AU465707B2 - Penicillanic acid derivatives - Google Patents
Penicillanic acid derivativesInfo
- Publication number
- AU465707B2 AU465707B2 AU38086/72A AU3808672A AU465707B2 AU 465707 B2 AU465707 B2 AU 465707B2 AU 38086/72 A AU38086/72 A AU 38086/72A AU 3808672 A AU3808672 A AU 3808672A AU 465707 B2 AU465707 B2 AU 465707B2
- Authority
- AU
- Australia
- Prior art keywords
- acid derivatives
- penicillanic acid
- penicillanic
- derivatives
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB273671 | 1971-01-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3808672A AU3808672A (en) | 1973-07-26 |
| AU465707B2 true AU465707B2 (en) | 1975-10-02 |
Family
ID=9744923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU38086/72A Expired AU465707B2 (en) | 1971-01-20 | 1972-01-19 | Penicillanic acid derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3853848A (enExample) |
| AU (1) | AU465707B2 (enExample) |
| BE (1) | BE778304A (enExample) |
| CA (1) | CA987307A (enExample) |
| CH (1) | CH571005A5 (enExample) |
| DE (1) | DE2202725A1 (enExample) |
| FR (1) | FR2122958A5 (enExample) |
| GB (1) | GB1312554A (enExample) |
| NL (1) | NL7200766A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7402536A (enExample) * | 1973-03-13 | 1974-09-17 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3479401A (en) * | 1966-06-28 | 1969-11-18 | Merck & Co Inc | Guanidinoaryl and guanidinomethylaryl compounds |
| US3647781A (en) * | 1969-08-14 | 1972-03-07 | Squibb & Sons Inc | Imines of nitroheterocyclic aldehydes and compounds of the penicllanic acid or cepham series |
| US3719667A (en) * | 1970-08-24 | 1973-03-06 | Lilly Co Eli | Epimerization of 6-acylamido and 6-imido penicillin sulfoxide esters |
-
1971
- 1971-01-20 GB GB273671A patent/GB1312554A/en not_active Expired
-
1972
- 1972-01-14 CA CA132,470A patent/CA987307A/en not_active Expired
- 1972-01-17 US US00218529A patent/US3853848A/en not_active Expired - Lifetime
- 1972-01-19 FR FR7201699A patent/FR2122958A5/fr not_active Expired
- 1972-01-19 AU AU38086/72A patent/AU465707B2/en not_active Expired
- 1972-01-19 NL NL7200766A patent/NL7200766A/xx unknown
- 1972-01-20 CH CH85972A patent/CH571005A5/xx not_active IP Right Cessation
- 1972-01-20 DE DE19722202725 patent/DE2202725A1/de active Pending
- 1972-01-20 BE BE778304A patent/BE778304A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3853848A (en) | 1974-12-10 |
| CH571005A5 (enExample) | 1975-12-31 |
| BE778304A (fr) | 1972-07-20 |
| CA987307A (en) | 1976-04-13 |
| FR2122958A5 (enExample) | 1972-09-01 |
| AU3808672A (en) | 1973-07-26 |
| GB1312554A (en) | 1973-04-04 |
| NL7200766A (enExample) | 1972-07-24 |
| DE2202725A1 (de) | 1972-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU462398B2 (en) | 6-amino penicillanic acid derivatives | |
| CA969965A (en) | Cycloakylaminoarylcarboxylic acid derivatives | |
| CA957371A (en) | Carbamoyl-triiodophenoxy-ethoxy-propionic acid derivatives | |
| AU464253B2 (en) | Asparagic acid derivatives | |
| AU463362B2 (en) | Penicillanic acid derivatives | |
| CA1003852A (en) | 2-p-nitro- or p-chlorobenzamidoacetohydroxamic acid | |
| CA967161A (en) | Piperidine-acetic acid derivatives | |
| PH9500A (en) | 6-amino-penicillanic acid derivatives | |
| AU465707B2 (en) | Penicillanic acid derivatives | |
| CA972759A (en) | Penicilloic acid derivatives | |
| CA970370A (en) | Dithiocarbamic acid derivatives | |
| CA888728A (en) | Fumaramic acid derivatives | |
| CA873891A (en) | Barbituric acid derivatives | |
| AU475349B2 (en) | Penicilloic acid derivatives | |
| CA882725A (en) | Penicillin derivatives | |
| CA881514A (en) | Penicillin derivatives | |
| CA872794A (en) | Lysergic acid derivatives | |
| AU476682B2 (en) | Lysergic acid derivatives | |
| CA872236A (en) | Lysergic acid derivatives | |
| AU479042B2 (en) | Penicillanic acid derivatives | |
| CA859145A (en) | 6-aminopenicillanic acid | |
| CA871748A (en) | Levulinic acid derivatives | |
| CA888721A (en) | 1-acyl-3-indolyl aliphatic acid derivatives | |
| AU457224B2 (en) | Nicotinic acid derivatives | |
| AU455887B2 (en) | Nicotinic acid derivatives |