AT258292B - Verfahren zur Herstellung von 3,4-Dimethyl-8-nitrochinolin - Google Patents
Verfahren zur Herstellung von 3,4-Dimethyl-8-nitrochinolinInfo
- Publication number
- AT258292B AT258292B AT653564A AT653564A AT258292B AT 258292 B AT258292 B AT 258292B AT 653564 A AT653564 A AT 653564A AT 653564 A AT653564 A AT 653564A AT 258292 B AT258292 B AT 258292B
- Authority
- AT
- Austria
- Prior art keywords
- nitroquinoline
- dimethyl
- preparation
- Prior art date
Links
- FKXPOWALVWGYNT-UHFFFAOYSA-N 3,4-dimethyl-8-nitroquinoline Chemical compound [O-][N+](=O)C1=CC=CC2=C(C)C(C)=CN=C21 FKXPOWALVWGYNT-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AU33690/63A AU266804B2 (en) | 1963-07-31 | Preparation of 3, 4-dimethyl-8-nitroquinoline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT258292B true AT258292B (de) | 1967-11-10 |
Family
ID=3721045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT653564A AT258292B (de) | 1963-07-31 | 1964-07-29 | Verfahren zur Herstellung von 3,4-Dimethyl-8-nitrochinolin |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT258292B (de) |
| BE (1) | BE651137A (de) |
| CH (1) | CH448088A (de) |
| GB (1) | GB1069388A (de) |
| NL (1) | NL6408321A (de) |
-
1964
- 1964-07-21 NL NL6408321A patent/NL6408321A/xx unknown
- 1964-07-29 CH CH994364A patent/CH448088A/de unknown
- 1964-07-29 BE BE651137D patent/BE651137A/xx unknown
- 1964-07-29 AT AT653564A patent/AT258292B/de active
- 1964-08-04 GB GB3141664D patent/GB1069388A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE651137A (de) | 1964-11-16 |
| GB1069388A (en) | 1967-05-17 |
| CH448088A (de) | 1967-12-15 |
| NL6408321A (de) | 1965-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH468966A (de) | Verfahren zur Herstellung von 3-Aminotricyclo-(4,3,1,1,3,8)-undecan | |
| CH459196A (de) | Verfahren zur Herstellung von 4,6-Pregnadienderivaten | |
| CH437316A (de) | Verfahren zur Herstellung von substituierten Phenyl-amino-1,3-diazacyclopenten-(2)-Verbindungen | |
| CH458587A (de) | Verfahren zur Herstellung von 8,9,10,11-Tetrahydro-12-phthaloperinon | |
| CH479574A (de) | Verfahren zur Herstellung von 13-Jod-14-oxo 13,14-seco-steroiden | |
| CH460766A (de) | Verfahren zur Herstellung von 3,3-Alkyliden-19-nor-steroiden | |
| CH436317A (de) | Verfahren zur Herstellung von 5-Joduracil-2'-desoxyribosid-3',5'-di-Estern | |
| CH449610A (de) | Verfahren zur Herstellung von Oestra-4,9-dien-3-olen | |
| AT247866B (de) | Verfahren zur Herstellung von 2, 6-Dichlorbenzonitril | |
| CH446312A (de) | Verfahren zur Herstellung von cis,cis-Cyclodecadien-(1,6) | |
| CH437320A (de) | Verfahren zur Herstellung von 4-Amino-5-hydroxypyridazonen (6) | |
| CH451163A (de) | Verfahren zur Herstellung von 2,2-Bipyridylium-dihalogeniden | |
| CH445477A (de) | Verfahren zur Herstellung von 1-Hydroxy-2,2,6,6-tetrachlorcyclohexankarbonamid-1 | |
| CH441352A (de) | Verfahren zur Herstellung von 1-Phenyl-3-butyl-4-methyl-triazolon-(5) | |
| CH459242A (de) | Verfahren zur Herstellung von 1,2-Dihydro-1-hydroxy-1,3,5-triazinen | |
| AT247848B (de) | Verfahren zur Herstellung von 1, 3-Dioxo-2-alkylcyclopentanen | |
| CH441583A (de) | Verfahren zur Herstellung von 1,4-Diarylamino-5-nitro-8-hydroxy-anthrachinonen | |
| CH439328A (de) | Verfahren zur Herstellung von 3,5-Dijodthyroninen | |
| CH435245A (de) | Verfahren zur Herstellung von 1-Aryl-perchlor-2-aza-alkenen-(2) | |
| CH427830A (de) | Verfahren zur Herstellung von substituierten 1,4-Benzodiazepinen | |
| CH444154A (de) | Verfahren zur Herstellung von 1(10),2,4a(5)-A-Homoöstratrien-4-onderivaten | |
| AT240356B (de) | Verfahren zur Herstellung von neuen 1, 2-Diaryl-4-alkyl-3, 5-dioxo-pyrazolidinen | |
| AT253703B (de) | Verfahren zur Herstellung von 3, 6-Dioxo-A-nor-B-homo-steroiden | |
| CH451151A (de) | Verfahren zur Herstellung von 1,4-Benzoxazin-2-onen | |
| CH471056A (de) | Verfahren zur Herstellung von 2,5-Dialkoxybenzaldehyden |