CA1093550A - Cephalosporin derivatives - Google Patents
Cephalosporin derivativesInfo
- Publication number
- CA1093550A CA1093550A CA206,673A CA206673A CA1093550A CA 1093550 A CA1093550 A CA 1093550A CA 206673 A CA206673 A CA 206673A CA 1093550 A CA1093550 A CA 1093550A
- Authority
- CA
- Canada
- Prior art keywords
- cephem
- carboxylic acid
- ylthiomethyl
- amino
- lower alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title description 9
- 229940124587 cephalosporin Drugs 0.000 title description 9
- 150000001780 cephalosporins Chemical class 0.000 title description 8
- -1 1,3,4-thiadiazol-2-ylthio Chemical group 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 17
- NCEMYYNYQIPXPN-UHFFFAOYSA-N 2-(cyanomethylsulfonyl)acetic acid Chemical class OC(=O)CS(=O)(=O)CC#N NCEMYYNYQIPXPN-UHFFFAOYSA-N 0.000 claims description 8
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 8
- JRRFRAHROZUYJH-UHFFFAOYSA-N 2-(cyanomethylsulfanyl)acetic acid Chemical class OC(=O)CSCC#N JRRFRAHROZUYJH-UHFFFAOYSA-N 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- XUTQHTOXGKVJPN-UHFFFAOYSA-N 7-azaniumyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)C2SC1 XUTQHTOXGKVJPN-UHFFFAOYSA-N 0.000 claims description 4
- TWJVALJJTLQMOZ-UHFFFAOYSA-N 2-(cyanomethylsulfinyl)acetic acid Chemical class OC(=O)CS(=O)CC#N TWJVALJJTLQMOZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 3
- BCWOKAYVKCXIBT-FFFFSGIJSA-N (6r)-7-[[2-(cyanomethylsulfonyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)(=O)CC#N)[C@H]2SC1 BCWOKAYVKCXIBT-FFFFSGIJSA-N 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 11
- 238000004519 manufacturing process Methods 0.000 claims 6
- HRNAAEHNTDTJBB-FFFFSGIJSA-N (6r)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CSCC#N)[C@H]2SC1 HRNAAEHNTDTJBB-FFFFSGIJSA-N 0.000 claims 1
- CCHLKVPKEFAGAX-NAIOAQEYSA-N (6r)-7-[[2-(cyanomethylsulfinyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)CC#N)[C@H]2SC1 CCHLKVPKEFAGAX-NAIOAQEYSA-N 0.000 claims 1
- HSUTURCETNCYGG-JLOHTSLTSA-N (6r)-7-[[2-(cyanomethylsulfonyl)acetyl]amino]-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)(=O)CC#N)[C@H]2SC1 HSUTURCETNCYGG-JLOHTSLTSA-N 0.000 claims 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 7
- JRRFRAHROZUYJH-UHFFFAOYSA-M 2-(cyanomethylsulfanyl)acetate Chemical compound [O-]C(=O)CSCC#N JRRFRAHROZUYJH-UHFFFAOYSA-M 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 5
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HJSGHKMSDOLGJJ-IOJJLOCKSA-N (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 HJSGHKMSDOLGJJ-IOJJLOCKSA-N 0.000 description 2
- VCWBDKQAJHDQLV-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-[(5-oxo-1,2-dihydro-1,2,4-triazol-3-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NC(=O)NN1 VCWBDKQAJHDQLV-HWZXHQHMSA-N 0.000 description 2
- BDSDFCVDQUGOFB-XNCJUZBTSA-N (6s,7s)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)[C@H](N)[C@H]12 BDSDFCVDQUGOFB-XNCJUZBTSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- XQHZGZUZBZHPJS-NQPNHJOESA-N (6R)-7-amino-3-(2H-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound NC1[C@@H]2N(C=C(CS2)CSC2=NN=NN2)C1=O XQHZGZUZBZHPJS-NQPNHJOESA-N 0.000 description 1
- MIKPIYLQGFPIIS-NHSZFOGYSA-N (6R)-7-amino-3-(2H-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound NC1[C@@H]2N(C=C(CS2)CSC2=CN=NN2)C1=O MIKPIYLQGFPIIS-NHSZFOGYSA-N 0.000 description 1
- PBWVUULTZUIRHT-OMNKOJBGSA-N (6R)-7-amino-3-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2CC)C(=O)O)C1=O PBWVUULTZUIRHT-OMNKOJBGSA-N 0.000 description 1
- SMDRVSKZFGHJMA-QZDNSWHDSA-N (6r)-7-[[2-(cyanomethylsulfinyl)acetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)CC#N)[C@@H]12 SMDRVSKZFGHJMA-QZDNSWHDSA-N 0.000 description 1
- MTZOBZYJWMKSPO-FFFFSGIJSA-N (6r)-7-[[2-(cyanomethylsulfonyl)acetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC)=C(C(O)=O)N2C(=O)C(NC(=O)CS(=O)(=O)CC#N)[C@@H]12 MTZOBZYJWMKSPO-FFFFSGIJSA-N 0.000 description 1
- XBTVNBOHMXJRDI-JLOHTSLTSA-N (6r)-7-[[2-(cyanomethylsulfonyl)acetyl]amino]-8-oxo-3-(2h-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N#CCS(=O)(=O)CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC=1C=NNN=1 XBTVNBOHMXJRDI-JLOHTSLTSA-N 0.000 description 1
- LOVQDTPQUKGWPG-XCGJVMPOSA-N (6r)-7-amino-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC(CSC)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 LOVQDTPQUKGWPG-XCGJVMPOSA-N 0.000 description 1
- XRYVJISVFNEKRV-OMNKOJBGSA-N (6r)-7-amino-3-[(2-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CCN1N=CN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XRYVJISVFNEKRV-OMNKOJBGSA-N 0.000 description 1
- VPELFMVIWMHYHL-IOJJLOCKSA-N (6r)-7-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC1=NSC(SCC=2CS[C@H]3N(C(C3N)=O)C=2C(O)=O)=N1 VPELFMVIWMHYHL-IOJJLOCKSA-N 0.000 description 1
- RSULBEJNHMXIEP-IOJJLOCKSA-N (6r)-7-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1C=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 RSULBEJNHMXIEP-IOJJLOCKSA-N 0.000 description 1
- IWPJVSCKARINRQ-FFFFSGIJSA-N (6r)-7-amino-3-[(5-butyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(CCCC)=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 IWPJVSCKARINRQ-FFFFSGIJSA-N 0.000 description 1
- OAJWKDBJUXZZHP-PLNQYNMKSA-N (6r)-7-amino-3-[(5-cyclopropyl-1h-1,2,4-triazol-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC(N=1)=NNC=1C1CC1 OAJWKDBJUXZZHP-PLNQYNMKSA-N 0.000 description 1
- OBZPELDGSNYFTD-XCGJVMPOSA-N (6r)-7-amino-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=CS1 OBZPELDGSNYFTD-XCGJVMPOSA-N 0.000 description 1
- MLOZJRLUNNFSGD-IOJJLOCKSA-N (6r)-7-amino-8-oxo-3-(2h-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC=1C=NNN=1 MLOZJRLUNNFSGD-IOJJLOCKSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical class CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- HSQYFMXOPIDSAA-UHFFFAOYSA-N 3-cyano-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC#N HSQYFMXOPIDSAA-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- FCUHLZZHVRZQNS-ZHWMGRLRSA-M sodium (6R)-7-[[2-(cyanomethylsulfonyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].CN1N=NN=C1SCC1=C(C([O-])=O)N2C(=O)C(NC(=O)CS(=O)(=O)CC#N)[C@H]2SC1 FCUHLZZHVRZQNS-ZHWMGRLRSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- FTCIOKFITICAHR-FFFFSGIJSA-N tert-butyl (6r)-7-amino-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1C(C)=NN=C1SCC1=C(C(=O)OC(C)(C)C)N2C(=O)C(N)[C@H]2SC1 FTCIOKFITICAHR-FFFFSGIJSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical group C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/46—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US389,407 | 1973-08-17 | ||
| US389407A US3883520A (en) | 1973-08-17 | 1973-08-17 | Substituted mercaptoacetamidocephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1093550A true CA1093550A (en) | 1981-01-13 |
Family
ID=23538135
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA206,673A Expired CA1093550A (en) | 1973-08-17 | 1974-08-09 | Cephalosporin derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3883520A (Direct) |
| JP (1) | JPS5049295A (Direct) |
| BE (1) | BE818679A (Direct) |
| CA (1) | CA1093550A (Direct) |
| CH (1) | CH606012A5 (Direct) |
| DE (1) | DE2439455A1 (Direct) |
| DK (1) | DK436574A (Direct) |
| ES (1) | ES429316A1 (Direct) |
| FR (1) | FR2240737B1 (Direct) |
| GB (1) | GB1440294A (Direct) |
| IE (1) | IE40510B1 (Direct) |
| IL (1) | IL45307A0 (Direct) |
| NL (1) | NL7410837A (Direct) |
| SE (1) | SE7410200L (Direct) |
| ZA (1) | ZA744175B (Direct) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1075277B (it) * | 1977-02-11 | 1985-04-22 | Erba Carlo Spa | Derivati insaturi e epossidici dell'acio 7-acilamido-3-cefem-4-carbossilico e procedimento per la loro preparazione |
| GB1449420A (en) * | 1973-11-26 | 1976-09-15 | Sankyo Co | 7alpha-methoxycephalosporing derivatives |
| US4059578A (en) * | 1974-09-09 | 1977-11-22 | Smithkline Corporation | 7-Substituted mercaptoacetamido cephamycins |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| US4020057A (en) * | 1975-06-18 | 1977-04-26 | Smithkline Corporation | 7β-Acyloxy cephalosporins |
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4034092A (en) * | 1976-05-03 | 1977-07-05 | Smithkline Corporation | 7-Acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4058609A (en) * | 1976-06-28 | 1977-11-15 | Smithkline Corporation | 7-Dithioacetamido cephalosporins |
| US4082912A (en) * | 1976-06-30 | 1978-04-04 | Bristol-Myers Company | Certain 7-acylamido-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylmethyl)-3-cephem-4-carboxylic acids their salts and easily hydrolyzed esters |
| US4112228A (en) * | 1976-07-13 | 1978-09-05 | Bristol-Myers Company | 7-(D-α-Hydroxy-2-arylacetamido)-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo-[4,3-b]pyridazin-3-on-6-ylthiomethyl)-3-cephem-4-carboxylic acids and derivatives |
| US4112086A (en) * | 1976-11-02 | 1978-09-05 | Smithkline Corporation | 7β-Acylamino-3-(phosphonoalkyl and esterified phosphonoalkyl substituted tetrazolylthiomethyl)cephalosporins |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
-
1973
- 1973-08-17 US US389407A patent/US3883520A/en not_active Expired - Lifetime
-
1974
- 1974-06-28 ZA ZA00744175A patent/ZA744175B/xx unknown
- 1974-07-19 IL IL45307A patent/IL45307A0/xx unknown
- 1974-08-09 CA CA206,673A patent/CA1093550A/en not_active Expired
- 1974-08-09 BE BE147459A patent/BE818679A/xx not_active IP Right Cessation
- 1974-08-09 SE SE7410200A patent/SE7410200L/xx unknown
- 1974-08-12 JP JP49092717A patent/JPS5049295A/ja active Pending
- 1974-08-13 NL NL7410837A patent/NL7410837A/xx not_active Application Discontinuation
- 1974-08-14 IE IE1703/74A patent/IE40510B1/xx unknown
- 1974-08-14 FR FR7428330A patent/FR2240737B1/fr not_active Expired
- 1974-08-15 DK DK436574A patent/DK436574A/da not_active Application Discontinuation
- 1974-08-16 DE DE2439455A patent/DE2439455A1/de not_active Withdrawn
- 1974-08-16 ES ES429316A patent/ES429316A1/es not_active Expired
- 1974-08-16 GB GB3610774A patent/GB1440294A/en not_active Expired
- 1974-08-16 CH CH1119474A patent/CH606012A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE818679A (fr) | 1975-02-10 |
| IL45307A0 (en) | 1974-10-22 |
| FR2240737A1 (Direct) | 1975-03-14 |
| IE40510B1 (en) | 1979-06-20 |
| ZA744175B (en) | 1975-06-25 |
| NL7410837A (nl) | 1975-02-19 |
| JPS5049295A (Direct) | 1975-05-01 |
| SE7410200L (Direct) | 1975-02-18 |
| AU7189674A (en) | 1976-02-05 |
| US3883520A (en) | 1975-05-13 |
| FR2240737B1 (Direct) | 1978-07-21 |
| GB1440294A (en) | 1976-06-23 |
| IE40510L (en) | 1975-02-17 |
| DK436574A (Direct) | 1975-04-28 |
| ES429316A1 (es) | 1976-08-16 |
| DE2439455A1 (de) | 1975-02-27 |
| CH606012A5 (Direct) | 1978-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3867380A (en) | 3-Heterocyclic thiomethylcephalosporins | |
| US3828037A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| CA1093550A (en) | Cephalosporin derivatives | |
| US3865819A (en) | Substituted sulfonylacetamido cephalosporins | |
| US4067976A (en) | Alpha-amino-alpha-(ureidophenyl)acetamidocephalosporins and their pharmaceutical compositions | |
| US3880848A (en) | 7-Trifluorome thylsulfinylacetamido cephalosporins | |
| GB2071654A (en) | Hydroxamic acid derivatives of 7-(2-amino-4-thiazolyl)oximino cephalosporins | |
| US3931160A (en) | α-Amino-α-(acylamidophenyl)acetamidocephalosporins | |
| US4059578A (en) | 7-Substituted mercaptoacetamido cephamycins | |
| US3963711A (en) | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins | |
| US3868369A (en) | 3-heterocyclicthiomethylcephalosporins | |
| US3963709A (en) | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins | |
| US3957770A (en) | Substituted acetamidocephalosporins | |
| US3943129A (en) | 7-Amino-3-(1,3,4-thiadiazolinylthio-methyl) cephalosporins | |
| US3884915A (en) | 7-Alkylmercaptoacetamido cephalosporins | |
| US3948905A (en) | Substituted sulfonylacetamido cephalosporins | |
| US3957984A (en) | Substituted mercaptoacetamidocephalosporins | |
| US3998818A (en) | Trifluoroethylmercapto, -sulfinyl or -sulfonyl acetamidocephalosporins | |
| US4013765A (en) | Compositions and methods for treating bacterial infections with substituted acetamidocephalosporins | |
| US4058609A (en) | 7-Dithioacetamido cephalosporins | |
| US3998819A (en) | Trifluoroethyl-mercapto, -sulfinyl or -sulfonyl acetamidocephalosporins | |
| US3898221A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| US3772286A (en) | 7-ureidocephalosporins | |
| US3960853A (en) | Substituted sulfonylacetamido cephalosporins | |
| US3946005A (en) | 7-Amino-3-(1,2,4-triazolinylthiomethyl)cephalosporins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |