AU5728280A - Benzoquinolizine carboxylic acid vetinary medicaments - Google Patents
Benzoquinolizine carboxylic acid vetinary medicamentsInfo
- Publication number
- AU5728280A AU5728280A AU57282/80A AU5728280A AU5728280A AU 5728280 A AU5728280 A AU 5728280A AU 57282/80 A AU57282/80 A AU 57282/80A AU 5728280 A AU5728280 A AU 5728280A AU 5728280 A AU5728280 A AU 5728280A
- Authority
- AU
- Australia
- Prior art keywords
- vetinary
- medicaments
- carboxylic acid
- benzoquinolizine carboxylic
- benzoquinolizine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- SWWBKIRNVOWLRS-UHFFFAOYSA-N 4h-benzo[a]quinolizine-1-carboxylic acid Chemical compound C1=CC=C2C3=C(C(=O)O)C=CCN3C=CC2=C1 SWWBKIRNVOWLRS-UHFFFAOYSA-N 0.000 title 1
- 239000003814 drug Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/03—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/04—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing a quinolizine ring system condensed with only one six-membered carbocyclic ring, e.g. julolidine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21723/79A IT1111918B (it) | 1979-04-10 | 1979-04-10 | Medicamento veterinario a base di acidi benzochinolizin carbossilici e loro derivati |
| IT2172379 | 1979-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU5728280A true AU5728280A (en) | 1980-10-16 |
Family
ID=11185937
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU57282/80A Withdrawn AU5728280A (en) | 1979-04-10 | 1980-04-09 | Benzoquinolizine carboxylic acid vetinary medicaments |
Country Status (7)
| Country | Link |
|---|---|
| AU (1) | AU5728280A (OSRAM) |
| FR (1) | FR2453647A1 (OSRAM) |
| GB (1) | GB2049420A (OSRAM) |
| IE (1) | IE52296B1 (OSRAM) |
| IT (1) | IT1111918B (OSRAM) |
| NZ (1) | NZ193374A (OSRAM) |
| ZA (1) | ZA802088B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4380543A (en) * | 1981-11-06 | 1983-04-19 | Riker Laboratories, Inc. | Antimicrobial 8-cyano-6,7-dihydro-5-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acids |
| HU206975B (en) * | 1991-03-14 | 1993-03-01 | Reanal Finomvegyszergyar | Process for producing granulation and veterinary composition comprising water-soluble flumequine complex |
| HUP9601361A3 (en) * | 1996-05-21 | 1999-04-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing optically active compounds |
| HUP9601362A3 (en) * | 1996-05-21 | 1999-04-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing optically active compounds |
-
1979
- 1979-04-10 IT IT21723/79A patent/IT1111918B/it active
-
1980
- 1980-04-09 NZ NZ193374A patent/NZ193374A/xx unknown
- 1980-04-09 IE IE712/80A patent/IE52296B1/en not_active IP Right Cessation
- 1980-04-09 AU AU57282/80A patent/AU5728280A/en not_active Withdrawn
- 1980-04-09 ZA ZA00802088A patent/ZA802088B/xx unknown
- 1980-04-10 FR FR8008061A patent/FR2453647A1/fr active Granted
- 1980-04-10 GB GB8011882A patent/GB2049420A/en not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2453647B1 (OSRAM) | 1983-12-23 |
| IT1111918B (it) | 1986-01-13 |
| IE800712L (en) | 1980-10-10 |
| NZ193374A (en) | 1982-12-07 |
| IE52296B1 (en) | 1987-09-02 |
| IT7921723A0 (it) | 1979-04-10 |
| FR2453647A1 (fr) | 1980-11-07 |
| GB2049420A (en) | 1980-12-31 |
| ZA802088B (en) | 1981-08-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU4413779A (en) | Modified azulmic acid | |
| AU527702B2 (en) | Pyridyloxy-phenoxy-alpha-propionic acid aminoalkyl esters | |
| AU531501B2 (en) | 3-quinoline-carboxylic acid | |
| AU535924B2 (en) | Carboxylic acid derivatives | |
| AU541322B2 (en) | 6-beta-halopenicillanic acid derivatiges | |
| AU541738B2 (en) | Cyclohexane carboxylic acid derivatives | |
| AU534582B2 (en) | Mercaptoacyldihydropyrazole carboxylic acid derivatives | |
| AU525371B2 (en) | Phenylcyclopropane carboxylic acid derivatives | |
| AU526877B2 (en) | Phenyl-alkanoic acid derivative | |
| AU6078080A (en) | N-methyl-carbamic acid o-pyrazol-4-yl esters | |
| AU561025B2 (en) | 2,2-dimethyl-5-phenoxypentanoic acid benzamides | |
| AU532837B2 (en) | N,n-dimethyl-carbamic acid o-pyrazolyl esters | |
| AU531828B2 (en) | N,n-dimethyl-carbamic acid o-pyrimidinyl esters | |
| AU5863380A (en) | Acid derivatives | |
| AU4668179A (en) | N,n-dimethyl-0-pyrazolyl-carbamic acid esters | |
| AU525915B2 (en) | Bromostyryl-cyclopropanecarboxylic acid phenoxybenzy esters | |
| AU535251B2 (en) | Benzimidazolylcarbamic acid esters | |
| AU533620B2 (en) | Pyrrolidinyl-sulfamoylbenzoic acid derivatives | |
| AU4835479A (en) | Dihalovinylcyclopropanethiolic acid esters | |
| AU529268B2 (en) | Tetrahaloethylcyclopropanecarboxylic acid esters | |
| AU537900B2 (en) | Dihydronicotinic acid derivatives | |
| AU536508B2 (en) | Aziridine-2-carboxylic acid | |
| AU531347B2 (en) | Substituted carbanilic acid estors | |
| AU537536B2 (en) | Carboxylic acid hydrazides | |
| AU5758980A (en) | Clauulanic acid derivatives |