CA1247431A - Migration imaging system - Google Patents
Migration imaging systemInfo
- Publication number
- CA1247431A CA1247431A CA000471328A CA471328A CA1247431A CA 1247431 A CA1247431 A CA 1247431A CA 000471328 A CA000471328 A CA 000471328A CA 471328 A CA471328 A CA 471328A CA 1247431 A CA1247431 A CA 1247431A
- Authority
- CA
- Canada
- Prior art keywords
- migration
- softenable layer
- layer
- marking material
- substrate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003384 imaging method Methods 0.000 title claims abstract description 148
- 238000013508 migration Methods 0.000 title claims abstract description 147
- 230000005012 migration Effects 0.000 title claims abstract description 147
- 239000000463 material Substances 0.000 claims abstract description 118
- 239000000758 substrate Substances 0.000 claims abstract description 61
- 239000010410 layer Substances 0.000 claims description 198
- 239000002904 solvent Substances 0.000 claims description 27
- 238000007600 charging Methods 0.000 claims description 21
- 230000003213 activating effect Effects 0.000 claims description 13
- 230000005855 radiation Effects 0.000 claims description 11
- 238000002347 injection Methods 0.000 claims description 10
- 239000007924 injection Substances 0.000 claims description 10
- 230000003247 decreasing effect Effects 0.000 claims description 9
- 239000002356 single layer Substances 0.000 claims description 9
- 239000002800 charge carrier Substances 0.000 claims description 8
- 230000003595 spectral effect Effects 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229920005989 resin Polymers 0.000 claims description 5
- 239000011347 resin Substances 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 230000001681 protective effect Effects 0.000 claims description 2
- 238000000034 method Methods 0.000 description 40
- 229910052757 nitrogen Inorganic materials 0.000 description 33
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 26
- 238000011161 development Methods 0.000 description 23
- 239000002245 particle Substances 0.000 description 21
- 239000002390 adhesive tape Substances 0.000 description 20
- 230000003287 optical effect Effects 0.000 description 20
- 229920001577 copolymer Polymers 0.000 description 18
- 238000000576 coating method Methods 0.000 description 17
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 15
- 238000005299 abrasion Methods 0.000 description 15
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 14
- -1 inclium Chemical compound 0.000 description 14
- 229910052711 selenium Inorganic materials 0.000 description 14
- 239000011669 selenium Substances 0.000 description 14
- 238000012545 processing Methods 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 229920002799 BoPET Polymers 0.000 description 10
- 239000005041 Mylar™ Substances 0.000 description 10
- 239000011230 binding agent Substances 0.000 description 10
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 10
- 230000000903 blocking effect Effects 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 230000000717 retained effect Effects 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 235000010290 biphenyl Nutrition 0.000 description 7
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000004305 biphenyl Substances 0.000 description 6
- 150000004985 diamines Chemical class 0.000 description 6
- LNCPIMCVTKXXOY-UHFFFAOYSA-N hexyl 2-methylprop-2-enoate Chemical compound CCCCCCOC(=O)C(C)=C LNCPIMCVTKXXOY-UHFFFAOYSA-N 0.000 description 6
- 239000011159 matrix material Substances 0.000 description 5
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 5
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical group CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 238000000151 deposition Methods 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 239000013081 microcrystal Substances 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 235000002791 Panax Nutrition 0.000 description 3
- 241000208343 Panax Species 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- SOGAXMICEFXMKE-UHFFFAOYSA-N alpha-Methyl-n-butyl acrylate Natural products CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000005670 electromagnetic radiation Effects 0.000 description 3
- 210000004905 finger nail Anatomy 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- JGOAZQAXRONCCI-SDNWHVSQSA-N n-[(e)-benzylideneamino]aniline Chemical compound C=1C=CC=CC=1N\N=C\C1=CC=CC=C1 JGOAZQAXRONCCI-SDNWHVSQSA-N 0.000 description 3
- 210000000282 nail Anatomy 0.000 description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 3
- 239000004417 polycarbonate Substances 0.000 description 3
- 229920000515 polycarbonate Polymers 0.000 description 3
- 238000001771 vacuum deposition Methods 0.000 description 3
- ABMKWMASVFVTMD-UHFFFAOYSA-N 1-methyl-2-(2-methylphenyl)benzene Chemical group CC1=CC=CC=C1C1=CC=CC=C1C ABMKWMASVFVTMD-UHFFFAOYSA-N 0.000 description 2
- JJQYAPNPXXKRDF-UHFFFAOYSA-N 4-(2,3-dihydro-1h-pyrazol-3-yl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1C=CNN1 JJQYAPNPXXKRDF-UHFFFAOYSA-N 0.000 description 2
- ZYASLTYCYTYKFC-UHFFFAOYSA-N 9-methylidenefluorene Chemical class C1=CC=C2C(=C)C3=CC=CC=C3C2=C1 ZYASLTYCYTYKFC-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N Carbazole Natural products C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229920013620 Pliolite Polymers 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000005499 meniscus Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 description 1
- WPMHMYHJGDAHKX-UHFFFAOYSA-N 1-ethenylpyrene Chemical compound C1=C2C(C=C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 WPMHMYHJGDAHKX-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 1
- BZCSACYQMHVJKO-UHFFFAOYSA-N 2-(4-butoxycarbonyl-2,7-dinitrofluoren-9-ylidene)propanedioic acid Chemical compound OC(=O)C(C(O)=O)=C1C2=CC([N+]([O-])=O)=CC=C2C2=C1C=C([N+]([O-])=O)C=C2C(=O)OCCCC BZCSACYQMHVJKO-UHFFFAOYSA-N 0.000 description 1
- NGXPSFCDNMDGCI-UHFFFAOYSA-N 2-chloro-n-[4-[4-(n-(2-chlorophenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound ClC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)Cl)C1=CC=CC=C1 NGXPSFCDNMDGCI-UHFFFAOYSA-N 0.000 description 1
- QNXWZWDKCBKRKK-UHFFFAOYSA-N 2-methyl-n-[4-[4-(n-(2-methylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound CC1=CC=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C(=CC=CC=1)C)C1=CC=CC=C1 QNXWZWDKCBKRKK-UHFFFAOYSA-N 0.000 description 1
- FJBAOOGKMNJJGK-UHFFFAOYSA-N 4-(1,3-dihydropyrazol-2-yl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1N1NC=CC1 FJBAOOGKMNJJGK-UHFFFAOYSA-N 0.000 description 1
- XPSLOHMBERQXIX-UHFFFAOYSA-N 4-(diethylamino)-2-ethoxybenzaldehyde Chemical compound CCOC1=CC(N(CC)CC)=CC=C1C=O XPSLOHMBERQXIX-UHFFFAOYSA-N 0.000 description 1
- GAYAMEKFIBYRJW-UHFFFAOYSA-N 4-(fluoren-9-ylidenemethyl)-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=C1C2=CC=CC=C2C2=CC=CC=C21 GAYAMEKFIBYRJW-UHFFFAOYSA-N 0.000 description 1
- MJPYLFDAOCWBAZ-UHFFFAOYSA-N 4-[2-[5-[2-[4-(dimethylamino)phenyl]ethenyl]-2-phenyl-1,3-dihydropyrazol-3-yl]ethenyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=CC1N(C=2C=CC=CC=2)NC(C=CC=2C=CC(=CC=2)N(C)C)=C1 MJPYLFDAOCWBAZ-UHFFFAOYSA-N 0.000 description 1
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 1
- ZDEBRDFIUSEHJN-UHFFFAOYSA-N 4-ethyl-n-[4-[4-(n-(4-ethylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound C1=CC(CC)=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C=CC(CC)=CC=1)C1=CC=CC=C1 ZDEBRDFIUSEHJN-UHFFFAOYSA-N 0.000 description 1
- UNZWWPCQEYRCMU-UHFFFAOYSA-N 4-methyl-n-[4-[4-(n-(4-methylphenyl)anilino)phenyl]phenyl]-n-phenylaniline Chemical compound C1=CC(C)=CC=C1N(C=1C=CC(=CC=1)C=1C=CC(=CC=1)N(C=1C=CC=CC=1)C=1C=CC(C)=CC=1)C1=CC=CC=C1 UNZWWPCQEYRCMU-UHFFFAOYSA-N 0.000 description 1
- GVFZLTNGWXSSLU-UHFFFAOYSA-N 9-[(2,4-dimethoxyphenyl)methylidene]fluorene Chemical compound COC1=CC(OC)=CC=C1C=C1C2=CC=CC=C2C2=CC=CC=C21 GVFZLTNGWXSSLU-UHFFFAOYSA-N 0.000 description 1
- NKNOIHZBUJIRRY-UHFFFAOYSA-N 9-[(4-methoxyphenyl)methylidene]fluorene Chemical compound C1=CC(OC)=CC=C1C=C1C2=CC=CC=C2C2=CC=CC=C21 NKNOIHZBUJIRRY-UHFFFAOYSA-N 0.000 description 1
- XRBNIPUYAMAOGV-UHFFFAOYSA-N 9-benzylidene-2-nitrofluorene Chemical compound C12=CC([N+](=O)[O-])=CC=C2C2=CC=CC=C2C1=CC1=CC=CC=C1 XRBNIPUYAMAOGV-UHFFFAOYSA-N 0.000 description 1
- LRSYZHFYNDZXMU-UHFFFAOYSA-N 9h-carbazol-3-amine Chemical compound C1=CC=C2C3=CC(N)=CC=C3NC2=C1 LRSYZHFYNDZXMU-UHFFFAOYSA-N 0.000 description 1
- 101100178983 Caenorhabditis elegans hyl-1 gene Proteins 0.000 description 1
- 229920000089 Cyclic olefin copolymer Polymers 0.000 description 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 1
- LFVLUOAHQIVABZ-UHFFFAOYSA-N Iodofenphos Chemical compound COP(=S)(OC)OC1=CC(Cl)=C(I)C=C1Cl LFVLUOAHQIVABZ-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229910001215 Te alloy Inorganic materials 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000007754 air knife coating Methods 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 229960002069 diamorphine Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000007786 electrostatic charging Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000007765 extrusion coating Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002220 fluorenes Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 238000007756 gravure coating Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000005525 hole transport Effects 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VREONUZGDYDJLN-UHFFFAOYSA-N n-(benzylideneamino)-n-phenylaniline Chemical compound C=1C=CC=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 VREONUZGDYDJLN-UHFFFAOYSA-N 0.000 description 1
- QYXUHIZLHNDFJT-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-methylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C)C1=CC=CC=C1 QYXUHIZLHNDFJT-UHFFFAOYSA-N 0.000 description 1
- CEAPHJPESODIQL-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-phenylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 CEAPHJPESODIQL-UHFFFAOYSA-N 0.000 description 1
- YTZSVRIIZBBSOI-UHFFFAOYSA-N n-[(9-methylcarbazol-3-yl)methylideneamino]-n-phenylaniline Chemical compound C=1C=C2N(C)C3=CC=CC=C3C2=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 YTZSVRIIZBBSOI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XONSRLHXNRNRLZ-UHFFFAOYSA-N n-methyl-n-(naphthalen-1-ylmethylideneamino)aniline Chemical compound C=1C=CC2=CC=CC=C2C=1C=NN(C)C1=CC=CC=C1 XONSRLHXNRNRLZ-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229920001558 organosilicon polymer Polymers 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BALXUFOVQVENIU-KXNXZCPBSA-N pseudoephedrine hydrochloride Chemical compound [H+].[Cl-].CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 BALXUFOVQVENIU-KXNXZCPBSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G17/00—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process
- G03G17/04—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process using photoelectrophoresis
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G13/00—Electrographic processes using a charge pattern
- G03G13/22—Processes involving a combination of more than one step according to groups G03G13/02 - G03G13/20
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Molecular Biology (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/567,838 US4536458A (en) | 1984-01-03 | 1984-01-03 | Migration imaging system |
| US567,838 | 1984-01-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1247431A true CA1247431A (en) | 1988-12-28 |
Family
ID=24268849
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000471328A Expired CA1247431A (en) | 1984-01-03 | 1985-01-02 | Migration imaging system |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4536458A (Direct) |
| EP (1) | EP0149328B1 (Direct) |
| JP (1) | JPS60169853A (Direct) |
| CA (1) | CA1247431A (Direct) |
| DE (1) | DE3471771D1 (Direct) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4883731A (en) * | 1988-01-04 | 1989-11-28 | Xerox Corporation | Imaging system |
| US4880715A (en) * | 1988-01-04 | 1989-11-14 | Xerox Corporation | Imaging system |
| US4937163A (en) * | 1989-01-27 | 1990-06-26 | Xerox Corporation | Imaging member and processes thereof |
| US4970130A (en) * | 1989-12-01 | 1990-11-13 | Xerox Corporation | Xeroprinting process with improved contrast potential |
| US5240799A (en) * | 1990-07-23 | 1993-08-31 | Xerox Corporation | Dual electrode migration imaging members and apparatuses and processes for the preparation and use of same |
| US5411825A (en) * | 1990-10-16 | 1995-05-02 | Xerox Corporation | Heat development process of migration imaging members |
| US5227265A (en) * | 1990-11-30 | 1993-07-13 | Eastman Kodak Company | Migration imaging system |
| EP0513341B1 (en) * | 1990-11-30 | 1998-01-21 | Eastman Kodak Company | Migration imaging method and apparatus using it |
| US5310612A (en) * | 1991-03-11 | 1994-05-10 | Fuji Xerox Co., Ltd. | Image-holding member and production method thereof, method for forming image-forming master using the image-holding member and the forming apparatus, and image-forming method using them |
| WO1993004411A1 (en) * | 1991-08-16 | 1993-03-04 | Eastman Kodak Company | Migration imaging with dyes or pigments to effect bleaching |
| US5202206A (en) * | 1991-10-04 | 1993-04-13 | Xerox Corporation | Process for simultaneous printing of fixed data and variable data |
| US5215838A (en) * | 1991-10-04 | 1993-06-01 | Xerox Corporation | Infrared or red light sensitive migration imaging member |
| US5296898A (en) * | 1992-08-05 | 1994-03-22 | Eastman Kodak Company | Method for producing images |
| US5484694A (en) | 1994-11-21 | 1996-01-16 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing antimony-doped tin oxide particles |
| US5580689A (en) * | 1994-12-09 | 1996-12-03 | Xerox Corporation | Migration imaging members |
| US5576129A (en) * | 1994-12-09 | 1996-11-19 | Xerox Corporation | Migration imaging members |
| US5563013A (en) * | 1995-05-01 | 1996-10-08 | Xerox Corporation | Pre-sensitized infrared or red light sensitive migration imaging members |
| US5534374A (en) * | 1995-05-01 | 1996-07-09 | Xerox Corporation | Migration imaging members |
| US5690993A (en) * | 1995-05-01 | 1997-11-25 | Xerox Corporation | Overcoated migration imaging members |
| US6180297B1 (en) | 1995-05-01 | 2001-01-30 | Xerox Corporation | Migration imaging process |
| US5635322A (en) * | 1995-11-17 | 1997-06-03 | Xerox Corportion | Process for developing and overcoating migration imaging members |
| US5576162A (en) | 1996-01-18 | 1996-11-19 | Eastman Kodak Company | Imaging element having an electrically-conductive layer |
| US5981120A (en) * | 1998-01-08 | 1999-11-09 | Xerox Corporation | Verdefilm for more uniform charging |
| US6212347B1 (en) | 2000-01-27 | 2001-04-03 | Xerox Corporation | Imaging apparatuses and processes thereof containing a marking material with a charge acceptance additive of an aluminum complex |
| US6187499B1 (en) | 2000-01-27 | 2001-02-13 | Xerox Corporation | Imaging apparatus |
| US6218066B1 (en) | 2000-01-27 | 2001-04-17 | Xerox Corporation | Developer compositions and processes |
| US6180308B1 (en) | 2000-01-27 | 2001-01-30 | Xerox Corporation | Developer compositions and processes |
| US20040031167A1 (en) * | 2002-06-13 | 2004-02-19 | Stein Nathan D. | Single wafer method and apparatus for drying semiconductor substrates using an inert gas air-knife |
| SG102718A1 (en) * | 2002-07-29 | 2004-03-26 | Asml Holding Nv | Lithography tool having a vacuum reticle library coupled to a vacuum chamber |
| US6826451B2 (en) * | 2002-07-29 | 2004-11-30 | Asml Holding N.V. | Lithography tool having a vacuum reticle library coupled to a vacuum chamber |
| TWI357095B (en) * | 2003-10-27 | 2012-01-21 | Samsung Electronics Co Ltd | Lithography equipment |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3975195A (en) * | 1964-10-12 | 1976-08-17 | Xerox Corporation | Migration imaging system |
| US4101321A (en) * | 1967-01-27 | 1978-07-18 | Xerox Corporation | Imaging system |
| US3795512A (en) * | 1967-12-21 | 1974-03-05 | J Knieser | Imaging system |
| US3933491A (en) * | 1969-06-30 | 1976-01-20 | Xerox Corporation | Imaging system |
| US3873309A (en) * | 1970-06-18 | 1975-03-25 | Xerox Corp | Imaging method using migration material |
| US3909262A (en) * | 1970-12-14 | 1975-09-30 | Xerox Corp | Imaging migration member employing a gelatin overcoating |
| JPS5628259B2 (Direct) * | 1973-02-13 | 1981-06-30 | ||
| US3954464A (en) * | 1974-05-28 | 1976-05-04 | Xerox Corporation | Method of fabricating a composite trigonal selenium photoreceptor |
| US4102682A (en) * | 1975-04-29 | 1978-07-25 | Xerox Corporation | Imaging member |
| US4265990A (en) * | 1977-05-04 | 1981-05-05 | Xerox Corporation | Imaging system with a diamine charge transport material in a polycarbonate resin |
| US4306008A (en) * | 1978-12-04 | 1981-12-15 | Xerox Corporation | Imaging system with a diamine charge transport material in a polycarbonate resin |
| US4299897A (en) * | 1978-12-15 | 1981-11-10 | Xerox Corporation | Aromatic amino charge transport layer in electrophotography |
-
1984
- 1984-01-03 US US06/567,838 patent/US4536458A/en not_active Expired - Lifetime
- 1984-12-05 EP EP84308431A patent/EP0149328B1/en not_active Expired
- 1984-12-05 DE DE8484308431T patent/DE3471771D1/de not_active Expired
- 1984-12-27 JP JP59282131A patent/JPS60169853A/ja active Granted
-
1985
- 1985-01-02 CA CA000471328A patent/CA1247431A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS60169853A (ja) | 1985-09-03 |
| US4536458A (en) | 1985-08-20 |
| DE3471771D1 (en) | 1988-07-07 |
| JPH0560096B2 (Direct) | 1993-09-01 |
| EP0149328A1 (en) | 1985-07-24 |
| EP0149328B1 (en) | 1988-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1247431A (en) | Migration imaging system | |
| US4536457A (en) | Migration imaging process | |
| US4529650A (en) | Image transfer material | |
| US5532102A (en) | Apparatus and process for preparation of migration imaging members | |
| CA1332117C (en) | Imaging system | |
| US5202206A (en) | Process for simultaneous printing of fixed data and variable data | |
| US5215838A (en) | Infrared or red light sensitive migration imaging member | |
| CA2049417C (en) | Heat development apparatus | |
| CA1332115C (en) | Imaging member containing a copolymer of styrene and ethyl acrylate | |
| US4937163A (en) | Imaging member and processes thereof | |
| EP0430703B1 (en) | Xeroprinting process | |
| US4880715A (en) | Imaging system | |
| CA1217078A (en) | Overcoated migration imaging system | |
| US5690993A (en) | Overcoated migration imaging members | |
| US5576129A (en) | Migration imaging members | |
| EP0716358B1 (en) | Improved migration imaging members | |
| US5554470A (en) | Process and apparatus for manufacturing migration imaging members | |
| US5538825A (en) | Printing plate preparation process | |
| US6180297B1 (en) | Migration imaging process | |
| US5563013A (en) | Pre-sensitized infrared or red light sensitive migration imaging members | |
| US5672451A (en) | Migration imaging members |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |