AU8025400B2 - - Google Patents
Info
- Publication number
- AU8025400B2 AU8025400B2 AU8025400B2 AU 8025400 B2 AU8025400 B2 AU 8025400B2 AU 8025400 B2 AU8025400 B2 AU 8025400B2
- Authority
- AU
- Australia
- Prior art keywords
- polypeptide
- binding
- multivalent
- target
- target polypeptide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920001184 polypeptide Polymers 0.000 claims description 416
- 230000027455 binding Effects 0.000 claims description 354
- 210000004080 Milk Anatomy 0.000 claims description 96
- 235000013336 milk Nutrition 0.000 claims description 96
- 239000008267 milk Substances 0.000 claims description 96
- 239000011159 matrix material Substances 0.000 claims description 80
- 239000003446 ligand Substances 0.000 claims description 45
- 239000000203 mixture Substances 0.000 claims description 35
- 102000004965 antibodies Human genes 0.000 claims description 34
- 108090001123 antibodies Proteins 0.000 claims description 34
- 241000124008 Mammalia Species 0.000 claims description 33
- 239000012530 fluid Substances 0.000 claims description 28
- 239000011541 reaction mixture Substances 0.000 claims description 16
- 239000001913 cellulose Substances 0.000 claims description 12
- 229920002678 cellulose Polymers 0.000 claims description 12
- 108060006943 RdRp Proteins 0.000 claims description 2
- 238000002965 ELISA Methods 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- 230000036536 Cave Effects 0.000 claims 1
- 102000004169 proteins and genes Human genes 0.000 description 126
- 108090000623 proteins and genes Proteins 0.000 description 126
- 235000018102 proteins Nutrition 0.000 description 120
- 210000001519 tissues Anatomy 0.000 description 71
- 230000014509 gene expression Effects 0.000 description 50
- 238000003776 cleavage reaction Methods 0.000 description 32
- 210000004027 cells Anatomy 0.000 description 30
- 230000003197 catalytic Effects 0.000 description 25
- 150000001413 amino acids Chemical class 0.000 description 24
- 239000005018 casein Substances 0.000 description 24
- 239000000047 product Substances 0.000 description 21
- 108020004707 nucleic acids Proteins 0.000 description 20
- 150000007523 nucleic acids Chemical class 0.000 description 20
- 102000011632 Caseins Human genes 0.000 description 17
- 108010076119 Caseins Proteins 0.000 description 17
- 235000021240 caseins Nutrition 0.000 description 17
- 238000000746 purification Methods 0.000 description 17
- 210000002919 epithelial cells Anatomy 0.000 description 16
- 241000283707 Capra Species 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 241000283690 Bos taurus Species 0.000 description 14
- 102000024070 binding proteins Human genes 0.000 description 14
- 108091007650 binding proteins Proteins 0.000 description 14
- 229920003013 deoxyribonucleic acid Polymers 0.000 description 14
- 239000012212 insulator Substances 0.000 description 14
- 210000004369 Blood Anatomy 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 13
- 102000004190 Enzymes Human genes 0.000 description 13
- 108090000790 Enzymes Proteins 0.000 description 13
- 210000002700 Urine Anatomy 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 13
- 241001465754 Metazoa Species 0.000 description 12
- 229920001850 Nucleic acid sequence Polymers 0.000 description 12
- 239000008280 blood Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 102000004407 Lactalbumin Human genes 0.000 description 10
- 108090000942 Lactalbumin Proteins 0.000 description 10
- GUBGYTABKSRVRQ-YOLKTULGSA-N Maltose Natural products O([C@@H]1[C@H](O)[C@@H](O)[C@H](O)O[C@H]1CO)[C@@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 GUBGYTABKSRVRQ-YOLKTULGSA-N 0.000 description 10
- 241000700159 Rattus Species 0.000 description 10
- 238000010828 elution Methods 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 230000028327 secretion Effects 0.000 description 10
- 102100005377 BMP2 Human genes 0.000 description 9
- 101700000123 BMP2 Proteins 0.000 description 9
- 229940088598 Enzyme Drugs 0.000 description 9
- 210000004293 Mammary Glands, Human Anatomy 0.000 description 9
- 108091005771 Peptidases Proteins 0.000 description 9
- 102000035443 Peptidases Human genes 0.000 description 9
- 239000004365 Protease Substances 0.000 description 9
- 239000005862 Whey Substances 0.000 description 9
- 108020001507 fusion proteins Proteins 0.000 description 9
- 102000037240 fusion proteins Human genes 0.000 description 9
- 210000002264 Mammary Glands, Animal Anatomy 0.000 description 8
- 241000699666 Mus <mouse, genus> Species 0.000 description 8
- 230000004913 activation Effects 0.000 description 8
- 235000019833 protease Nutrition 0.000 description 8
- 108060001965 CSN2 Proteins 0.000 description 7
- 108020005345 3' Untranslated Regions Proteins 0.000 description 6
- 102100014432 CSN2 Human genes 0.000 description 6
- 229920000401 Three prime untranslated region Polymers 0.000 description 6
- 238000004113 cell culture Methods 0.000 description 6
- 238000005516 engineering process Methods 0.000 description 6
- 230000001900 immune effect Effects 0.000 description 6
- 108091022076 maltose binding proteins Proteins 0.000 description 6
- 235000021247 β-casein Nutrition 0.000 description 6
- 241000283898 Ovis Species 0.000 description 5
- 230000036462 Unbound Effects 0.000 description 5
- 125000000539 amino acid group Chemical group 0.000 description 5
- 238000004166 bioassay Methods 0.000 description 5
- -1 e.g. Substances 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 210000004962 mammalian cells Anatomy 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000001890 transfection Methods 0.000 description 5
- 238000001262 western blot Methods 0.000 description 5
- 235000002198 Annona diversifolia Nutrition 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 4
- 108090000746 Chymosin Proteins 0.000 description 4
- 102000008100 Human Serum Albumin Human genes 0.000 description 4
- 108091006822 Human Serum Albumin Proteins 0.000 description 4
- 210000004185 Liver Anatomy 0.000 description 4
- 102000014171 Milk Proteins Human genes 0.000 description 4
- 108010011756 Milk Proteins Proteins 0.000 description 4
- 241000699660 Mus musculus Species 0.000 description 4
- 210000002966 Serum Anatomy 0.000 description 4
- 241000282898 Sus scrofa Species 0.000 description 4
- 229940019336 antithrombotic Enzymes Drugs 0.000 description 4
- 230000001413 cellular Effects 0.000 description 4
- 238000004520 electroporation Methods 0.000 description 4
- 239000003102 growth factor Substances 0.000 description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 4
- 150000002632 lipids Chemical class 0.000 description 4
- 235000021239 milk protein Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 230000001131 transforming Effects 0.000 description 4
- 108020003076 Amidases Proteins 0.000 description 3
- 102000005922 Amidases Human genes 0.000 description 3
- 229960005348 Antithrombin III Drugs 0.000 description 3
- 102000004411 Antithrombin-III Human genes 0.000 description 3
- 108090000935 Antithrombin-III Proteins 0.000 description 3
- 241000282836 Camelus dromedarius Species 0.000 description 3
- 229940080701 Chymosin Drugs 0.000 description 3
- 229920001405 Coding region Polymers 0.000 description 3
- 241000283073 Equus caballus Species 0.000 description 3
- 102000003951 Erythropoietin Human genes 0.000 description 3
- 108090000394 Erythropoietin Proteins 0.000 description 3
- 241000282842 Lama glama Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- 102000009618 Transforming Growth Factors Human genes 0.000 description 3
- 108010009583 Transforming Growth Factors Proteins 0.000 description 3
- 230000003213 activating Effects 0.000 description 3
- 239000000427 antigen Substances 0.000 description 3
- 102000038129 antigens Human genes 0.000 description 3
- 108091007172 antigens Proteins 0.000 description 3
- 230000001580 bacterial Effects 0.000 description 3
- 235000014633 carbohydrates Nutrition 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- 230000004186 co-expression Effects 0.000 description 3
- 235000013365 dairy product Nutrition 0.000 description 3
- 230000002255 enzymatic Effects 0.000 description 3
- 229940105423 erythropoietin Drugs 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000000855 fermentation Methods 0.000 description 3
- 230000004151 fermentation Effects 0.000 description 3
- 210000004602 germ cell Anatomy 0.000 description 3
- 238000001638 lipofection Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000006011 modification reaction Methods 0.000 description 3
- 230000002797 proteolythic Effects 0.000 description 3
- 238000003259 recombinant expression Methods 0.000 description 3
- 230000001105 regulatory Effects 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229920000160 (ribonucleotides)n+m Polymers 0.000 description 2
- 102100001249 ALB Human genes 0.000 description 2
- 102100018024 ANG Human genes 0.000 description 2
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 2
