CA1141580A - Timing layers for color transfer assemblages - Google Patents
Timing layers for color transfer assemblagesInfo
- Publication number
- CA1141580A CA1141580A CA000381167A CA381167A CA1141580A CA 1141580 A CA1141580 A CA 1141580A CA 000381167 A CA000381167 A CA 000381167A CA 381167 A CA381167 A CA 381167A CA 1141580 A CA1141580 A CA 1141580A
- Authority
- CA
- Canada
- Prior art keywords
- layer
- silver halide
- timing
- percent
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000012546 transfer Methods 0.000 title claims abstract description 15
- -1 silver halide Chemical class 0.000 claims abstract description 104
- 229910052709 silver Inorganic materials 0.000 claims abstract description 91
- 239000004332 silver Substances 0.000 claims abstract description 91
- 239000000839 emulsion Substances 0.000 claims abstract description 81
- 239000000203 mixture Substances 0.000 claims abstract description 71
- 238000011161 development Methods 0.000 claims abstract description 67
- 230000018109 developmental process Effects 0.000 claims abstract description 67
- 238000012545 processing Methods 0.000 claims abstract description 44
- 230000003472 neutralizing effect Effects 0.000 claims abstract description 41
- 239000003112 inhibitor Substances 0.000 claims abstract description 15
- 239000000463 material Substances 0.000 claims description 49
- 150000001875 compounds Chemical class 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 8
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 claims description 7
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 7
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 230000006872 improvement Effects 0.000 claims description 7
- 239000000178 monomer Substances 0.000 claims description 7
- 239000012466 permeate Substances 0.000 claims description 7
- 229920001897 terpolymer Polymers 0.000 claims description 7
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical compound SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 claims description 6
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical compound SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 claims description 6
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical compound SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 claims description 6
- 239000012964 benzotriazole Substances 0.000 claims description 6
- HBCQSNAFLVXVAY-UHFFFAOYSA-N pyrimidine-2-thiol Chemical compound SC1=NC=CC=N1 HBCQSNAFLVXVAY-UHFFFAOYSA-N 0.000 claims description 6
- JJJPTTANZGDADF-UHFFFAOYSA-N thiadiazole-4-thiol Chemical compound SC1=CSN=N1 JJJPTTANZGDADF-UHFFFAOYSA-N 0.000 claims description 6
- 238000009826 distribution Methods 0.000 claims description 4
- 239000002243 precursor Substances 0.000 claims description 4
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 150000002790 naphthalenes Chemical class 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- FVRXOULDGSWPPO-UHFFFAOYSA-N 1,2-dihydropyrazole-3-thione Chemical compound SC1=CC=NN1 FVRXOULDGSWPPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 6
- 239000001257 hydrogen Substances 0.000 claims 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 6
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims 5
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 claims 5
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 claims 5
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 claims 2
- 238000007599 discharging Methods 0.000 claims 2
- 230000015556 catabolic process Effects 0.000 abstract description 4
- 239000010410 layer Substances 0.000 description 210
- 239000000975 dye Substances 0.000 description 70
