CA1003415A - 3-(2-aminopropyl)-indoles - Google Patents
3-(2-aminopropyl)-indolesInfo
- Publication number
- CA1003415A CA1003415A CA162,180A CA162180A CA1003415A CA 1003415 A CA1003415 A CA 1003415A CA 162180 A CA162180 A CA 162180A CA 1003415 A CA1003415 A CA 1003415A
- Authority
- CA
- Canada
- Prior art keywords
- indoles
- aminopropyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QSQQQURBVYWZKJ-UHFFFAOYSA-N alpha-methyltryptamine Chemical class C1=CC=C2C(CC(N)C)=CNC2=C1 QSQQQURBVYWZKJ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7205196A FR2171935B1 (id) | 1972-02-16 | 1972-02-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1003415A true CA1003415A (en) | 1977-01-11 |
Family
ID=9093584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA162,180A Expired CA1003415A (en) | 1972-02-16 | 1973-02-05 | 3-(2-aminopropyl)-indoles |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3953442A (id) |
| JP (1) | JPS4892363A (id) |
| AR (1) | AR201098A1 (id) |
| AT (1) | AT322543B (id) |
| AU (1) | AU5172573A (id) |
| BE (1) | BE795457A (id) |
| CA (1) | CA1003415A (id) |
| CH (1) | CH576959A5 (id) |
| DD (1) | DD105610A5 (id) |
| DE (1) | DE2307708A1 (id) |
| ES (1) | ES411679A1 (id) |
| FR (1) | FR2171935B1 (id) |
| GB (1) | GB1382943A (id) |
| HU (1) | HU165507B (id) |
| IE (1) | IE37162B1 (id) |
| IL (1) | IL41417A (id) |
| LU (1) | LU67032A1 (id) |
| NL (1) | NL153544B (id) |
| PH (1) | PH9387A (id) |
| PL (1) | PL82175B1 (id) |
| RO (1) | RO61190A (id) |
| SE (1) | SE390535B (id) |
| SU (1) | SU523637A3 (id) |
| ZA (1) | ZA73619B (id) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4256641A (en) * | 1976-06-22 | 1981-03-17 | Hoffmann-La Roche Inc. | Novel syntheses of tryptophans |
| US4316847A (en) * | 1979-07-30 | 1982-02-23 | Hoffmann-La Roche Inc. | Pyrroles and pyrrolidines |
| US4379933A (en) * | 1980-02-15 | 1983-04-12 | American Hoechst Corporation | Process for preparing spiro[indoline-3,4'-piperidine]s |
| US4379932A (en) * | 1980-02-15 | 1983-04-12 | American Hoechst Corporation | Process for preparing spiro[indoline-3,4'-piperidine]s |
| DE3430284A1 (de) * | 1984-08-17 | 1986-02-27 | Troponwerke GmbH & Co KG, 5000 Köln | Neue tryptamin-derivate, ein verfahren zu ihrer herstellung und ihre verwendung |
| NZ238424A (en) * | 1990-06-07 | 1993-12-23 | Wellcome Found | 3,5-substituted indole derivatives; medicaments and preparatory processes. |
| DK139593D0 (da) * | 1993-12-16 | 1993-12-16 | Lundbeck & Co As H | Compounds |
| US5965582A (en) * | 1994-08-03 | 1999-10-12 | Asta Medica Aktiengesellschaft | N-benzylindole and benzopyrazole derivatives with anti-asthmatic, anti-allergic, anti-inflammatory and immunemodulating effect |
| US5916801A (en) * | 1996-10-31 | 1999-06-29 | Lopinto; Richard William | Nectophotometer |
| CA2670468A1 (en) * | 2006-11-20 | 2008-05-29 | University Of Sunderland | Melatonin derivatives and their use as antioxidants |
| RU2662815C2 (ru) * | 2012-03-23 | 2018-07-31 | Новартис Аг | Химический способ получения спироиндолонов и их промежуточных соединений |
-
0
- BE BE795457D patent/BE795457A/xx unknown
-
1972
- 1972-02-16 FR FR7205196A patent/FR2171935B1/fr not_active Expired
- 1972-12-29 PL PL1972159972A patent/PL82175B1/xx unknown
-
1973
- 1973-01-25 CH CH106773A patent/CH576959A5/xx not_active IP Right Cessation
