AU482736B2 - Therapeutic agents (calcium clofibrate - Google Patents
Therapeutic agents (calcium clofibrateInfo
- Publication number
- AU482736B2 AU482736B2 AU69920/74A AU6992074A AU482736B2 AU 482736 B2 AU482736 B2 AU 482736B2 AU 69920/74 A AU69920/74 A AU 69920/74A AU 6992074 A AU6992074 A AU 6992074A AU 482736 B2 AU482736 B2 AU 482736B2
- Authority
- AU
- Australia
- Prior art keywords
- clofibrate
- calcium
- therapeutic agents
- therapeutic
- agents
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229950008918 Calcium Clofibrate Drugs 0.000 title 1
- IXCILCKRXAZYGP-UHFFFAOYSA-L calcium;2-(4-chlorophenoxy)-2-methylpropanoate Chemical compound [Ca+2].[O-]C(=O)C(C)(C)OC1=CC=C(Cl)C=C1.[O-]C(=O)C(C)(C)OC1=CC=C(Cl)C=C1 IXCILCKRXAZYGP-UHFFFAOYSA-L 0.000 title 1
- 239000003814 drug Substances 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/370,506 US3952096A (en) | 1973-06-15 | 1973-06-15 | Mixture of calcium carbonate and calcium-α-p-chlorophenoxyisobutyrate as an antihyperlipemic agent |
| USUS370506 | 1973-06-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU482736B2 true AU482736B2 (en) | 1975-12-11 |
| AU6992074A AU6992074A (en) | 1975-12-11 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1020033A (en) | Bandage | |
| CA1032427A (en) | Therapeutic stocking | |
| CA1010336A (en) | Orthopedic device | |
| CA994822A (en) | Therapeutic equipment | |
| CA1010277A (en) | Tissue former | |
| ZA732683B (en) | Therapeutic agent | |
| CA1030287A (en) | Paper-sizing agents | |
| ZA743124B (en) | Therapeutic agents | |
| AU473444B2 (en) | Therapeutic agents | |
| AU489923B2 (en) | Therapeutic salts | |
| AU482736B2 (en) | Therapeutic agents (calcium clofibrate | |
| AU471785B2 (en) | Therapeutic compositions | |
| AU476206B2 (en) | Therapeutic composition | |
| AU487490B2 (en) | Therapeutic agent | |
| AU495749B2 (en) | Therapeutic composition | |
| AU491493B2 (en) | Dental treatment | |
| ZA746761B (en) | Therapeutic agents | |
| AU7611374A (en) | Therapeutic composition | |
| AU7277374A (en) | Therapeutic composition | |
| AU478302B2 (en) | Therapeutic compounds | |
| CA911333A (en) | Therapeutic compositions | |
| CA907519A (en) | Therapeutic compositions | |
| CA897064A (en) | Therapeutic compositions | |
| AU479657B2 (en) | Disinfectant | |
| AU479321B2 (en) | Certain salicylanilides |