AU568021B2 - A process for the preparation of cyclobutene-substituted aromatic hydro-carbons. - Google Patents
A process for the preparation of cyclobutene-substituted aromatic hydro-carbons.Info
- Publication number
- AU568021B2 AU568021B2 AU44002/85A AU4400285A AU568021B2 AU 568021 B2 AU568021 B2 AU 568021B2 AU 44002/85 A AU44002/85 A AU 44002/85A AU 4400285 A AU4400285 A AU 4400285A AU 568021 B2 AU568021 B2 AU 568021B2
- Authority
- AU
- Australia
- Prior art keywords
- ortho
- aromatic hydrocarbon
- alkyl
- benzene
- halomethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 150000004945 aromatic hydrocarbons Chemical class 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 22
- 238000002360 preparation method Methods 0.000 title claims description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 40
- 239000002904 solvent Substances 0.000 claims description 21
- -1 alkyl halomethyl aromatic hydrocarbon Chemical class 0.000 claims description 19
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 claims description 16
- 238000000197 pyrolysis Methods 0.000 claims description 14
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 13
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Chemical class C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 235000010290 biphenyl Nutrition 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000004305 biphenyl Chemical class 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims description 4
- ZDZHCHYQNPQSGG-UHFFFAOYSA-N binaphthyl group Chemical group C1(=CC=CC2=CC=CC=C12)C1=CC=CC2=CC=CC=C12 ZDZHCHYQNPQSGG-UHFFFAOYSA-N 0.000 claims description 3
- 125000006267 biphenyl group Chemical class 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims 2
- PYHXGXCGESYPCW-UHFFFAOYSA-M 2,2-diphenylacetate Chemical compound C=1C=CC=CC=1C(C(=O)[O-])C1=CC=CC=C1 PYHXGXCGESYPCW-UHFFFAOYSA-M 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- DLAHAXOYRFRPFQ-UHFFFAOYSA-N dodecyl benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC=CC=C1 DLAHAXOYRFRPFQ-UHFFFAOYSA-N 0.000 claims 1
- 229940049953 phenylacetate Drugs 0.000 claims 1
- 239000000047 product Substances 0.000 description 27
- 239000007858 starting material Substances 0.000 description 15
- 239000000376 reactant Substances 0.000 description 14
- 125000001424 substituent group Chemical group 0.000 description 13
- 125000003118 aryl group Chemical group 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 125000001183 hydrocarbyl group Chemical group 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 7
- ZAEQIUHBBXZXDA-UHFFFAOYSA-N methyl 3-(chloromethyl)-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C(CCl)=C1 ZAEQIUHBBXZXDA-UHFFFAOYSA-N 0.000 description 7
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000010453 quartz Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 239000003085 diluting agent Substances 0.000 description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- 150000003857 carboxamides Chemical class 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 229940095102 methyl benzoate Drugs 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- WHEATZOONURNGF-UHFFFAOYSA-N benzocyclobutadiene Chemical compound C1=CC=C2C=CC2=C1 WHEATZOONURNGF-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 150000004074 biphenyls Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004970 halomethyl group Chemical group 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- OMOOHFFFXDHVQI-UHFFFAOYSA-N 1-(chloromethyl)-2-ethyl-4-methoxybenzene Chemical compound CCC1=CC(OC)=CC=C1CCl OMOOHFFFXDHVQI-UHFFFAOYSA-N 0.000 description 1
- JLLWDRAZPXDTMF-UHFFFAOYSA-N 1-(chloromethyl)-2-ethyl-4-propoxybenzene Chemical compound CCCOC1=CC=C(CCl)C(CC)=C1 JLLWDRAZPXDTMF-UHFFFAOYSA-N 0.000 description 1
- KKHAJWFTMBCCTE-UHFFFAOYSA-N 1-(chloromethyl)-2-methyl-4-pentoxybenzene Chemical compound CCCCCOC1=CC=C(CCl)C(C)=C1 KKHAJWFTMBCCTE-UHFFFAOYSA-N 0.000 description 1
- NRZMREJYPPZBNU-UHFFFAOYSA-N 1-(chloromethyl)-2-methyl-4-propoxybenzene Chemical compound CCCOC1=CC=C(CCl)C(C)=C1 NRZMREJYPPZBNU-UHFFFAOYSA-N 0.000 description 1
- VQRBXYBBGHOGFT-UHFFFAOYSA-N 1-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCl VQRBXYBBGHOGFT-UHFFFAOYSA-N 0.000 description 1
- IZIIPLCEAZIGFD-UHFFFAOYSA-N 1-(chloromethyl)-4-ethoxy-2-ethylbenzene Chemical compound CCOC1=CC=C(CCl)C(CC)=C1 IZIIPLCEAZIGFD-UHFFFAOYSA-N 0.000 description 1
- SCHBATMNWUJBLJ-UHFFFAOYSA-N 1-(chloromethyl)-4-ethoxy-2-propylbenzene Chemical compound CCCC1=CC(OCC)=CC=C1CCl SCHBATMNWUJBLJ-UHFFFAOYSA-N 0.000 description 1
- MRDCOPHJGMPTTM-UHFFFAOYSA-N 1-(chloromethyl)-4-hexoxy-2-methylbenzene Chemical compound CCCCCCOC1=CC=C(CCl)C(C)=C1 MRDCOPHJGMPTTM-UHFFFAOYSA-N 0.000 description 1
- AQMNBXSAFVAZNH-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxy-2-methylbenzene Chemical compound COC1=CC=C(CCl)C(C)=C1 AQMNBXSAFVAZNH-UHFFFAOYSA-N 0.000 description 1
- OEHNMUKZSLNZBO-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxy-2-propylbenzene Chemical compound CCCC1=CC(OC)=CC=C1CCl OEHNMUKZSLNZBO-UHFFFAOYSA-N 0.000 description 1
- JNSJENJIFJIAEO-UHFFFAOYSA-N 1-(chloromethyl)-4-pentoxy-2-propylbenzene Chemical compound CCCCCOC1=CC=C(CCl)C(CCC)=C1 JNSJENJIFJIAEO-UHFFFAOYSA-N 0.000 description 1
- VUARHDJVWUDZRK-UHFFFAOYSA-N 1-(chloromethyl)-4-propoxy-2-propylbenzene Chemical compound CCCOC1=CC=C(CCl)C(CCC)=C1 VUARHDJVWUDZRK-UHFFFAOYSA-N 0.000 description 1
- QTBCCYJNTXZDCM-UHFFFAOYSA-N 1-butoxy-2-chloro-3,4-dimethylbenzene Chemical compound CCCCOC1=CC=C(C)C(C)=C1Cl QTBCCYJNTXZDCM-UHFFFAOYSA-N 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- NOUPPSWLQUSEQB-UHFFFAOYSA-N 2-butyl-1-(chloromethyl)-4-ethoxybenzene Chemical compound CCCCC1=CC(OCC)=CC=C1CCl NOUPPSWLQUSEQB-UHFFFAOYSA-N 0.000 description 1
- MQMVIRVTIRSONB-UHFFFAOYSA-N 2-butyl-1-(chloromethyl)-4-hexoxybenzene Chemical compound CCCCCCOC1=CC=C(CCl)C(CCCC)=C1 MQMVIRVTIRSONB-UHFFFAOYSA-N 0.000 description 1
- VDDUPTQTENXOKS-UHFFFAOYSA-N 2-butyl-1-(chloromethyl)-4-propoxybenzene Chemical compound CCCCC1=CC(OCCC)=CC=C1CCl VDDUPTQTENXOKS-UHFFFAOYSA-N 0.000 description 1
- COZSEJRWCLXYJQ-UHFFFAOYSA-N 2-chloro-1-hexoxy-4-methyl-3-propylbenzene Chemical compound CCCCCCOC1=CC=C(C)C(CCC)=C1Cl COZSEJRWCLXYJQ-UHFFFAOYSA-N 0.000 description 1
- NXTPDDGFUYTMSO-UHFFFAOYSA-N 4-butoxy-1-(chloromethyl)-2-propylbenzene Chemical compound CCCCOC1=CC=C(CCl)C(CCC)=C1 NXTPDDGFUYTMSO-UHFFFAOYSA-N 0.000 description 1
- JPWAPANPWILBSQ-UHFFFAOYSA-N 4-butoxy-2-butyl-1-(chloromethyl)benzene Chemical compound CCCCOC1=CC=C(CCl)C(CCCC)=C1 JPWAPANPWILBSQ-UHFFFAOYSA-N 0.000 description 1
- DOYDXOHKXFDYJY-UHFFFAOYSA-N 7-benzylbicyclo[4.2.0]octa-1(8),2,4,6-tetraene Chemical compound C=12C=CC=CC2=CC=1CC1=CC=CC=C1 DOYDXOHKXFDYJY-UHFFFAOYSA-N 0.000 description 1
- BMTLRWFAQMOEAZ-UHFFFAOYSA-N 7-butoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OCCCC)=CC2=C1 BMTLRWFAQMOEAZ-UHFFFAOYSA-N 0.000 description 1
- OLJBTWDGVUEMSU-UHFFFAOYSA-N 7-butylbicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(CCCC)=CC2=C1 OLJBTWDGVUEMSU-UHFFFAOYSA-N 0.000 description 1
- YHUDBXMDNUDPRS-UHFFFAOYSA-N 7-ethoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OCC)=CC2=C1 YHUDBXMDNUDPRS-UHFFFAOYSA-N 0.000 description 1
- XRTHFYRYHCIJLA-UHFFFAOYSA-N 7-ethylbicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(CC)=CC2=C1 XRTHFYRYHCIJLA-UHFFFAOYSA-N 0.000 description 1
- DLHPNSDGRDWQPM-UHFFFAOYSA-N 7-hexoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OCCCCCC)=CC2=C1 DLHPNSDGRDWQPM-UHFFFAOYSA-N 0.000 description 1
- HRUKTKQSCKQPKI-UHFFFAOYSA-N 7-hexylbicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(CCCCCC)=CC2=C1 HRUKTKQSCKQPKI-UHFFFAOYSA-N 0.000 description 1
- ZBEZKFBWEZJSMY-UHFFFAOYSA-N 7-methoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OC)=CC2=C1 ZBEZKFBWEZJSMY-UHFFFAOYSA-N 0.000 description 1
- LGZQOOADINJYPI-UHFFFAOYSA-N 7-pentoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OCCCCC)=CC2=C1 LGZQOOADINJYPI-UHFFFAOYSA-N 0.000 description 1
- PXPHDUQKHTXCKB-UHFFFAOYSA-N 7-pentylbicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(CCCCC)=CC2=C1 PXPHDUQKHTXCKB-UHFFFAOYSA-N 0.000 description 1
- POCGWSKSWNYDAE-UHFFFAOYSA-N 7-phenoxybicyclo[4.2.0]octa-1(8),2,4,6-tetraene Chemical compound C=12C=CC=CC2=CC=1OC1=CC=CC=C1 POCGWSKSWNYDAE-UHFFFAOYSA-N 0.000 description 1
- GYVVIHBBENIOKC-UHFFFAOYSA-N 7-phenylmethoxybicyclo[4.2.0]octa-1(8),2,4,6-tetraene Chemical compound C=12C=CC=CC2=CC=1OCC1=CC=CC=C1 GYVVIHBBENIOKC-UHFFFAOYSA-N 0.000 description 1
- SDZFKPKJTQSWHY-UHFFFAOYSA-N 7-propoxybicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(OCCC)=CC2=C1 SDZFKPKJTQSWHY-UHFFFAOYSA-N 0.000 description 1
- MGPGGRMJNVBKPM-UHFFFAOYSA-N 7-propylbicyclo[4.2.0]octa-1,3,5,7-tetraene Chemical compound C1=CC=C2C(CCC)=CC2=C1 MGPGGRMJNVBKPM-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005427 anthranyl group Chemical group 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940054066 benzamide antipsychotics Drugs 0.000 description 1
- 150000005347 biaryls Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical group [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- CFBGXYDUODCMNS-UHFFFAOYSA-N cyclobutene Chemical compound C1CC=C1 CFBGXYDUODCMNS-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/76—Esters of carboxylic acids having a carboxyl group bound to a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US612164 | 1984-05-21 | ||
| US06/612,164 US4570011A (en) | 1984-05-21 | 1984-05-21 | Preparation of cyclobutene substituted aromatic hydrocarbons |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU4400285A AU4400285A (en) | 1985-12-13 |
| AU568021B2 true AU568021B2 (en) | 1987-12-10 |
Family
ID=24451996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU44002/85A Ceased AU568021B2 (en) | 1984-05-21 | 1985-05-20 | A process for the preparation of cyclobutene-substituted aromatic hydro-carbons. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4570011A (enExample) |
| EP (1) | EP0182872B1 (enExample) |
| JP (1) | JPS61500792A (enExample) |
| AU (1) | AU568021B2 (enExample) |
| CA (1) | CA1231961A (enExample) |
| DE (1) | DE3574129D1 (enExample) |
| ES (1) | ES8702872A1 (enExample) |
| WO (1) | WO1985005355A1 (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4783514A (en) * | 1986-02-28 | 1988-11-08 | The Dow Chemical Company | Polymeric monoarylcyclobutane compositions |
| US4675370A (en) * | 1986-04-29 | 1987-06-23 | University Of Dayton | Resin systems derived from benzocyclobutene-alkyne imide monomers |
| US5449740A (en) * | 1986-05-08 | 1995-09-12 | The University Of Dayton | Resin systems derived from insitu-generated bisdienes from bis-benzocyclobutene compounds |
| US4711964A (en) * | 1986-05-08 | 1987-12-08 | University Of Dayton | Bisdiene from bis-benzocyclobutene compound |
| US4916235A (en) * | 1986-11-26 | 1990-04-10 | University Of Dayton | Resin systems derived from benzocyclobutene-maleimide compounds |
| US4996288A (en) * | 1987-05-06 | 1991-02-26 | The Dow Chemical Company | Cyclobutarene ketoanhydride and ketocarboxy |
| US4795827A (en) * | 1987-10-16 | 1989-01-03 | The Dow Chemical Company | Cyclobutarene ketoaniline monomeric and polymeric compositions |
| US5093541A (en) * | 1987-10-23 | 1992-03-03 | The Dow Chemical Company | Preparation of cyclobutarenes via the steam pyrolysis of aromatic derivatives |
| US4851603A (en) * | 1987-10-23 | 1989-07-25 | The Dow Chemical Company | Preparation of cyclobutarenes via the steam pyrolysis of aromatic derivatives |
| US4898999A (en) * | 1988-06-03 | 1990-02-06 | Shell Oil Company | Process for halogenating cyclobutenoarenes |
| DE3820896A1 (de) * | 1988-06-21 | 1990-03-15 | Basf Ag | Neue benzonitrile, benzaldehyde und benzylalkohole sowie verfahren zu ihrer herstellung |
| US5214187A (en) * | 1988-06-21 | 1993-05-25 | Basf Aktiengesellschaft | Benzonitriles, benzaldehydes and benzyl alcohols |
| US5003123A (en) * | 1988-06-23 | 1991-03-26 | Shell Oil Company | Process for the preparation of cyclobutenoarenes |
| US4973636A (en) * | 1989-05-30 | 1990-11-27 | Shell Oil Company | Bisbenzocyclobutene/bisimide compositions |
| US5032451A (en) * | 1989-05-30 | 1991-07-16 | Shell Oil Company | Bisbenzocyclobutene/bisimide compositions |
| US5077367A (en) * | 1989-09-29 | 1991-12-31 | The Dow Chemical Company | Crystalline syndiotactic copolymers from arylcyclobutene functional monomers and vinyl aromatic monomers |
| US5232970A (en) * | 1990-08-31 | 1993-08-03 | The Dow Chemical Company | Ceramic-filled thermally-conductive-composites containing fusible semi-crystalline polyamide and/or polybenzocyclobutenes for use in microelectronic applications |
| US5227536A (en) * | 1991-09-20 | 1993-07-13 | The Dow Chemical Company | Process for preparing hydroxybenzocyclobutenes |
| US5334752A (en) * | 1992-07-01 | 1994-08-02 | The Board Of Regents Acting For And On Behalf Of University Of Michigan | Cyclobutabenzene monomers |
| US5391650A (en) * | 1992-12-30 | 1995-02-21 | The Dow Chemical Company | Bisbenzocyclobutene thermosetting compounds and process for preparing the same |
| US5514769A (en) * | 1995-06-19 | 1996-05-07 | The United States Of America As Represented By The Secretary Of The Air Force | Aromatic polyamides containing keto-benzocyclobutene pendants |
-
1984
- 1984-05-21 US US06/612,164 patent/US4570011A/en not_active Expired - Fee Related
-
1985
- 1985-05-17 CA CA000481777A patent/CA1231961A/en not_active Expired
- 1985-05-20 DE DE8585902848T patent/DE3574129D1/de not_active Expired
- 1985-05-20 AU AU44002/85A patent/AU568021B2/en not_active Ceased
- 1985-05-20 JP JP60502401A patent/JPS61500792A/ja active Granted
- 1985-05-20 WO PCT/US1985/000939 patent/WO1985005355A1/en not_active Ceased
- 1985-05-20 EP EP85902848A patent/EP0182872B1/en not_active Expired
- 1985-05-20 ES ES543306A patent/ES8702872A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4570011A (en) | 1986-02-11 |
| EP0182872B1 (en) | 1989-11-08 |
| WO1985005355A1 (en) | 1985-12-05 |
| ES8702872A1 (es) | 1987-01-16 |
| AU4400285A (en) | 1985-12-13 |
| EP0182872A1 (en) | 1986-06-04 |
| JPS644493B2 (enExample) | 1989-01-25 |
| EP0182872A4 (en) | 1986-08-21 |
| CA1231961A (en) | 1988-01-26 |
| JPS61500792A (ja) | 1986-04-24 |
| ES543306A0 (es) | 1987-01-16 |
| DE3574129D1 (en) | 1989-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU568021B2 (en) | A process for the preparation of cyclobutene-substituted aromatic hydro-carbons. | |
| Heitz et al. | Synthesis of monomers and polymers by the Heck reaction | |
| US5037919A (en) | Reactive compounds containing perfluorovinyl groups | |
| US5347063A (en) | Method for direct arylation of diamondoids | |
| US5198513A (en) | Reactive compounds containing perfluorovinyl groups | |
| US4579992A (en) | Production of 3,3- and 2,3-dimethylbutenes, 2,3-dimethylbutadiene and/or glycol or polyglycol N-alkyl-3,3- and -2,3-dimethylbutyl ether | |
| US3674884A (en) | Process for the preparation of aromatic hydrocarbons containing monoethylenic unsaturated radicals | |
| US5254776A (en) | Synthesis of bromobiphenyls | |
| US3835187A (en) | Process for preparing aromatic acid chlorides | |
| US4789755A (en) | Process for the preparation of stilbenedicarboxylate derivatives | |
| KR870001162B1 (ko) | 시클로부텐-치환된 방향족 탄화수소의 제조방법 | |
| US2774783A (en) | 1, 1-dicyano ethylenes and ethanes containing halogen substituents | |
| US3358046A (en) | Selective chlorination | |
| CA1093585A (en) | Thermal process for preparing 3-phenoxybenzyl bromide | |
| US3594423A (en) | Conversion of vinylbenzenes to ethynylbenzenes | |
| US3890326A (en) | Bromination with trifluoromethylbromide | |
| US3548018A (en) | Selective production of stilbenes and/or bibenzyls by the coupling of toluenes | |
| US3278569A (en) | Method for preparing esters from aromatic chloromethyl compounds | |
| US4038331A (en) | Catalytic process for preparation of perfluoroalkyl substituted aromatic compounds | |
| US3689559A (en) | Aromatic bromination process | |
| JPH0262832A (ja) | トリフルオロメチル誘導体の製造方法 | |
| US3530192A (en) | Synthesis of polychlorobenzal chloride | |
| US3632831A (en) | Synthesis of dialkyl 4 4'-biphenyldicarboxylates | |
| US3775476A (en) | Aromatic acid chloride process | |
| AU594456B2 (en) | Process for the preparation of di-ortho-substituted di-meta-halogenated para-halomethylphenols |