CA1072245A - Free-radical polymerizations using mixed initiator systems at two thermally distinct polymerization stages - Google Patents
Free-radical polymerizations using mixed initiator systems at two thermally distinct polymerization stagesInfo
- Publication number
- CA1072245A CA1072245A CA288,600A CA288600A CA1072245A CA 1072245 A CA1072245 A CA 1072245A CA 288600 A CA288600 A CA 288600A CA 1072245 A CA1072245 A CA 1072245A
- Authority
- CA
- Canada
- Prior art keywords
- polymerization
- initiator
- initiators
- bis
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003999 initiator Substances 0.000 title claims abstract description 74
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 62
- 238000010526 radical polymerization reaction Methods 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 claims abstract description 47
- 239000000178 monomer Substances 0.000 claims abstract description 32
- 229920002554 vinyl polymer Polymers 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 3
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 3
- 125000004419 alkynylene group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 47
- 239000000203 mixture Substances 0.000 claims description 22
- 229920000642 polymer Polymers 0.000 claims description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 13
- 238000012662 bulk polymerization Methods 0.000 claims description 8
- 238000010557 suspension polymerization reaction Methods 0.000 claims description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- RIPYNJLMMFGZSX-UHFFFAOYSA-N (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate Chemical compound C=1C=CC=CC=1C(=O)OOC(C)(C)CCC(C)(C)OOC(=O)C1=CC=CC=C1 RIPYNJLMMFGZSX-UHFFFAOYSA-N 0.000 claims description 4
- HSLFISVKRDQEBY-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)cyclohexane Chemical compound CC(C)(C)OOC1(OOC(C)(C)C)CCCCC1 HSLFISVKRDQEBY-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 claims description 3
- XYPOZZARRUPZNK-UHFFFAOYSA-N bis[(2-methylpropan-2-yl)oxy] carbonate Chemical compound CC(C)(C)OOC(=O)OOC(C)(C)C XYPOZZARRUPZNK-UHFFFAOYSA-N 0.000 claims description 2
- QYJVHXFJGNNXGU-UHFFFAOYSA-N 3,3-bis(tert-butylperoxy)butanoic acid Chemical compound CC(C)(C)OOC(C)(CC(O)=O)OOC(C)(C)C QYJVHXFJGNNXGU-UHFFFAOYSA-N 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 229920000136 polysorbate Polymers 0.000 claims 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000839 emulsion Substances 0.000 description 6
- 239000004342 Benzoyl peroxide Substances 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- -1 t-butylperoxy isopropyl carbonate Di-t-butyldiperoxyazelate Chemical compound 0.000 description 3
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- GOAHRBQLKIZLKG-UHFFFAOYSA-N 1-tert-butylperoxybutane Chemical compound CCCCOOC(C)(C)C GOAHRBQLKIZLKG-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- RUMACXVDVNRZJZ-UHFFFAOYSA-N 2-methylpropyl 2-methylprop-2-enoate Chemical compound CC(C)COC(=O)C(C)=C RUMACXVDVNRZJZ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229920006384 Airco Polymers 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- JUIBLDFFVYKUAC-UHFFFAOYSA-N [5-(2-ethylhexanoylperoxy)-2,5-dimethylhexan-2-yl] 2-ethylhexaneperoxoate Chemical compound CCCCC(CC)C(=O)OOC(C)(C)CCC(C)(C)OOC(=O)C(CC)CCCC JUIBLDFFVYKUAC-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- XOXFKMAPHYKJOS-UHFFFAOYSA-N benzoyl benzenecarboperoxoate;dodecanoyl dodecaneperoxoate Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1.CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC XOXFKMAPHYKJOS-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- DVBJBNKEBPCGSY-UHFFFAOYSA-M cetylpyridinium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 DVBJBNKEBPCGSY-UHFFFAOYSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- CIKJANOSDPPCAU-UHFFFAOYSA-N ditert-butyl cyclohexane-1,4-dicarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1CCC(C(=O)OOC(C)(C)C)CC1 CIKJANOSDPPCAU-UHFFFAOYSA-N 0.000 description 1
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229920005669 high impact polystyrene Polymers 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 229940068984 polyvinyl alcohol Drugs 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/28—Oxygen or compounds releasing free oxygen
- C08F4/32—Organic compounds
- C08F4/38—Mixtures of peroxy-compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/757,186 US4129703A (en) | 1977-01-06 | 1977-01-06 | Free-radical polymerizations using mixed initiator systems at two thermally distinct polymerization stages |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1072245A true CA1072245A (en) | 1980-02-19 |
Family
ID=25046758
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA288,600A Expired CA1072245A (en) | 1977-01-06 | 1977-10-13 | Free-radical polymerizations using mixed initiator systems at two thermally distinct polymerization stages |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4129703A (index.php) |
| JP (1) | JPS5385880A (index.php) |
| CA (1) | CA1072245A (index.php) |
| DE (1) | DE2749519A1 (index.php) |
| FR (1) | FR2376871A1 (index.php) |
| GB (1) | GB1588877A (index.php) |
| NL (1) | NL7711670A (index.php) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4396737A (en) * | 1981-11-19 | 1983-08-02 | Ppg Industries, Inc. | Polymerization of polyol allyl carbonate using polymerization initiators of short and long half lives |
| US4962147A (en) * | 1988-05-26 | 1990-10-09 | Hoechst Celanese Corporation | Process for the suspension polymerization of 4-acetoxystyrene and hydrolysis to 4-hydroxystyrene polymers |
| CA2019626C (en) * | 1989-06-30 | 1994-11-22 | Yuichi Arito | Styrene type resin and production method thereof |
| US5274029A (en) * | 1990-09-10 | 1993-12-28 | Kelley Joseph M | Styrene polymerization process |
| CA2063473C (en) * | 1991-07-01 | 1998-09-22 | T. Hwee Ng | Process for preparing copolymers |
| CA2115587A1 (en) * | 1993-02-18 | 1994-08-19 | Hayato Kihara | Styrene copolymers, polystyrene compositions, processes for producing styrene copolymers, and injection-molded articles |
| US6037428A (en) * | 1997-04-25 | 2000-03-14 | Shin-Etsu Chemical Co., Ltd. | Polymerization of vinyl chloride with peroxide mixtures |
| US5972329A (en) * | 1997-05-16 | 1999-10-26 | Isp Investments Inc. | Fixative polymers |
| DE19749570A1 (de) * | 1997-11-10 | 1999-05-12 | Basf Ag | Verfahren zur Herstellung von expandierbaren Styrolpolymerisaten |
| CN1934137B (zh) * | 2004-01-30 | 2012-09-26 | 多乐士集团(澳大利亚)有限公司 | 用于制备固体聚酯颗粒的引发体系 |
| KR100877577B1 (ko) * | 2006-12-26 | 2009-01-08 | 제일모직주식회사 | 광학용 방향족 비닐계 열가소성 수지 및 그 제조방법 |
| WO2009065799A1 (en) * | 2007-11-20 | 2009-05-28 | Akzo Nobel N.V. | Process for preparing styrene-based (co)polymers |
| EP3750929A1 (en) * | 2019-06-12 | 2020-12-16 | Trinseo Europe GmbH | Styrenic polymers having reduced trimer content |
| CN116063599B (zh) * | 2023-02-07 | 2025-08-29 | 安徽秀朗新材料科技有限公司 | 一种窄分子量分布的phs类树脂的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2656334A (en) * | 1948-09-28 | 1953-10-20 | Koppers Co Inc | Catalytic polymerization process |
| BE575339A (index.php) * | 1958-02-03 | |||
| US3222341A (en) * | 1961-08-01 | 1965-12-07 | Monsanto Co | Process for polymerizing styrene |
| NL292366A (index.php) * | 1962-05-17 | |||
| US3293233A (en) * | 1963-04-09 | 1966-12-20 | Rexall Drug Chemical | Process for polymerizing ethylene at high pressures in the presence of a mixture of peroxides having different half lives |
| US3265274A (en) * | 1964-07-30 | 1966-08-09 | Vernon G Burnell | Pamphlet assembly and stapling machine |
| NL149816B (nl) * | 1967-08-29 | 1976-06-15 | Noury & Van Der Lande | Werkwijze voor de peroxydische homo- of copolymerisatie van vinylmonomeren. |
| GB1243197A (en) * | 1968-01-18 | 1971-08-18 | British Petroleum Co | Polymerisation process |
| US3817965A (en) * | 1968-02-27 | 1974-06-18 | Aquitaine Petrole | Polymerization of vinyl compounds in suspension |
| GB1252153A (index.php) * | 1968-04-30 | 1971-11-03 |
-
1977
- 1977-01-06 US US05/757,186 patent/US4129703A/en not_active Expired - Lifetime
- 1977-10-13 CA CA288,600A patent/CA1072245A/en not_active Expired
- 1977-10-25 NL NL7711670A patent/NL7711670A/xx not_active Application Discontinuation
- 1977-11-04 DE DE19772749519 patent/DE2749519A1/de not_active Withdrawn
- 1977-11-10 FR FR7733945A patent/FR2376871A1/fr active Granted
- 1977-11-24 GB GB48998/77A patent/GB1588877A/en not_active Expired
-
1978
- 1978-01-05 JP JP5178A patent/JPS5385880A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2376871B1 (index.php) | 1984-01-27 |
| FR2376871A1 (fr) | 1978-08-04 |
| NL7711670A (nl) | 1978-07-10 |
| JPS5385880A (en) | 1978-07-28 |
| US4129703A (en) | 1978-12-12 |
| DE2749519A1 (de) | 1978-07-13 |
| GB1588877A (en) | 1981-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1072245A (en) | Free-radical polymerizations using mixed initiator systems at two thermally distinct polymerization stages | |
| US4786696A (en) | Process for the preparation of tacky polymeric microspheres | |
| US3104231A (en) | Aqueous emulsion of cross-linked terpolymers free of microgel and method of making same | |
| US4125696A (en) | Polymerization process using di-t-butyl diperoxycarbonate as a finishing catalyst | |
| US4200593A (en) | Process for the preparation of copolymers containing low monomer content | |
| US4125695A (en) | Polymerization process with reduced cycle time employing polyfunctional free radical initiators | |
| US3219588A (en) | Catalysts for the polymerization of vinyl monomers | |
| US3110702A (en) | Molecular weight control in polymerization of vinylidene monomers | |
| US3523111A (en) | Emulsion polymerization of vinyl chloride with redox initiator system components and emulsifier prepared before monomer addition | |
| JP2002526574A (ja) | 重合反応中の非常に速い開始剤の連続的配量 | |
| US3198775A (en) | Copolymers having improved optical clarity | |
| US4130700A (en) | Polymerization process using diperoxy ketals as finishing catalysts | |
| EP0112708A2 (en) | Film-forming olefinic nitrile polymer latex and method of preparing same | |
| US2917477A (en) | Aqueous polymerization process using amino acid chelating agent and product | |
| US3236798A (en) | Film-forming acrylonitrile polyer latex and method for preparing same | |
| CA2482132A1 (en) | Co-metering of organic initiators and protective colloids during polymerization reactions | |
| EP0177956B1 (en) | Low molecular weight vinyl halide/vinyl ester copolymers by aqueous polymerization | |
| US3388109A (en) | Novel polymerization catalyst based on hydrogen peroxide and thioglycolic acid | |
| Baxendale et al. | Kinetics and heats of copolymerization of acrylonitrile and methyl methacrylate | |
| US3165500A (en) | Process for the production of acrylonitrile polymers | |
| US2646424A (en) | Acrylonitrile compositions and process for making the same | |
| US3790542A (en) | Method for polymerizing vinyl chloride | |
| US3457241A (en) | Method for producing vinyl chloride polymers | |
| US3673282A (en) | Core-shell vinyl halide polymers having a long-chain vinyl ether containing shell | |
| US2385258A (en) | Substituted acrylonitrile polymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |