CA1057552A - Crystalline organic pigment sensitizers for photoconductive layers - Google Patents
Crystalline organic pigment sensitizers for photoconductive layersInfo
- Publication number
- CA1057552A CA1057552A CA224,287A CA224287A CA1057552A CA 1057552 A CA1057552 A CA 1057552A CA 224287 A CA224287 A CA 224287A CA 1057552 A CA1057552 A CA 1057552A
- Authority
- CA
- Canada
- Prior art keywords
- photoconductor
- group
- photoconductive composition
- pigment
- organic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012860 organic pigment Substances 0.000 title claims abstract description 14
- -1 alkali metal salts Chemical class 0.000 claims abstract description 111
- 239000000203 mixture Substances 0.000 claims abstract description 41
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 25
- 238000000034 method Methods 0.000 claims abstract description 25
- 125000004429 atom Chemical group 0.000 claims abstract description 24
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 17
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims abstract description 16
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims abstract description 14
- 229910052784 alkaline earth metal Chemical group 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 13
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 11
- 229910006069 SO3H Inorganic materials 0.000 claims abstract description 8
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims abstract description 8
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 8
- 150000002367 halogens Chemical class 0.000 claims abstract description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims abstract description 8
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000003513 alkali Chemical group 0.000 claims abstract description 7
- 150000001342 alkaline earth metals Chemical group 0.000 claims abstract description 7
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims abstract description 7
- 239000000049 pigment Substances 0.000 claims description 37
- 239000011230 binding agent Substances 0.000 claims description 14
- 230000001235 sensitizing effect Effects 0.000 claims description 14
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 12
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims description 6
- 150000004982 aromatic amines Chemical group 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 229910052711 selenium Inorganic materials 0.000 claims description 6
- 239000011669 selenium Substances 0.000 claims description 6
- 239000011787 zinc oxide Substances 0.000 claims description 6
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052980 cadmium sulfide Inorganic materials 0.000 claims description 5
- 229910000464 lead oxide Inorganic materials 0.000 claims description 5
- 125000002524 organometallic group Chemical group 0.000 claims description 5
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 4
- UHYPYGJEEGLRJD-UHFFFAOYSA-N cadmium(2+);selenium(2-) Chemical compound [Se-2].[Cd+2] UHYPYGJEEGLRJD-UHFFFAOYSA-N 0.000 claims description 4
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 4
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 claims 4
- 229920005596 polymer binder Polymers 0.000 claims 2
- 239000002491 polymer binding agent Substances 0.000 claims 2
- 125000003748 selenium group Chemical group *[Se]* 0.000 claims 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims 1
- AQCDIIAORKRFCD-UHFFFAOYSA-N cadmium selenide Chemical compound [Cd]=[Se] AQCDIIAORKRFCD-UHFFFAOYSA-N 0.000 claims 1
- 239000010936 titanium Substances 0.000 claims 1
- 229910052719 titanium Inorganic materials 0.000 claims 1
- 239000000463 material Substances 0.000 description 34
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- 125000001424 substituent group Chemical group 0.000 description 14