- KOWWOODYPWDWOJ-LVBPXUMQSA-N elatine Chemical compound C([C@]12CN(C3[C@@]45OCO[C@]44[C@H]6[C@@H](OC)[C@@H]([C@H](C4)OC)C[C@H]6[C@@]3([C@@H]1[C@@H]5OC)[C@@H](OC)CC2)CC)OC(=O)C1=CC=CC=C1N1C(=O)CC(C)C1=O KOWWOODYPWDWOJ-LVBPXUMQSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 14
- 238000011160 research Methods 0.000 description 12
- 238000009792 diffusion process Methods 0.000 description 11
- 230000006870 function Effects 0.000 description 8
- 239000011229 interlayer Substances 0.000 description 7
- 239000004816 latex Substances 0.000 description 7
- 229920000126 latex Polymers 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 6
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 5
- 150000002596 lactones Chemical class 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- BTANRVKWQNVYAZ-SCSAIBSYSA-N (2R)-butan-2-ol Chemical compound CC[C@@H](C)O BTANRVKWQNVYAZ-SCSAIBSYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 229940044600 maleic anhydride Drugs 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 239000006069 physical mixture Substances 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 4
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910052729 chemical element Inorganic materials 0.000 description 3
- 125000001145 hydrido group Chemical group *[H] 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- ZWDZJRRQSXLOQR-UHFFFAOYSA-N n-butyl-n-phenylacetamide Chemical compound CCCCN(C(C)=O)C1=CC=CC=C1 ZWDZJRRQSXLOQR-UHFFFAOYSA-N 0.000 description 3
- 239000004848 polyfunctional curative Substances 0.000 description 3
- LPYUENQFPVNPHY-UHFFFAOYSA-N 3-methoxycatechol Chemical compound COC1=CC=CC(O)=C1O LPYUENQFPVNPHY-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- HBMCQTHGYMTCOF-UHFFFAOYSA-N 4-hydroxyphenyl acetate Chemical compound CC(=O)OC1=CC=C(O)C=C1 HBMCQTHGYMTCOF-UHFFFAOYSA-N 0.000 description 2
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 238000001994 activation Methods 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003605 opacifier Substances 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- UVWWZGPJRBROMK-UHFFFAOYSA-M potassium;2,5-dihydroxy-4-octadecan-2-ylbenzenesulfonate Chemical compound [K+].CCCCCCCCCCCCCCCCC(C)C1=CC(O)=C(S([O-])(=O)=O)C=C1O UVWWZGPJRBROMK-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000027756 respiratory electron transport chain Effects 0.000 description 2
- 239000000837 restrainer Substances 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- QYSXJUFSXHHAJI-YRZJJWOYSA-N vitamin D3 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-YRZJJWOYSA-N 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- FQUIGIBJXTUFCB-UHFFFAOYSA-N 1,4-dimethylpyrazolidin-3-one Chemical compound CC1CN(C)NC1=O FQUIGIBJXTUFCB-UHFFFAOYSA-N 0.000 description 1
- XGNFGPFKRNWFGA-UHFFFAOYSA-N 1-(3,4-dimethylphenyl)-4-(hydroxymethyl)-4-methylpyrazolidin-3-one Chemical compound C1=C(C)C(C)=CC=C1N1NC(=O)C(C)(CO)C1 XGNFGPFKRNWFGA-UHFFFAOYSA-N 0.000 description 1
- STENCEYZPYSPCE-UHFFFAOYSA-N 1-(3-chlorophenyl)-4-methylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=CC(Cl)=C1 STENCEYZPYSPCE-UHFFFAOYSA-N 0.000 description 1
- YGAZCASNSMLPKJ-UHFFFAOYSA-N 1-(3-chlorophenyl)pyrazolidin-3-one Chemical compound ClC1=CC=CC(N2NC(=O)CC2)=C1 YGAZCASNSMLPKJ-UHFFFAOYSA-N 0.000 description 1
- BWVQIBKUGHYXLO-UHFFFAOYSA-N 1-(3-methylphenyl)pyrazolidin-3-one Chemical compound CC1=CC=CC(N2NC(=O)CC2)=C1 BWVQIBKUGHYXLO-UHFFFAOYSA-N 0.000 description 1
- PASQTEDKDMHJPQ-UHFFFAOYSA-N 1-(4-chlorophenyl)-4-methylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=C(Cl)C=C1 PASQTEDKDMHJPQ-UHFFFAOYSA-N 0.000 description 1
- QEWLOWAUHUOAEK-UHFFFAOYSA-N 1-(4-chlorophenyl)pyrazolidin-3-one Chemical compound C1=CC(Cl)=CC=C1N1NC(=O)CC1 QEWLOWAUHUOAEK-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- CJAOGUFAAWZWNI-UHFFFAOYSA-N 1-n,1-n,4-n,4-n-tetramethylbenzene-1,4-diamine Chemical compound CN(C)C1=CC=C(N(C)C)C=C1 CJAOGUFAAWZWNI-UHFFFAOYSA-N 0.000 description 1
- NWUNKFTVLXWQQC-UHFFFAOYSA-N 2,5-di(dodecan-2-yl)benzene-1,4-diol Chemical compound CCCCCCCCCCC(C)C1=CC(O)=C(C(C)CCCCCCCCCC)C=C1O NWUNKFTVLXWQQC-UHFFFAOYSA-N 0.000 description 1
- AYNPIRVEWMUJDE-UHFFFAOYSA-N 2,5-dichlorohydroquinone Chemical compound OC1=CC(Cl)=C(O)C=C1Cl AYNPIRVEWMUJDE-UHFFFAOYSA-N 0.000 description 1
- AUABZJZJXPSZCN-UHFFFAOYSA-N 2-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC=C1O AUABZJZJXPSZCN-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XPIXWKOZBARZHU-UHFFFAOYSA-N 3,5-bis(bromoamino)phenol Chemical compound OC1=CC(NBr)=CC(NBr)=C1 XPIXWKOZBARZHU-UHFFFAOYSA-N 0.000 description 1
- MRIBCCHYZOSDOM-UHFFFAOYSA-N 3-(1-phenyltetrazol-5-yl)sulfanylpropanenitrile Chemical compound N#CCCSC1=NN=NN1C1=CC=CC=C1 MRIBCCHYZOSDOM-UHFFFAOYSA-N 0.000 description 1
- AJKLCDRWGVLVSH-UHFFFAOYSA-N 4,4-bis(hydroxymethyl)-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(CO)(CO)CN1C1=CC=CC=C1 AJKLCDRWGVLVSH-UHFFFAOYSA-N 0.000 description 1
- SJSJAWHHGDPBOC-UHFFFAOYSA-N 4,4-dimethyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(C)CN1C1=CC=CC=C1 SJSJAWHHGDPBOC-UHFFFAOYSA-N 0.000 description 1
- FJWJYHHBUMICTP-UHFFFAOYSA-N 4,4-dimethylpyrazolidin-3-one Chemical compound CC1(C)CNNC1=O FJWJYHHBUMICTP-UHFFFAOYSA-N 0.000 description 1
- UWOZQBARAREECT-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-(4-methylphenyl)pyrazolidin-3-one Chemical compound C1=CC(C)=CC=C1N1NC(=O)C(C)(CO)C1 UWOZQBARAREECT-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- MBAGWXXPOYAQSA-UHFFFAOYSA-N 4-(octadecylamino)benzene-1,2-diol Chemical compound CCCCCCCCCCCCCCCCCCNC1=CC=C(O)C(O)=C1 MBAGWXXPOYAQSA-UHFFFAOYSA-N 0.000 description 1
- CHPDWZOITMMWOU-UHFFFAOYSA-N 4-cyclohexylbenzene-1,2-diol Chemical compound C1=C(O)C(O)=CC=C1C1CCCCC1 CHPDWZOITMMWOU-UHFFFAOYSA-N 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- VHVBDNDZNOOFQV-UHFFFAOYSA-N 4-methyl-1-(4-methylphenyl)pyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=C(C)C=C1 VHVBDNDZNOOFQV-UHFFFAOYSA-N 0.000 description 1
- ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=CC=C1 ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 0.000 description 1
- XVRRTSAWVKTSSW-UHFFFAOYSA-N 4-methylpyrazolidin-3-one Chemical compound CC1CNNC1=O XVRRTSAWVKTSSW-UHFFFAOYSA-N 0.000 description 1
- WYVJDRGXWOXCCH-UHFFFAOYSA-N 5-methylpyrazolidin-3-one Chemical compound CC1CC(=O)NN1 WYVJDRGXWOXCCH-UHFFFAOYSA-N 0.000 description 1
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 1
- ORZRMRUXSPNQQL-UHFFFAOYSA-N 6-nitro-1h-indazole Chemical compound [O-][N+](=O)C1=CC=C2C=NNC2=C1 ORZRMRUXSPNQQL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 102000003800 Selectins Human genes 0.000 description 1
- 108090000184 Selectins Proteins 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- DOQPXTMNIUCOSY-UHFFFAOYSA-N [4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-[2-(3,4-dimethoxyphenyl)ethyl]-methylazanium;chloride Chemical compound [H+].[Cl-].C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 DOQPXTMNIUCOSY-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- FZUOMLXLXCAPOO-UHFFFAOYSA-N acetic acid;2-tert-butylbenzene-1,4-diol Chemical compound CC(O)=O.CC(C)(C)C1=CC(O)=CC=C1O FZUOMLXLXCAPOO-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 229940116800 covera Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000006240 deamidation Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000586 desensitisation Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000009975 flexible effect Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- OSERTJVHNKHOIV-UHFFFAOYSA-N interjectin Natural products OCC1OC(Oc2ccc(cc2O)C#CCC(OC3OC(CO)C(O)C(O)C3OC(=O)C=Cc4ccc(O)cc4)C(O)c5ccc(O)c(O)c5)C(O)C(O)C1O OSERTJVHNKHOIV-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- AYUAOOVOPDIDCP-UHFFFAOYSA-N s-(4-acetyl-5-methyltriazol-2-yl) benzenecarbothioate Chemical compound N1=C(C)C(C(=O)C)=NN1SC(=O)C1=CC=CC=C1 AYUAOOVOPDIDCP-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 210000003371 toe Anatomy 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
- G03C8/52—Bases or auxiliary layers; Substances therefor
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US175,224 | 1980-08-04 | ||
| US06/175,224 US4314020A (en) | 1980-08-04 | 1980-08-04 | Color transfers assemblages with two timing layers and a neutralizing layer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1141580A true CA1141580A (en) | 1983-02-22 |
Family
ID=22639453
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000381167A Expired CA1141580A (en) | 1980-08-04 | 1981-07-06 | Timing layers for color transfer assemblages |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4314020A (show.php) |
| EP (1) | EP0045480B1 (show.php) |
| JP (1) | JPS5760332A (show.php) |
| CA (1) | CA1141580A (show.php) |
| DE (1) | DE3162373D1 (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4375506A (en) * | 1981-10-30 | 1983-03-01 | Eastman Kodak Company | Timing layers for color transfer assemblages containing positive-working redox dye-releasers and development accelerators |
| US4356249A (en) * | 1981-10-30 | 1982-10-26 | Eastman Kodak Company | Timing layers and auxiliary neutralizing layer for color transfer assemblages containing positive-working redox dye-releasers |
| US4481277A (en) * | 1983-02-02 | 1984-11-06 | Polaroid Corporation | Photographic products and processes with scavengers for silver ions or silver complexes |
| US5258407A (en) * | 1991-12-31 | 1993-11-02 | Sterling Winthrop Inc. | 3,4-disubstituted phenols-immunomodulating agents |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3779756A (en) * | 1970-11-09 | 1973-12-18 | Eastman Kodak Co | Color developer scavenger layer for diffusion transfer dye image-receiving elements and systems |
| US3706557A (en) * | 1971-04-28 | 1972-12-19 | Polaroid Corp | Color diffusion transfer film unit containing a temporary barrier for developer restrainers |
| US4009029A (en) * | 1973-06-05 | 1977-02-22 | Eastman Kodak Company | Cyanoethyl-containing blocked development restrainers |
| CA1035188A (en) | 1974-08-15 | 1978-07-25 | Eastman Kodak Company | Blocked development restrainers |
| US4061496A (en) * | 1976-04-14 | 1977-12-06 | Eastman Kodak Company | Combination of two timing layers for photographic products |
| US4056394A (en) * | 1976-04-14 | 1977-11-01 | Eastman Kodak Company | Timing layer for color transfer film units comprising copolymer with activation energy to penetration greater than 18 kcal/mole |
| DE2816878A1 (de) | 1977-04-20 | 1978-11-02 | Eastman Kodak Co | Deckblatt fuer photographische bildaufzeichnungsmaterialien |
| CA1112929A (en) | 1977-11-03 | 1981-11-24 | Thomas I. Abbott | Use of hydroquinone esters as blocked competing developers for color transfer assemblages |
| US4190447A (en) * | 1978-01-09 | 1980-02-26 | Eastman Kodak Company | Cover sheets for integral imaging receiver elements |
| JPS6016615B2 (ja) * | 1978-04-25 | 1985-04-26 | 富士写真フイルム株式会社 | カラ−拡散転写法写真要素 |
| US4229516A (en) * | 1978-10-02 | 1980-10-21 | Eastman Kodak Company | Photographic material with temporary barrier layer comprising a mixture of vinylidene chloride terpolymer and polymeric carboxy-ester-lactone and photographic transfer process therefor |
| GB2019392B (en) | 1979-04-03 | 1983-01-26 | Fuji Photo Film Co Ltd | Lyl- and heterocyclic thioethers which are development inhibitor precurors and photographic elements containing them |
-
1980
- 1980-08-04 US US06/175,224 patent/US4314020A/en not_active Expired - Lifetime
-
1981
- 1981-07-06 CA CA000381167A patent/CA1141580A/en not_active Expired
- 1981-07-29 EP EP81105966A patent/EP0045480B1/en not_active Expired
- 1981-07-29 DE DE8181105966T patent/DE3162373D1/de not_active Expired
- 1981-08-04 JP JP56121507A patent/JPS5760332A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4314020A (en) | 1982-02-02 |
| EP0045480A1 (en) | 1982-02-10 |
| JPS6331774B2 (show.php) | 1988-06-27 |
| EP0045480B1 (en) | 1984-02-22 |
| DE3162373D1 (en) | 1984-03-29 |
| JPS5760332A (en) | 1982-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3930864A (en) | Auxiliary mordant layer for excess dye formed in integral color transfer assemblage | |
| US4061496A (en) | Combination of two timing layers for photographic products | |
| US4056394A (en) | Timing layer for color transfer film units comprising copolymer with activation energy to penetration greater than 18 kcal/mole | |
| US4009030A (en) | Timing layer for color transfer assemblages comprising a mixture of cellulose acetate and maleic anhydride copolymer | |
| US4485164A (en) | Oxidants for reducing post-process D-min increase in positive redox dye-releasing image transfer systems | |
| US4356250A (en) | Use of zinc salts to increase dye stability | |
| US4499174A (en) | Hydrophilic layers adjacent a stripping layer for diffusion transfer assemblages | |
| US4529683A (en) | Surfactant-like material in a hydrophilic layer adjacent a stripping layer for diffusion transfer assemblages | |
| CA1141580A (en) | Timing layers for color transfer assemblages | |
| US4029504A (en) | Photographic image transfer elements containing neutralizing layers comprising particulate materials | |
| US4029849A (en) | Cover sheets with timing layer comprising cellulose acetate and copolymer of maleic anhydride | |
| US4353973A (en) | Use of oxalic acid or an acid salt thereof in color transfer assemblages | |
| US4356249A (en) | Timing layers and auxiliary neutralizing layer for color transfer assemblages containing positive-working redox dye-releasers | |
| US4296195A (en) | Two-sheet diffusion transfer assemblages and photographic elements | |
| US4606992A (en) | Reflecting layer for image transfer prints | |
| US4030920A (en) | Processing compositions containing glycols for color transfer processes comprising direct positive silver halide developement | |
| US4450222A (en) | Use of carbon adsorption deactivating compounds in image transfer elements | |
| US4415647A (en) | Polymeric vehicle for dye image-receiving layer containing a poly(vinylimidazole) mordant | |
| US4375506A (en) | Timing layers for color transfer assemblages containing positive-working redox dye-releasers and development accelerators | |
| US4440848A (en) | Vinyl-ester polymeric timing layer for color transfer assemblages | |
| US4357392A (en) | Coversheet for color transfer assemblages | |
| US4028103A (en) | Processing compositions for color transfer processes comprising alkali metal fluorides and oxalates | |
| US4416970A (en) | Use of manganous compounds in image transfer elements | |
| CA1128799A (en) | Photographic use of n-alkyl- or n-aryl-benzisoxazolone as scavengers for oxidized electron transfer agents | |
| US4471047A (en) | Use of carbon adsorption deactivating compounds in image transfer elements |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |