AU2005905299A0 - Fulvestrant formulations - Google Patents
Fulvestrant formulationsInfo
- Publication number
- AU2005905299A0 AU2005905299A0 AU2005905299A AU2005905299A AU2005905299A0 AU 2005905299 A0 AU2005905299 A0 AU 2005905299A0 AU 2005905299 A AU2005905299 A AU 2005905299A AU 2005905299 A AU2005905299 A AU 2005905299A AU 2005905299 A0 AU2005905299 A0 AU 2005905299A0
- Authority
- AU
- Australia
- Prior art keywords
- fulvestrant formulations
- fulvestrant
- formulations
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- VWUXBMIQPBEWFH-WCCTWKNTSA-N (7R,8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)CC2=C1 VWUXBMIQPBEWFH-WCCTWKNTSA-N 0.000 title 1
- 229960002258 Fulvestrant Drugs 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR1020087009828A KR20080066926A (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| US12/088,150 US20090227552A1 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulations |
| CA002623345A CA2623345A1 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| PCT/AU2006/001399 WO2007033434A1 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| EP06790270A EP1928469A4 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| JP2008531488A JP2009509942A (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| AU2006294430A AU2006294430A1 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
| SG201006835-1A SG165404A1 (en) | 2005-09-26 | 2006-09-26 | Fulvestrant formulation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU2005905299A0 true AU2005905299A0 (en) | 2005-10-13 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1928469A4 (en) | Fulvestrant formulation | |
| EP1865313B8 (en) | Optical-isomer-separating agent | |
| AU2005100155A4 (en) | Boardsling | |
| AU2005905299A0 (en) | Fulvestrant formulations | |
| AU2005100821A4 (en) | MediDirect | |
| AU2005100875A4 (en) | Venti - geni | |
| AU2005100082A4 (en) | Mobilus | |
| AU2005100156A4 (en) | Auscar | |
| AU2005101012A4 (en) | Phoneblock | |
| AU2005100452A4 (en) | Sqeg | |
| AU2005100778A4 (en) | Halta | |
| AU2005100098A4 (en) | Vent - A - Loo | |
| AU2005100866A4 (en) | Infopower | |
| AU2005903973A0 (en) | Therapeutic compositions | |
| AU2005901758A0 (en) | Therapeutic Formulations | |
| AU2005906295A0 (en) | Therapeutic formulations | |
| AU2005907230A0 (en) | Anitbacterial Agents | |
| AU2005900988A0 (en) | Composition | |
| AU2005901601A0 (en) | Glow-Cycle | |
| AU2005902120A0 (en) | Aquaboy | |
| AU2005901928A0 (en) | Deckmate | |
| AU2005901818A0 (en) | Stayblock | |
| AU2005901808A0 (en) | Cylinderauctuator | |
| AU2005901743A0 (en) | Mobilfone-tracka | |
| AU2005902117A0 (en) | Rainhats |