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 10
- 239000008199 coating composition Substances 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 9
- 239000001055 blue pigment Substances 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 8
- 238000000576 coating method Methods 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 229920005989 resin Polymers 0.000 description 7
- 239000011347 resin Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 150000005840 aryl radicals Chemical group 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 206010070834 Sensitisation Diseases 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 150000002894 organic compounds Chemical class 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001054 red pigment Substances 0.000 description 4
- 230000008313 sensitization Effects 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 229920000180 alkyd Polymers 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 235000005513 chalcones Nutrition 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 150000002429 hydrazines Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000007659 semicarbazones Chemical class 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 125000005259 triarylamine group Chemical group 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- PDBZHEMVWXFWIT-UHFFFAOYSA-N 1-[4-(n-phenylanilino)phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 PDBZHEMVWXFWIT-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 description 2
- 125000004171 alkoxy aryl group Chemical group 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000005001 aminoaryl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 125000005026 carboxyaryl group Chemical group 0.000 description 2
- 239000004020 conductor Substances 0.000 description 2
- CHVJITGCYZJHLR-UHFFFAOYSA-N cyclohepta-1,3,5-triene Chemical compound C1C=CC=CC=C1 CHVJITGCYZJHLR-UHFFFAOYSA-N 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000003106 haloaryl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005027 hydroxyaryl group Chemical group 0.000 description 2
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 2
- 239000011810 insulating material Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000005504 styryl group Chemical group 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- DQFBYFPFKXHELB-VAWYXSNFSA-N trans-chalcone Chemical compound C=1C=CC=CC=1C(=O)\C=C\C1=CC=CC=C1 DQFBYFPFKXHELB-VAWYXSNFSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 2
- KJPJZBYFYBYKPK-UHFFFAOYSA-N vat yellow 1 Chemical compound C12=CC=CC=C2C(=O)C2=CC=C3N=C4C5=CC=CC=C5C(=O)C5=C4C4=C3C2=C1N=C4C=C5 KJPJZBYFYBYKPK-UHFFFAOYSA-N 0.000 description 2
- 238000001429 visible spectrum Methods 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- FJLAFBORFDOARE-UHFFFAOYSA-N 1,3-bis[4-(diethylamino)phenyl]prop-2-en-1-one Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC(=O)C1=CC=C(N(CC)CC)C=C1 FJLAFBORFDOARE-UHFFFAOYSA-N 0.000 description 1
- OSNILPMOSNGHLC-UHFFFAOYSA-N 1-[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1CN1CCCCC1 OSNILPMOSNGHLC-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- XKGSCMHEPOBYNY-UHFFFAOYSA-N 11-azido-11h-dibenzo[1,2-a:1',2'-e][7]annulene Chemical compound C1=CC2=CC=CC=C2C(N=[N+]=[N-])C2=CC=CC=C21 XKGSCMHEPOBYNY-UHFFFAOYSA-N 0.000 description 1
- SRIISEYIFDTFRZ-UHFFFAOYSA-N 11h-dibenzo[1,2-a:1',2'-e][7]annulen-11-ol Chemical compound C1=CC2=CC=CC=C2C(O)C2=CC=CC=C21 SRIISEYIFDTFRZ-UHFFFAOYSA-N 0.000 description 1
- OFAPSLLQSSHRSQ-UHFFFAOYSA-N 1H-triazine-2,4-diamine Chemical class NN1NC=CC(N)=N1 OFAPSLLQSSHRSQ-UHFFFAOYSA-N 0.000 description 1
- LWPYVNQGNFIKLG-UHFFFAOYSA-N 2,3,4-triphenyl-3,4-dihydropyrazole Chemical compound C1(=CC=CC=C1)N1N=CC(C1C1=CC=CC=C1)C1=CC=CC=C1 LWPYVNQGNFIKLG-UHFFFAOYSA-N 0.000 description 1
- YWIQQKOKNPPGDO-UHFFFAOYSA-N 2,3-didehydrophenylalanine zwitterion Chemical compound OC(=O)C(N)=CC1=CC=CC=C1 YWIQQKOKNPPGDO-UHFFFAOYSA-N 0.000 description 1
- OQYNUZDJQMOTFA-UHFFFAOYSA-N 2,3-diphenyl-3,4-dihydropyrazole Chemical compound C1C=NN(C=2C=CC=CC=2)C1C1=CC=CC=C1 OQYNUZDJQMOTFA-UHFFFAOYSA-N 0.000 description 1
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 1
- FVIJAMSIJIDRSM-UHFFFAOYSA-N 3-(9H-carbazol-3-yl)-9-[3-(9H-carbazol-3-yl)carbazol-9-yl]carbazole Chemical group C1=CC(=CC=2C3=CC=CC=C3NC1=2)C=1C=CC=2N(C3=CC=CC=C3C=2C=1)N1C2=CC=CC=C2C=2C=C(C=CC1=2)C=1C=CC=2NC3=CC=CC=C3C=2C=1 FVIJAMSIJIDRSM-UHFFFAOYSA-N 0.000 description 1
- BETPIXSZIMPADP-UHFFFAOYSA-N 3-ethoxy-9-(3-ethoxycarbazol-9-yl)carbazole Chemical group C12=CC=CC=C2C2=CC(OCC)=CC=C2N1N1C2=CC=C(OCC)C=C2C2=CC=CC=C21 BETPIXSZIMPADP-UHFFFAOYSA-N 0.000 description 1
- SOFRHZUTPGJWAM-UHFFFAOYSA-N 3-hydroxy-4-[(2-methoxy-5-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound COc1ccc(cc1N=Nc1c(O)c(cc2ccccc12)C(=O)Nc1cccc(c1)[N+]([O-])=O)[N+]([O-])=O SOFRHZUTPGJWAM-UHFFFAOYSA-N 0.000 description 1
- QIENYFQFILCORP-UHFFFAOYSA-N 4,5-dimethyl-1,5-diphenyl-4H-pyrazole Chemical compound C1(=CC=CC=C1)N1N=CC(C1(C)C1=CC=CC=C1)C QIENYFQFILCORP-UHFFFAOYSA-N 0.000 description 1
- TUULDSMQZYVZEL-UHFFFAOYSA-N 4-(chloromethyl)-2,3-diphenyl-3,4-dihydropyrazole Chemical compound C1(=CC=CC=C1)N1N=CC(C1C1=CC=CC=C1)CCl TUULDSMQZYVZEL-UHFFFAOYSA-N 0.000 description 1
- LLMKIFSDWAECLH-UHFFFAOYSA-N 4-(n-(n-(4-hydroxy-3-methylphenyl)anilino)anilino)-2-methylphenol Chemical compound C1=C(O)C(C)=CC(N(N(C=2C=CC=CC=2)C=2C=C(C)C(O)=CC=2)C=2C=CC=CC=2)=C1 LLMKIFSDWAECLH-UHFFFAOYSA-N 0.000 description 1
- UESSERYYFWCTBU-UHFFFAOYSA-N 4-(n-phenylanilino)benzaldehyde Chemical compound C1=CC(C=O)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 UESSERYYFWCTBU-UHFFFAOYSA-N 0.000 description 1
- FWPDVKDTOHKZQS-UHFFFAOYSA-N 4-(n-phenylanilino)benzonitrile Chemical compound C1=CC(C#N)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 FWPDVKDTOHKZQS-UHFFFAOYSA-N 0.000 description 1
- NIGKTGXZVMXWCF-UHFFFAOYSA-N 4-[1-[4-(dimethylamino)phenyl]-1-phenylethyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C(C)(C=1C=CC(=CC=1)N(C)C)C1=CC=CC=C1 NIGKTGXZVMXWCF-UHFFFAOYSA-N 0.000 description 1
- XXWVEJFXXLLAIB-UHFFFAOYSA-N 4-[[4-(diethylamino)-2-methylphenyl]-phenylmethyl]-n,n-diethyl-3-methylaniline Chemical compound CC1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)N(CC)CC)C)C1=CC=CC=C1 XXWVEJFXXLLAIB-UHFFFAOYSA-N 0.000 description 1
- XLHZNWJJXBPXBH-UHFFFAOYSA-N 4-[[4-(diethylamino)phenyl]-diphenylstannyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1[Sn](C=1C=CC(=CC=1)N(CC)CC)(C=1C=CC=CC=1)C1=CC=CC=C1 XLHZNWJJXBPXBH-UHFFFAOYSA-N 0.000 description 1
- RCVPBQLQIQCEMF-UHFFFAOYSA-N 4-arsinoyl-N,N,3-trimethylaniline Chemical compound CC1=C(C=CC(=C1)N(C)C)[AsH2]=O RCVPBQLQIQCEMF-UHFFFAOYSA-N 0.000 description 1
- WFEMATLXEGZOHZ-UHFFFAOYSA-N 4-bis[4-(diethylamino)phenyl]phosphinothioyl-N,N-diethylaniline bis[4-(diethylamino)phenyl]-sulfanylidenetin Chemical compound C(C)N(C1=CC=C(C=C1)[Sn](=S)C1=CC=C(C=C1)N(CC)CC)CC.C(C)N(C1=CC=C(C=C1)P(C1=CC=C(C=C1)N(CC)CC)(C1=CC=C(C=C1)N(CC)CC)=S)CC WFEMATLXEGZOHZ-UHFFFAOYSA-N 0.000 description 1
- CRQGOPGADOKQKQ-UHFFFAOYSA-N 4-cyclohepta-1,3,6-trien-1-yl-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C1=CC=CCC=C1 CRQGOPGADOKQKQ-UHFFFAOYSA-N 0.000 description 1
- SYFDYRCRHZNEIP-UHFFFAOYSA-N 4-methoxy-2,3-bis(4-methylphenyl)-3,4-dihydropyrazole Chemical compound C1(=CC=C(C=C1)N1N=CC(C1C1=CC=C(C=C1)C)OC)C SYFDYRCRHZNEIP-UHFFFAOYSA-N 0.000 description 1
- UQBMYVKKPGKAAN-UHFFFAOYSA-N 7-(n-phenylanilino)chromen-2-one Chemical compound C1=C2OC(=O)C=CC2=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 UQBMYVKKPGKAAN-UHFFFAOYSA-N 0.000 description 1
