CA1044250A - Alkyl 2-nitro-5-(2',4'-dichlorophenoxy) thiobenzoates, process for preparation thereof and their use as herbicides - Google Patents
Alkyl 2-nitro-5-(2',4'-dichlorophenoxy) thiobenzoates, process for preparation thereof and their use as herbicidesInfo
- Publication number
- CA1044250A CA1044250A CA218,267A CA218267A CA1044250A CA 1044250 A CA1044250 A CA 1044250A CA 218267 A CA218267 A CA 218267A CA 1044250 A CA1044250 A CA 1044250A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- nitro
- weeds
- dichlorophenoxy
- test
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 25
- 125000000217 alkyl group Chemical group 0.000 title claims abstract description 12
- 238000002360 preparation method Methods 0.000 title abstract description 8
- 239000004009 herbicide Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 65
- 241000196324 Embryophyta Species 0.000 claims abstract description 62
- 235000021307 Triticum Nutrition 0.000 claims abstract description 17
- 230000002147 killing effect Effects 0.000 claims abstract description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 9
- 241000209140 Triticum Species 0.000 claims abstract description 4
- IUSYSZLVZMUVDO-UHFFFAOYSA-N 5-(2,4-dichlorophenoxy)-2-nitrobenzoic acid Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 IUSYSZLVZMUVDO-UHFFFAOYSA-N 0.000 claims abstract 2
- 230000002363 herbicidal effect Effects 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- DHXXMDIXAXQNTH-UHFFFAOYSA-N o-ethyl 5-(2,4-dichlorophenoxy)-2-nitrobenzenecarbothioate Chemical compound C1=C([N+]([O-])=O)C(C(=S)OCC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DHXXMDIXAXQNTH-UHFFFAOYSA-N 0.000 claims description 2
- QVTNYEOYRPSQSI-UHFFFAOYSA-N o-methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzenecarbothioate Chemical compound C1=C([N+]([O-])=O)C(C(=S)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 QVTNYEOYRPSQSI-UHFFFAOYSA-N 0.000 claims description 2
- JKYQDKKBXVCWFU-UHFFFAOYSA-N o-propyl 5-(2,4-dichlorophenoxy)-2-nitrobenzenecarbothioate Chemical compound C1=C([N+]([O-])=O)C(C(=S)OCCC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 JKYQDKKBXVCWFU-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- WUIMOSVVZBSGPJ-UHFFFAOYSA-N o-propan-2-yl 5-(2,4-dichlorophenoxy)-2-nitrobenzenecarbothioate Chemical compound C1=C([N+]([O-])=O)C(C(=S)OC(C)C)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 WUIMOSVVZBSGPJ-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 15
- -1 alkyl 2-nitro-5-(2',4'-di-chlorophenoxy)thiobenzoate Chemical compound 0.000 abstract description 9
- 238000012360 testing method Methods 0.000 description 42
- 208000027418 Wounds and injury Diseases 0.000 description 23
- 230000006378 damage Effects 0.000 description 23
- 208000014674 injury Diseases 0.000 description 23
- 244000098338 Triticum aestivum Species 0.000 description 19
- 240000007594 Oryza sativa Species 0.000 description 15
- 239000002689 soil Substances 0.000 description 15
- 244000286177 Raphanus raphanistrum Species 0.000 description 14
- 235000007164 Oryza sativa Nutrition 0.000 description 13
- 235000000245 Raphanus raphanistrum subsp raphanistrum Nutrition 0.000 description 10
- 235000011380 Raphanus sativus Nutrition 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000440 bentonite Substances 0.000 description 8
- 229910000278 bentonite Inorganic materials 0.000 description 8
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 8
- 235000009566 rice Nutrition 0.000 description 8
- 239000004563 wettable powder Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 240000008042 Zea mays Species 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 244000058871 Echinochloa crus-galli Species 0.000 description 5
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 5
- 244000214240 Galinsoga parviflora Species 0.000 description 5
- 235000014820 Galium aparine Nutrition 0.000 description 5
- 240000005702 Galium aparine Species 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 235000000241 Raphanus raphanistrum Nutrition 0.000 description 5
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 240000006122 Chenopodium album Species 0.000 description 4
- 235000002767 Daucus carota Nutrition 0.000 description 4
- 244000000626 Daucus carota Species 0.000 description 4
- 244000283628 Elatine triandra Species 0.000 description 4
- 241000759199 Eleocharis acicularis Species 0.000 description 4
- 244000110797 Polygonum persicaria Species 0.000 description 4
- 235000004442 Polygonum persicaria Nutrition 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 235000005822 corn Nutrition 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 235000011498 Chenopodium album var missouriense Nutrition 0.000 description 3
- 235000013328 Chenopodium album var. album Nutrition 0.000 description 3
- 235000014052 Chenopodium album var. microphyllum Nutrition 0.000 description 3
- 235000014050 Chenopodium album var. stevensii Nutrition 0.000 description 3
- 235000013012 Chenopodium album var. striatum Nutrition 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 244000207740 Lemna minor Species 0.000 description 3
- 235000006439 Lemna minor Nutrition 0.000 description 3
- 240000007038 Lindernia dubia Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000011999 Panicum crusgalli Nutrition 0.000 description 3
- 244000273339 Pontederia cordata Species 0.000 description 3
- 235000001855 Portulaca oleracea Nutrition 0.000 description 3
- 241000341978 Rotala Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000005545 Veronica americana Nutrition 0.000 description 3
- 240000005592 Veronica officinalis Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000035784 germination Effects 0.000 description 3
- 235000009181 lance leaf pickerel weed Nutrition 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000021217 seedling development Effects 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000011305 Capsella bursa pastoris Nutrition 0.000 description 2
- 240000008867 Capsella bursa-pastoris Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000286838 Eclipta prostrata Species 0.000 description 2
- 241001660456 Eleocharis tenuis Species 0.000 description 2
- 235000009967 Erodium cicutarium Nutrition 0.000 description 2
- 240000003759 Erodium cicutarium Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 240000002702 Lapsana communis Species 0.000 description 2
- 240000000178 Monochoria vaginalis Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 244000184734 Pyrus japonica Species 0.000 description 2
- 244000155504 Rotala indica Species 0.000 description 2
- 241000219053 Rumex Species 0.000 description 2
- 241000209056 Secale Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 244000300264 Spinacia oleracea Species 0.000 description 2
- 235000009337 Spinacia oleracea Nutrition 0.000 description 2
- 244000245511 Veronica didyma Species 0.000 description 2
- 235000000502 Veronica didyma Nutrition 0.000 description 2
- 235000007244 Zea mays Nutrition 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 239000002956 ash Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MSUVWOONRMIXIO-UHFFFAOYSA-N 2-phenoxybenzenecarbothioic s-acid Chemical class SC(=O)C1=CC=CC=C1OC1=CC=CC=C1 MSUVWOONRMIXIO-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001065551 Aphanus Species 0.000 description 1
- 241001576539 Asperugo procumbens Species 0.000 description 1
- 241000208838 Asteraceae Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241001072256 Boraginaceae Species 0.000 description 1
- 241000219193 Brassicaceae Species 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 241000220244 Capsella <angiosperm> Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000219294 Cerastium Species 0.000 description 1
- 241000871189 Chenopodiaceae Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000010071 Cucumis prophetarum Nutrition 0.000 description 1
- 244000024469 Cucumis prophetarum Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 240000004472 Dopatrium junceum Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000132521 Erigeron Species 0.000 description 1
- 241001252539 Erigeron philadelphicus Species 0.000 description 1
- 235000002918 Fraxinus excelsior Nutrition 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- 244000242291 Lemna paucicostata Species 0.000 description 1
- 235000017074 Lepidium campestre Nutrition 0.000 description 1
- 244000136541 Lepidium campestre Species 0.000 description 1
- 240000005471 Lindernia micrantha Species 0.000 description 1
- 240000004428 Lindernia procumbens Species 0.000 description 1
- 244000081171 Ludwigia prostrata Species 0.000 description 1
- 241001108764 Ludwigia sphaerocarpa Species 0.000 description 1
- 101100118976 Mus musculus Clint1 gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 244000236458 Panicum colonum Species 0.000 description 1
- 244000088461 Panicum crus-galli Species 0.000 description 1
- 241000013557 Plantaginaceae Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000219050 Polygonaceae Species 0.000 description 1
- 241001506137 Rapa Species 0.000 description 1
- 244000079489 Rorippa palustris Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241001408202 Sagittaria pygmaea Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 235000014249 Spirodela polyrhiza Nutrition 0.000 description 1
- 240000000067 Spirodela polyrhiza Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241001180927 Trigonotis peduncularis Species 0.000 description 1
- 244000247695 Veronica chamaedrys Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- NKWPZUCBCARRDP-UHFFFAOYSA-L calcium bicarbonate Chemical compound [Ca+2].OC([O-])=O.OC([O-])=O NKWPZUCBCARRDP-UHFFFAOYSA-L 0.000 description 1
- 229910000020 calcium bicarbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- XHXXWWGGXFUMAJ-UHFFFAOYSA-N methanethiol;sodium Chemical compound [Na].SC XHXXWWGGXFUMAJ-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229960001866 silicon dioxide Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4112974A JPS50135227A (en:Method) | 1974-04-10 | 1974-04-10 | |
| JP6627674A JPS50157333A (en:Method) | 1974-06-10 | 1974-06-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1044250A true CA1044250A (en) | 1978-12-12 |
Family
ID=26380685
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA218,267A Expired CA1044250A (en) | 1974-04-10 | 1975-01-17 | Alkyl 2-nitro-5-(2',4'-dichlorophenoxy) thiobenzoates, process for preparation thereof and their use as herbicides |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3953489A (en:Method) |
| BR (1) | BR7502221A (en:Method) |
| CA (1) | CA1044250A (en:Method) |
| DE (1) | DE2501797C2 (en:Method) |
| FR (1) | FR2267317B1 (en:Method) |
| GB (1) | GB1484395A (en:Method) |
| IT (1) | IT1048802B (en:Method) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USRE32243E (en) * | 1969-04-25 | 1986-09-09 | Rhone-Poulenc Agrochimie | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32216E (en) * | 1969-04-25 | 1986-07-29 | Rhone-Poulenc Agrochimie | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| US4164410A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Esters of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| USRE32215E (en) * | 1971-02-11 | 1986-07-22 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids compositions of the same and herbicidal use thereof |
| US4164408A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Salts of substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| US4164409A (en) * | 1971-02-11 | 1979-08-14 | Mobil Oil Corp. | Substituted phenoxybenzoic acids, compositions of the same and herbicidal use thereof |
| US4681622A (en) * | 1973-09-19 | 1987-07-21 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivatives thereof as herbicides |
| US4606758A (en) * | 1973-09-19 | 1986-08-19 | Rhone-Poulenc Agrochimie | Substituted phenoxybenzoic acids and derivative thereof as herbicides |
| US4183743A (en) * | 1975-11-20 | 1980-01-15 | Ishihara Sangyo Kaisha Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| US4213775A (en) * | 1977-07-28 | 1980-07-22 | Ube Industries, Ltd. | Diphenyl ether derivatives and herbicidal compositions containing the same |
| DK155935C (da) * | 1979-05-16 | 1989-10-16 | Rohm & Haas | Substituerede diphenylethere, herbicide praeparater indeholdende disse forbindelser samt fremgangsmaade til bekaempelse af ukrudt |
| JPS56113744A (en) * | 1980-02-13 | 1981-09-07 | Nippon Nohyaku Co Ltd | Benzoate derivative, its preparation, and use of said derivative |
| CA1312408C (en) * | 1987-10-09 | 1993-01-05 | Peter W. Merz | Reactive, thixotropic hot-melt adhesive on silane basis |
| US5446197A (en) * | 1994-10-04 | 1995-08-29 | Basf Corporation | Method of purifying acifluorfen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3333945A (en) * | 1964-10-13 | 1967-08-01 | Velsicol Chemical Corp | Herbicidal composition and method |
| US3784635A (en) * | 1969-04-25 | 1974-01-08 | Mobil Oil Corp | Substituted phenoxybenzoic acids and esters thereof |
| US3867543A (en) * | 1972-08-16 | 1975-02-18 | Chevron Res | Insect control methods employing certain substituted benzoates |
-
1975
- 1975-01-17 DE DE2501797A patent/DE2501797C2/de not_active Expired
- 1975-01-17 US US05/542,052 patent/US3953489A/en not_active Expired - Lifetime
- 1975-01-17 GB GB2090/75A patent/GB1484395A/en not_active Expired
- 1975-01-17 FR FR7501563A patent/FR2267317B1/fr not_active Expired
- 1975-01-17 CA CA218,267A patent/CA1044250A/en not_active Expired
- 1975-04-11 BR BR2221/75A patent/BR7502221A/pt unknown
- 1975-06-27 IT IT7519317A patent/IT1048802B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| US3953489A (en) | 1976-04-27 |
| AU7740775A (en) | 1976-07-22 |
| BR7502221A (pt) | 1975-12-09 |
| GB1484395A (en) | 1977-09-01 |
| FR2267317A1 (en:Method) | 1975-11-07 |
| FR2267317B1 (en:Method) | 1978-08-18 |
| IT1048802B (it) | 1980-12-20 |
| DE2501797C2 (de) | 1986-01-30 |
| DE2501797A1 (de) | 1975-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1044250A (en) | Alkyl 2-nitro-5-(2',4'-dichlorophenoxy) thiobenzoates, process for preparation thereof and their use as herbicides | |
| US5240951A (en) | Isothiazolecarboxylic acid derivatives, rice blast control agents containing the same as active ingredients, and rice blast control method applying the control agents | |
| US4929273A (en) | N-benzyl-2-(4-fluoro-3-trifluoromethylphenoxy)butanoic amide and herbicidal composition containing the same | |
| KR870000806B1 (ko) | 치환된 프로파르길옥시 아세토니트릴 유도체의 제조방법 | |
| US3187042A (en) | N-alkoxy benzamides | |
| US4157257A (en) | Benzenesulfonamide derivatives | |
| EP0086111B1 (en) | A fungicidal indanylbenzamide | |
| US4015975A (en) | Compositions containing alkyl 2-nitro-5-(2',4'-dichlorophenoxy)-thiobenzoates, and method of use thereof | |
| US4144049A (en) | N-(4-Benzyloxyphenyl)-N-methyl-N-methoxyurea | |
| CA1088065A (en) | Pesticidal agents | |
| CN115417791B (zh) | 一种肟醚类1,3-环己二酮化合物及其合成方法和应用 | |
| EP0459133A2 (en) | Aryloxyspiroalkylindolinone herbicides | |
| KR910006448B1 (ko) | 복소환 화합물, 그의 제조방법 및 그를 유효성분으로서 함유하는 제초제 조성물 | |
| KR910002672B1 (ko) | 페닐아세트아닐리드 유도체의 제조방법 | |
| EP0007772A1 (en) | N-substituted benzothiazolines and benzoxazolines and their use as herbicides and plant growth regulants | |
| CA2129016C (en) | N-aryloxyacyl-n-phenyltetrahydrophthalamic acid derivatives, methods of producing same, and herbicides containing same as effective components | |
| CA2067742A1 (en) | N-acyl-n-phenyltetrahydrophthalamic acid derivatives methods of producing same, and herbicides containing same as effective components | |
| US5068365A (en) | Hexahydrophthalic anilide derivatives | |
| US4551478A (en) | 3-Nitrobenzene sulfonanilide derivatives and fungicidal compositions for the control of plant diseases containing same | |
| US4529437A (en) | Herbicides | |
| US5759958A (en) | Triazole derivative, herbicidal compositions containing the derivatives and methods of their use | |
| CA2129017C (en) | N-acyl-n-phenylmaleamic acid derivatives, methods of producing same, and herbicides containing same as effective components | |
| EP0061583A1 (en) | Herbicidal compositions containing alpha-alpha-dimethyl phenylacetanilides | |
| AU614540B2 (en) | Phenoxyphenyl substituted tetrazolinones | |
| US4377408A (en) | Herbicidal derivatives of 5-phenoxy-4(3H)-quinazolinone-1-oxide |