CA1078779A - Diaphragm cell having uniform and minimum spacing between the anodes and cathodes - Google Patents
Diaphragm cell having uniform and minimum spacing between the anodes and cathodesInfo
- Publication number
- CA1078779A CA1078779A CA244,030A CA244030A CA1078779A CA 1078779 A CA1078779 A CA 1078779A CA 244030 A CA244030 A CA 244030A CA 1078779 A CA1078779 A CA 1078779A
- Authority
- CA
- Canada
- Prior art keywords
- diaphragm
- cell
- anodes
- net
- cathodes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001508 alkali metal halide Inorganic materials 0.000 claims abstract description 4
- 150000008045 alkali metal halides Chemical class 0.000 claims abstract description 4
- 238000005868 electrolysis reaction Methods 0.000 claims abstract description 4
- 210000000188 diaphragm Anatomy 0.000 claims description 72
- 210000004027 cell Anatomy 0.000 claims description 50
- 229910052751 metal Inorganic materials 0.000 claims description 26
- 239000002184 metal Substances 0.000 claims description 26
- 239000000463 material Substances 0.000 claims description 18
- 210000005056 cell body Anatomy 0.000 claims description 17
- -1 asbestss filaments Substances 0.000 claims description 15
- 230000001681 protective effect Effects 0.000 claims description 11
- 239000010425 asbestos Substances 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 229910052895 riebeckite Inorganic materials 0.000 claims description 8
- 230000002844 continuous effect Effects 0.000 claims description 6
- 239000003365 glass fiber Substances 0.000 claims description 6
- 239000004033 plastic Substances 0.000 claims description 6
- 229920003023 plastic Polymers 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 239000012267 brine Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims description 5
- 239000002131 composite material Substances 0.000 claims description 4
- 239000003456 ion exchange resin Substances 0.000 claims description 4
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 4
- TXEYQDLBPFQVAA-UHFFFAOYSA-N tetrafluoromethane Chemical compound FC(F)(F)F TXEYQDLBPFQVAA-UHFFFAOYSA-N 0.000 claims description 4
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 3
- 239000004744 fabric Substances 0.000 claims description 3
- 239000012528 membrane Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 3
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004743 Polypropylene Substances 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 claims description 2
- 229920001155 polypropylene Polymers 0.000 claims description 2
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 claims 1
- 229910044991 metal oxide Inorganic materials 0.000 claims 1
- 230000002829 reductive effect Effects 0.000 abstract description 3
- 230000000717 retained effect Effects 0.000 abstract description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 229910002804 graphite Inorganic materials 0.000 description 10
- 239000010439 graphite Substances 0.000 description 10
- 239000002245 particle Substances 0.000 description 7
- 229910000831 Steel Inorganic materials 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000010959 steel Substances 0.000 description 6
- 229910006069 SO3H Inorganic materials 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 229940058401 polytetrafluoroethylene Drugs 0.000 description 4
- 239000004810 polytetrafluoroethylene Substances 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 239000011151 fibre-reinforced plastic Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229920001875 Ebonite Polymers 0.000 description 2
- 229920002430 Fibre-reinforced plastic Polymers 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- 229920002313 fluoropolymer Polymers 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910005143 FSO2 Inorganic materials 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000011246 composite particle Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 229910001924 platinum group oxide Inorganic materials 0.000 description 1
