AU6500574A - Prostanoic acid derivatives - Google Patents
Prostanoic acid derivativesInfo
- Publication number
- AU6500574A AU6500574A AU65005/74A AU6500574A AU6500574A AU 6500574 A AU6500574 A AU 6500574A AU 65005/74 A AU65005/74 A AU 65005/74A AU 6500574 A AU6500574 A AU 6500574A AU 6500574 A AU6500574 A AU 6500574A
- Authority
- AU
- Australia
- Prior art keywords
- acid derivatives
- prostanoic acid
- prostanoic
- derivatives
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2305437A DE2305437A1 (de) | 1973-02-03 | 1973-02-03 | Prostansaeurederivate |
| DE2364447A DE2364447A1 (de) | 1973-12-24 | 1973-12-24 | Prostansaeurederivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU6500574A true AU6500574A (en) | 1975-07-31 |
Family
ID=25764643
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU65005/74A Expired AU6500574A (en) | 1973-02-03 | 1974-01-30 | Prostanoic acid derivatives |
Country Status (7)
| Country | Link |
|---|---|
| AU (1) | AU6500574A (es) |
| DD (1) | DD109373A5 (es) |
| ES (2) | ES422877A1 (es) |
| FR (1) | FR2215966B1 (es) |
| GB (1) | GB1442268A (es) |
| IL (1) | IL44113A (es) |
| NL (1) | NL7401448A (es) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1499253A (en) * | 1975-02-14 | 1978-01-25 | Upjohn Co | Prostaglandins |
-
1974
- 1974-01-24 GB GB338574A patent/GB1442268A/en not_active Expired
- 1974-01-29 IL IL44113A patent/IL44113A/en unknown
- 1974-01-30 AU AU65005/74A patent/AU6500574A/en not_active Expired
- 1974-02-01 NL NL7401448A patent/NL7401448A/xx unknown
- 1974-02-01 DD DD176323A patent/DD109373A5/xx unknown
- 1974-02-01 FR FR7403402A patent/FR2215966B1/fr not_active Expired
- 1974-02-02 ES ES422877A patent/ES422877A1/es not_active Expired
- 1974-02-02 ES ES422876A patent/ES422876A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DD109373A5 (es) | 1974-11-05 |
| NL7401448A (es) | 1974-08-06 |
| FR2215966B1 (es) | 1976-12-24 |
| GB1442268A (en) | 1976-07-14 |
| FR2215966A1 (es) | 1974-08-30 |
| ES422876A1 (es) | 1976-09-16 |
| IL44113A (en) | 1976-11-30 |
| IL44113A0 (en) | 1974-05-16 |
| ES422877A1 (es) | 1976-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL45299A0 (en) | Prostanoic acid derivatives | |
| ZA751391B (en) | 16-oxygenated prostanoic acid derivatives | |
| MY7700132A (en) | Prostanoic acid derivatives | |
| ZA742417B (en) | Mycophenolic acid derivatives | |
| IL39376A0 (en) | Prostanoic acid derivatives | |
| IL43248A0 (en) | Prostanoic acid derivatives | |
| ZA741906B (en) | 2- anilino-nicotinic acid derivatives | |
| IL46296A (en) | Pregnan-21-oic acid derivatives | |
| AU6939974A (en) | Sulphamoylbenzoic acid | |
| PH14870A (en) | Oxamic acid derivatives | |
| ZA742734B (en) | Derivatives of 1,3-benzodioxole-2-carboxylic acid | |
| CA1028699A (en) | Prostanoic acid derivatives | |
| IL44613A (en) | 3,20-dioxo-pregn-4-enoic acid derivatives | |
| ZA752022B (en) | Prostanoic acid derivatives | |
| ZA754491B (en) | Prostanoic acid derivatives | |
| IL44025A0 (en) | Prostadienoic acid derivatives | |
| GB1483379A (en) | 7-halo-methyl-17-hydroxy-3-oxo-17alpha-pregn-4-ene-21-carboxylic acid ypsilon-lactones | |
| AU6566674A (en) | Beta-pyridyl-carbonamido-alkane-sulfonic acid salts | |
| AU6500574A (en) | Prostanoic acid derivatives | |
| AU8324075A (en) | Prostanoic acid derivatives | |
| ZA754721B (en) | Prostanoic acid derivatives | |
| ZA74469B (en) | Prostanoic acid derivatives | |
| IL45173A0 (en) | Cyclopentylheptanoic and-cis-5-heptanoic acid derivatives | |
| IL45084A0 (en) | Prostenoic acid derivatives | |
| ZA748127B (en) | New pregnan-21-oic acid derivatives |