- NYBZETNSMGMJDP-UHFFFAOYSA-N 7-[2-[4-(N-phenylanilino)phenyl]ethenyl]chromen-2-one Chemical compound C1(=CC=CC=C1)N(C1=CC=C(C=CC2=CC=C3C=CC(OC3=C2)=O)C=C1)C1=CC=CC=C1 NYBZETNSMGMJDP-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N Acetylene Chemical compound C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- IWQGITZIDIHDEV-UHFFFAOYSA-N C1(=CC=CC=C1)NC1=CC=C(C=C1)NC1=CC=CC=C1.C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.C1(=CC=CC=C1)NC1=CC=CC2=CC=CC=C12 Chemical compound C1(=CC=CC=C1)NC1=CC=C(C=C1)NC1=CC=CC=C1.C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.C1(=CC=CC=C1)NC1=CC=CC2=CC=CC=C12 IWQGITZIDIHDEV-UHFFFAOYSA-N 0.000 description 1
- PUOCKWCLYNTQFA-UHFFFAOYSA-N CN(C1=CC=C(C(C=CC2=CC=CC=C2)=O)C=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C(C=CC2=CC=CC=C2)=O)C=C1)C1=CC=CC=C1.CN(C1=CC=C(C=C1)C=CC(=O)C1=CC=CC=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C=C1)C=CC(=O)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound CN(C1=CC=C(C(C=CC2=CC=CC=C2)=O)C=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C(C=CC2=CC=CC=C2)=O)C=C1)C1=CC=CC=C1.CN(C1=CC=C(C=C1)C=CC(=O)C1=CC=CC=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C=C1)C=CC(=O)C1=CC=CC=C1)C1=CC=CC=C1 PUOCKWCLYNTQFA-UHFFFAOYSA-N 0.000 description 1
- ABEYJLBDBJQSEV-UHFFFAOYSA-N CN(C1=CC=C(C=C1)C=CC(=O)C1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C=C1)C=CC(=O)C1=CC=C(C=C1)N(C)C)C1=CC=CC=C1 Chemical compound CN(C1=CC=C(C=C1)C=CC(=O)C1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1)C.C1(=CC=CC=C1)N(C1=CC=C(C=C1)C=CC(=O)C1=CC=C(C=C1)N(C)C)C1=CC=CC=C1 ABEYJLBDBJQSEV-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 229920004315 LEXAN™ RESIN 105 Polymers 0.000 description 1
- BBFKSYAVLAQRBB-UHFFFAOYSA-N N,N-dimethyl-2,3-diphenyl-3,4-dihydropyrazol-4-amine Chemical compound C1(=CC=CC=C1)N1N=CC(C1C1=CC=CC=C1)N(C)C BBFKSYAVLAQRBB-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 229910001370 Se alloy Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 238000000333 X-ray scattering Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- CPQZJYRWMLBSSN-UHFFFAOYSA-N [4-(n-phenylanilino)benzoyl] 4-(n-phenylanilino)benzoate Chemical compound C=1C=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1C(=O)OC(=O)C(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 CPQZJYRWMLBSSN-UHFFFAOYSA-N 0.000 description 1
- MUBKMWFYVHYZAI-UHFFFAOYSA-N [Al].[Cu].[Zn] Chemical compound [Al].[Cu].[Zn] MUBKMWFYVHYZAI-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- ZDZHCHYQNPQSGG-UHFFFAOYSA-N binaphthyl group Chemical group C1(=CC=CC2=CC=CC=C12)C1=CC=CC2=CC=CC=C12 ZDZHCHYQNPQSGG-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 150000001789 chalcones Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- SURLGNKAQXKNSP-DBLYXWCISA-N chlorin Chemical compound C\1=C/2\N/C(=C\C3=N/C(=C\C=4NC(/C=C\5/C=CC/1=N/5)=CC=4)/C=C3)/CC\2 SURLGNKAQXKNSP-DBLYXWCISA-N 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000002508 contact lithography Methods 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- RWYFURDDADFSHT-RBBHPAOJSA-N diane Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C1=C(Cl)C2=CC(=O)[C@@H]3CC3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RWYFURDDADFSHT-RBBHPAOJSA-N 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 239000001002 diarylmethane dye Substances 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- BVQXZULQPWPOKX-UHFFFAOYSA-N ethyl 2,6-diphenyl-4-[4-(n-phenylanilino)phenyl]benzoate Chemical compound CCOC(=O)C1=C(C=2C=CC=CC=2)C=C(C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1C1=CC=CC=C1 BVQXZULQPWPOKX-UHFFFAOYSA-N 0.000 description 1
- 238000007687 exposure technique Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical group C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- XHPBZHOZZVRDHL-UHFFFAOYSA-N n-phenyl-4-[4-(n-phenylanilino)phenyl]aniline Chemical compound C=1C=C(C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 XHPBZHOZZVRDHL-UHFFFAOYSA-N 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical class C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 239000001053 orange pigment Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000011101 paper laminate Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 1
- 229920001490 poly(butyl methacrylate) polymer Polymers 0.000 description 1
- 229920000205 poly(isobutyl methacrylate) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- PEQHIRFAKIASBK-UHFFFAOYSA-N tetraphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PEQHIRFAKIASBK-UHFFFAOYSA-N 0.000 description 1
- 239000001003 triarylmethane dye Chemical class 0.000 description 1
- 150000005671 trienes Chemical class 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0677—Monoazo dyes
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/466,659 US4018607A (en) | 1974-05-03 | 1974-05-03 | Crystalline organic pigment sensitizers for photoconductive layers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1057552A true CA1057552A (en) | 1979-07-03 |
Family
ID=23852622
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA224,287A Expired CA1057552A (en) | 1974-05-03 | 1975-04-10 | Crystalline organic pigment sensitizers for photoconductive layers |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4018607A (enExample) |
| CA (1) | CA1057552A (enExample) |
| FR (1) | FR2269741B1 (enExample) |
| GB (1) | GB1506439A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4293628A (en) * | 1977-01-27 | 1981-10-06 | Ricoh Co., Ltd. | Electrophotographic elements containing disazo compounds |
| US4279981A (en) * | 1977-04-22 | 1981-07-21 | Ricoh Company, Ltd. | Electrophotographic elements containing trisazo compounds |
| US4272598A (en) * | 1977-04-27 | 1981-06-09 | Ricoh Co., Ltd. | Electrophotographic material containing disazo compounds |
| US4251614A (en) * | 1977-07-05 | 1981-02-17 | Ricoh Company, Ltd. | Novel disazo compounds, process for the preparation of same and application of said disazo compounds and analogues thereof to electrophotographic sensitive materials |
| US4314015A (en) * | 1977-07-18 | 1982-02-02 | Ricoh Co., Ltd. | Electrophotographic sensitive materials containing disazo compounds |
| JPS5569147A (en) * | 1978-11-20 | 1980-05-24 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS5573057A (en) * | 1978-11-27 | 1980-06-02 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS6029944B2 (ja) * | 1978-12-13 | 1985-07-13 | 株式会社リコー | 積層型電子写真感光体及びその製造方法 |
| JPS561944A (en) * | 1979-06-20 | 1981-01-10 | Ricoh Co Ltd | Electrophotographic receptor |
| JPS57178246A (en) * | 1981-04-27 | 1982-11-02 | Fuji Photo Film Co Ltd | Photoconductive composition and electrophotographic sensitive material using it |
| US4362798A (en) * | 1981-05-18 | 1982-12-07 | International Business Machines Corporation | Hydrazone and pyrazoline or acetosol yellow containing charge transport layer, photoconductor and electrophotographic process using the same |
| US6268457B1 (en) | 1999-06-10 | 2001-07-31 | Allied Signal, Inc. | Spin-on glass anti-reflective coatings for photolithography |
| US6824879B2 (en) | 1999-06-10 | 2004-11-30 | Honeywell International Inc. | Spin-on-glass anti-reflective coatings for photolithography |
| CA2374944A1 (en) * | 1999-06-10 | 2000-12-21 | Nigel Hacker | Spin-on-glass anti-reflective coatings for photolithography |
| US7414188B2 (en) * | 2002-01-25 | 2008-08-19 | Konarka Technologies, Inc. | Co-sensitizers for dye sensitized solar cells |
| CN1606713B (zh) * | 2001-11-15 | 2011-07-06 | 霍尼韦尔国际公司 | 用于照相平版印刷术的旋涂抗反射涂料 |
| EP1543549A1 (en) * | 2002-09-20 | 2005-06-22 | Honeywell International, Inc. | Interlayer adhesion promoter for low k materials |
| US8053159B2 (en) | 2003-11-18 | 2011-11-08 | Honeywell International Inc. | Antireflective coatings for via fill and photolithography applications and methods of preparation thereof |
| US8557877B2 (en) | 2009-06-10 | 2013-10-15 | Honeywell International Inc. | Anti-reflective coatings for optically transparent substrates |
| US8864898B2 (en) | 2011-05-31 | 2014-10-21 | Honeywell International Inc. | Coating formulations for optical elements |
| JP6803842B2 (ja) | 2015-04-13 | 2020-12-23 | ハネウェル・インターナショナル・インコーポレーテッドＨｏｎｅｙｗｅｌｌ Ｉｎｔｅｒｎａｔｉｏｎａｌ Ｉｎｃ． | オプトエレクトロニクス用途のためのポリシロキサン製剤及びコーティング |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3384632A (en) * | 1965-04-02 | 1968-05-21 | Xerox Corp | Arylazo-4-isopropoxy-1-naphthol compounds |
| BE754283A (fr) * | 1969-08-01 | 1970-12-31 | Rca Corp | Materiaux electrophotographiques rendus spectralement sensibles |
| US3684548A (en) * | 1970-06-30 | 1972-08-15 | Lawrence E Contois | Method of preparing a homogeneous dye-sensitized electrophotographic element |
| US3775105A (en) * | 1972-12-26 | 1973-11-27 | Ibm | Disazo pigment sensitized photoconductor |
-
1974
- 1974-05-03 US US05/466,659 patent/US4018607A/en not_active Expired - Lifetime
-
1975
- 1975-04-10 CA CA224,287A patent/CA1057552A/en not_active Expired
- 1975-04-29 FR FR7513325A patent/FR2269741B1/fr not_active Expired
- 1975-05-05 GB GB18784/75A patent/GB1506439A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1506439A (en) | 1978-04-05 |
| FR2269741B1 (enExample) | 1977-04-15 |
| US4018607A (en) | 1977-04-19 |
| FR2269741A1 (enExample) | 1975-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1057552A (en) | Crystalline organic pigment sensitizers for photoconductive layers | |
| US3567450A (en) | Photoconductive elements containing substituted triarylamine photoconductors | |
| US3526501A (en) | 4-diarylamino-substituted chalcone containing photoconductive compositions for use in electrophotography | |
| CA1046330A (en) | Photoconductive composition and elements with a styryl amino group containing photoconductor | |
| CA1064936A (en) | Photoconductive polymer and photoconductive compositions and elements containing same | |
| US3512966A (en) | Process of electrophotographic recording employing persistent organic photoconductive compositions | |
| CA1045879A (en) | Aggregate photoconductive compositions and elements with a styryl amino group containing photoconductor | |
| US4018606A (en) | Organic azo pigment sensitizers for photoconductive layers | |
| JPS62116943A (ja) | 電子写真感光体 | |
| US3684548A (en) | Method of preparing a homogeneous dye-sensitized electrophotographic element | |
| US3533783A (en) | Light adapted photoconductive elements | |
| US3554745A (en) | Electrophotographic composition and element | |
| US4173473A (en) | Radiation sensitive compositions containing pyrylium compounds | |
| US3586500A (en) | Electrophotographic composition and element | |
| JP3042044B2 (ja) | 電子写真用感光体 | |
| US3719486A (en) | Photoconductive elements containing organo-metallic photoconductors | |
| US3958991A (en) | Supersensitizing dye combination for electrophotographic composition and element | |
| US4233443A (en) | Novel radiation sensitive compounds and radiation sensitive compositions containing the same | |
| US4454211A (en) | Electrophotographic photosensitive member with pyrazoline charge transport material | |
| US3527602A (en) | Organic photoconductors | |
| US3653887A (en) | Novel {60 ,{60 {40 -bis(aminobenzylidene) aryldiacetonitrile photoconductors | |
| US3711280A (en) | Metallocene photoconductors used in electrophotography | |
| US3554746A (en) | Photoconductive elements containing haloarylketone-formaldehyde polymeric binders | |
| US3814600A (en) | Electrophotographic element | |
| US3503740A (en) | Photoconductive elements containing organic photoconductors and sensitizers |