BE752571A - Benzofurannes utilisables notamment comme azureurs optiques - Google Patents
Benzofurannes utilisables notamment comme azureurs optiquesInfo
- Publication number
- BE752571A BE752571A BE752571DA BE752571A BE 752571 A BE752571 A BE 752571A BE 752571D A BE752571D A BE 752571DA BE 752571 A BE752571 A BE 752571A
- Authority
- BE
- Belgium
- Prior art keywords
- blasters
- benzofurans
- optical
- optical blasters
- benzofurans used
- Prior art date
Links
- MPNFMCAOBNNFJF-UHFFFAOYSA-N 2,3-diphenyl-1-benzofuran Chemical compound C1=CC=CC=C1C1=C(C=2C=CC=CC=2)C2=CC=CC=C2O1 MPNFMCAOBNNFJF-UHFFFAOYSA-N 0.000 title 1
- 230000003287 optical effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/91—Dibenzofurans; Hydrogenated dibenzofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/84—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D307/84—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D307/85—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/92—Naphthofurans; Hydrogenated naphthofurans
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/614—Optical bleaching or brightening in aqueous solvents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH986369 | 1969-06-27 | ||
| US4592270A | 1970-06-12 | 1970-06-12 | |
| US379288A US3900419A (en) | 1969-06-27 | 1973-07-16 | Benzofurans |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE752571A true BE752571A (fr) | 1970-12-28 |
Family
ID=27176328
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE752571D BE752571A (fr) | 1969-06-27 | 1970-06-26 | Benzofurannes utilisables notamment comme azureurs optiques |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3772323A (instruction) |
| BE (1) | BE752571A (instruction) |
| CH (2) | CH986369A4 (instruction) |
| DE (1) | DE2031774A1 (instruction) |
| FR (1) | FR2051384A5 (instruction) |
| GB (1) | GB1313332A (instruction) |
| NL (1) | NL7009485A (instruction) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH986369A4 (instruction) * | 1969-06-27 | 1970-12-31 | ||
| US3940417A (en) * | 1970-12-09 | 1976-02-24 | Ciba-Geigy Corporation | Quaternised benzofuranyl-benzimidazoles |
| US4002423A (en) * | 1971-08-13 | 1977-01-11 | Hoechst Aktiengesellschaft | Benzofuran derivatives process for their preparation and their use as optical brighteners |
| US4039555A (en) * | 1973-02-09 | 1977-08-02 | Hoechst Aktiengesellschaft | Benzofuran derivatives, process for preparing them and their use as optical brighteners |
| CH187973A4 (de) * | 1973-02-09 | 1977-03-31 | Hoechst Ag | Verfahren zum optischen Aufhellen von Textilmaterialien |
| CH597335A5 (instruction) * | 1973-09-14 | 1978-03-31 | Ciba Geigy Ag | |
| US4009994A (en) * | 1974-08-22 | 1977-03-01 | Ciba-Geigy Corporation | Process and product of optical brightening with quaternized benzofuranyl-benzimidazoles |
| CH632628B (de) * | 1976-07-26 | Ciba Geigy Ag | Verfahren zur herstellung von benzofuranyl-benzimidazolen und deren verwendung als optische aufheller. | |
| CH635839A5 (de) * | 1976-08-04 | 1983-04-29 | Sandoz Ag | Verfahren zur herstellung von n-substituierten und quaternierten benzimidazolen und deren verwendung. |
| CH645359A5 (de) * | 1978-11-20 | 1984-09-28 | Ciba Geigy Ag | Lagerstabile, konzentrierte waessrige loesung von benzimidazolium-aufhellern. |
| DE2918965A1 (de) * | 1979-05-11 | 1980-11-20 | Bayer Ag | Benzofuranverbindungen sowie deren verwendung als optische aufheller |
| US4302592A (en) * | 1980-09-15 | 1981-11-24 | Shell Oil Company | Pesticidal 3-(2,3-dihydrobenzofuran-7-yl)-5-methoxy-1,3,4-oxadiazol-2(3H)-one |
| IT1272917B (it) * | 1995-01-20 | 1997-07-01 | 3V Sigma Spa | Derivati di benzossazolo,loro uso come filtri solari e composizioni cosmetiche che li contengono |
| US5518713A (en) * | 1995-02-13 | 1996-05-21 | 3V Inc. | Benzoxazole derivatives, the use thereof as sunscreens and cosmetic compositions containing them |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3103518A (en) * | 1958-01-14 | 1963-09-10 | G -methoxybenzimidazole- | |
| DE1594841A1 (de) * | 1966-01-14 | 1970-07-23 | Bayer Ag | Aufhellungsmittel |
| CH986369A4 (instruction) * | 1969-06-27 | 1970-12-31 |
-
1969
- 1969-06-27 CH CH986369D patent/CH986369A4/xx unknown
- 1969-06-27 CH CH986369A patent/CH509458A/de not_active IP Right Cessation
-
1970
- 1970-06-12 US US00045922A patent/US3772323A/en not_active Expired - Lifetime
- 1970-06-26 NL NL7009485A patent/NL7009485A/xx unknown
- 1970-06-26 GB GB3116570A patent/GB1313332A/en not_active Expired
- 1970-06-26 FR FR7023788A patent/FR2051384A5/fr not_active Expired
- 1970-06-26 DE DE19702031774 patent/DE2031774A1/de not_active Withdrawn
- 1970-06-26 BE BE752571D patent/BE752571A/xx unknown
-
1973
- 1973-07-16 US US379288A patent/US3900419A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2051384A5 (instruction) | 1971-04-02 |
| GB1313332A (en) | 1973-04-11 |
| NL7009485A (instruction) | 1970-12-29 |
| CH509458A (de) | 1971-06-30 |
| US3900419A (en) | 1975-08-19 |
| DE2031774A1 (de) | 1971-01-07 |
| CH986369A4 (instruction) | 1970-12-31 |
| US3772323A (en) | 1973-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT322238B (de) | Brillenglas | |
| AT336305B (de) | Lichtwellen-kopplungsanordnung | |
| BE787576A (fr) | Derives de benzofuranne et leur utilisation comme azureurs optiques | |
| FR2291514A1 (fr) | Coupleur optique | |
| AT297244B (de) | Glasgegenstand | |
| BE752571A (fr) | Benzofurannes utilisables notamment comme azureurs optiques | |
| BR7017311D0 (pt) | Novos esteres de cicloalcenonas | |
| BR7019559D0 (pt) | Projeteis luminosos | |
| BE751417A (fr) | Composes triazolyl-styryliques utilisables comme azureurs optiques | |
| CH506898A (de) | Laser-Anordnung | |
| CH518014A (de) | Hohlleiter-Anordnung | |
| CH498990A (de) | Formstein | |
| SU441726A3 (ru) | Газовый оптический квантовый генератор | |
| BE793273A (fr) | Derives du stilbene utilisables comme azureurs optiques | |
| BE750073A (nl) | Voetstuk | |
| AT294959B (de) | Optoelektronische Anordnung | |
| NL144063B (nl) | Optisch filter. | |
| AT325346B (de) | Verteilerpumpe | |
| AT300115B (de) | Rasterleuchte | |
| BE759538A (fr) | Elements optiques | |
| BE755433A (fr) | Nouvelle poutre composite | |
| TR17159A (tr) | Bulamac halinde doekuem | |
| BE744607A (fr) | Azureurs optiques | |
| AT323202B (de) | Lichtsetzmaschine | |
| BE751871A (fr) | Vinyl-v-triazoles utilisables comme azureurs optiques |