- 1973-01-29 IE IE136/73A patent/IE37162B1/xx unknown
- 1973-01-29 ZA ZA730619A patent/ZA73619B/xx unknown
- 1973-01-29 IL IL41417A patent/IL41417A/en unknown
- 1973-02-01 AR AR246394A patent/AR201098A1/es active
- 1973-02-02 AU AU51725/73A patent/AU5172573A/en not_active Expired
- 1973-02-03 RO RO73719A patent/RO61190A/ro unknown
- 1973-02-05 CA CA162,180A patent/CA1003415A/en not_active Expired
- 1973-02-05 AT AT98073A patent/AT322543B/de not_active IP Right Cessation
- 1973-02-09 NL NL737301880A patent/NL153544B/xx unknown
- 1973-02-10 PH PH14337*UA patent/PH9387A/en unknown
- 1973-02-12 SE SE7301945A patent/SE390535B/xx unknown
- 1973-02-14 GB GB733073A patent/GB1382943A/en not_active Expired
- 1973-02-14 DD DD168884A patent/DD105610A5/xx unknown
- 1973-02-14 JP JP48018870A patent/JPS4892363A/ja active Pending
- 1973-02-14 LU LU67032A patent/LU67032A1/xx unknown
- 1973-02-15 HU HUCI1341A patent/HU165507B/hu unknown
- 1973-02-15 SU SU1888664A patent/SU523637A3/ru active
- 1973-02-16 ES ES411679A patent/ES411679A1/es not_active Expired
- 1973-02-16 US US05/333,343 patent/US3953442A/en not_active Expired - Lifetime
- 1973-02-16 DE DE19732307708 patent/DE2307708A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| LU67032A1 (id) | 1973-08-17 |
| GB1382943A (en) | 1975-02-05 |
| SE390535B (sv) | 1976-12-27 |
| CH576959A5 (id) | 1976-06-30 |
| FR2171935A1 (id) | 1973-09-28 |
| AR201098A1 (es) | 1975-02-14 |
| DD105610A5 (id) | 1974-05-05 |
| SU523637A3 (ru) | 1976-07-30 |
| FR2171935B1 (id) | 1975-04-25 |
| IE37162L (en) | 1973-08-16 |
| NL7301880A (id) | 1973-08-20 |
| HU165507B (id) | 1974-09-28 |
| IE37162B1 (en) | 1977-05-25 |
| JPS4892363A (id) | 1973-11-30 |
| DE2307708A1 (de) | 1973-08-23 |
| IL41417A (en) | 1976-10-31 |
| BE795457A (fr) | 1973-08-16 |
| ES411679A1 (es) | 1976-01-01 |
| NL153544B (nl) | 1977-06-15 |
| IL41417A0 (en) | 1973-03-30 |
| PL82175B1 (id) | 1975-10-31 |
| PH9387A (en) | 1975-10-22 |
| RO61190A (id) | 1976-11-15 |
| AT322543B (de) | 1975-05-26 |
| US3953442A (en) | 1976-04-27 |
| ZA73619B (en) | 1973-10-31 |
| AU5172573A (en) | 1974-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU4806372A (en) | Saf-t-jet | |
| AU467469B2 (en) | Trifluoromethylmercaptoacetamindocephalosphorins | |
| AU454372B2 (en) | Childsafe actuator-overcap | |
| AU469305B2 (en) | Deipenylyl-alkanoylaminopyridine | |
| CA1003415A (en) | 3-(2-aminopropyl)-indoles | |
| AU475339B2 (en) | S-substituted-2-thiodenosines | |
| AU475748B2 (en) | Napnthopyrans | |
| AU470359B2 (en) | Sulphamoylphenyl-imidazolidinones | |
| AU466344B2 (en) | Cycloalkyllactamimides | |
| AU468159B2 (en) | 5-aroyl-furans | |
| AU471369B2 (en) | Diphenylmethoxyethylamines | |
| AU468599B2 (en) | 15-oxasteroids | |
| AU467526B2 (en) | Pyronorifamycins | |
| AU473297B2 (en) | Indolylimidoylheterocyclics | |
| AU468236B2 (en) | 2-acyl-5-nitrothiazoles | |
| AU472554B2 (en) | Isothocyanobenzoxazoles | |
| CA890591A (en) | Single mode iraser | |
| AU478476B2 (en) | Improved rollerskate | |
| AU474168B2 (en) | Anilinobenzothiazoles | |
| AU485245B2 (en) | Pentanorprostaglandins | |
| AU469398B2 (en) | N-benzyl-tetrahydropyridines | |
| AU469608B2 (en) | Oxainoquinazolinones | |
| AU479372B2 (en) | Dl-methionyl-dl-methionine | |
| AU473061B2 (en) | 3-aminohydroxypropoxy-2-substituted-4-pyranones | |
| CA895059A (en) | Beltfasteners |