CA1051705A - High gain transition metal complex imaging - Google Patents
High gain transition metal complex imagingInfo
- Publication number
- CA1051705A CA1051705A CA221,786A CA221786A CA1051705A CA 1051705 A CA1051705 A CA 1051705A CA 221786 A CA221786 A CA 221786A CA 1051705 A CA1051705 A CA 1051705A
- Authority
- CA
- Canada
- Prior art keywords
- image
- cobalt
- iii
- forming
- complex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003384 imaging method Methods 0.000 title abstract description 11
- 229910052723 transition metal Inorganic materials 0.000 title description 3
- 150000003624 transition metals Chemical class 0.000 title description 3
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 122
- 239000010941 cobalt Substances 0.000 claims abstract description 122
- 230000005855 radiation Effects 0.000 claims abstract description 88
- 238000000576 coating method Methods 0.000 claims abstract description 69
- 150000001875 compounds Chemical class 0.000 claims abstract description 64
- 239000011248 coating agent Substances 0.000 claims abstract description 63
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 62
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims abstract description 53
- 230000009467 reduction Effects 0.000 claims abstract description 42
- JAWGVVJVYSANRY-UHFFFAOYSA-N cobalt(3+) Chemical compound [Co+3] JAWGVVJVYSANRY-UHFFFAOYSA-N 0.000 claims abstract description 39
- 239000003446 ligand Substances 0.000 claims abstract description 36
- 150000001450 anions Chemical class 0.000 claims abstract description 35
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 30
- 239000002253 acid Substances 0.000 claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 29
- 150000007513 acids Chemical class 0.000 claims abstract description 24
- 239000013522 chelant Substances 0.000 claims abstract description 24
- 239000002738 chelating agent Substances 0.000 claims abstract description 24
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 claims abstract description 20
- 230000008569 process Effects 0.000 claims abstract description 19
- 230000005595 deprotonation Effects 0.000 claims abstract description 8
- 238000010537 deprotonation reaction Methods 0.000 claims abstract description 8
- GSOLWAFGMNOBSY-UHFFFAOYSA-N cobalt Chemical compound [Co][Co][Co][Co][Co][Co][Co][Co] GSOLWAFGMNOBSY-UHFFFAOYSA-N 0.000 claims abstract 30
- -1 carboxylate anions Chemical class 0.000 claims description 162
- 230000003595 spectral effect Effects 0.000 claims description 63
- 229910052739 hydrogen Inorganic materials 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 33
- 125000003118 aryl group Chemical group 0.000 claims description 31
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 239000000975 dye Substances 0.000 claims description 24
- 230000005283 ground state Effects 0.000 claims description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 19
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 18
- 239000011230 binding agent Substances 0.000 claims description 18
- 238000010438 heat treatment Methods 0.000 claims description 16
- 239000002671 adjuvant Substances 0.000 claims description 13
- 230000015572 biosynthetic process Effects 0.000 claims description 12
- 239000012954 diazonium Substances 0.000 claims description 12
- VZVHUBYZGAUXLX-UHFFFAOYSA-N azane;azanide;cobalt(3+) Chemical compound N.N.N.[NH2-].[NH2-].[NH2-].[Co+3] VZVHUBYZGAUXLX-UHFFFAOYSA-N 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 claims description 11
- 125000001624 naphthyl group Chemical group 0.000 claims description 11
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 claims description 11
- 150000001989 diazonium salts Chemical class 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000004429 atom Chemical group 0.000 claims description 9
- 230000003287 optical effect Effects 0.000 claims description 9
- 230000003647 oxidation Effects 0.000 claims description 9
- 238000007254 oxidation reaction Methods 0.000 claims description 9
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 7
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 7
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 claims description 6
- MWKAGZWJHCTVJY-UHFFFAOYSA-N 3-hydroxyoctadecan-2-one Chemical compound CCCCCCCCCCCCCCCC(O)C(C)=O MWKAGZWJHCTVJY-UHFFFAOYSA-N 0.000 claims description 6
- OAEGRYMCJYIXQT-UHFFFAOYSA-N dithiooxamide Chemical compound NC(=S)C(N)=S OAEGRYMCJYIXQT-UHFFFAOYSA-N 0.000 claims description 6
- 230000005670 electromagnetic radiation Effects 0.000 claims description 6
- 238000012546 transfer Methods 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000002091 cationic group Chemical group 0.000 claims description 5
- 230000001235 sensitizing effect Effects 0.000 claims description 5
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 4
- ZAMUDYFFFFHBNY-UHFFFAOYSA-N 10-diazonioanthracen-9-olate Chemical compound C1=CC=C2C([O-])=C(C=CC=C3)C3=C([N+]#N)C2=C1 ZAMUDYFFFFHBNY-UHFFFAOYSA-N 0.000 claims description 4
- GEOQDCBHAVUVST-UHFFFAOYSA-N 10-diazoniophenanthren-9-olate Chemical compound C1=CC=C2C([O-])=C([N+]#N)C3=CC=CC=C3C2=C1 GEOQDCBHAVUVST-UHFFFAOYSA-N 0.000 claims description 4
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 4
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 150000008365 aromatic ketones Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 150000007857 hydrazones Chemical class 0.000 claims description 4
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- XEVRDFDBXJMZFG-UHFFFAOYSA-N carbonyl dihydrazine Chemical compound NNC(=O)NN XEVRDFDBXJMZFG-UHFFFAOYSA-N 0.000 claims description 3
- JUPWRUDTZGBNEX-UHFFFAOYSA-N cobalt;pentane-2,4-dione Chemical group [Co].CC(=O)CC(C)=O.CC(=O)CC(C)=O.CC(=O)CC(C)=O JUPWRUDTZGBNEX-UHFFFAOYSA-N 0.000 claims description 3
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 claims description 3
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- YZERDTREOUSUHF-UHFFFAOYSA-N pentafluorobenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=C(F)C(F)=C1F YZERDTREOUSUHF-UHFFFAOYSA-N 0.000 claims description 3
- YPJUNDFVDDCYIH-UHFFFAOYSA-M 2,2,3,3,4,4,4-heptafluorobutanoate Chemical compound [O-]C(=O)C(F)(F)C(F)(F)C(F)(F)F YPJUNDFVDDCYIH-UHFFFAOYSA-M 0.000 claims description 2
- XETLOFNELZCXMX-UHFFFAOYSA-N 2-(diethylamino)ethyl 2-(4-hexoxyphenyl)-2-hydroxy-2-phenylacetate;hydrochloride Chemical compound Cl.C1=CC(OCCCCCC)=CC=C1C(O)(C(=O)OCCN(CC)CC)C1=CC=CC=C1 XETLOFNELZCXMX-UHFFFAOYSA-N 0.000 claims description 2
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 claims description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 2
- 239000002262 Schiff base Substances 0.000 claims description 2
- 150000004753 Schiff bases Chemical class 0.000 claims description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 claims description 2
- 229940089960 chloroacetate Drugs 0.000 claims description 2
- 235000001671 coumarin Nutrition 0.000 claims description 2
- 229940120124 dichloroacetate Drugs 0.000 claims description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 claims description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 claims description 2
- 229960001860 salicylate Drugs 0.000 claims description 2
- 229940066528 trichloroacetate Drugs 0.000 claims description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 2
- OAKYDTWNPFUACK-UHFFFAOYSA-N [Co+3].CC(C(=NO)C)=NO.CC(C(=NO)C)=NO Chemical compound [Co+3].CC(C(=NO)C)=NO.CC(C(=NO)C)=NO OAKYDTWNPFUACK-UHFFFAOYSA-N 0.000 claims 1
- CPONZVKCUOQCHY-UHFFFAOYSA-N [Co+3].N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 Chemical compound [Co+3].N1=C(C=CC=C1)C1=NC=CC=C1.N1=C(C=CC=C1)C1=NC=CC=C1 CPONZVKCUOQCHY-UHFFFAOYSA-N 0.000 claims 1
- 125000005263 alkylenediamine group Chemical group 0.000 claims 1
- ANVHTOSCMIQEGM-UHFFFAOYSA-N cobalt(3+) prop-1-ene Chemical compound [Co+3].C=CC.C=CC.C=CC ANVHTOSCMIQEGM-UHFFFAOYSA-N 0.000 claims 1
- FJXJVMWVCUOBJK-UHFFFAOYSA-N cobalt(3+) prop-1-ene Chemical compound [Co+3].C=CC.C=CC FJXJVMWVCUOBJK-UHFFFAOYSA-N 0.000 claims 1
- JHBWUDJPQWKJHP-UHFFFAOYSA-N cobalt(3+);ethane-1,2-diamine Chemical compound [Co+3].NCCN.NCCN.NCCN JHBWUDJPQWKJHP-UHFFFAOYSA-N 0.000 claims 1
- OZKNLYINXCRJHF-UHFFFAOYSA-N cobalt(3+);ethane-1,2-diamine Chemical compound [Co+3].NCCN.NCCN OZKNLYINXCRJHF-UHFFFAOYSA-N 0.000 claims 1
- 229960000956 coumarin Drugs 0.000 claims 1
- 229940012017 ethylenediamine Drugs 0.000 claims 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 claims 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical group CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 claims 1
- 125000004151 quinonyl group Chemical group 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 abstract description 8
- 230000000977 initiatory effect Effects 0.000 abstract 1
- 239000010410 layer Substances 0.000 description 168
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 95
- 231100000489 sensitizer Toxicity 0.000 description 51
- 239000000243 solution Substances 0.000 description 41
- 238000006722 reduction reaction Methods 0.000 description 37
- 125000001424 substituent group Chemical group 0.000 description 36
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 28
- 239000003638 chemical reducing agent Substances 0.000 description 27
- 150000004053 quinones Chemical class 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- ZQDPJFUHLCOCRG-AATRIKPKSA-N trans-3-hexene Chemical compound CC\C=C\CC ZQDPJFUHLCOCRG-AATRIKPKSA-N 0.000 description 24
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 23
- 239000000203 mixture Substances 0.000 description 19
- NLMVLMCSXDIGSW-UHFFFAOYSA-N 2H-benzimidazole Chemical compound C1=CC=CC2=NCN=C21 NLMVLMCSXDIGSW-UHFFFAOYSA-N 0.000 description 15
- 239000000376 reactant Substances 0.000 description 14
- 238000000926 separation method Methods 0.000 description 14
- 229910052709 silver Inorganic materials 0.000 description 13
- 239000004332 silver Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 238000001228 spectrum Methods 0.000 description 12
- 238000012545 processing Methods 0.000 description 11
- 125000003003 spiro group Chemical group 0.000 description 11
- 229940005561 1,4-benzoquinone Drugs 0.000 description 10
- UPLMJIUMVHVVAB-UHFFFAOYSA-N 2-propan-2-yloxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OC(C)C)=CC(=O)C2=C1 UPLMJIUMVHVVAB-UHFFFAOYSA-N 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 230000033116 oxidation-reduction process Effects 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 8
- LLYOXZQVOKALCD-UHFFFAOYSA-N chembl1400298 Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=CC=N1 LLYOXZQVOKALCD-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 7
- 238000005259 measurement Methods 0.000 description 7
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 6
- 150000004697 chelate complex Chemical class 0.000 description 6
- GXWORUBZHJHIGI-UHFFFAOYSA-K cobalt(3+);triperchlorate Chemical compound [Co+3].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O GXWORUBZHJHIGI-UHFFFAOYSA-K 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- 238000010586 diagram Methods 0.000 description 6
- 230000006870 function Effects 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 6
- 125000005504 styryl group Chemical group 0.000 description 6
- LADPYGLMKGTIAA-UHFFFAOYSA-N 3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound C1=NCN2CC21 LADPYGLMKGTIAA-UHFFFAOYSA-N 0.000 description 5
- 244000028419 Styrax benzoin Species 0.000 description 5
- 235000000126 Styrax benzoin Nutrition 0.000 description 5
- 235000008411 Sumatra benzointree Nutrition 0.000 description 5
- 125000004104 aryloxy group Chemical group 0.000 description 5
- 229960002130 benzoin Drugs 0.000 description 5
- 229950011260 betanaphthol Drugs 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 238000011161 development Methods 0.000 description 5
- 230000018109 developmental process Effects 0.000 description 5
- 235000019382 gum benzoic Nutrition 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 229920000139 polyethylene terephthalate Polymers 0.000 description 5
- 239000005020 polyethylene terephthalate Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- 238000001429 visible spectrum Methods 0.000 description 5
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 4
- BTLZWDQILSWMQY-UHFFFAOYSA-N 2-[benzyl(ethyl)amino]-3-chloronaphthalene-1,4-dione Chemical compound ClC=1C(=O)C2=CC=CC=C2C(=O)C=1N(CC)CC1=CC=CC=C1 BTLZWDQILSWMQY-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229930192627 Naphthoquinone Natural products 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000003368 amide group Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- CIZVQWNPBGYCGK-UHFFFAOYSA-N benzenediazonium Chemical compound N#[N+]C1=CC=CC=C1 CIZVQWNPBGYCGK-UHFFFAOYSA-N 0.000 description 4
- 239000000298 carbocyanine Substances 0.000 description 4
- 239000002131 composite material Substances 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 230000001747 exhibiting effect Effects 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 239000011229 interlayer Substances 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 230000005012 migration Effects 0.000 description 4
- 238000013508 migration Methods 0.000 description 4
- 150000002791 naphthoquinones Chemical class 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- KRGINZFLXQKIQZ-UHFFFAOYSA-N 2-chloro-3-morpholin-4-ylnaphthalene-1,4-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C(Cl)=C1N1CCOCC1 KRGINZFLXQKIQZ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UJKPHYRXOLRVJJ-MLSVHJFASA-N CC(O)C1=C(C)/C2=C/C3=N/C(=C\C4=C(CCC(O)=O)C(C)=C(N4)/C=C4\N=C(\C=C\1/N\2)C(C)=C4C(C)O)/C(CCC(O)=O)=C3C Chemical compound CC(O)C1=C(C)/C2=C/C3=N/C(=C\C4=C(CCC(O)=O)C(C)=C(N4)/C=C4\N=C(\C=C\1/N\2)C(C)=C4C(C)O)/C(CCC(O)=O)=C3C UJKPHYRXOLRVJJ-MLSVHJFASA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 206010070834 Sensitisation Diseases 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- LBFUKZWYPLNNJC-UHFFFAOYSA-N cobalt(ii,iii) oxide Chemical compound [Co]=O.O=[Co]O[Co]=O LBFUKZWYPLNNJC-UHFFFAOYSA-N 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 229960003569 hematoporphyrin Drugs 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 3
- 150000002460 imidazoles Chemical class 0.000 description 3
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 238000007540 photo-reduction reaction Methods 0.000 description 3
- 238000006479 redox reaction Methods 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 230000008313 sensitization Effects 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- YFKBXYGUSOXJGS-UHFFFAOYSA-N 1,3-Diphenyl-2-propanone Chemical compound C=1C=CC=CC=1CC(=O)CC1=CC=CC=C1 YFKBXYGUSOXJGS-UHFFFAOYSA-N 0.000 description 2
- ZEGDFCCYTFPECB-UHFFFAOYSA-N 2,3-dimethoxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OC)=C(OC)C(=O)C2=C1 ZEGDFCCYTFPECB-UHFFFAOYSA-N 0.000 description 2
- MYKLQMNSFPAPLZ-UHFFFAOYSA-N 2,5-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C(C)=CC1=O MYKLQMNSFPAPLZ-UHFFFAOYSA-N 0.000 description 2
- OBGBGHKYJAOXRR-UHFFFAOYSA-N 2-methoxy-1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C(OC)=CC(=O)C2=C1 OBGBGHKYJAOXRR-UHFFFAOYSA-N 0.000 description 2
- NJWGQARXZDRHCD-UHFFFAOYSA-N 2-methylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(C)=CC=C3C(=O)C2=C1 NJWGQARXZDRHCD-UHFFFAOYSA-N 0.000 description 2
- VTWDKFNVVLAELH-UHFFFAOYSA-N 2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=CC1=O VTWDKFNVVLAELH-UHFFFAOYSA-N 0.000 description 2
- SYUYTOYKQOAVDW-UHFFFAOYSA-N 2-nitrosonaphthalen-1-ol Chemical class C1=CC=C2C(O)=C(N=O)C=CC2=C1 SYUYTOYKQOAVDW-UHFFFAOYSA-N 0.000 description 2
- RGCITEKHKXPDDH-UHFFFAOYSA-N 4-(diethylamino)benzenediazonium Chemical compound CCN(CC)C1=CC=C([N+]#N)C=C1 RGCITEKHKXPDDH-UHFFFAOYSA-N 0.000 description 2
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 229910021581 Cobalt(III) chloride Inorganic materials 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 241000257303 Hymenoptera Species 0.000 description 2
- MJVAVZPDRWSRRC-UHFFFAOYSA-N Menadione Chemical compound C1=CC=C2C(=O)C(C)=CC(=O)C2=C1 MJVAVZPDRWSRRC-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- RMMPZDDLWLALLJ-UHFFFAOYSA-N Thermophillin Chemical compound COC1=CC(=O)C(OC)=CC1=O RMMPZDDLWLALLJ-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 2
- 125000005248 alkyl aryloxy group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 2
- QSQUFRGBXGXOHF-UHFFFAOYSA-N cobalt(iii) nitrate Chemical compound [Co].O[N+]([O-])=O.O[N+]([O-])=O.O[N+]([O-])=O QSQUFRGBXGXOHF-UHFFFAOYSA-N 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 125000004986 diarylamino group Chemical group 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical compound O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 2
- 230000005281 excited state Effects 0.000 description 2
- 238000007687 exposure technique Methods 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 2
- 150000002466 imines Chemical group 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229940056932 lead sulfide Drugs 0.000 description 2
- 229910052981 lead sulfide Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- NLWXVDTUBBMEAL-UHFFFAOYSA-N n'-amino-n-phenyliminomethanimidamide Chemical compound NN=CN=NC1=CC=CC=C1 NLWXVDTUBBMEAL-UHFFFAOYSA-N 0.000 description 2
- 150000002916 oxazoles Chemical class 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 239000011941 photocatalyst Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical compound C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 2
- 230000011514 reflex Effects 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- OGFYIDCVDSATDC-UHFFFAOYSA-N silver silver Chemical compound [Ag].[Ag] OGFYIDCVDSATDC-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229920003048 styrene butadiene rubber Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004964 sulfoalkyl group Chemical group 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 229920001059 synthetic polymer Polymers 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DVDTXNZWCZVVFL-UHFFFAOYSA-N (1'-methylspiro[benzimidazole-2,2'-cyclohexane]-1'-yl)-spiro[benzimidazole-2,2'-cyclohexane]-1'-yldiazene Chemical compound CC1(CCCCC12N=C1C(=N2)C=CC=C1)N=NC1CCCCC12N=C1C(=N2)C=CC=C1 DVDTXNZWCZVVFL-UHFFFAOYSA-N 0.000 description 1
- FHBXQJDYHHJCIF-UHFFFAOYSA-N (2,3-diaminophenyl)-phenylmethanone Chemical compound NC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1N FHBXQJDYHHJCIF-UHFFFAOYSA-N 0.000 description 1
- RNKOUSCCPHSCFE-UHFFFAOYSA-N (2,4-dimethoxyphenyl)methanol Chemical compound COC1=CC=C(CO)C(OC)=C1 RNKOUSCCPHSCFE-UHFFFAOYSA-N 0.000 description 1
- UJHSIDUUJPTLDY-UHFFFAOYSA-N (2-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 UJHSIDUUJPTLDY-UHFFFAOYSA-N 0.000 description 1
- CHEANNSDVJOIBS-MHZLTWQESA-N (3s)-3-cyclopropyl-3-[3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]propanoic acid Chemical compound COC1=CC=C(F)C(C=2C(=CC(COC=3C=C(C=CC=3)[C@@H](CC(O)=O)C3CC3)=CC=2)C=2C(CCC=2)(C)C)=C1 CHEANNSDVJOIBS-MHZLTWQESA-N 0.000 description 1
- AGBQKNBQESQNJD-SSDOTTSWSA-N (R)-lipoic acid Chemical compound OC(=O)CCCC[C@@H]1CCSS1 AGBQKNBQESQNJD-SSDOTTSWSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OIEBJDKBJBREGC-UHFFFAOYSA-N 1,3-bis[1-(2-bromophenoxy)cyclohexa-2,4-dien-1-yl]-1,3-diphenylpropan-2-one Chemical compound BrC1=CC=CC=C1OC1(C(C(=O)C(C=2C=CC=CC=2)C2(C=CC=CC2)OC=2C(=CC=CC=2)Br)C=2C=CC=CC=2)C=CC=CC1 OIEBJDKBJBREGC-UHFFFAOYSA-N 0.000 description 1
- XFWJCBLRUVFUAF-UHFFFAOYSA-N 1,3-bis[1-(2-chlorophenoxy)cyclohexa-2,4-dien-1-yl]-1,3-diphenylpropan-2-one Chemical compound ClC1=CC=CC=C1OC1(C(C(=O)C(C=2C=CC=CC=2)C2(C=CC=CC2)OC=2C(=CC=CC=2)Cl)C=2C=CC=CC=2)C=CC=CC1 XFWJCBLRUVFUAF-UHFFFAOYSA-N 0.000 description 1
- VNNAMLWXHXFIRE-UHFFFAOYSA-N 1,3-bis[1-(2-iodophenoxy)cyclohexa-2,4-dien-1-yl]-1,3-diphenylpropan-2-one Chemical compound IC1=CC=CC=C1OC1(C(C(=O)C(C=2C=CC=CC=2)C2(C=CC=CC2)OC=2C(=CC=CC=2)I)C=2C=CC=CC=2)C=CC=CC1 VNNAMLWXHXFIRE-UHFFFAOYSA-N 0.000 description 1
- HKNVETRDKRLOIJ-UHFFFAOYSA-N 1,3-bis[1-(4-benzoylphenoxy)cyclohexa-2,4-dien-1-yl]-1,3-diphenylpropan-2-one Chemical compound C=1C=CC=CC=1C(C1(C=CC=CC1)OC=1C=CC(=CC=1)C(=O)C=1C=CC=CC=1)C(=O)C(C1(C=CC=CC1)OC=1C=CC(=CC=1)C(=O)C=1C=CC=CC=1)C1=CC=CC=C1 HKNVETRDKRLOIJ-UHFFFAOYSA-N 0.000 description 1
- 150000004057 1,4-benzoquinones Chemical class 0.000 description 1
- NXFVJTJWPUVTKK-UHFFFAOYSA-N 1-(1,3-benzothiazol-2-yldiazenyl)naphthalen-2-ol Chemical compound C1=CC=C2SC(N=NC3=C4C=CC=CC4=CC=C3O)=NC2=C1 NXFVJTJWPUVTKK-UHFFFAOYSA-N 0.000 description 1
- HOCMRGMKKFPXRF-UHFFFAOYSA-N 1-(2-butylphenyl)-2-hydroxy-2-phenylethanone Chemical compound CCCCC1=CC=CC=C1C(=O)C(O)C1=CC=CC=C1 HOCMRGMKKFPXRF-UHFFFAOYSA-N 0.000 description 1
- NGPIXUMCFRMCCS-UHFFFAOYSA-N 1-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)ethyl acetate Chemical compound CC(=O)OC(C)C1=CC(=O)C(C)=CC1=O NGPIXUMCFRMCCS-UHFFFAOYSA-N 0.000 description 1
- WPOCOWWFTUACRB-UHFFFAOYSA-N 1-(quinolin-2-yldiazenyl)naphthalen-2-ol Chemical compound N1=C(C=CC2=CC=CC=C12)N=NC1=C(C=CC2=CC=CC=C12)O WPOCOWWFTUACRB-UHFFFAOYSA-N 0.000 description 1
- XEYHAEIBVFRPQO-UHFFFAOYSA-N 1-[(4-nitro-1,3-thiazol-2-yl)diazenyl]naphthalen-2-ol Chemical compound [N+](=O)([O-])C=1N=C(SC1)N=NC1=C(C=CC2=CC=CC=C12)O XEYHAEIBVFRPQO-UHFFFAOYSA-N 0.000 description 1
- JQBCNOTZIWAYSD-UHFFFAOYSA-N 1-amino-3-[(1-hydroxynaphthalen-2-yl)amino]urea Chemical compound C1=CC=CC2=C(O)C(NNC(=O)NN)=CC=C21 JQBCNOTZIWAYSD-UHFFFAOYSA-N 0.000 description 1
- NZOBMSHKTMROJO-UHFFFAOYSA-N 1-azido-4-methoxynaphthalene Chemical compound C1=CC=C2C(OC)=CC=C(N=[N+]=[N-])C2=C1 NZOBMSHKTMROJO-UHFFFAOYSA-N 0.000 description 1
- YXAOOTNFFAQIPZ-UHFFFAOYSA-N 1-nitrosonaphthalen-2-ol Chemical compound C1=CC=CC2=C(N=O)C(O)=CC=C21 YXAOOTNFFAQIPZ-UHFFFAOYSA-N 0.000 description 1
- AXFPFXFXERAMCB-UHFFFAOYSA-N 10-diazonio-2,7-diethylanthracen-9-olate Chemical compound C1=CC(CC)=CC2=C([O-])C3=CC(CC)=CC=C3C([N+]#N)=C21 AXFPFXFXERAMCB-UHFFFAOYSA-N 0.000 description 1
- JIFMCYCZWZODJM-UHFFFAOYSA-N 10-diazonio-2-methoxyanthracen-9-olate Chemical compound C1=CC=CC2=C([O-])C3=CC(OC)=CC=C3C([N+]#N)=C21 JIFMCYCZWZODJM-UHFFFAOYSA-N 0.000 description 1
- XHUWBKGTFFJHHL-UHFFFAOYSA-N 10-diazonio-3,6-diethoxyanthracen-9-olate Chemical compound C1=CC(OCC)=CC2=C([N+]#N)C3=CC(OCC)=CC=C3C([O-])=C21 XHUWBKGTFFJHHL-UHFFFAOYSA-N 0.000 description 1
- VPMJHZSEUPTNGM-UHFFFAOYSA-N 10-diazonio-3-nitroanthracen-9-olate Chemical compound [O-][N+](=O)C1=CC=C2C([O-])=C(C=CC=C3)C3=C([N+]#N)C2=C1 VPMJHZSEUPTNGM-UHFFFAOYSA-N 0.000 description 1
- QHNYWTUUYUBSLR-UHFFFAOYSA-N 10-diazonio-4-ethoxyanthracen-9-olate Chemical compound C1=CC=C2C([N+]#N)=C3C(OCC)=CC=CC3=C([O-])C2=C1 QHNYWTUUYUBSLR-UHFFFAOYSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- IRQBBEVABNBDJI-UHFFFAOYSA-N 2,2-dimethyl-5-(2-phenylethenyl)benzimidazole Chemical compound C=1C2=NC(C)(C)N=C2C=CC=1C=CC1=CC=CC=C1 IRQBBEVABNBDJI-UHFFFAOYSA-N 0.000 description 1
- HGXRNTGVJFDQTP-UHFFFAOYSA-N 2,2-dimethylbenzimidazol-4-amine Chemical compound C1=CC=C(N)C2=NC(C)(C)N=C21 HGXRNTGVJFDQTP-UHFFFAOYSA-N 0.000 description 1
- CDILYTPEQRPZEX-UHFFFAOYSA-N 2,2-dimethylbenzimidazole Chemical compound C1=CC=CC2=NC(C)(C)N=C21 CDILYTPEQRPZEX-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- LOSRWHPOKIAAJH-UHFFFAOYSA-N 2,3-diethoxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCC)=C(OCC)C(=O)C2=C1 LOSRWHPOKIAAJH-UHFFFAOYSA-N 0.000 description 1
- LGFDNUSAWCHVJN-UHFFFAOYSA-N 2,3-dimethyl-1,4-naphthoquinone Chemical compound C1=CC=C2C(=O)C(C)=C(C)C(=O)C2=C1 LGFDNUSAWCHVJN-UHFFFAOYSA-N 0.000 description 1
- GYTWZWMAZNKVQZ-UHFFFAOYSA-N 2,4,6-triphenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound C1=CC=CC=C1C1N2C1C(C=1C=CC=CC=1)=NC2C1=CC=CC=C1 GYTWZWMAZNKVQZ-UHFFFAOYSA-N 0.000 description 1
- AVXHBWXWHRKOOR-UHFFFAOYSA-N 2,5-bis(2-phenylethoxy)cyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=C(OCCC=2C=CC=CC=2)C(=O)C=C1OCCC1=CC=CC=C1 AVXHBWXWHRKOOR-UHFFFAOYSA-N 0.000 description 1
- BZZIJKWURTYMLH-UHFFFAOYSA-N 2,5-bis(dimethylamino)cyclohexa-2,5-diene-1,4-dione Chemical compound CN(C)C1=CC(=O)C(N(C)C)=CC1=O BZZIJKWURTYMLH-UHFFFAOYSA-N 0.000 description 1
- VADOYCRIDMQKBQ-UHFFFAOYSA-N 2,5-di(butan-2-yloxy)cyclohexa-2,5-diene-1,4-dione Chemical compound CCC(C)OC1=CC(=O)C(OC(C)CC)=CC1=O VADOYCRIDMQKBQ-UHFFFAOYSA-N 0.000 description 1
- XMTVIMLHAWZAAB-UHFFFAOYSA-N 2,5-diethoxycyclohexa-2,5-diene-1,4-dione Chemical compound CCOC1=CC(=O)C(OCC)=CC1=O XMTVIMLHAWZAAB-UHFFFAOYSA-N 0.000 description 1
- OLBNOBQOQZRLMP-UHFFFAOYSA-N 2,6-dimethoxy-p-benzoquinone Chemical compound COC1=CC(=O)C=C(OC)C1=O OLBNOBQOQZRLMP-UHFFFAOYSA-N 0.000 description 1
- SENUUPBBLQWHMF-UHFFFAOYSA-N 2,6-dimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=C(C)C1=O SENUUPBBLQWHMF-UHFFFAOYSA-N 0.000 description 1
- CASHWAGXBJSQDV-UHFFFAOYSA-N 2-(1,3,5-triazin-2-yl)-1,3,5-triazine Chemical group C1=NC=NC(C=2N=CN=CN=2)=N1 CASHWAGXBJSQDV-UHFFFAOYSA-N 0.000 description 1
- HFWAVOVTZUVEJZ-UHFFFAOYSA-N 2-(1-hydroxy-2-methylpropan-2-yl)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(C(C)(CO)C)=CC(=O)C2=C1 HFWAVOVTZUVEJZ-UHFFFAOYSA-N 0.000 description 1
- KCQOHPNVNBHQFX-UHFFFAOYSA-N 2-(1-methoxycyclohexa-2,4-dien-1-yl)-1-phenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1(OC)CC=CC=C1 KCQOHPNVNBHQFX-UHFFFAOYSA-N 0.000 description 1
- GQTXVVHSRZQTNX-UHFFFAOYSA-N 2-(2,2-dimethylpropoxy)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCC(C)(C)C)=CC(=O)C2=C1 GQTXVVHSRZQTNX-UHFFFAOYSA-N 0.000 description 1
- FDSRQPQNVGTEED-UHFFFAOYSA-N 2-(2-chlorophenoxy)-1,2-diphenylethanone Chemical compound ClC1=CC=CC=C1OC(C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 FDSRQPQNVGTEED-UHFFFAOYSA-N 0.000 description 1
- MGFPPVRYBHPUDB-UHFFFAOYSA-N 2-(2-ethoxyethoxy)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCOCC)=CC(=O)C2=C1 MGFPPVRYBHPUDB-UHFFFAOYSA-N 0.000 description 1
- CJAYFZCIFCQFBQ-UHFFFAOYSA-N 2-(2-hydroxyethyl)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(CCO)=CC(=O)C2=C1 CJAYFZCIFCQFBQ-UHFFFAOYSA-N 0.000 description 1
- FCPJPRROGZMUBG-UHFFFAOYSA-N 2-(2-iodophenoxy)-1,2-diphenylethanone Chemical compound IC1=CC=CC=C1OC(C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 FCPJPRROGZMUBG-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NQDSKRXTNMFZBV-UHFFFAOYSA-N 2-(2-methoxyethoxy)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCOC)=CC(=O)C2=C1 NQDSKRXTNMFZBV-UHFFFAOYSA-N 0.000 description 1
- BIEFDNUEROKZRA-UHFFFAOYSA-N 2-(2-phenylethenyl)aniline Chemical class NC1=CC=CC=C1C=CC1=CC=CC=C1 BIEFDNUEROKZRA-UHFFFAOYSA-N 0.000 description 1
- UAPFWAVFGCFPHR-UHFFFAOYSA-N 2-(2-phenylethoxy)naphthalene-1,4-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C=C1OCCC1=CC=CC=C1 UAPFWAVFGCFPHR-UHFFFAOYSA-N 0.000 description 1
- QWZCNRMOGTXXPE-UHFFFAOYSA-N 2-(3-hydroxypropoxy)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCCO)=CC(=O)C2=C1 QWZCNRMOGTXXPE-UHFFFAOYSA-N 0.000 description 1
- HQCFMRCRHYBMTQ-UHFFFAOYSA-N 2-(3-oxo-3-phenylpropyl)naphthalene-1,4-dione Chemical compound C=1C(=O)C2=CC=CC=C2C(=O)C=1CCC(=O)C1=CC=CC=C1 HQCFMRCRHYBMTQ-UHFFFAOYSA-N 0.000 description 1
- VFQIOURDCYJEAE-UHFFFAOYSA-N 2-(4-chlorophenoxy)-1,2-diphenylethanone Chemical compound C1=CC(Cl)=CC=C1OC(C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 VFQIOURDCYJEAE-UHFFFAOYSA-N 0.000 description 1
- XOGZNQPRFWQATP-UHFFFAOYSA-N 2-(benzhydryldisulfanyl)naphthalene Chemical compound C=1C=C2C=CC=CC2=CC=1SSC(C=1C=CC=CC=1)C1=CC=CC=C1 XOGZNQPRFWQATP-UHFFFAOYSA-N 0.000 description 1
- SIEUOSAKMGHHNX-UHFFFAOYSA-N 2-(cyclohexyldisulfanyl)naphthalene Chemical compound C1CCCCC1SSC1=CC=C(C=CC=C2)C2=C1 SIEUOSAKMGHHNX-UHFFFAOYSA-N 0.000 description 1
- YWEDSYCFWBEXBJ-UHFFFAOYSA-N 2-(diethylamino)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(N(CC)CC)=CC(=O)C2=C1 YWEDSYCFWBEXBJ-UHFFFAOYSA-N 0.000 description 1
- UILUHPCHRFOCEL-UHFFFAOYSA-N 2-(hydroxymethyl)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(CO)=CC(=O)C2=C1 UILUHPCHRFOCEL-UHFFFAOYSA-N 0.000 description 1
- DJPNTZRSUQLFAJ-UHFFFAOYSA-N 2-(methoxymethyl)-3-methylnaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(COC)=C(C)C(=O)C2=C1 DJPNTZRSUQLFAJ-UHFFFAOYSA-N 0.000 description 1
- IOFKWLKLPZWWSO-UHFFFAOYSA-N 2-(phenoxymethyl)naphthalene-1,4-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C=C1COC1=CC=CC=C1 IOFKWLKLPZWWSO-UHFFFAOYSA-N 0.000 description 1
- VIYPWBASJNQKAR-UHFFFAOYSA-N 2-azido-N-octylbenzimidazole-1-carboxamide Chemical compound N(=[N+]=[N-])C1=NC2=C(N1C(NCCCCCCCC)=O)C=CC=C2 VIYPWBASJNQKAR-UHFFFAOYSA-N 0.000 description 1
- UQZZWESEBPBPNN-UHFFFAOYSA-N 2-benzhydryloxynaphthalene-1,4-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C=C1OC(C=1C=CC=CC=1)C1=CC=CC=C1 UQZZWESEBPBPNN-UHFFFAOYSA-N 0.000 description 1
- KOODOYDFZRYOFG-UHFFFAOYSA-N 2-butan-2-yloxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OC(C)CC)=CC(=O)C2=C1 KOODOYDFZRYOFG-UHFFFAOYSA-N 0.000 description 1
- BATAHUJPPGPXIN-UHFFFAOYSA-N 2-butoxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCCC)=CC(=O)C2=C1 BATAHUJPPGPXIN-UHFFFAOYSA-N 0.000 description 1
- JBESNJFQKCIVMU-UHFFFAOYSA-K 2-carboxyphenolate;cobalt(3+);ethane-1,2-diamine Chemical compound [Co+3].NCCN.NCCN.NCCN.OC(=O)C1=CC=CC=C1[O-].OC(=O)C1=CC=CC=C1[O-].OC(=O)C1=CC=CC=C1[O-] JBESNJFQKCIVMU-UHFFFAOYSA-K 0.000 description 1
- VLXXHHDKQNJEEP-UHFFFAOYSA-N 2-chloro-3-(2-hydroxyethoxy)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCO)=C(Cl)C(=O)C2=C1 VLXXHHDKQNJEEP-UHFFFAOYSA-N 0.000 description 1
- XUGFUJGRYIVAFD-UHFFFAOYSA-N 2-chloro-3-(diethylamino)naphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(N(CC)CC)=C(Cl)C(=O)C2=C1 XUGFUJGRYIVAFD-UHFFFAOYSA-N 0.000 description 1
- YLULGOCHLLLHOM-UHFFFAOYSA-N 2-chloro-3-ethoxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCC)=C(Cl)C(=O)C2=C1 YLULGOCHLLLHOM-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- IASDWFLLCNCUHL-UHFFFAOYSA-N 2-ethoxy-3-methylnaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCC)=C(C)C(=O)C2=C1 IASDWFLLCNCUHL-UHFFFAOYSA-N 0.000 description 1
- NCGAYLKFEUZNAW-UHFFFAOYSA-N 2-ethoxy-5-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C(OCC)=CC(=O)C(C=2C=CC=CC=2)=C1 NCGAYLKFEUZNAW-UHFFFAOYSA-N 0.000 description 1
- MEYARNKYUHUVBB-UHFFFAOYSA-N 2-hydroxy-1-[2-(hydroxymethyl)phenyl]-2-phenylethanone Chemical compound OCC1=CC=CC=C1C(=O)C(O)C1=CC=CC=C1 MEYARNKYUHUVBB-UHFFFAOYSA-N 0.000 description 1
- OLVMPQNPFWQNTC-UHFFFAOYSA-N 2-hydroxy-2-phenyl-1-(2-phenylphenyl)ethanone Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1C1=CC=CC=C1 OLVMPQNPFWQNTC-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- VHKLZNVZXIRBCW-UHFFFAOYSA-N 2-pentoxynaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(OCCCCC)=CC(=O)C2=C1 VHKLZNVZXIRBCW-UHFFFAOYSA-N 0.000 description 1
- AXYQEGMSGMXGGK-UHFFFAOYSA-N 2-phenoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)C(C=1C=CC=CC=1)OC1=CC=CC=C1 AXYQEGMSGMXGGK-UHFFFAOYSA-N 0.000 description 1
- AUOCBDYQSBVTEM-UHFFFAOYSA-N 2-phenyl-5-propoxycyclohexa-2,5-diene-1,4-dione Chemical compound C(CC)OC=1C(C=C(C(C1)=O)C1=CC=CC=C1)=O AUOCBDYQSBVTEM-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- LGLAFLFRMBHOKX-UHFFFAOYSA-N 2-pyrrolidin-1-ylnaphthalene-1,4-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C=C1N1CCCC1 LGLAFLFRMBHOKX-UHFFFAOYSA-N 0.000 description 1
- UGWULZWUXSCWPX-UHFFFAOYSA-N 2-sulfanylideneimidazolidin-4-one Chemical compound O=C1CNC(=S)N1 UGWULZWUXSCWPX-UHFFFAOYSA-N 0.000 description 1
- GSSXLFACIJSBOM-UHFFFAOYSA-N 2h-pyran-2-ol Chemical compound OC1OC=CC=C1 GSSXLFACIJSBOM-UHFFFAOYSA-N 0.000 description 1
- OALHHIHQOFIMEF-UHFFFAOYSA-N 3',6'-dihydroxy-2',4',5',7'-tetraiodo-3h-spiro[2-benzofuran-1,9'-xanthene]-3-one Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(I)=C(O)C(I)=C1OC1=C(I)C(O)=C(I)C=C21 OALHHIHQOFIMEF-UHFFFAOYSA-N 0.000 description 1
- WUBNJKMFYXGQDB-UHFFFAOYSA-N 3,3-diphenyl-2-benzofuran-1-one Chemical compound C12=CC=CC=C2C(=O)OC1(C=1C=CC=CC=1)C1=CC=CC=C1 WUBNJKMFYXGQDB-UHFFFAOYSA-N 0.000 description 1
- NJXWZWXCHBNOOG-UHFFFAOYSA-N 3,3-diphenylpropyl(1-phenylethyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C(C)[NH2+]CCC(C=1C=CC=CC=1)C1=CC=CC=C1 NJXWZWXCHBNOOG-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- KTLVPQKXDIWMKO-UHFFFAOYSA-N 3-(1,4-dioxonaphthalen-2-yl)butanal Chemical compound C1=CC=C2C(=O)C(C(CC=O)C)=CC(=O)C2=C1 KTLVPQKXDIWMKO-UHFFFAOYSA-N 0.000 description 1
- CNKKGOQJYINHLK-UHFFFAOYSA-N 3-chloro-10-diazonioanthracen-9-olate Chemical compound ClC1=CC=C2C([O-])=C(C=CC=C3)C3=C([N+]#N)C2=C1 CNKKGOQJYINHLK-UHFFFAOYSA-N 0.000 description 1
- NDZUMKRLIPIEQP-UHFFFAOYSA-N 4,10-dihydroxyperylene-3,9-dione Chemical compound C1=CC2=C(C=CC3=O)C4C3=C(O)C=CC4C(C=CC3=O)=C2C3=C1O NDZUMKRLIPIEQP-UHFFFAOYSA-N 0.000 description 1
- NSRJQSRSBJWJCT-UHFFFAOYSA-N 4,4-diethyl-6-(3-nitrophenyl)-2-phenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound N12C(CC)(CC)N=C(C=3C=CC=CC=3)C2C1C1=CC=CC([N+]([O-])=O)=C1 NSRJQSRSBJWJCT-UHFFFAOYSA-N 0.000 description 1
- ZURRJBURTJNBNL-UHFFFAOYSA-N 4,4-dimethyl-6-(4-nitrophenyl)-2-phenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound N12C(C)(C)N=C(C=3C=CC=CC=3)C2C1C1=CC=C([N+]([O-])=O)C=C1 ZURRJBURTJNBNL-UHFFFAOYSA-N 0.000 description 1
- JSKHHLYGQWQJOX-UHFFFAOYSA-N 4,6-diphenyl-3,5-diazabicyclo[3.1.0]hex-2-ene-2-carbonitrile Chemical compound N#CC1=NC(C=2C=CC=CC=2)N2C1C2C1=CC=CC=C1 JSKHHLYGQWQJOX-UHFFFAOYSA-N 0.000 description 1
- MOXBCYIWIODTKI-UHFFFAOYSA-N 4-(dimethylamino)benzenediazonium Chemical compound CN(C)C1=CC=C([N+]#N)C=C1 MOXBCYIWIODTKI-UHFFFAOYSA-N 0.000 description 1
- VWDLPATYDZFCES-UHFFFAOYSA-N 4-[4-[(2,4-dinitrophenyl)methylidene]quinolin-1-yl]butane-1-sulfonic acid Chemical compound C12=CC=CC=C2N(CCCCS(=O)(=O)O)C=CC1=CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O VWDLPATYDZFCES-UHFFFAOYSA-N 0.000 description 1
- BKQJWJKRVJLLFK-UHFFFAOYSA-N 4-azido-n,n-dimethylaniline Chemical compound CN(C)C1=CC=C(N=[N+]=[N-])C=C1 BKQJWJKRVJLLFK-UHFFFAOYSA-N 0.000 description 1
- PQXPAFTXDVNANI-UHFFFAOYSA-N 4-azidobenzoic acid Chemical compound OC(=O)C1=CC=C(N=[N+]=[N-])C=C1 PQXPAFTXDVNANI-UHFFFAOYSA-N 0.000 description 1
- XYRPKGFSPDOTHW-UHFFFAOYSA-N 4-bromo-2,2-dimethylbenzimidazole Chemical compound C1=CC=C(Br)C2=NC(C)(C)N=C21 XYRPKGFSPDOTHW-UHFFFAOYSA-N 0.000 description 1
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical compound ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 1
- YKCXLAAZDYZWSN-UHFFFAOYSA-N 4-cyano-n'-(2-methylanilino)-n-pyridin-2-yliminobenzenecarboximidamide Chemical compound CC1=CC=CC=C1NN=C(C=1C=CC(=CC=1)C#N)N=NC1=CC=CC=N1 YKCXLAAZDYZWSN-UHFFFAOYSA-N 0.000 description 1
- NDWREMQQKBXOCP-UHFFFAOYSA-N 4-ethenyl-2,2-dimethylbenzimidazole Chemical compound C1=CC=C(C=C)C2=NC(C)(C)N=C21 NDWREMQQKBXOCP-UHFFFAOYSA-N 0.000 description 1
- DHLYOGJWFTWNJX-UHFFFAOYSA-N 4-fluorospiro[benzimidazole-2,1'-cyclohexane] Chemical compound N1=C2C(F)=CC=CC2=NC21CCCCC2 DHLYOGJWFTWNJX-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- UDYXBGRPILRBKA-UHFFFAOYSA-N 4-methoxy-2-nitrosophenol Chemical compound COC1=CC=C(O)C(N=O)=C1 UDYXBGRPILRBKA-UHFFFAOYSA-N 0.000 description 1
- ISUZSEZPBMLKRZ-UHFFFAOYSA-N 4-methyl-6-(4-nitrophenyl)-2-phenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound N12C(C)N=C(C=3C=CC=CC=3)C2C1C1=CC=C([N+]([O-])=O)C=C1 ISUZSEZPBMLKRZ-UHFFFAOYSA-N 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- BJBGAAAJTDQABC-UHFFFAOYSA-N 4-nitrosobenzene-1,3-diol Chemical compound OC1=CC=C(N=O)C(O)=C1 BJBGAAAJTDQABC-UHFFFAOYSA-N 0.000 description 1
- JFRVSVBXJQBLLT-UHFFFAOYSA-N 4-spiro[benzimidazole-2,2'-cyclohexane]-1'-ylmorpholine Chemical compound C1CCCC2(N=C3C=CC=CC3=N2)C1N1CCOCC1 JFRVSVBXJQBLLT-UHFFFAOYSA-N 0.000 description 1
- JDBGXEHEIRGOBU-UHFFFAOYSA-N 5-hydroxymethyluracil Chemical compound OCC1=CNC(=O)NC1=O JDBGXEHEIRGOBU-UHFFFAOYSA-N 0.000 description 1
- DDXAFERTPIQUDQ-UHFFFAOYSA-N 5-methoxyspiro[benzimidazole-2,1'-cyclohexane] Chemical compound N1=C2C=C(OC)C=CC2=NC21CCCCC2 DDXAFERTPIQUDQ-UHFFFAOYSA-N 0.000 description 1
- MVHKZWGRJVGWSA-UHFFFAOYSA-N 5-nitro-2,2-diphenylbenzimidazole Chemical compound N1=C2C=C([N+](=O)[O-])C=CC2=NC1(C=1C=CC=CC=1)C1=CC=CC=C1 MVHKZWGRJVGWSA-UHFFFAOYSA-N 0.000 description 1
- KNRUPYBRVSGVAW-UHFFFAOYSA-N 6-(4-chlorophenyl)-4,4-dimethyl-2-phenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound N12C(C)(C)N=C(C=3C=CC=CC=3)C2C1C1=CC=C(Cl)C=C1 KNRUPYBRVSGVAW-UHFFFAOYSA-N 0.000 description 1
- MMPJPLZUJANSCC-UHFFFAOYSA-N 6-(4-nitrophenyl)-2,4-diphenyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1N2C1C(C=1C=CC=CC=1)=NC2C1=CC=CC=C1 MMPJPLZUJANSCC-UHFFFAOYSA-N 0.000 description 1
- BUDPWQYXDVEPCV-UHFFFAOYSA-N 6-(4-nitrophenyl)-2-phenyl-4-propyl-3,5-diazabicyclo[3.1.0]hex-2-ene Chemical compound N12C(CCC)N=C(C=3C=CC=CC=3)C2C1C1=CC=C([N+]([O-])=O)C=C1 BUDPWQYXDVEPCV-UHFFFAOYSA-N 0.000 description 1
- 229940076442 9,10-anthraquinone Drugs 0.000 description 1
- FJAJUGDABJTHAR-UHFFFAOYSA-N 9-(anthracen-9-yldisulfanyl)anthracene Chemical compound C1=CC=C2C(SSC=3C4=CC=CC=C4C=C4C=CC=CC4=3)=C(C=CC=C3)C3=CC2=C1 FJAJUGDABJTHAR-UHFFFAOYSA-N 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- FHVGJMWIRCCASK-UHFFFAOYSA-N C1(=CC=CC=C1)N=NC(=NNC1=NC2=CC=CC=C2C=C1)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)N=NC(=NNC1=NC2=CC=CC=C2C=C1)C1=CC=CC=C1 FHVGJMWIRCCASK-UHFFFAOYSA-N 0.000 description 1
- UVLMYMPXBDVTCH-UHFFFAOYSA-N C1(=CC=CC=C1)N=NC(=NNC=1SC2=C(N1)C=CC=C2)C2=CC(=CC=C2)Cl Chemical compound C1(=CC=CC=C1)N=NC(=NNC=1SC2=C(N1)C=CC=C2)C2=CC(=CC=C2)Cl UVLMYMPXBDVTCH-UHFFFAOYSA-N 0.000 description 1
- WYVPQXUKAWCQMU-UHFFFAOYSA-N C=1C=CC=NC=1NN=C(C=1C=CC=CC=1)N=NC1=CC=CC=C1 Chemical compound C=1C=CC=NC=1NN=C(C=1C=CC=CC=1)N=NC1=CC=CC=C1 WYVPQXUKAWCQMU-UHFFFAOYSA-N 0.000 description 1
- MHQVDTOIELKRGC-UHFFFAOYSA-N CC1=C(C=C(C=C1)C)N=NC(=NNC1=NC=CC=C1)C1=CC=CC=C1 Chemical compound CC1=C(C=C(C=C1)C)N=NC(=NNC1=NC=CC=C1)C1=CC=CC=C1 MHQVDTOIELKRGC-UHFFFAOYSA-N 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 241000040710 Chela Species 0.000 description 1
- YFQLSRBMSCFGEA-UHFFFAOYSA-K ClC(C(=O)[O-])(Cl)Cl.[Co+3].N1=CC=CC=C1.N1=CC=CC=C1.CC(C(=NO)C)=NO.CC(C(=NO)C)=NO.ClC(C(=O)[O-])(Cl)Cl.ClC(C(=O)[O-])(Cl)Cl Chemical compound ClC(C(=O)[O-])(Cl)Cl.[Co+3].N1=CC=CC=C1.N1=CC=CC=C1.CC(C(=NO)C)=NO.CC(C(=NO)C)=NO.ClC(C(=O)[O-])(Cl)Cl.ClC(C(=O)[O-])(Cl)Cl YFQLSRBMSCFGEA-UHFFFAOYSA-K 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 101100285518 Drosophila melanogaster how gene Proteins 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- BBPQOYAMHKZXSB-UHFFFAOYSA-N FC1=C(C=CC=C1)NN=CN=N Chemical compound FC1=C(C=CC=C1)NN=CN=N BBPQOYAMHKZXSB-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 1
- 101000713585 Homo sapiens Tubulin beta-4A chain Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical group 0.000 description 1
- XTRXBOSGRMJASM-UHFFFAOYSA-N N1=NN=C(C=C1)NC(=C(C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O)NC1=NN=NC=C1)C1=CC=CC=C1 Chemical class N1=NN=C(C=C1)NC(=C(C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O)NC1=NN=NC=C1)C1=CC=CC=C1 XTRXBOSGRMJASM-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- MRPVPDQWBANSLA-UHFFFAOYSA-L S(C#N)[Co+]SC#N.C(CN)N.C(CN)N Chemical compound S(C#N)[Co+]SC#N.C(CN)N.C(CN)N MRPVPDQWBANSLA-UHFFFAOYSA-L 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical compound [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 1
- 102100036788 Tubulin beta-4A chain Human genes 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- RFESNAMUUSDBQQ-UHFFFAOYSA-N [4-(4-benzoylphenoxy)phenyl]-phenylmethanone Chemical compound C=1C=C(OC=2C=CC(=CC=2)C(=O)C=2C=CC=CC=2)C=CC=1C(=O)C1=CC=CC=C1 RFESNAMUUSDBQQ-UHFFFAOYSA-N 0.000 description 1
- DRUFMXREUWOOMU-UHFFFAOYSA-N [N+](=O)([O-])[Co][N+](=O)[O-].NCCNCCNCCN Chemical compound [N+](=O)([O-])[Co][N+](=O)[O-].NCCNCCNCCN DRUFMXREUWOOMU-UHFFFAOYSA-N 0.000 description 1
- OVOGPCZCPJPLLW-UHFFFAOYSA-N [[4-[5-(4-diazonioiminocyclohexa-2,5-dien-1-ylidene)-1,3,4-oxadiazol-2-ylidene]cyclohexa-2,5-dien-1-ylidene]hydrazinylidene]azanide Chemical compound C1=CC(N=[N+]=[N-])=CC=C1C1=NN=C(C=2C=CC(=CC=2)N=[N+]=[N-])O1 OVOGPCZCPJPLLW-UHFFFAOYSA-N 0.000 description 1
- 239000011358 absorbing material Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- DZBUGLKDJFMEHC-UHFFFAOYSA-O acridine;hydron Chemical compound C1=CC=CC2=CC3=CC=CC=C3[NH+]=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-O 0.000 description 1
- 150000001251 acridines Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- AGBQKNBQESQNJD-UHFFFAOYSA-N alpha-Lipoic acid Natural products OC(=O)CCCCC1CCSS1 AGBQKNBQESQNJD-UHFFFAOYSA-N 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 150000008425 anthrones Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WVCXSPJPERKPJS-UHFFFAOYSA-L azane;dichloropalladium;hydrate Chemical compound N.N.N.N.O.Cl[Pd]Cl WVCXSPJPERKPJS-UHFFFAOYSA-L 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- MXMZCLLIUQEKSN-UHFFFAOYSA-N benzimidazoline Chemical compound C1=CC=C2NCNC2=C1 MXMZCLLIUQEKSN-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- BLMPQMFVWMYDKT-NZTKNTHTSA-N carfilzomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)[C@]1(C)OC1)NC(=O)CN1CCOCC1)CC1=CC=CC=C1 BLMPQMFVWMYDKT-NZTKNTHTSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 230000005591 charge neutralization Effects 0.000 description 1
- IOMXCGDXEUDZAK-UHFFFAOYSA-N chembl1511179 Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=NC=CS1 IOMXCGDXEUDZAK-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- GTKRFUAGOKINCA-UHFFFAOYSA-M chlorosilver;silver Chemical compound [Ag].[Ag]Cl GTKRFUAGOKINCA-UHFFFAOYSA-M 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- BAPCGMHGZBRCBQ-UHFFFAOYSA-K cobalt(3+) ethane-1,2-diamine 2-hydroxy-2,2-diphenylacetate Chemical compound [Co+3].NCCN.NCCN.NCCN.C=1C=CC=CC=1C(C([O-])=O)(O)C1=CC=CC=C1.C=1C=CC=CC=1C(C([O-])=O)(O)C1=CC=CC=C1.C=1C=CC=CC=1C(C([O-])=O)(O)C1=CC=CC=C1 BAPCGMHGZBRCBQ-UHFFFAOYSA-K 0.000 description 1
- SPBNESDHQFJNNO-UHFFFAOYSA-K cobalt(3+);2,2,2-trifluoroacetate Chemical compound [Co+3].[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F.[O-]C(=O)C(F)(F)F SPBNESDHQFJNNO-UHFFFAOYSA-K 0.000 description 1
- QIOXACADOKKFAK-UHFFFAOYSA-N cobalt(3+);pyridine Chemical compound [Co+3].C1=CC=NC=C1 QIOXACADOKKFAK-UHFFFAOYSA-N 0.000 description 1
- NZWDUEWMZGGSDD-UHFFFAOYSA-K cobalt(3+);trithiocyanate Chemical compound N#CS[Co](SC#N)SC#N NZWDUEWMZGGSDD-UHFFFAOYSA-K 0.000 description 1
- 150000004695 complexes Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- AFYCEAFSNDLKSX-UHFFFAOYSA-N coumarin 460 Chemical compound CC1=CC(=O)OC2=CC(N(CC)CC)=CC=C21 AFYCEAFSNDLKSX-UHFFFAOYSA-N 0.000 description 1
- 150000004775 coumarins Chemical class 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- NJDNXYGOVLYJHP-UHFFFAOYSA-L disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzoate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C21 NJDNXYGOVLYJHP-UHFFFAOYSA-L 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000007606 doctor blade method Methods 0.000 description 1
- WAMKWBHYPYBEJY-UHFFFAOYSA-N duroquinone Chemical compound CC1=C(C)C(=O)C(C)=C(C)C1=O WAMKWBHYPYBEJY-UHFFFAOYSA-N 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 230000005518 electrochemistry Effects 0.000 description 1
- 238000006056 electrooxidation reaction Methods 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- CXOBWJYMBBMTBX-UHFFFAOYSA-N ethyl 2-[bis(2-ethoxy-2-oxoethyl)amino]acetate Chemical compound CCOC(=O)CN(CC(=O)OCC)CC(=O)OCC CXOBWJYMBBMTBX-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229920001600 hydrophobic polymer Polymers 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 235000019136 lipoic acid Nutrition 0.000 description 1
- 238000001459 lithography Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- ACDHTNKWGNDNJM-UHFFFAOYSA-N methyl 2-(1,4-dioxonaphthalen-2-yl)oxyacetate Chemical compound C1=CC=C2C(=O)C(OCC(=O)OC)=CC(=O)C2=C1 ACDHTNKWGNDNJM-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- AGUSCPNQHJYZIK-UHFFFAOYSA-N n',n'-dimethylethanedithioamide Chemical compound CN(C)C(=S)C(N)=S AGUSCPNQHJYZIK-UHFFFAOYSA-N 0.000 description 1
- ITFBXBXHBKPHAV-UHFFFAOYSA-N n'-(1,3-benzothiazol-2-yl)ethanedithioamide Chemical compound C1=CC=C2SC(NC(=S)C(=S)N)=NC2=C1 ITFBXBXHBKPHAV-UHFFFAOYSA-N 0.000 description 1
- QAUUUWUHTWYWTF-UHFFFAOYSA-N n'-(4-chloroanilino)-n-pyridin-2-yliminobenzenecarboximidamide Chemical compound C1=CC(Cl)=CC=C1NN=C(C=1C=CC=CC=1)N=NC1=CC=CC=N1 QAUUUWUHTWYWTF-UHFFFAOYSA-N 0.000 description 1
- WVHPFIGQQVVDCK-UHFFFAOYSA-K n'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;dichlorocobalt(1+);2,2,2-trifluoroacetate Chemical compound Cl[Co+]Cl.[O-]C(=O)C(F)(F)F.NCCNCCNCCN WVHPFIGQQVVDCK-UHFFFAOYSA-K 0.000 description 1
- GHXTXGVNFQZWGP-UHFFFAOYSA-N n'-anilino-n-(1,3-benzoxazol-2-ylimino)benzenecarboximidamide Chemical compound C=1C=CC=CC=1NN=C(N=NC=1OC2=CC=CC=C2N=1)C1=CC=CC=C1 GHXTXGVNFQZWGP-UHFFFAOYSA-N 0.000 description 1
- NEIZJYIUHSEECN-UHFFFAOYSA-N n'-anilino-n-pyridin-2-yliminobenzenecarboximidamide Chemical compound C=1C=CC=CC=1NN=C(C=1C=CC=CC=1)N=NC1=CC=CC=N1 NEIZJYIUHSEECN-UHFFFAOYSA-N 0.000 description 1
- HRNHNGILHBRCEE-UHFFFAOYSA-N n'-quinolin-2-ylethanedithioamide Chemical compound C1=CC=CC2=NC(NC(=S)C(=S)N)=CC=C21 HRNHNGILHBRCEE-UHFFFAOYSA-N 0.000 description 1
- RCOLWKMQGYNNDK-UHFFFAOYSA-N n-(1,3-benzoxazol-2-ylimino)-n'-(4-chloroanilino)benzenecarboximidamide Chemical compound C1=CC(Cl)=CC=C1NN=C(C=1C=CC=CC=1)N=NC1=NC2=CC=CC=C2O1 RCOLWKMQGYNNDK-UHFFFAOYSA-N 0.000 description 1
- UOUBPDZUBVJZOQ-UHFFFAOYSA-N n-(hydroxymethyl)benzamide Chemical compound OCNC(=O)C1=CC=CC=C1 UOUBPDZUBVJZOQ-UHFFFAOYSA-N 0.000 description 1
- KYDLWVBNCQERCD-ZROIWOOFSA-N n-[(z)-pyridin-2-ylmethylideneamino]pyridin-2-amine Chemical compound C=1C=CC=NC=1N\N=C/C1=CC=CC=N1 KYDLWVBNCQERCD-ZROIWOOFSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- QZGIWPZCWHMVQL-UIYAJPBUSA-N neocarzinostatin chromophore Chemical compound O1[C@H](C)[C@H](O)[C@H](O)[C@@H](NC)[C@H]1O[C@@H]1C/2=C/C#C[C@H]3O[C@@]3([C@@H]3OC(=O)OC3)C#CC\2=C[C@H]1OC(=O)C1=C(O)C=CC2=C(C)C=C(OC)C=C12 QZGIWPZCWHMVQL-UIYAJPBUSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 239000001005 nitro dye Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- SCOAVUHOIJMIBW-UHFFFAOYSA-N phenanthrene-1,2-dione Chemical class C1=CC=C2C(C=CC(C3=O)=O)=C3C=CC2=C1 SCOAVUHOIJMIBW-UHFFFAOYSA-N 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical compound O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 description 1
- QWYZFXLSWMXLDM-UHFFFAOYSA-M pinacyanol iodide Chemical class [I-].C1=CC2=CC=CC=C2N(CC)C1=CC=CC1=CC=C(C=CC=C2)C2=[N+]1CC QWYZFXLSWMXLDM-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 238000003969 polarography Methods 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003236 pyrrolines Chemical class 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000033458 reproduction Effects 0.000 description 1
- 230000027756 respiratory electron transport chain Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 210000001525 retina Anatomy 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000001022 rhodamine dye Substances 0.000 description 1
- BPELEZSCHIEMAE-UHFFFAOYSA-N salicylaldehyde imine Chemical compound OC1=CC=CC=C1C=N BPELEZSCHIEMAE-UHFFFAOYSA-N 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 150000001629 stilbenes Chemical class 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000988 sulfur dye Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000003115 supporting electrolyte Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- DGQOCLATAPFASR-UHFFFAOYSA-N tetrahydroxy-1,4-benzoquinone Chemical compound OC1=C(O)C(=O)C(O)=C(O)C1=O DGQOCLATAPFASR-UHFFFAOYSA-N 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003549 thiazolines Chemical class 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- 229960002663 thioctic acid Drugs 0.000 description 1
- 125000000858 thiocyanato group Chemical group *SC#N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000004832 voltammetry Methods 0.000 description 1
- 239000001018 xanthene dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/67—Compositions containing cobalt salts or cobalt compounds as photosensitive substances
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/32—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers one component being a heavy metal compound, e.g. lead or iron
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/137—Cobalt complex containing
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46117274A | 1974-04-15 | 1974-04-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1051705A true CA1051705A (en) | 1979-04-03 |
Family
ID=23831487
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA221,786A Expired CA1051705A (en) | 1974-04-15 | 1975-03-11 | High gain transition metal complex imaging |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4075019A (enExample) |
| JP (1) | JPS5410857B2 (enExample) |
| BE (1) | BE827953A (enExample) |
| CA (1) | CA1051705A (enExample) |
| FR (1) | FR2274954A1 (enExample) |
| GB (1) | GB1497453A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50137721A (enExample) * | 1974-04-22 | 1975-11-01 | ||
| US4334005A (en) * | 1976-09-07 | 1982-06-08 | Eastman Kodak Company | Transition metal photoreduction systems and processes |
| US4243737A (en) * | 1977-11-25 | 1981-01-06 | Eastman Kodak Company | Image forming composition and elements with Co(III) complex, conjugated π bonding compounds and photoreductant |
| CA1116915A (en) * | 1977-12-28 | 1982-01-26 | Anthony Adin | Inhibition of image formation utilizing cobalt(iii) complexes |
| US4273860A (en) * | 1977-12-28 | 1981-06-16 | Eastman Kodak Company | Inhibition of image formation utilizing cobalt(III) complexes |
| JPS5536838A (en) * | 1978-09-08 | 1980-03-14 | Tokyo Ohka Kogyo Co Ltd | Novel light absorber and photoresist composition containing this |
