AP347A - Propenoic acid derivatives. - Google Patents
Propenoic acid derivatives. Download PDFInfo
- Publication number
- AP347A AP347A APAP/P/1992/000396A AP9200396A AP347A AP 347 A AP347 A AP 347A AP 9200396 A AP9200396 A AP 9200396A AP 347 A AP347 A AP 347A
- Authority
- AP
- ARIPO
- Prior art keywords
- oil
- compound
- meo
- optionally substituted
- aryl
- Prior art date
Links
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 106
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 19
- 125000003118 aryl group Chemical group 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 10
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 10
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 7
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 5
- 150000002148 esters Chemical group 0.000 claims abstract description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 59
- 241000233866 Fungi Species 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 1
- 230000003032 phytopathogenic effect Effects 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 26
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 5
- 101100440695 Dictyostelium discoideum corB gene Proteins 0.000 abstract 1
- 239000003921 oil Substances 0.000 description 127
- 239000000460 chlorine Substances 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- -1 aliphatic hydrocarbon radical Chemical class 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 19
- 239000000243 solution Substances 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000007787 solid Substances 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 8
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000010410 dusting Methods 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229960001866 silicon dioxide Drugs 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- QOBDIPACAOEDAX-UHFFFAOYSA-N 7-methyl-3h-1-benzothiophen-2-one Chemical compound CC1=CC=CC2=C1SC(=O)C2 QOBDIPACAOEDAX-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- 241000221785 Erysiphales Species 0.000 description 3
- 241000227653 Lycopersicon Species 0.000 description 3
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 3
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000013375 chromatographic separation Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- MTIXYUVQMDNLJT-UHFFFAOYSA-N 7-methyl-1-benzothiophene-2,3-dione Chemical compound CC1=CC=CC2=C1SC(=O)C2=O MTIXYUVQMDNLJT-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- 241000736122 Parastagonospora nodorum Species 0.000 description 2
- 241000233679 Peronosporaceae Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 241001281803 Plasmopara viticola Species 0.000 description 2
- 206010039509 Scab Diseases 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241001617088 Thanatephorus sasakii Species 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000005553 drilling Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N methyl phenyl ether Natural products COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 125000004149 thio group Chemical group *S* 0.000 description 2
- SHAHPWSYJFYMRX-GDLCADMTSA-N (2S)-2-(4-{[(1R,2S)-2-hydroxycyclopentyl]methyl}phenyl)propanoic acid Chemical compound C1=CC([C@@H](C(O)=O)C)=CC=C1C[C@@H]1[C@@H](O)CCC1 SHAHPWSYJFYMRX-GDLCADMTSA-N 0.000 description 1
- VUDZSIYXZUYWSC-DBRKOABJSA-N (4r)-1-[(2r,4r,5r)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1,3-diazinan-2-one Chemical compound FC1(F)[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)N[C@H](O)CC1 VUDZSIYXZUYWSC-DBRKOABJSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- IHDKBHLTKNUCCW-UHFFFAOYSA-N 1,3-thiazole 1-oxide Chemical compound O=S1C=CN=C1 IHDKBHLTKNUCCW-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- MHESOLAAORBNPM-UHFFFAOYSA-N 1-benzothiophene-2,3-dione Chemical compound C1=CC=C2C(=O)C(=O)SC2=C1 MHESOLAAORBNPM-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical class C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 description 1
- QCJUPRYQWRQIPA-UHFFFAOYSA-N 2,4,6-tris(7-methyl-1-benzothiophen-2-yl)-1,3,5,2,4,6-trioxatriborinane Chemical compound C1=CC(C)=C2SC(B3OB(OB(O3)C=3SC4=C(C)C=CC=C4C=3)C3=CC=4C=CC=C(C=4S3)C)=CC2=C1 QCJUPRYQWRQIPA-UHFFFAOYSA-N 0.000 description 1
- LXOFYPKXCSULTL-UHFFFAOYSA-N 2,4,7,9-tetramethyldec-5-yne-4,7-diol Chemical compound CC(C)CC(C)(O)C#CC(C)(O)CC(C)C LXOFYPKXCSULTL-UHFFFAOYSA-N 0.000 description 1
- OEEPIGFTISQIKQ-UHFFFAOYSA-N 2-(4-chloro-2,5-dimethylphenyl)sulfanylacetic acid Chemical compound CC1=CC(SCC(O)=O)=C(C)C=C1Cl OEEPIGFTISQIKQ-UHFFFAOYSA-N 0.000 description 1
- URRLCUSVKQBENI-UHFFFAOYSA-N 2-(bromomethyl)-5-phenylpyrimidine Chemical compound C1=NC(CBr)=NC=C1C1=CC=CC=C1 URRLCUSVKQBENI-UHFFFAOYSA-N 0.000 description 1
- ABROBCBIIWHVNS-UHFFFAOYSA-N 2-Ethylbenzenethiol Chemical compound CCC1=CC=CC=C1S ABROBCBIIWHVNS-UHFFFAOYSA-N 0.000 description 1
- DSCJETUEDFKYGN-UHFFFAOYSA-N 2-Methoxybenzenethiol Chemical compound COC1=CC=CC=C1S DSCJETUEDFKYGN-UHFFFAOYSA-N 0.000 description 1
- IXWAXBWLIMOWLX-UHFFFAOYSA-N 2-[3-bromo-2-(6,6-dimethylhept-2-en-4-ynylsulfanyl)phenyl]-2-oxoacetic acid Chemical compound CC(C)(C)C#CC=CCSC1=C(Br)C=CC=C1C(=O)C(O)=O IXWAXBWLIMOWLX-UHFFFAOYSA-N 0.000 description 1
- SCVHCTVZOUEDSF-UHFFFAOYSA-N 2-[3-chloro-2-(6,6-dimethylhept-2-en-4-ynylsulfanyl)phenyl]-2-oxoacetic acid Chemical compound CC(C)(C)C#CC=CCSC1=C(Cl)C=CC=C1C(=O)C(O)=O SCVHCTVZOUEDSF-UHFFFAOYSA-N 0.000 description 1
- PUNNBYJJKHKQEM-UHFFFAOYSA-N 2-[3-chloro-2-[(2,5-dimethylphenyl)methylsulfanyl]phenyl]acetic acid Chemical compound CC1=CC=C(C)C(CSC=2C(=CC=CC=2Cl)CC(O)=O)=C1 PUNNBYJJKHKQEM-UHFFFAOYSA-N 0.000 description 1
- LXGUMIXGNHHXRX-UHFFFAOYSA-N 2-[3-methyl-2-[(4-methylphenyl)methylsulfanyl]phenyl]acetic acid Chemical compound C1=CC(C)=CC=C1CSC1=C(C)C=CC=C1CC(O)=O LXGUMIXGNHHXRX-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 description 1
- MIHIJWOEDDPOLG-UHFFFAOYSA-N 2-methoxyiminoacetic acid Chemical compound CON=CC(O)=O MIHIJWOEDDPOLG-UHFFFAOYSA-N 0.000 description 1
- LQAQMOIBXDELJX-UHFFFAOYSA-N 2-methoxyprop-2-enoic acid Chemical compound COC(=C)C(O)=O LQAQMOIBXDELJX-UHFFFAOYSA-N 0.000 description 1
- BVRDQVRQVGRNHG-UHFFFAOYSA-N 2-morpholin-4-ylpyrimido[2,1-a]isoquinolin-4-one Chemical compound N1=C2C3=CC=CC=C3C=CN2C(=O)C=C1N1CCOCC1 BVRDQVRQVGRNHG-UHFFFAOYSA-N 0.000 description 1
- ONPJWQSDZCGSQM-UHFFFAOYSA-N 2-phenylprop-2-enoic acid Chemical class OC(=O)C(=C)C1=CC=CC=C1 ONPJWQSDZCGSQM-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- 125000006497 3-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 description 1
- ARTAFUJPRUWRJK-UHFFFAOYSA-N 3h-1-benzothiophen-2-one Chemical compound C1=CC=C2SC(=O)CC2=C1 ARTAFUJPRUWRJK-UHFFFAOYSA-N 0.000 description 1
- SQFXAVDWPCKBRS-UHFFFAOYSA-N 4,7-dimethyl-1-benzothiophene-2,3-dione Chemical compound CC1=CC=C(C)C2=C1SC(=O)C2=O SQFXAVDWPCKBRS-UHFFFAOYSA-N 0.000 description 1
- PLBDOPBECRIDKT-UHFFFAOYSA-N 4-(bromomethyl)-1-chloro-2-methoxybenzene Chemical compound COC1=CC(CBr)=CC=C1Cl PLBDOPBECRIDKT-UHFFFAOYSA-N 0.000 description 1
- JOFDSYLCZIHGGO-UHFFFAOYSA-N 4-[(4-cyclohexylphenyl)methyl-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-methylamino]acetyl]amino]-2-hydroxybenzoic acid Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(=O)(=O)N(C)CC(=O)N(C=1C=C(O)C(C(O)=O)=CC=1)CC(C=C1)=CC=C1C1CCCCC1 JOFDSYLCZIHGGO-UHFFFAOYSA-N 0.000 description 1
- XDCOYBQVEVSNNB-UHFFFAOYSA-N 4-[(7-naphthalen-2-yl-1-benzothiophen-2-yl)methylamino]butanoic acid Chemical compound OC(=O)CCCNCc1cc2cccc(-c3ccc4ccccc4c3)c2s1 XDCOYBQVEVSNNB-UHFFFAOYSA-N 0.000 description 1
- OJYSHGUXHULIBN-UHFFFAOYSA-N 4-chloro-2,5-dimethylbenzenethiol Chemical compound CC1=CC(Cl)=C(C)C=C1S OJYSHGUXHULIBN-UHFFFAOYSA-N 0.000 description 1
- LRVBDTHTUONCGP-UHFFFAOYSA-N 5,7-dimethyl-1-benzothiophene-2,3-dione Chemical compound CC1=CC(C)=CC2=C1SC(=O)C2=O LRVBDTHTUONCGP-UHFFFAOYSA-N 0.000 description 1
- CHAGSWXQCQQQTL-UHFFFAOYSA-N 5-chloro-4,7-dimethyl-1-benzothiophen-3-one Chemical compound CC1=CC(Cl)=C(C)C2=C1SCC2=O CHAGSWXQCQQQTL-UHFFFAOYSA-N 0.000 description 1
- RMGZBQXQLJBVBL-UHFFFAOYSA-N 5-fluoro-2-hydroxyimino-7-methyl-1-benzothiophen-3-one Chemical compound CC1=CC(F)=CC2=C1SC(=NO)C2=O RMGZBQXQLJBVBL-UHFFFAOYSA-N 0.000 description 1
- JJLLEEQJMWGXDN-UHFFFAOYSA-N 6-fluoro-2-hydroxyimino-7-methyl-1-benzothiophen-3-one Chemical compound C1=C(F)C(C)=C2SC(=NO)C(=O)C2=C1 JJLLEEQJMWGXDN-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- NXWVBVPOSZSGMT-UHFFFAOYSA-N 7-chloro-1-benzothiophen-3-one Chemical compound ClC1=CC=CC2=C1SCC2=O NXWVBVPOSZSGMT-UHFFFAOYSA-N 0.000 description 1
- UQBAOGUCHXEEKH-UHFFFAOYSA-N 7-chloro-1-benzothiophene-2,3-dione Chemical compound ClC1=CC=CC2=C1SC(=O)C2=O UQBAOGUCHXEEKH-UHFFFAOYSA-N 0.000 description 1
- BIJMRMUTEPHZSR-UHFFFAOYSA-N 7-chloro-2-hydroxyimino-1-benzothiophen-3-one Chemical compound O=C1C(=NO)SC2=C1C=CC=C2Cl BIJMRMUTEPHZSR-UHFFFAOYSA-N 0.000 description 1
- IISWWZYYCGTXNY-UHFFFAOYSA-N 7-chloro-2-hydroxyimino-5-methyl-1-benzothiophen-3-one Chemical compound ClC1=CC(C)=CC2=C1SC(=NO)C2=O IISWWZYYCGTXNY-UHFFFAOYSA-N 0.000 description 1
- CCWCZTRIWIOVKY-UHFFFAOYSA-N 7-ethoxy-1-benzothiophene-2,3-dione Chemical compound CCOC1=CC=CC2=C1SC(=O)C2=O CCWCZTRIWIOVKY-UHFFFAOYSA-N 0.000 description 1
- NNGZHDYHDBZHPC-UHFFFAOYSA-N 7-ethyl-1-benzothiophene-2,3-dione Chemical compound CCC1=CC=CC2=C1SC(=O)C2=O NNGZHDYHDBZHPC-UHFFFAOYSA-N 0.000 description 1
- PIHVNUSWMTZFBD-UHFFFAOYSA-N 7-methyl-1-benzothiophene Chemical compound CC1=CC=CC2=C1SC=C2 PIHVNUSWMTZFBD-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920005682 EO-PO block copolymer Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LOMVENUNSWAXEN-UHFFFAOYSA-N Methyl oxalate Chemical compound COC(=O)C(=O)OC LOMVENUNSWAXEN-UHFFFAOYSA-N 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 description 1
- TZYWCYJVHRLUCT-VABKMULXSA-N N-benzyloxycarbonyl-L-leucyl-L-leucyl-L-leucinal Chemical compound CC(C)C[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCC1=CC=CC=C1 TZYWCYJVHRLUCT-VABKMULXSA-N 0.000 description 1
- 241001668536 Oculimacula yallundae Species 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 241000682843 Pseudocercosporella Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 241000221535 Pucciniales Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- YLEIFZAVNWDOBM-ZTNXSLBXSA-N ac1l9hc7 Chemical compound C([C@H]12)C[C@@H](C([C@@H](O)CC3)(C)C)[C@@]43C[C@@]14CC[C@@]1(C)[C@@]2(C)C[C@@H]2O[C@]3(O)[C@H](O)C(C)(C)O[C@@H]3[C@@H](C)[C@H]12 YLEIFZAVNWDOBM-ZTNXSLBXSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000004666 alkoxyiminoalkyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- JIJAYWGYIDJVJI-UHFFFAOYSA-N butyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCCCC)=CC=CC2=C1 JIJAYWGYIDJVJI-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000005159 cyanoalkoxy group Chemical group 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 125000004609 dihydroquinazolinyl group Chemical group N1(CN=CC2=CC=CC=C12)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- KWABLUYIOFEZOY-UHFFFAOYSA-N dioctyl butanedioate Chemical compound CCCCCCCCOC(=O)CCC(=O)OCCCCCCCC KWABLUYIOFEZOY-UHFFFAOYSA-N 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 244000078703 ectoparasite Species 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002194 fatty esters Chemical class 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical class O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- PXLVPVOLKYSPTN-LFIBNONCSA-N methyl (E)-2-[2-[(4-chloro-3-methoxyphenyl)methylsulfanyl]-3-methylphenyl]-3-methoxyprop-2-enoate Chemical compound CO\C=C(\C(=O)OC)c1cccc(C)c1SCc1ccc(Cl)c(OC)c1 PXLVPVOLKYSPTN-LFIBNONCSA-N 0.000 description 1
- VEKVDFYTTXLRCF-UHFFFAOYSA-N methyl 2-[3-bromo-2-(6,6-dimethylhept-2-en-4-ynylsulfanyl)phenyl]-3-methoxyprop-2-enoate Chemical compound BrC=1C(=C(C=CC1)C(C(=O)OC)=COC)SCC=CC#CC(C)(C)C VEKVDFYTTXLRCF-UHFFFAOYSA-N 0.000 description 1
- DUGCZHXTLPAXBN-UHFFFAOYSA-N methyl 2-[3-chloro-2-(6,6-dimethylhept-2-en-4-ynylsulfanyl)phenyl]-3-methoxyprop-2-enoate Chemical compound ClC=1C(=C(C=CC1)C(C(=O)OC)=COC)SCC=CC#CC(C)(C)C DUGCZHXTLPAXBN-UHFFFAOYSA-N 0.000 description 1
- WWLGPKPBOVUNMK-UHFFFAOYSA-N methyl 2-[3-chloro-2-[(4-methylphenyl)methylsulfanyl]phenyl]-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=CC(Cl)=C1SCC1=CC=C(C)C=C1 WWLGPKPBOVUNMK-UHFFFAOYSA-N 0.000 description 1
- QTXMSAZFUDXUEX-UHFFFAOYSA-N methyl 2-[3-methyl-2-[(4-methylphenyl)methylsulfanyl]phenyl]acetate Chemical compound CC1=CC=C(CSC2=C(C=CC=C2C)CC(=O)OC)C=C1 QTXMSAZFUDXUEX-UHFFFAOYSA-N 0.000 description 1
- IILVEICQSFFHDC-UHFFFAOYSA-N methyl 2-methoxyimino-2-[3-methyl-2-[(4-methylphenyl)methylsulfanyl]phenyl]acetate Chemical compound CON=C(C(=O)OC)C1=C(C(=CC=C1)C)SCC1=CC=C(C=C1)C IILVEICQSFFHDC-UHFFFAOYSA-N 0.000 description 1
- SHNLFOOIRGNDCF-UHFFFAOYSA-N methyl 3-hydroxy-2-[3-methyl-2-[(5-phenylpyrimidin-2-yl)methylsulfanyl]phenyl]prop-2-enoate Chemical compound COC(=O)C(=CO)C1=CC=CC(C)=C1SCC1=NC=C(C=2C=CC=CC=2)C=N1 SHNLFOOIRGNDCF-UHFFFAOYSA-N 0.000 description 1
