AU2016902883A0 - Insulin Analogs - Google Patents
Insulin AnalogsInfo
- Publication number
- AU2016902883A0 AU2016902883A0 AU2016902883A AU2016902883A AU2016902883A0 AU 2016902883 A0 AU2016902883 A0 AU 2016902883A0 AU 2016902883 A AU2016902883 A AU 2016902883A AU 2016902883 A AU2016902883 A AU 2016902883A AU 2016902883 A0 AU2016902883 A0 AU 2016902883A0
- Authority
- AU
- Australia
- Prior art keywords
- insulin analogs
- insulin
- analogs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical class N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 title 1
Priority Applications (24)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CR20190096A CR20190096A (en) | 2016-07-22 | 2017-07-21 | INSULIN ANALOGUES |
| EP17830123.0A EP3487876A4 (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| SG11201900181RA SG11201900181RA (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| CA3030930A CA3030930A1 (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| KR1020237015079A KR20230070049A (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| AU2017298565A AU2017298565B2 (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| BR112019000991A BR112019000991A2 (en) | 2016-07-22 | 2017-07-21 | insulin analogue, pharmaceutical composition, method for treating and / or preventing an insulin related condition, method for decreasing blood glucose levels, use of insulin analogue, replanning method or modification of a polypeptide which is known to bind to an insulin receptor, polypeptide, isolated molecule, method for identifying a compound that binds to the insulin receptor, computer based method for identifying a compound that mimics insulin activity, compound identified using a method, polypeptide crystal, structure of the polypeptide, use of structure, use of structural model, peptide, method for increasing insulin receptor activation in a subject, method for lowering blood sugar in a subject, method for treating type 1 diabetes in a subject, and therapeutic protein |
| PCT/AU2017/050758 WO2018014091A1 (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| KR1020197004760A KR102529353B1 (en) | 2016-07-22 | 2017-07-21 | insulin analogues |
| US16/319,450 US11248034B2 (en) | 2016-07-22 | 2017-07-21 | Insulin analogs |
| RU2019100497A RU2769476C2 (en) | 2016-07-22 | 2017-07-21 | Insulin analogues |
| CN202310855095.4A CN116874584A (en) | 2016-07-22 | 2017-07-21 | Insulin analogues |
| JP2019503259A JP7143275B2 (en) | 2016-07-22 | 2017-07-21 | insulin analog |
| IL264330A IL264330B1 (en) | 2016-07-22 | 2017-07-21 | An insulin analog, pharmaceutical composition comprising it and its uses |
| MA045727A MA45727A (en) | 2016-07-22 | 2017-07-21 | INSULIN ANALOGUES |
| MX2019000829A MX2019000829A (en) | 2016-07-22 | 2017-07-21 | Insulin analogs. |
| NZ750355A NZ750355B2 (en) | 2017-07-21 | Insulin analogs | |
| CN201780050247.6A CN110072884B (en) | 2016-07-22 | 2017-07-21 | Insulin analogues |
| PH12019500090A PH12019500090A1 (en) | 2016-04-07 | 2019-01-14 | Insulin analogs |
| CL2019000159A CL2019000159A1 (en) | 2016-07-22 | 2019-01-21 | Insulin analogues |
| ZA2019/01095A ZA201901095B (en) | 2016-07-22 | 2019-02-20 | Insulin analogs |
| AU2021269301A AU2021269301B2 (en) | 2016-07-22 | 2021-11-16 | Insulin Analogs |
| US17/568,698 US20220340636A1 (en) | 2016-07-22 | 2022-01-04 | Insulin analogs |
| JP2022146483A JP2022191233A (en) | 2016-07-22 | 2022-09-14 | Insulin analogs |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU2016902883A0 true AU2016902883A0 (en) | 2016-08-04 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP3286169A4 (en) | Novel compounds | |
| EP3325449A4 (en) | Compounds | |
| EP3229877A4 (en) | Incremental syringe | |
| EP3265150A4 (en) | Auto-injector | |
| EP3291676A4 (en) | Mitragynine analogs and uses thereof | |
| EP3194411A4 (en) | Nucleotide analogs | |
| EP3185927A4 (en) | Syringe accessory | |
| EP3244950A4 (en) | Respiratory interface | |
| EP3341404A4 (en) | Novel insulin analogs and use thereof | |
| EP3261443A4 (en) | Desacetoxytubulysin h and analogs thereof | |
| EP3251707A4 (en) | Infusion set | |
| EP3437680A4 (en) | High-slidability syringe | |
| EP3127570A4 (en) | Syringe | |
| EP3332819A4 (en) | Syringe | |
| EP3407974A4 (en) | Amlexanox analogs | |
| EP3281641A4 (en) | Medicine | |
| EP3255044A4 (en) | Diaza-benzofluoranthrene compounds | |
| EP3348292A4 (en) | Infusion set | |
| EP3243541A4 (en) | Syringe | |
| EP3409310A4 (en) | Syringe | |
| EP3355888B8 (en) | Hemi-synthetic trilobine analogs for use as a drug | |
| EP3372264A4 (en) | Syringe | |
| EP3406230A4 (en) | Cannula | |
| EP3204347A4 (en) | Compounds | |
| ZA201901095B (en) | Insulin analogs |