| US4247625A (en) * | 1978-12-20 | 1981-01-27 | Eastman Kodak Company | Imaging processes, elements and compositions featuring dye-retaining binders for reaction products of cobalt complexes and aromatic dialdehyde |
| US4288531A (en) * | 1978-12-20 | 1981-09-08 | Eastman Kodak Company | Imaging elements |
| US4292399A (en) * | 1979-10-22 | 1981-09-29 | Eastman Kodak Company | Cobalt (III) complex imaging compositions having improved photographic properties |
| JPS5670545A (en) * | 1979-11-14 | 1981-06-12 | Ricoh Co Ltd | Photothermosensitive composition |
| US4294912A (en) * | 1980-07-17 | 1981-10-13 | Eastman Kodak Company | Thermally responsive cobalt(III) complex imaging compositions having lowered activation temperatures |
| US4467022A (en) * | 1980-08-11 | 1984-08-21 | Minnesota Mining And Manufacturing Company | Imaging process and article employing photolabile, blocked surfactant |
| US4554238A (en) * | 1984-03-20 | 1985-11-19 | Minnesota Mining And Manufacturing Company | Spectrally-sensitized imaging system |
| US4681828A (en) * | 1986-09-02 | 1987-07-21 | Eastman Kodak Company | Method of chemical electrographic image amplification using chemically active toner particles |
| WO1988003667A1 (en) * | 1986-11-07 | 1988-05-19 | Optical Recording Corporation | Recording media incorporating complex metal azide explosives and dye-azide explosives |
| US4968586A (en) * | 1988-12-23 | 1990-11-06 | Eastman Kodak Company | Photoresist compositions containing cobalt (III) compound and redox transfer ligand |
| US5476755A (en) * | 1993-11-19 | 1995-12-19 | Konica Corporation | Image forming element and image forming method |
| US5698363A (en) * | 1995-07-10 | 1997-12-16 | Konica Corporation | Image forming method |
| US8066433B2 (en) | 2008-03-14 | 2011-11-29 | Pro-Mart Industries, Inc. | Valve for vacuum storage bag |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1880449A (en) * | 1930-08-07 | 1932-10-04 | Eastman Kodak Co | Tropochromic coating |
| BE546818A (enExample) * | 1955-04-06 | |||
| NL227834A (enExample) * | 1957-05-17 | |||
| US3655383A (en) * | 1959-04-30 | 1972-04-11 | Minnesota Mining & Mfg | Method for reproducing images of a solid photocatalyst with an oxidizing agent |
| GB908299A (en) * | 1959-12-31 | 1962-10-17 | Ilford Ltd | Production of colour photographic records |
| US3297440A (en) * | 1963-05-02 | 1967-01-10 | Gevaert Photo Prod Nv | Photopolymerization of ethylenically unsaturated organic compositions and the formation of a relief image |
| US3383212A (en) * | 1964-04-29 | 1968-05-14 | Du Pont | Photographic process utilizing composition comprising an oxidatively activatable color generator, thermally activatable oxidant and a redox couple |
| US3418118A (en) * | 1965-06-03 | 1968-12-24 | Du Pont | Photographic processes and products |
| GB1118654A (en) * | 1966-03-15 | 1968-07-03 | Agfa Gevaert Nv | Improved light-sensitive silver halide emulsions |
| US3623865A (en) * | 1967-03-16 | 1971-11-30 | Itek Corp | Processes for producing photographic images utilizing leucophthalocyanines and photosensitive materials and products related thereto |
| US3561969A (en) * | 1967-10-17 | 1971-02-09 | Du Pont | Light-sensitive color forming compositions of 9, 10-phenanthrenequinone |
| US3567453A (en) * | 1967-12-26 | 1971-03-02 | Eastman Kodak Co | Light sensitive compositions for photoresists and lithography |
| US3754914A (en) * | 1968-07-29 | 1973-08-28 | Canon Kk | Photosensitive composition containing an organic halogen compound photoactivator a color modifier and a photoreducible organic metal salt and the use thereof |
| BE754283A (fr) * | 1969-08-01 | 1970-12-31 | Rca Corp | Materiaux electrophotographiques rendus spectralement sensibles |
| US3765883A (en) * | 1970-02-04 | 1973-10-16 | Canon Kk | Organic photoconductors sensitized with free radical liberators and organometallic compounds |
| US3856524A (en) * | 1971-10-14 | 1974-12-24 | Eastman Kodak Co | Photographic elements and processes for providing tanned image records |
| BE790677A (fr) * | 1971-10-28 | 1973-02-15 | Rca Corp | Materiaux electrophotographiques sensibilises du point de vue spectral |
-
1975
- 1975-03-11 CA CA221,786A patent/CA1051705A/en not_active Expired
- 1975-04-14 FR FR7511496A patent/FR2274954A1/fr active Granted
- 1975-04-15 BE BE155423A patent/BE827953A/xx not_active IP Right Cessation
- 1975-04-15 GB GB15497/75A patent/GB1497453A/en not_active Expired
- 1975-04-15 JP JP4575775A patent/JPS5410857B2/ja not_active Expired
- 1975-10-30 US US05/627,416 patent/US4075019A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2274954A1 (fr) | 1976-01-09 |
| BE827953A (fr) | 1975-10-15 |
| JPS50139724A (enExample) | 1975-11-08 |
| JPS5410857B2 (enExample) | 1979-05-10 |
| DE2516188B2 (de) | 1977-03-10 |
| FR2274954B1 (enExample) | 1979-06-08 |
| US4075019A (en) | 1978-02-21 |
| DE2516188A1 (de) | 1975-10-23 |
| GB1497453A (en) | 1978-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1051705A (en) | High gain transition metal complex imaging | |
| US5153104A (en) | Thermally developable light-sensitive layers containing photobleachable sensitizers | |
| US4045221A (en) | Process of amplifying image in image recording layer by releasing reactant from image forming layer containing cobalt(III)complex | |
| US4201588A (en) | Radiation sensitive co(III)complex photoreduction element with image recording layer | |
| US4284704A (en) | Photographic elements with incorporated hydrogen source photoreductant and tetrazolium salt | |
| JPH04234036A (ja) | 感光性熱現像組成物 | |
| US4144062A (en) | Organotellurium (II) and (IV) compounds in heat-developable photographic materials and process | |
| US3887374A (en) | Tetrazolium alt photoreductive imaging | |
| US4273860A (en) | Inhibition of image formation utilizing cobalt(III) complexes | |
| JP2002278019A (ja) | 高感度フォトサーモグラフィ材料および該材料を使用する方法 | |
| US4243737A (en) | Image forming composition and elements with Co(III) complex, conjugated π bonding compounds and photoreductant | |
| US3887372A (en) | Photographic elements and processes for producing formazan dye images of enhanced stability | |
| US4171221A (en) | High gain Co(III)complex imaging | |
| EP0003263B1 (en) | A method of forming an image, and an imaging element for inhibiting image formation with cobalt (iii) complexes | |
| US4195998A (en) | CO(III) Complex containing radiation sensitive element with diazo recording layer | |
| CA1076408A (en) | Cobalt complex amplification imaging system | |
| US4324852A (en) | Transition metal photoreduction systems and processes | |
| US4334005A (en) | Transition metal photoreduction systems and processes | |
| US4314019A (en) | Transition metal photoreduction systems and processes | |
| US4294912A (en) | Thermally responsive cobalt(III) complex imaging compositions having lowered activation temperatures | |
| CA1051706A (en) | Transition metal photoreduction systems and processes | |
| US3881930A (en) | 2H-benzimidazole photoreductive imaging | |
| EP0120601B1 (en) | Oxidative imaging | |
| CA1051250A (en) | Spectral sensitization of transition metal complexes | |
| CA1109877A (en) | Hydrolytically stable tellurium (iv) compounds and compositions |