ATE53587T1 - Aminoanthracendione-platin-komplexe fuer antikrebs-verbindungen. - Google Patents
Aminoanthracendione-platin-komplexe fuer antikrebs-verbindungen.Info
- Publication number
- ATE53587T1 ATE53587T1 AT85109732T AT85109732T ATE53587T1 AT E53587 T1 ATE53587 T1 AT E53587T1 AT 85109732 T AT85109732 T AT 85109732T AT 85109732 T AT85109732 T AT 85109732T AT E53587 T1 ATE53587 T1 AT E53587T1
- Authority
- AT
- Austria
- Prior art keywords
- aminoanthracendione
- platinum complexes
- cancer compounds
- cancer
- compounds
- Prior art date
Links
- OPEJZQFCUBLFRA-UHFFFAOYSA-N 3-aminoanthracene-1,2-dione;platinum Chemical class [Pt].C1=CC=C2C=C(C(=O)C(C(N)=C3)=O)C3=CC2=C1 OPEJZQFCUBLFRA-UHFFFAOYSA-N 0.000 title 1
- 230000001093 anti-cancer Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 title 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT8422224A IT1213205B (it) | 1984-08-03 | 1984-08-03 | Amminoantrachinoni cis-platino complessi e loro impiego come agenti antitumorali. |
| IT21324/85A IT1201425B (it) | 1985-06-27 | 1985-06-27 | Cis-platino complessi e loro impiego come agenti antitumorali |
| EP85109732A EP0170290B1 (de) | 1984-08-03 | 1985-08-02 | Aminoanthracendione-Platin-Komplexe für Anti-Krebs-Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE53587T1 true ATE53587T1 (de) | 1990-06-15 |
Family
ID=27227795
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT85109732T ATE53587T1 (de) | 1984-08-03 | 1985-08-02 | Aminoanthracendione-platin-komplexe fuer antikrebs-verbindungen. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | ATE53587T1 (de) |
-
1985
- 1985-08-02 AT AT85109732T patent/ATE53587T1/de not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3586188D1 (de) | Antikoerper-metallionen-komplexe. | |
| FI853313L (fi) | Speciallins foer glasoegon. | |
| IT8247713A0 (it) | Composti chinazolinici anti-tumorali | |
| DE3579358D1 (de) | Lagemessanordnung. | |
| FI853736A7 (fi) | Triatsolokinatsoliiniyhdisteet. | |
| DE3667468D1 (de) | Platinkomplexe. | |
| DE3770028D1 (de) | Platin-(iv)-komplexe. | |
| FI854811A7 (fi) | Skaerhuvud foer traodkapare. | |
| DE3576605D1 (de) | Zusammensetzungen fuer widerstaende. | |
| KR850010635U (ko) | 사이드 몰 | |
| FI862539A7 (fi) | Sovitelma analyysien suorittamiseen. | |
| FI854301A7 (fi) | Solubilisoitu platinayhdiste. | |
| FI852755A7 (fi) | Aminofenoliyhdisteet. | |
| DE3766490D1 (de) | Platinkomplexe. | |
| NO852659L (no) | Drivmekanisme for slagmaskin. | |
| DE3578180D1 (de) | Aminoanthracendione-platin-komplexe fuer anti-krebs-verbindungen. | |
| DE3581346D1 (de) | Platinkomplexe. | |
| FI854971A7 (fi) | Platinakomplex. | |
| DE3577466D1 (de) | Funktionssystem fuer baumerntemaschine. | |
| FI852768A7 (fi) | Yhdisteet. | |
| ATE53587T1 (de) | Aminoanthracendione-platin-komplexe fuer antikrebs-verbindungen. | |
| DE3575394D1 (de) | Abgabevorrichtung fuer blaetter. | |
| FI853005A7 (fi) | Uudet aminoalkyylipenem-yhdisteet. | |
| ATE60059T1 (de) | Platinkomplexe. | |
| FI854369A0 (fi) | Styranordning foer plasmagenerator. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| UEP | Publication of translation of european patent specification | ||
| EEIH | Change in the person of patent owner | ||
| REN | Ceased due to non-payment of the annual fee |