- 239000005023 polychlorotrifluoroethylene (PCTFE) polymer Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000011150 reinforced concrete Substances 0.000 description 1
- 239000002990 reinforced plastic Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B13/00—Diaphragms; Spacing elements
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/17—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof
- C25B9/19—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Cell Electrode Carriers And Collectors (AREA)
- Battery Electrode And Active Subsutance (AREA)
- Electrolytic Production Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/547,062 US3960697A (en) | 1975-02-04 | 1975-02-04 | Diaphragm cell having uniform and minimum spacing between the anodes and cathodes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1078779A true CA1078779A (en) | 1980-06-03 |
Family
ID=24183192
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA244,030A Expired CA1078779A (en) | 1975-02-04 | 1976-01-21 | Diaphragm cell having uniform and minimum spacing between the anodes and cathodes |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3960697A (OSRAM) |
| JP (1) | JPS51103081A (OSRAM) |
| AR (1) | AR206956A1 (OSRAM) |
| BR (1) | BR7600576A (OSRAM) |
| CA (1) | CA1078779A (OSRAM) |
| DE (1) | DE2604033A1 (OSRAM) |
| ES (1) | ES444872A1 (OSRAM) |
| FR (1) | FR2300143A1 (OSRAM) |
| GB (1) | GB1529737A (OSRAM) |
| GR (1) | GR58276B (OSRAM) |
| IT (1) | IT1053411B (OSRAM) |
| SE (1) | SE425671B (OSRAM) |
| ZA (1) | ZA7693B (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4188469A (en) * | 1975-05-20 | 1980-02-12 | E. I. Du Pont De Nemours And Company | Composition of hydrophilic fluoropolymers with fibrous matter and liquid carrier |
| US4153520A (en) * | 1975-05-20 | 1979-05-08 | E. I. Du Pont De Nemours And Company | Method for the electrolytic production of chlorine from brine |
| US4169024A (en) * | 1975-05-20 | 1979-09-25 | E. I. Du Pont De Nemours And Company | Process for electrolytically producing chlorine in a cell having a diaphragm comprising hydrophilic fluoropolymers |
| US4189369A (en) * | 1975-05-20 | 1980-02-19 | E. I. Du Pont De Nemours And Company | Diaphragm of hydrophilic fluoropolymers |
| US4186084A (en) * | 1975-05-20 | 1980-01-29 | E. I. Du Pont De Nemours And Company | Hydrophilic fluoropolymers |
| JPS5222599A (en) * | 1975-08-15 | 1977-02-19 | Asahi Glass Co Ltd | Production of alkali hydroxide |
| US4032427A (en) * | 1975-11-03 | 1977-06-28 | Olin Corporation | Porous anode separator |
| US4126588A (en) * | 1975-12-30 | 1978-11-21 | Asahi Glass Company Ltd. | Fluorinated cation exchange membrane and use thereof in electrolysis of alkali metal halide |
| JPS52145397A (en) * | 1976-03-31 | 1977-12-03 | Asahi Chem Ind Co Ltd | Electrolysis |
| JPS52120983A (en) * | 1976-04-05 | 1977-10-11 | Asahi Chem Ind Co Ltd | Improved cation exchange membrane |
| US4032423A (en) * | 1976-06-09 | 1977-06-28 | Ppg Industries, Inc. | Method of assembling a bipolar electrolyzer |
| GB1533904A (en) * | 1976-11-12 | 1978-11-29 | Ici Ltd | Diaphragm cells |
| JPS5526015U (OSRAM) * | 1978-08-03 | 1980-02-20 | ||
| US4250001A (en) * | 1979-06-19 | 1981-02-10 | Monsanto Company | Pretreatment of cathodes in electrohydrodimerization of acrylonitrile |
| US4283264A (en) * | 1979-09-14 | 1981-08-11 | Hooker Chemicals & Plastics Corp. | Electrolytic cell separator, tubular member component thereof and methods for manufacturing and using such separator and component |
| US4341596A (en) * | 1980-10-14 | 1982-07-27 | Fmc Corporation | Method of preparing reinforced asbestos diaphragms for chlorine-caustic cells |
| US4368109A (en) * | 1980-11-05 | 1983-01-11 | Olin Corporation | Electrolytic cell with inter-electrode spacer means |
| US5306410A (en) * | 1992-12-04 | 1994-04-26 | Farmer Thomas E | Method and device for electrically coupling a conductor to the metal surface of an electrolytic cell wall |
| US5427658A (en) * | 1993-10-21 | 1995-06-27 | Electrosci Incorporated | Electrolytic cell and method for producing a mixed oxidant gas |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA700296A (en) * | 1964-12-22 | Kwo-Wei Chen William | Membranes | |
| US2944956A (en) * | 1956-11-16 | 1960-07-12 | Dow Chemical Co | Chlorine cell having protected diaphragm |
| FR1540964A (fr) * | 1966-06-21 | 1968-10-04 | Monsanto Co | Cellule électrolytique et membrane composite |
| US3477938A (en) * | 1967-10-06 | 1969-11-11 | Dryden Chem Ltd | Anode structure for electrolytic cell |
| US3674676A (en) * | 1970-02-26 | 1972-07-04 | Diamond Shamrock Corp | Expandable electrodes |
| US3809630A (en) * | 1970-06-20 | 1974-05-07 | Oronzio De Nora Impianti | Electrolysis cell with permeable valve metal anode and diaphragms on both the anode and cathode |
| US3796648A (en) * | 1971-12-22 | 1974-03-12 | Fmc Corp | Electrolytic cell having self-aligning anodes |
-
1975
- 1975-02-04 US US05/547,062 patent/US3960697A/en not_active Expired - Lifetime
-
1976
- 1976-01-01 AR AR262158A patent/AR206956A1/es active
- 1976-01-07 ZA ZA00760093A patent/ZA7693B/xx unknown
- 1976-01-21 IT IT47739/76A patent/IT1053411B/it active
- 1976-01-21 CA CA244,030A patent/CA1078779A/en not_active Expired
- 1976-01-30 BR BR7600576A patent/BR7600576A/pt unknown
- 1976-02-03 JP JP51010790A patent/JPS51103081A/ja active Pending
- 1976-02-03 FR FR7602934A patent/FR2300143A1/fr active Granted
- 1976-02-03 ES ES444872A patent/ES444872A1/es not_active Expired
- 1976-02-03 SE SE7601156A patent/SE425671B/xx unknown
- 1976-02-03 GB GB4243/76A patent/GB1529737A/en not_active Expired
- 1976-02-03 GR GR49939A patent/GR58276B/el unknown
- 1976-02-03 DE DE2604033A patent/DE2604033A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB1529737A (en) | 1978-10-25 |
| AU1024776A (en) | 1977-07-21 |
| ES444872A1 (es) | 1977-10-01 |
| AR206956A1 (es) | 1976-08-31 |
| JPS51103081A (OSRAM) | 1976-09-11 |
| IT1053411B (it) | 1981-08-31 |
| DE2604033A1 (de) | 1976-08-05 |
| SE425671B (sv) | 1982-10-25 |
| GR58276B (en) | 1977-09-19 |
| SE7601156L (sv) | 1976-08-05 |
| FR2300143B1 (OSRAM) | 1979-08-24 |
| FR2300143A1 (fr) | 1976-09-03 |
| BR7600576A (pt) | 1976-08-31 |
| ZA7693B (en) | 1976-12-29 |
| US3960697A (en) | 1976-06-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1078779A (en) | Diaphragm cell having uniform and minimum spacing between the anodes and cathodes | |
| US4014775A (en) | Diaphragm cell having uniform and minimum spacing between the anodes and cathodes | |
| CA1280716C (en) | Ion exchange membrane with non-electrode layer for electrolytic processes | |
| CA1056768A (en) | Coating metal anodes to decrease consumption rates | |
| US4105514A (en) | Process for electrolysis in a membrane cell employing pressure actuated uniform spacing | |
| CA1111000A (en) | Separator-electrode unit for electrolytic cells | |
| CA1117472A (en) | Filter press cell | |
| US5168005A (en) | Multiaxially reinforced membrane | |
| CA1095855A (en) | Electrolytic cell having membrane enclosed anodes | |
| US5288384A (en) | Wetting of diaphragms | |
| SE449233B (sv) | Monopoler elektrolysor av filterpresstyp | |
| CA1225615A (en) | Process for electrolyzing aqueous solution of alkali metal chloride | |
| EP0041716B1 (en) | Electrolytic cell assembly | |
| US4436608A (en) | Narrow gap gas electrode electrolytic cell | |
| CA1040135A (en) | Electrolytic diaphragm cell | |
| EP0076386B1 (en) | Monopolar membrane electrolytic cell | |
| US4596639A (en) | Electrolysis process and electrolytic cell | |
| US4556470A (en) | Electrolytic cell with membrane and solid, horizontal cathode plate | |
| CA1160987A (en) | Finger type electrolytic cell for the electrolysis of an aqueous alkali metal chloride solution | |
| CA1130758A (en) | Electrolytic cell | |
| US4528077A (en) | Membrane electrolytic cell for minimizing hypochlorite and chlorate formation | |
| KR790001868B1 (ko) | 개량된 격막 전해조 | |
| USRE30864E (en) | Process for electrolysis in a membrane cell employing pressure actuated uniform spacing | |
| CA1058556A (en) | Process and apparatus for electrolysis | |
| KR930005659B1 (ko) | 알칼리 금속 염화물 전해용 양이온 교환막 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |