CA1127848A - Interconnecting toy block arrangement - Google Patents
Interconnecting toy block arrangementInfo
- Publication number
- CA1127848A CA1127848A CA334,030A CA334030A CA1127848A CA 1127848 A CA1127848 A CA 1127848A CA 334030 A CA334030 A CA 334030A CA 1127848 A CA1127848 A CA 1127848A
- Authority
- CA
- Canada
- Prior art keywords
- female coupler
- coupler member
- wall
- male
- insertion portion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002347 injection Methods 0.000 claims abstract description 6
- 239000007924 injection Substances 0.000 claims abstract description 6
- 239000002991 molded plastic Substances 0.000 claims abstract description 4
- 238000003780 insertion Methods 0.000 claims description 36
- 230000037431 insertion Effects 0.000 claims description 36
- 230000002093 peripheral effect Effects 0.000 claims description 24
- 230000014759 maintenance of location Effects 0.000 claims description 16
- 238000007373 indentation Methods 0.000 claims description 6
- 238000003466 welding Methods 0.000 claims description 5
- 239000004033 plastic Substances 0.000 abstract description 17
- 229920003023 plastic Polymers 0.000 abstract description 17
- 238000004519 manufacturing process Methods 0.000 abstract description 6
- 230000000717 retained effect Effects 0.000 abstract description 5
- 238000000071 blow moulding Methods 0.000 abstract description 4
- 239000000463 material Substances 0.000 abstract description 4
- 238000000034 method Methods 0.000 description 5
- 239000007767 bonding agent Substances 0.000 description 3
- 239000003292 glue Substances 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 230000006978 adaptation Effects 0.000 description 2
- 230000004323 axial length Effects 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007779 soft material Substances 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 229920002457 flexible plastic Polymers 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 230000036630 mental development Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- ACXGJHCPFCFILV-UHFFFAOYSA-M sodium;2-(4-chloro-2-methylphenoxy)acetate;3,6-dichloro-2-methoxybenzoic acid Chemical compound [Na+].COC1=C(Cl)C=CC(Cl)=C1C(O)=O.CC1=CC(Cl)=CC=C1OCC([O-])=O ACXGJHCPFCFILV-UHFFFAOYSA-M 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
- A63H33/06—Building blocks, strips, or similar building parts to be assembled without the use of additional elements
- A63H33/08—Building blocks, strips, or similar building parts to be assembled without the use of additional elements provided with complementary holes, grooves, or protuberances, e.g. dovetails
- A63H33/088—Building blocks, strips, or similar building parts to be assembled without the use of additional elements provided with complementary holes, grooves, or protuberances, e.g. dovetails with holes
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/04—Building blocks, strips, or similar building parts
- A63H33/06—Building blocks, strips, or similar building parts to be assembled without the use of additional elements
- A63H33/08—Building blocks, strips, or similar building parts to be assembled without the use of additional elements provided with complementary holes, grooves, or protuberances, e.g. dovetails
Landscapes
- Toys (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1978120543U JPS5537622U (enExample) | 1978-09-04 | 1978-09-04 | |
| JP53-120543 | 1978-11-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1127848A true CA1127848A (en) | 1982-07-20 |
Family
ID=14788890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA334,030A Expired CA1127848A (en) | 1978-09-04 | 1979-08-17 | Interconnecting toy block arrangement |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4306373A (enExample) |
| JP (1) | JPS5537622U (enExample) |
| CA (1) | CA1127848A (enExample) |
| DE (1) | DE2934174C2 (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5778Y2 (enExample) * | 1979-03-09 | 1982-01-05 | ||
| JPS5777Y2 (enExample) * | 1979-03-09 | 1982-01-05 | ||
| US4592354A (en) * | 1983-10-11 | 1986-06-03 | Senmed, Inc. | Tissue retention spool for intraluminal anastomotic surgical stapling instrument and methods |
| US4629192A (en) * | 1985-05-20 | 1986-12-16 | Franklin Nichols | Interlocking puzzle blocks |
| US4752269A (en) * | 1986-05-09 | 1988-06-21 | Jonathan Feinstein | Reconfigurable, interchangeable and interlocking playthings, blocks or construction pieces |
| US5133168A (en) * | 1990-09-14 | 1992-07-28 | Odl, Incorporated | Window frame connector |
| US5249403A (en) * | 1990-09-14 | 1993-10-05 | Odl, Incorporated | Window frame connector |
| EP0506354A1 (en) * | 1991-03-26 | 1992-09-30 | Jen-Shyong Wu | Decorative continuous assemblage of composing elements |
| US5259803A (en) * | 1991-04-09 | 1993-11-09 | Lyman Ronald L | Toy construction set featuring gears and radiant connectors |
| US5195916A (en) * | 1991-05-03 | 1993-03-23 | Her Ming Long | Dual disc flying toy with flat lower member |
| DK154391D0 (da) * | 1991-09-03 | 1991-09-03 | Gram Ole As | Byggeelement isaer til legetoej |
| USD336666S (en) | 1991-11-06 | 1993-06-22 | Interlego A.G. | Element for a toy building set |
| USD346627S (en) | 1992-11-24 | 1994-05-03 | Interlego A.G. | Element for a toy building set |
| US5644881A (en) * | 1995-11-02 | 1997-07-08 | Odl, Incorporated | Window frame with integral connectors |
| US5853314A (en) * | 1997-02-18 | 1998-12-29 | Bora; Sunil K. | Toy building block |
| USD409679S (en) * | 1998-03-18 | 1999-05-11 | Interlego Ag | Toy building element |
| USD426588S (en) * | 1998-12-21 | 2000-06-13 | Connector Set Limited Partnership | Treble stud construction toy block |
| US6086444A (en) * | 1998-12-21 | 2000-07-11 | Connector Set Limited Partnership | Block-type construction toy |
| USD420711S (en) * | 1998-12-21 | 2000-02-15 | Connector Set Limited Partnership | Dual stud construction toy block |
| USD420062S (en) * | 1998-12-21 | 2000-02-01 | Connector Set Limited Partnership | Single stud construction toy block |
| US7096636B1 (en) * | 2001-11-20 | 2006-08-29 | Jeremiah F. Neill | Modular building block system |
| US20040198140A1 (en) * | 2003-02-12 | 2004-10-07 | Earl Barber | Building block play system |
| US20050191932A1 (en) * | 2004-03-01 | 2005-09-01 | Lin Fu-Chi | Building block |
| GB2462383B (en) * | 2004-10-26 | 2010-05-12 | Pamela Saha | Polariscope toy and ornament with accompanying photoelastic and/or photoplastic devices |
| US7140944B2 (en) * | 2005-01-24 | 2006-11-28 | Mattel, Inc. | Connecting toy |
| USD546401S1 (en) | 2005-05-17 | 2007-07-10 | Soren Christian Sorensen | Toy building element |
| USD545918S1 (en) | 2005-05-17 | 2007-07-03 | Soren Christian Sorensen | Toy building element |
| US7553209B1 (en) | 2005-05-17 | 2009-06-30 | Soren Christian Sorensen | Toy-building elements for variably positional toys |
| USD545917S1 (en) | 2005-05-17 | 2007-07-03 | Soren Christian Sorensen | Toy building element |
| USD545380S1 (en) | 2005-05-17 | 2007-06-26 | Soren Christian Sorensen | Toy building element |
| USD546900S1 (en) | 2005-05-17 | 2007-07-17 | Soren Christian Sorensen | Toy building element |
| KR200400173Y1 (ko) * | 2005-08-19 | 2005-11-02 | 허세헌 | 목재블록 |
| US20070039478A1 (en) * | 2005-08-22 | 2007-02-22 | Main Power Electrical Factory Ltd. | Coffee machine brew head |
| US8651914B2 (en) * | 2006-01-27 | 2014-02-18 | Costas Sisamos | Snap-lock construction toy |
| ITMI20061956A1 (it) * | 2006-10-12 | 2007-01-11 | Claudio Vicentelli | Set di blocchi con elementi magnetici di ancoraggio mobili per la costruzione di giochi |
| RU2331452C1 (ru) * | 2006-11-22 | 2008-08-20 | Общество С Ограниченной Ответственностью "Деко" | Способ изготовления объемных закрытых пустотелых элементов игрушечного конструктора |
| USD580995S1 (en) * | 2006-12-14 | 2008-11-18 | Sun Woo Chun | Toy block |
| US7731558B2 (en) * | 2007-08-15 | 2010-06-08 | Jon Capriola | Illuminated toy building structures |
| US8864546B1 (en) * | 2007-08-15 | 2014-10-21 | Jon P. Capriola | Illuminated toy building system and methods |
| US8742814B2 (en) | 2009-07-15 | 2014-06-03 | Yehuda Binder | Sequentially operated modules |
| KR101129446B1 (ko) * | 2009-12-15 | 2012-03-26 | 천선우 | 원활한 단계적 각도 조절이 가능한 조립 완구 |
| TWM391894U (en) * | 2010-06-10 | 2010-11-11 | Yi-Qing Guo | Anti-wearing structure for display rack |
| WO2012005567A1 (en) * | 2010-07-05 | 2012-01-12 | Wang Han Yap | Building block |
| US8371894B1 (en) | 2011-12-23 | 2013-02-12 | LaRose Industries, LLC | Illuminated toy construction kit |
| KR101551226B1 (ko) * | 2012-02-06 | 2015-09-09 | 가부시키가이샤 아테크 | 연결가능한 블록 |
| US9155975B2 (en) | 2012-08-03 | 2015-10-13 | Jonathan P. Capriola | Lamp adapter apparatus for use with powered toy building blocks |
| DE102012017305A1 (de) * | 2012-09-03 | 2014-03-06 | Leonhard Oschütz | Verbindungskonstruktion zwischen Konstruktionselementen und Konstruktionselement |
| USD737763S1 (en) | 2013-03-15 | 2015-09-01 | Jonathan Capriola | Mobile power supply |
| USD748204S1 (en) * | 2014-02-25 | 2016-01-26 | Chiswick Innovations Ltd | Toy building block |
| US20150314211A1 (en) * | 2014-04-30 | 2015-11-05 | Hasbro, Inc. | Toy construction set |
| USD835727S1 (en) | 2015-01-26 | 2018-12-11 | Mega Brands Inc. | Construction set element |
| USD781964S1 (en) | 2015-01-26 | 2017-03-21 | Mega Brands Inc. | Construction set element |
| USD835726S1 (en) | 2015-01-26 | 2018-12-11 | Mega Brands Inc. | Construction set element |
| USD841101S1 (en) | 2015-01-26 | 2019-02-19 | Mega Brands Inc. | Construction set element |
| USD758501S1 (en) * | 2015-05-19 | 2016-06-07 | Soren Christian Sorensen | Double-axle toy building element |
| US10232279B2 (en) * | 2015-12-18 | 2019-03-19 | Reginald Frederick Woolston | Modular cube building system |
| USD825678S1 (en) * | 2016-01-26 | 2018-08-14 | Costas Sisamos | Snap-lock construction toy |
| USD812151S1 (en) * | 2016-01-26 | 2018-03-06 | Costas Sisamos | Snap-lock construction toy |
| JP1569818S (enExample) * | 2016-04-18 | 2017-02-20 | ||
| USD807969S1 (en) * | 2016-10-14 | 2018-01-16 | Microduino Inc. | Connector module |
| USD807440S1 (en) * | 2016-10-14 | 2018-01-09 | Microduino Inc. | Connector module |
| USD807968S1 (en) * | 2016-10-14 | 2018-01-16 | Microduino Inc. | Connector module |
| USD834104S1 (en) | 2017-04-26 | 2018-11-20 | Mattel-Mega Holdings (Us), Llc | Construction set element |
| USD834105S1 (en) | 2017-06-01 | 2018-11-20 | Mattel-Mega Holdings (Us), Llc | Construction set element |
| CN108325221B (zh) * | 2018-04-20 | 2023-11-03 | 马耀民 | 针对颗粒积木的柔性搭建平台 |
| US11794124B2 (en) | 2018-10-02 | 2023-10-24 | Snap Ships LLC | Connection systems for toy construction pieces, toy construction pieces including the same, and toy construction kits including the same |
| RU189585U1 (ru) * | 2018-12-07 | 2019-05-28 | Александр Суренович Марутян | Элемент конструктора "m-ar-go" |
| GR1009678B (el) * | 2019-01-10 | 2020-01-14 | Δημητριος Βασιλειου Γραψας | Τρισδιαστατη ψηφιδα |
| USD930463S1 (en) * | 2019-06-05 | 2021-09-14 | Frank Escobedo | 6-way fitting |
| RU2769615C1 (ru) * | 2021-03-22 | 2022-04-04 | Александр Суренович Марутян | Элемент конструктора |
| USD986345S1 (en) * | 2021-06-21 | 2023-05-16 | Xin Feng | Toy block |
| CN114870409B (zh) * | 2022-04-14 | 2025-03-11 | 上海乐一实业有限公司 | 拼接玩具、拼接玩具的球形件组装方法 |
| USD1084158S1 (en) * | 2023-01-16 | 2025-07-15 | Lego A/S | Toy brick with an upstanding knob |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1779826A (en) * | 1927-04-18 | 1930-10-28 | Thomas I Potter | Structural toy |
| US1985032A (en) * | 1933-02-01 | 1934-12-18 | Hoult Frank | Constructional toy |
| DE812411C (de) * | 1949-05-07 | 1951-08-30 | Adolf Schaper | Steckerverbindung fuer Bauspielteile |
| US2921347A (en) * | 1957-02-20 | 1960-01-19 | Lansky Die Cutting Corp | Knockdown structure |
| GB870810A (en) * | 1958-04-28 | 1961-06-21 | Shipton & Company Ltd E | Improvements in toy blocks |
| US3069805A (en) * | 1960-02-08 | 1962-12-25 | William M Burrows | Amusement device |
| US3604130A (en) * | 1968-07-05 | 1971-09-14 | Incentive Ab | Construction series for molecular models |
| BE754451A (fr) * | 1969-08-08 | 1971-02-05 | Dart Ind Inc | Jeu de construction forme de blocs |
| US3681870A (en) * | 1971-01-27 | 1972-08-08 | Childcraft Education Corp | Construction toy and a block construction therefor |
| US3706139A (en) * | 1971-08-12 | 1972-12-19 | George C Brumlik | Construction elements for the assembly of molecular models, toys and the like |
| JPS4941435U (enExample) * | 1972-07-11 | 1974-04-11 | ||
| JPS5221598B2 (enExample) * | 1973-11-02 | 1977-06-11 | ||
| US4037978A (en) * | 1974-08-23 | 1977-07-26 | B.C. Investments Ltd. | Resilient swivel connector |
| ZA764146B (en) * | 1975-09-17 | 1977-06-29 | Ferrero & C Spa P | Container usable as a toy construction element |
-
1978
- 1978-09-04 JP JP1978120543U patent/JPS5537622U/ja active Pending
-
1979
- 1979-08-07 US US06/064,523 patent/US4306373A/en not_active Expired - Lifetime
- 1979-08-17 CA CA334,030A patent/CA1127848A/en not_active Expired
- 1979-08-23 DE DE2934174A patent/DE2934174C2/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2934174A1 (de) | 1980-03-13 |
| US4306373A (en) | 1981-12-22 |
| DE2934174C2 (de) | 1985-06-27 |
| JPS5537622U (enExample) | 1980-03-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1127848A (en) | Interconnecting toy block arrangement | |
| US5395278A (en) | Manually manipulatable flexible toy | |
| CA1126957A (en) | Interconnecting toy block arrangement | |
| US6273778B1 (en) | Toy building set | |
| US4579538A (en) | Construction toy | |
| US4701131A (en) | Geometric modeling kit and method of making same | |
| US5137485A (en) | Toy construction set with improved radial and axial connectability and expandability | |
| US6736691B1 (en) | Toy building set with interconnection by means of tenons with snap | |
| US5449206A (en) | Ball and socket joint with internal stop | |
| EP1022040B1 (en) | A system of elements for the composition of static or dynamic constructions | |
| US5771650A (en) | Interlocking building block system | |
| USRE33785E (en) | Geometric modeling kit and method of making same | |
| US4267662A (en) | Inflatable mating building blocks | |
| US5061219A (en) | Construction toy | |
| CA2051905C (en) | Construction toy | |
| US5238438A (en) | Construction toy and adapter | |
| EP1463571A1 (en) | Rod and connector toy construction set | |
| EP1998864A2 (en) | Construction toy | |
| US5143476A (en) | Snap lock system for tubular parts | |
| WO1995007416A1 (en) | Flexible tie strut | |
| MX2007015372A (es) | Interconexiones entre juguetes de modulos armables de tipo bloque y barra y de tipo conector. | |
| KR950023350A (ko) | 합성 수지로 성형한 벨트 접속장치 및 그 제작 방법 | |
| GB2056867A (en) | Toy blocks | |
| IE46346B1 (en) | A recreational kit for constructing objects | |
| US20070077854A1 (en) | Sectional three-dimensional model |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |