A (en) | 3,4-epoxy-4-methylcyclohexanes | |
| CA865727A (en) | 4,5-dehydro-3-oxo-19-hydroxysteroids | |
| CA871120A (en) | 3,4-dihydroquinazolinones | |
| CA871704A (en) | 2,6-methano-3-benzazocines | |
| AU452853B2 (en) | 4 ALKOXY-l, 2-METHYLENEDIOXYBENZENES | |
| CA865743A (en) | 5,10-epoxy-dibenzocycloheptenes | |
| CA874978A (en) | 3,4-dihydroquinazolinones | |
| CA883819A (en) | 6,9,21-trihalogenosteroids |