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 2
- 102000000119 Beta-lactoglobulin Human genes 0.000 description 2
- 108050008461 Beta-lactoglobulin Proteins 0.000 description 2
- 210000002805 Bone Matrix Anatomy 0.000 description 2
- 229940021722 Caseins Drugs 0.000 description 2
- 229920002101 Chitin Polymers 0.000 description 2
- DJHJJVWPFGHIPH-OODMECLYSA-N Chitin Chemical compound O[C@@H]1C(NC(=O)C)[C@H](O)OC(CO)[C@H]1COC[C@H]1C(NC(C)=O)[C@@H](O)[C@H](COC[C@H]2C([C@@H](O)[C@H](O)C(CO)O2)NC(C)=O)C(CO)O1 DJHJJVWPFGHIPH-OODMECLYSA-N 0.000 description 2
- 229920002676 Complementary DNA Polymers 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N Cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- 108010014173 Factor X Proteins 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 101700054771 GCA Proteins 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- 102000004547 Glucosylceramidase Human genes 0.000 description 2
- 108010017544 Glucosylceramidase Proteins 0.000 description 2
- 229940088597 Hormone Drugs 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N Imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 102000018358 Immunoglobulins Human genes 0.000 description 2
- 108060003951 Immunoglobulins Proteins 0.000 description 2
- 102000004877 Insulin Human genes 0.000 description 2
- 108090001061 Insulin Proteins 0.000 description 2
- 102100011875 LTF Human genes 0.000 description 2
- 229940078795 Lactoferrin Drugs 0.000 description 2
- 108010063045 Lactoferrin Proteins 0.000 description 2
- 101700061402 MTRX Proteins 0.000 description 2
- 102000015528 Myelin Basic Protein Human genes 0.000 description 2
- 108010025255 Myelin Basic Protein Proteins 0.000 description 2
- 229920002649 Nonsense suppressor Polymers 0.000 description 2
- 108010076181 Proinsulin Proteins 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- 229940097325 Prolactin Drugs 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 101710017884 Segment-8 Proteins 0.000 description 2
- 102000003978 Tissue plasminogen activator Human genes 0.000 description 2
- 108090000373 Tissue plasminogen activator Proteins 0.000 description 2
- 108020003635 Untranslated Regions Proteins 0.000 description 2
- 229920000146 Untranslated region Polymers 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 108010072788 angiogenin Proteins 0.000 description 2
- 108091006028 chimera Proteins 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- 230000002708 enhancing Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229940012426 factor X Drugs 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- 235000021242 lactoferrin Nutrition 0.000 description 2
- 238000000520 microinjection Methods 0.000 description 2
- 102000005614 monoclonal antibodies Human genes 0.000 description 2
- 108010045030 monoclonal antibodies Proteins 0.000 description 2
- 101700045377 mvp1 Proteins 0.000 description 2
- 210000000287 oocyte Anatomy 0.000 description 2
- 210000000056 organs Anatomy 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 230000000087 stabilizing Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229960000187 tissue plasminogen activator Drugs 0.000 description 2
- 239000002753 trypsin inhibitor Substances 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 235000021246 κ-casein Nutrition 0.000 description 2
- 108020003589 5' Untranslated Regions Proteins 0.000 description 1
- 101710027066 ALB Proteins 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 108010077805 Bacterial Proteins Proteins 0.000 description 1
- 102000024969 Bacterial Proteins Human genes 0.000 description 1
- 102000001893 Bone Morphogenetic Protein Receptors Human genes 0.000 description 1
- 108010040422 Bone Morphogenetic Protein Receptors Proteins 0.000 description 1
- 210000000988 Bone and Bones Anatomy 0.000 description 1
- 241000283725 Bos Species 0.000 description 1
- 101710010743 CSN1S1 Proteins 0.000 description 1
- 108060001966 CSN3 Proteins 0.000 description 1
- 102100002888 CSN3 Human genes 0.000 description 1
- 241000282832 Camelidae Species 0.000 description 1
- 102000012286 Chitinases Human genes 0.000 description 1
- 108010022172 Chitinases Proteins 0.000 description 1
- 108010047041 Complementarity Determining Regions Proteins 0.000 description 1
- 101710023634 Csn1s2a Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 108010056651 EC 2.5.1.61 Proteins 0.000 description 1
- 102000016942 Elastin Human genes 0.000 description 1
- 108010014258 Elastin Proteins 0.000 description 1
- 210000001161 Embryo, Mammalian Anatomy 0.000 description 1
- 210000003038 Endothelium Anatomy 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 102100006624 F9 Human genes 0.000 description 1
- 230000035693 Fab Effects 0.000 description 1
- 108010076282 Factor IX Proteins 0.000 description 1
- 108010054218 Factor VIII Proteins 0.000 description 1
- 229960000301 Factor VIII Drugs 0.000 description 1
- 102000001690 Factor VIII Human genes 0.000 description 1
- 102000001133 Fertilins Human genes 0.000 description 1
- 108010069446 Fertilins Proteins 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 229940012952 Fibrinogen Drugs 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 229940019698 Fibrinogen containing hemostatics Drugs 0.000 description 1
- 229940028334 Follicle Stimulating Hormone Drugs 0.000 description 1
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 description 1
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 description 1
- 101700048985 GATA1 Proteins 0.000 description 1
- 102100010478 GATA1 Human genes 0.000 description 1
- 102000008214 Glutamate decarboxylases Human genes 0.000 description 1
- 108091022086 Glutamate decarboxylases Proteins 0.000 description 1
- RWSXRVCMGQZWBV-WDSKDSINSA-N Glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 1
- 229960003180 Glutathione Drugs 0.000 description 1
- 108010024636 Glutathione Proteins 0.000 description 1
- 240000001340 Gmelina philippensis Species 0.000 description 1
- 102100016162 HMBS Human genes 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 102000003864 Human Follicle Stimulating Hormone Human genes 0.000 description 1
- 108010082302 Human Follicle Stimulating Hormone Proteins 0.000 description 1
- 229940072221 IMMUNOGLOBULINS Drugs 0.000 description 1
- 108060001040 JUN Proteins 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 241000282838 Lama Species 0.000 description 1
- 229920001320 Leader sequence (mRNA) Polymers 0.000 description 1
- 210000004072 Lung Anatomy 0.000 description 1
- 102100015262 MYC Human genes 0.000 description 1
- 102100018549 MYOG Human genes 0.000 description 1
- 108010014251 Muramidase Proteins 0.000 description 1
- 102000016943 Muramidase Human genes 0.000 description 1
- 210000003205 Muscles Anatomy 0.000 description 1
- 108010035768 MyoD Protein Proteins 0.000 description 1
- 108010056785 Myogenin Proteins 0.000 description 1
- 102000003505 Myosin family Human genes 0.000 description 1
- 108060008487 Myosin family Proteins 0.000 description 1
- 102000008730 Nestin Human genes 0.000 description 1
- 108010088225 Nestin Proteins 0.000 description 1
- 101700037331 PAX1 Proteins 0.000 description 1
- 210000002381 Plasma Anatomy 0.000 description 1
- 108020004412 RNA 3' Polyadenylation Signals Proteins 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 102000007312 Recombinant Proteins Human genes 0.000 description 1
- 108010033725 Recombinant Proteins Proteins 0.000 description 1
- 102000006382 Ribonucleases Human genes 0.000 description 1
- 108010083644 Ribonucleases Proteins 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 241000282849 Ruminantia Species 0.000 description 1
- 101710009148 SERPINA1 Proteins 0.000 description 1
- 102100017253 SFTPC Human genes 0.000 description 1
- 101710033335 SFTPC Proteins 0.000 description 1
- 102100002942 SYCP1 Human genes 0.000 description 1
- 101700084525 SYCP1 Proteins 0.000 description 1
- 210000003296 Saliva Anatomy 0.000 description 1
- 108010071390 Serum Albumin Proteins 0.000 description 1
- 108010070144 Single-Chain Antibodies Proteins 0.000 description 1
- 102000005632 Single-Chain Antibodies Human genes 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 102000019197 Superoxide Dismutase Human genes 0.000 description 1
- 108010012715 Superoxide Dismutase Proteins 0.000 description 1
- 210000004243 Sweat Anatomy 0.000 description 1
- 101710037124 TEK Proteins 0.000 description 1
- 101710012548 TIE1 Proteins 0.000 description 1
- 210000001550 Testis Anatomy 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H Tricalcium phosphate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 102000011777 Wnt1 Protein Human genes 0.000 description 1
- 108010062203 Wnt1 Protein Proteins 0.000 description 1
- 229940050528 albumin Drugs 0.000 description 1
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 description 1
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
- 235000020244 animal milk Nutrition 0.000 description 1
- 230000001475 anti-trypsic Effects 0.000 description 1
- 229960000070 antineoplastic Monoclonal antibodies Drugs 0.000 description 1
- 238000001574 biopsy Methods 0.000 description 1
- 239000011616 biotin Substances 0.000 description 1
- 239000003114 blood coagulation factor Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L cacl2 Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000000423 cell based assay Methods 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000000975 co-precipitation Methods 0.000 description 1
- 230000000295 complement Effects 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 239000003636 conditioned culture media Substances 0.000 description 1
- 238000007821 culture assay Methods 0.000 description 1
- 201000009910 diseases by infectious agent Diseases 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N edta Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 229920002549 elastin Polymers 0.000 description 1
- 210000002308 embryonic cell Anatomy 0.000 description 1
- 108010048031 engrailed 2 protein Proteins 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 229960004222 factor IX Drugs 0.000 description 1
- 238000010353 genetic engineering Methods 0.000 description 1
- 235000020251 goat milk Nutrition 0.000 description 1
- 239000000122 growth hormone Substances 0.000 description 1
- 239000001963 growth media Substances 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-O guanidinium Chemical compound NC(N)=[NH2+] ZRALSGWEFCBTJO-UHFFFAOYSA-O 0.000 description 1
- 101700058970 hbaA Proteins 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000002209 hydrophobic Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000000415 inactivating Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000017730 intein-mediated protein splicing Effects 0.000 description 1
- 210000003292 kidney cell Anatomy 0.000 description 1
- 229960000274 lysozyme Drugs 0.000 description 1
- 235000010335 lysozyme Nutrition 0.000 description 1
- 239000004325 lysozyme Substances 0.000 description 1
- 230000023247 mammary gland development Effects 0.000 description 1
- 239000002609 media Substances 0.000 description 1
- 230000001404 mediated Effects 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- 229960000060 monoclonal antibodies Drugs 0.000 description 1
- 230000001537 neural Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 229920001894 non-coding RNA Polymers 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 125000003835 nucleoside group Chemical group 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000002823 phage display Methods 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N precursor Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 210000001236 prokaryotic cell Anatomy 0.000 description 1
- 108010043277 recombinant soluble CD4 Proteins 0.000 description 1
- 210000001082 somatic cell Anatomy 0.000 description 1
- 235000014347 soups Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 101700045588 st Proteins 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 230000001225 therapeutic Effects 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000002103 transcriptional Effects 0.000 description 1
- 230000001052 transient Effects 0.000 description 1
- 230000003612 virological Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
AU781944B2 (en) | Methods of producing a target molecule in a transgenic animal and purification of the target molecule | |
US20040226053A1 (en) | Methods of producing a target molecule in a transgenic animal and purification of the target molecule | |
CA2506629A1 (fr) | Production stable d'anticorps modifies dans le lait, et procedes de production | |
US20060179500A1 (en) | Methods and vectors for improving nucleic acid expression | |
US20040092719A1 (en) | Isolation of immunoglobulin molecules that lack inter-heavy chain disulfide bonds | |
AU1462200A (en) | Transgenic and cloned mammals | |
AU8025400B2 (fr) | ||
US20030177513A1 (en) | Transgenic and cloned mammals | |
AU781915B2 (en) | Method of purifying heterologous proteins | |
US20030046716A1 (en) | Transgenically produced platelet derived growth factor | |
US20050193431A1 (en) | Somatic cell line | |
EP1375654A2 (fr) | Mammifères trangéniques et clonés | |
AU2003204830B2 (en) | Transgenic and cloned mammals | |
AU2004210607A1 (en) | Transgenic and cloned mammals | |
AU2008202456A1 (en) | Transgenic and cloned mammals |