AU569307B2 - 3-phenoxy-1-azetidinecarboxamides - Google Patents
3-phenoxy-1-azetidinecarboxamidesInfo
- Publication number
- AU569307B2 AU569307B2 AU30257/84A AU3025784A AU569307B2 AU 569307 B2 AU569307 B2 AU 569307B2 AU 30257/84 A AU30257/84 A AU 30257/84A AU 3025784 A AU3025784 A AU 3025784A AU 569307 B2 AU569307 B2 AU 569307B2
- Authority
- AU
- Australia
- Prior art keywords
- azetidinecarboxamides
- phenoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- XQHOIPJEWVQKGA-UHFFFAOYSA-N 3-phenoxyazetidine-1-carboxamide Chemical class C1N(C(=O)N)CC1OC1=CC=CC=C1 XQHOIPJEWVQKGA-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US511077 | 1983-07-06 | ||
| US06/511,077 US4594189A (en) | 1983-07-06 | 1983-07-06 | Process for preparing 3-phenoxy-1-azetidines and carboxamide derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3025784A AU3025784A (en) | 1985-01-10 |
| AU569307B2 true AU569307B2 (en) | 1988-01-28 |
Family
ID=24033376
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU30257/84A Ceased AU569307B2 (en) | 1983-07-06 | 1984-07-04 | 3-phenoxy-1-azetidinecarboxamides |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4594189A (Direct) |
| EP (1) | EP0131435B1 (Direct) |
| JP (1) | JPS6036457A (Direct) |
| AU (1) | AU569307B2 (Direct) |
| CA (1) | CA1221975A (Direct) |
| DE (1) | DE3466685D1 (Direct) |
| PH (1) | PH20894A (Direct) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU599312B2 (en) * | 1985-02-28 | 1990-07-19 | A.H. Robins Company, Incorporated | Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides |
| AU599585B2 (en) * | 1985-02-28 | 1990-07-26 | A.H. Robins Company, Incorporated | 3-Aryloxyazetidine carboxamides as anticonvulsants and antiepileptics |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU571258B2 (en) * | 1978-04-18 | 1988-04-14 | A.H. Robins Company, Incorporated | N-lower alkyl-3-phenoxy-1-azetidinecarboxamides |
| US4956359A (en) * | 1985-02-28 | 1990-09-11 | A. H. Robins Company, Inc. | 3-aryloxy and 3-arylthioazetidinecarboxamides as anticonvulsants and antiepileptics |
| US5068231A (en) * | 1985-02-28 | 1991-11-26 | A. H. Robins Company Incorporated | Method of treating muscular tension, muscle spasticity and anxiety with 3-aryloxy and 3-arylthioazetidinecarboxamides |
| US5183903A (en) * | 1991-11-26 | 1993-02-02 | A. H. Robins Company, Incorporated | Urea fusion process for the synthesis of 3-phenoxy-1-azetidinecarboxamides |
| CN114315494B (zh) * | 2021-12-29 | 2023-09-22 | 苏州楚凯药业有限公司 | 一种(s)-2-甲基氮杂环丁烷盐酸盐的制备方法 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU6301180A (en) * | 1980-10-07 | 1982-04-22 | A.H. Robins Company, Incorporated | N-alkyl o-phenoxy-1-azetidinecarboxamides |
| AU1459783A (en) * | 1982-08-19 | 1984-02-23 | A.H. Robins Company, Incorporated | 3-phenoxy-1-acetidine carboxamides |
| AU3225284A (en) * | 1978-04-18 | 1985-04-26 | A.H. Robins Company, Incorporated | N-lower alkyl-3-phenoxy-1-azetidinecarboxamides |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3094518A (en) * | 1963-06-18 | Novel carbamyl-azetidine compounds | ||
| US4031221A (en) * | 1974-06-17 | 1977-06-21 | American Hoechst Corporation | Method of treating pain and hypertension |
| US4379151A (en) * | 1978-03-14 | 1983-04-05 | A. H. Robins Company, Inc. | 3-Phenoxyazetidines for anorexigenic activity |
| US4226861A (en) * | 1978-04-18 | 1980-10-07 | A. H. Robins Company, Inc. | N-Lower-alkyl 3-phenoxy-1-azetidinecarboxamides |
| GB2085427B (en) * | 1980-10-08 | 1984-12-05 | Robins Co Inc A H | 3-phenoxyazetidines |
| US4505907A (en) * | 1982-09-02 | 1985-03-19 | A. H. Robins Company, Inc. | N-Formyl and N-hydroxymethyl-3-phenoxy-1-azetidinecarboxamides |
-
1983
- 1983-07-06 US US06/511,077 patent/US4594189A/en not_active Expired - Lifetime
-
1984
- 1984-07-04 AU AU30257/84A patent/AU569307B2/en not_active Ceased
- 1984-07-04 CA CA000458081A patent/CA1221975A/en not_active Expired
- 1984-07-05 DE DE8484304600T patent/DE3466685D1/de not_active Expired
- 1984-07-05 JP JP59139740A patent/JPS6036457A/ja active Granted
- 1984-07-05 EP EP84304600A patent/EP0131435B1/en not_active Expired
- 1984-07-06 PH PH30932A patent/PH20894A/en unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU3225284A (en) * | 1978-04-18 | 1985-04-26 | A.H. Robins Company, Incorporated | N-lower alkyl-3-phenoxy-1-azetidinecarboxamides |
| AU6301180A (en) * | 1980-10-07 | 1982-04-22 | A.H. Robins Company, Incorporated | N-alkyl o-phenoxy-1-azetidinecarboxamides |
| AU1459783A (en) * | 1982-08-19 | 1984-02-23 | A.H. Robins Company, Incorporated | 3-phenoxy-1-acetidine carboxamides |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU599312B2 (en) * | 1985-02-28 | 1990-07-19 | A.H. Robins Company, Incorporated | Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides |
| AU599585B2 (en) * | 1985-02-28 | 1990-07-26 | A.H. Robins Company, Incorporated | 3-Aryloxyazetidine carboxamides as anticonvulsants and antiepileptics |
Also Published As
| Publication number | Publication date |
|---|---|
| PH20894A (en) | 1987-05-27 |
| AU3025784A (en) | 1985-01-10 |
| EP0131435B1 (en) | 1987-10-07 |
| US4594189A (en) | 1986-06-10 |
| JPH0542429B2 (Direct) | 1993-06-28 |
| DE3466685D1 (en) | 1987-11-12 |
| CA1221975A (en) | 1987-05-19 |
| EP0131435A1 (en) | 1985-01-16 |
| JPS6036457A (ja) | 1985-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU3047684A (en) | 2-hydroxy-5-acryloxyalkylphenyl -2h- benzotriazoles | |
| AU3040384A (en) | Fluoro-terpolymers | |
| AU2936184A (en) | 13alpha-gonanes | |
| AU2773884A (en) | Pyridyl- and pyrimidyl- sulphonamides | |
| AU2768784A (en) | Carry-cot | |
| AU2810384A (en) | Nivamaler | |
| AU2836184A (en) | Desensitiser | |
| AU2670684A (en) | N-aryl-alpha-amino-carboxamides | |
| AU2867284A (en) | Korpertrainingsgerat | |
| AU2478684A (en) | Branch-copolymers | |
| AU2809484A (en) | N-pyridylindoles | |
| AU2449484A (en) | N-piperazinylalkanoylanilides | |
| AU2692984A (en) | Benzoquinolizines | |
| AU2952484A (en) | 6-deoxyanthracyclines | |
| AU3025784A (en) | 3-phenoxy-1-azetidinecarboxamides | |
| AU2743684A (en) | 4-phenyl-tetrahydro-furano-pyridines | |
| AU2543484A (en) | Sky-light | |
| AU2580684A (en) | Pyridyl-benzoxazines | |
| AU2917784A (en) | Thiazolo - and thiazinobenzimidazoles | |
| AU2454184A (en) | Aroylimidazolones | |
| AU2445584A (en) | D-homosteroids | |
| AU3036384A (en) | Mini - somatostatins | |
| AU2610884A (en) | Benzobisoxazinetetra-ones | |
| AU2814784A (en) | Larmsystem | |
| AU2682284A (en) | Diphenylazomethines |