AU2011247824A1 - Glucagon-like peptide-1 analogue and use thereof - Google Patents
Glucagon-like peptide-1 analogue and use thereofInfo
- Publication number
- AU2011247824A1 AU2011247824A1 AU2011247824A AU2011247824A AU2011247824A1 AU 2011247824 A1 AU2011247824 A1 AU 2011247824A1 AU 2011247824 A AU2011247824 A AU 2011247824A AU 2011247824 A AU2011247824 A AU 2011247824A AU 2011247824 A1 AU2011247824 A1 AU 2011247824A1
- Authority
- AU
- Australia
- Prior art keywords
- glucagon
- analogue
- peptide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- DTHNMHAUYICORS-KTKZVXAJSA-N 107444-51-9 Chemical class C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 title 1
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN201010156732 | 2010-04-27 | ||
| CN201010156732.1 | 2010-04-27 | ||
| CN201110078365 | 2011-03-30 | ||
| CN201110078365.2 | 2011-03-30 | ||
| PCT/CN2011/000764 WO2011134284A1 (en) | 2010-04-27 | 2011-04-29 | Glucagon-like peptide-1 analogue and use thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2011247824A1 true AU2011247824A1 (en) | 2012-11-22 |
| AU2011247824B2 AU2011247824B2 (en) | 2014-02-13 |
Family
ID=44860821
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2011247824A Ceased AU2011247824B2 (en) | 2010-04-27 | 2011-04-29 | Glucagon-like peptide-1 analogue and use thereof |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US8951959B2 (en) |
| EP (1) | EP2565205B1 (en) |
| AU (1) | AU2011247824B2 (en) |
| BR (1) | BR112012027545B1 (en) |
| CA (1) | CA2797431C (en) |
| ES (1) | ES2548259T3 (en) |
| HK (1) | HK1162037A1 (en) |
| RU (1) | RU2531590C2 (en) |
| SG (1) | SG185066A1 (en) |
| WO (1) | WO2011134284A1 (en) |
| ZA (1) | ZA201208829B (en) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2537287T3 (en) | 2009-07-13 | 2015-06-05 | Zealand Pharma A/S | Acylated glucagon analogs |
| EP2844669B1 (en) | 2012-05-03 | 2018-08-01 | Zealand Pharma A/S | Gip-glp-1 dual agonist compounds and methods |
| AU2013295035B2 (en) | 2012-07-23 | 2017-08-03 | Zealand Pharma A/S | Glucagon analogues |
| FR2994848B1 (en) | 2012-08-30 | 2014-08-22 | Univ Paris Curie | TREATMENT OF ARTHROSIS BY INCRETINED HORMONES OR THEIR ANALOGUES |
| TWI608013B (en) | 2012-09-17 | 2017-12-11 | 西蘭製藥公司 | Glucagon analogues |
| RS57632B1 (en) | 2013-10-17 | 2018-11-30 | Zealand Pharma As | Acylated glucagon analogues |
| US9988429B2 (en) | 2013-10-17 | 2018-06-05 | Zealand Pharma A/S | Glucagon analogues |
| AU2014345569B2 (en) | 2013-11-06 | 2020-08-13 | Zealand Pharma A/S | GIP-GLP-1 dual agonist compounds and methods |
| EP3066117B1 (en) | 2013-11-06 | 2019-01-02 | Zealand Pharma A/S | Glucagon-glp-1-gip triple agonist compounds |
| EP3985016A1 (en) | 2014-10-29 | 2022-04-20 | Zealand Pharma A/S | Gip agonist compounds and methods |
| EP3283507B8 (en) | 2015-04-16 | 2019-11-13 | Zealand Pharma A/S | Acylated glucagon analogue |
| CN106928086B (en) * | 2015-12-31 | 2019-05-31 | 深圳翰宇药业股份有限公司 | A kind of preparation method of long-chain compound |
| KR20200141469A (en) | 2018-04-05 | 2020-12-18 | 썬 파마슈티칼 인더스트리스 리미티드 | Novel GLP-1 analog |
| CN111333714A (en) * | 2020-03-05 | 2020-06-26 | 成都奥达生物科技有限公司 | Long-acting GLP-1 compound |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2401276C2 (en) * | 2003-09-19 | 2010-10-10 | Ново Нордиск А/С | Glucagon-like peptide-1 (glp-1) derivatives |
| BRPI0414539B8 (en) * | 2003-09-19 | 2021-05-25 | Novo Nordisk As | compound, pharmaceutical composition, and use of a compound |
| BRPI0417684A (en) * | 2003-12-18 | 2007-03-20 | Novo Nordisk As | compound, pharmaceutical composition, and use of a compound |
| TWI372629B (en) * | 2005-03-18 | 2012-09-21 | Novo Nordisk As | Acylated glp-1 compounds |
| AU2006224537A1 (en) * | 2005-03-18 | 2006-09-21 | Novo Nordisk A/S | Extended GLP-1 compounds |
| ES2528496T3 (en) * | 2010-05-17 | 2015-02-10 | Betta Pharmaceuticals Co., Ltd. | New glucagon-like peptide analogs, composition, and methods of use |
-
2011
- 2011-04-29 ES ES11774275.9T patent/ES2548259T3/en active Active
- 2011-04-29 RU RU2012150108/04A patent/RU2531590C2/en active
- 2011-04-29 AU AU2011247824A patent/AU2011247824B2/en not_active Ceased
- 2011-04-29 CA CA2797431A patent/CA2797431C/en active Active
- 2011-04-29 EP EP11774275.9A patent/EP2565205B1/en not_active Not-in-force
- 2011-04-29 US US13/643,840 patent/US8951959B2/en active Active
- 2011-04-29 SG SG2012079661A patent/SG185066A1/en unknown
- 2011-04-29 BR BR112012027545-3A patent/BR112012027545B1/en not_active IP Right Cessation
- 2011-04-29 WO PCT/CN2011/000764 patent/WO2011134284A1/en active Application Filing
-
2012
- 2012-03-13 HK HK12102503.2A patent/HK1162037A1/en not_active IP Right Cessation
- 2012-11-22 ZA ZA2012/08829A patent/ZA201208829B/en unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HUS2100032I1 (en) | Substituted 5-fluoro-1h-pyrazolopyridines and use thereof | |
| AU2011247824A1 (en) | Glucagon-like peptide-1 analogue and use thereof | |
| ZA201208829B (en) | Glucagon-like peptide-1 analogue and use thereof | |
| HK1187049A1 (en) | Bisaryl-bonded aryltriazolones and use thereof | |
| PL3480273T3 (en) | Adhesive compositions and use thereof | |
| EP2640791A4 (en) | Adhesive compositions and use thereof | |
| PL2588491T3 (en) | Novel peptide and use thereof | |
| PL2585509T3 (en) | Coated parts and use thereof | |
| PL2563131T3 (en) | Pesticidal composition and its use | |
| HRP20182083T1 (en) | Novel combination and use | |
| GB2480515B (en) | Lacquer composition and use thereof | |
| ZA201207242B (en) | Pesticidal composition and its use | |
| PL2563133T3 (en) | Pesticidal composition and its use | |
| EP2563132A4 (en) | Pesticidal composition and its use | |
| PL2563134T3 (en) | Pesticidal composition and its use | |
| EP2660249A4 (en) | Peptide derivative and use thereof | |
| HK1162526A1 (en) | Glp-1 derivatives and uses thereof glp-1 | |
| GB0905790D0 (en) | Novel polypeptides and use thereof | |
| PL393311A1 (en) | Multilayer electrode and the application thereof | |
| EP2638160B8 (en) | Nuclions and ribocapsids | |
| GB0902812D0 (en) | Composition and use | |
| AU2010904801A0 (en) | Seleno-Compounds and Therapeutic Uses Thereof | |
| AU2009903870A0 (en) | Flow-Aerator and Wave-Mixer |