- URDKGSAQXQZAAB-UHFFFAOYSA-N methyl 3-methoxy-2-[3-methyl-2-[(3-methyl-5-nitrophenyl)methylsulfanyl]phenyl]prop-2-enoate Chemical compound COC=C(C(=O)OC)C1=CC=CC(C)=C1SCC1=CC(C)=CC([N+]([O-])=O)=C1 URDKGSAQXQZAAB-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 125000005609 naphthenate group Chemical group 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 238000003359 percent control normalization Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000008121 plant development Effects 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- NWZBFJYXRGSRGD-UHFFFAOYSA-M sodium;octadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCCCOS([O-])(=O)=O NWZBFJYXRGSRGD-UHFFFAOYSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- CTDPGMNOBQHERX-UHFFFAOYSA-N thiophene-2,3-dione Chemical compound O=C1SC=CC1=O CTDPGMNOBQHERX-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- LGQXXHMEBUOXRP-UHFFFAOYSA-N tributyl borate Chemical compound CCCCOB(OCCCC)OCCCC LGQXXHMEBUOXRP-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/42—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing within the same carbon skeleton a carboxylic group or a thio analogue, or a derivative thereof, and a carbon atom having only two bonds to hetero atoms with at the most one bond to halogen, e.g. keto-carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
- A01N37/50—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids the nitrogen atom being doubly bound to the carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/54—1,3-Diazines; Hydrogenated 1,3-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/647—Triazoles; Hydrogenated triazoles
- A01N43/653—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/74—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,3
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/82—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with three ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/63—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/65—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfone or sulfoxide groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/10—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/26—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Abstract
Compounds of formula I wherein X is CH or N; n is 0, 1, 2 or 3; R1 and R3, which may be the same or different, are alkyl,. alkoxy or alkylthio, each of which is optionally substituted, halogen, nitro, cyano, COOR4, -NR5R6, CONR5R6, COR7 or R8S(0)q; or R1 and an adjacent R3 group, or two adjacent R3 groups, together with the carbon atoms to which they are attached can form a 5 to 8 membered ring which can include 1 to 3 heteroatoms and may be substituted; R2 is an optionally substituted aliphatic hydrocarbon radical, which may be unsaturated, aryl or heterocyclyl; R4 is hydrogen or an ester forming group; R5 and R6 are the same or different and are hydrogen, optionally substituted alkyl, acyll or aryl, or together with the nitrogen to which they are attached, form a 5 to 7 membered ring which can contain other hetero atoms; R7 is hydrogen, optionally substituted alkyl or aryl; R8 is optionally substituted alkyl or aryl; and q is 1 or 2, have fungicidal activity as do the intermediates of formula II wherein R9 is hydrogen or methyl, and of formula III
Description
Title: Propenoic Acid Derivatives
Field of the invention
This invention relates to propenoic acid derivatives, having fungicidal activity.
