AT154378B - Kryolithhaltige Emailfritte. - Google Patents
Kryolithhaltige Emailfritte.Info
- Publication number
- AT154378B AT154378B AT154378DA AT154378B AT 154378 B AT154378 B AT 154378B AT 154378D A AT154378D A AT 154378DA AT 154378 B AT154378 B AT 154378B
- Authority
- AT
- Austria
- Prior art keywords
- frit containing
- enamel frit
- sep
- containing cryolite
- cryolite
- Prior art date
Links
- 229910001610 cryolite Inorganic materials 0.000 title description 3
- 210000003298 dental enamel Anatomy 0.000 title 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 229910021538 borax Inorganic materials 0.000 description 3
- 239000010433 feldspar Substances 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- 239000004328 sodium tetraborate Substances 0.000 description 3
- 235000010339 sodium tetraborate Nutrition 0.000 description 3
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 1
Landscapes
- Glass Compositions (AREA)
Description
<Desc/Clms Page number 1> EMI1.1 EMI1.2 <Desc/Clms Page number 2> EMI2.1 EMI2.2 <tb> <tb> 1. <SEP> Borax <SEP> ...................... <SEP> 22 <tb> Kryolith <SEP> ...................... <SEP> 18 <tb> Soda <SEP> ...................... <SEP> 4 <tb> Salpeter <SEP> ...................... <SEP> 2 <tb> Quarz <SEP> ...................... <SEP> 54 <tb> Feldspat..................... <SEP> - <tb> 100. <tb> 2. <SEP> Borax <SEP> ...................... <SEP> 14 <tb> Kroylith <SEP> ...................... <SEP> 16 <tb> Soda <SEP> ...................... <SEP> 4 <tb> Slapeter <SEP> ...................... <SEP> 3 <tb> Quarz <SEP> ...................... <SEP> 43 <tb> Feldspat <SEP> ...................... <SEP> 20 <tb> 100. <tb> 3. <SEP> Borax <SEP> ...................... <SEP> 22 <tb> Kryolith................. <SEP> 0.... <SEP> 12 <tb> Kieselfluornatrium............ <SEP> 4 <tb> Soda <SEP> ...................... <SEP> 4 <tb> Salpeter <SEP> ...................... <SEP> 3 <tb> Quarz <SEP> ...................... <SEP> 40 <tb> Feldspat <SEP> ...................... <SEP> 15 <tb> 100. <tb> EMI2.3
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT154378T | 1936-02-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT154378B true AT154378B (de) | 1938-09-26 |
Family
ID=3648005
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT154378D AT154378B (de) | 1936-02-25 | 1936-02-25 | Kryolithhaltige Emailfritte. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT154378B (de) |
-
1936
- 1936-02-25 AT AT154378D patent/AT154378B/de active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT154378B (de) | Kryolithhaltige Emailfritte. | |
| US2145867A (en) | Tube forming tool | |
| AT136078B (de) | Stromabnehmer. | |
| FR792362A (fr) | Perfectionnement à la fabrication des ressorts à boudin | |
| AT137137B (de) | Büstenhalter. | |
| GB451733A (en) | Improvements in or relating to the manufacture of salts by means of base exchangers | |
| AT141031B (de) | Flaschenverschluß. | |
| AT154331B (de) | Mit Glühelektroden versehene Metalldampfentladungsröhre. | |
| AT157901B (de) | Elektrische Entladungsröhre. | |
| AT138701B (de) | Schalter. | |
| AT110208B (de) | Glasglocke für Waggonbeleuchtung. | |
| AT152871B (de) | Wagenheber. | |
| AT145910B (de) | Schiebefenster für Fahrzeuge. | |
| AT154372B (de) | Verfahren zur Regeneration von Altkautschuk. | |
| AT134806B (de) | Ausziehtisch. | |
| AT154330B (de) | Braunsche Röhre. | |
| AT159335B (de) | Schiebefenster für windschnittige Eisenbahnfahrzeuge. | |
| FR800465A (fr) | Valve pour ballon | |
| IE14248L (en) | Refractory glasses | |
| IE14247L (en) | Refractory glasses | |
| CA357262A (en) | Furnace regenerator | |
| FR819181A (fr) | Obus lance-message | |
| CA358185A (en) | Lehr mechanism | |
| IE13525L (en) | Percussion fuses | |
| CA360119A (en) | Mercury sulphate |