Prior Art
Alkyl 2-aryl-2-propenoate derivatives have been disclosed as having pesticidal activity. In our EP 299694, we have disclosed compounds of this type and in particular
2-phenyl-2-propenoic acid derivatives in which the phenyl group is substituted in the 2-position by substituted thio groups. Analogous compounds have also been disclosed in EP 251082. Although many of these compounds have outstanding fungicidal activity, some compounds of this type appear to be unstable when exposed to light and the activity is thus not always maintained over a long period.
Description of the Invention
We have now found that introduction of certain substituents in the 3-position of the aryl ring results in compounds having good fungicidal activity coupled with greater stability.
Thus according to one aspect of the invention there is provided a compound of formula I
wherein
X is CH or N;
n is 0, 1, 2 or 3;
R1 and R3, which may be the same or different, are alkyl, alkoxy or alkylthio, each of which is optionally substituted, halogen, nitro, cyano, COOR4, -NR5R6, CONR5R6, COR7 or R8S(O)q; or R1 and an adjacent R3 group, or two adjacent R3 groups, together with the carbon atoms to which they are attached can form a 5 to 8 membered ring which can include 1 to 3 heteroatoms and may be substituted;
R2 is an optionally substituted aliphatic hydrocarbon radical, which may be unsaturated, aryl or heterocyclyl;
R4 is hydrogen or an ester forming group;
R5 and R6 are the same or different and are hydrogen, optionally substituted alkyl, acyl or aryl, or together with the nitrogen to which they are attached, form a 5 to 7 membered ring which can contain other hetero atoms;
R7 is hydrogen, optionally substituted alkyl or aryl;
R8 is optionally substituted alkyl or aryl; and q is 1 or 2.
Aliphatic hydrocarbon radicals are generally of up 10 carbon atoms and can be cyclic or acyclic. Alkyl groups may branched or straight chained. If R2 is alkyl it is generally of 4 to 9 carbon atoms. Substituents, when present on any aliphatic hydrocarbon radical group, include halogen, alkoxy (e.g. of 1 to 4 carbon atoms), haloalkoxy (e.g. difluoromethoxy), hydroxy, alkylthio, nitro, optionally substituted amino, carboxy, alkoxycarbonyl, cyano, acyloxy and aryl. Cyclic aliphatic groups are generally of 3 to 8 carbon atoms. Aryl groups are usually phenyl, optionally substituted, e.g. by halogen, optionally substituted alkyl or alkoxy, aryl, aryloxy, nitro, amino, COOH, alkoxycarbonyl, CN, CONRSR6 or S(O)pR8 (p = 0, 1 or 2). In some cases two substituents, together with the phenyl to which they are attached, can form a fused ring which itself can be optionally substituted as for phenyl. The terms heterocyclyl includes aromatic and non-aromatic rings which usually contain 5 to 7 ring atoms and including up to three hetero atoms usually selected from nitrogen, oxygen and sulfur.
Examples of such groups include thienyl, furyl, pyridyl, pyrimidinyl, pyrazolyl, thiazolyl, thiazolinyl, thiazolone, oxazolyl, benzimidazolyl, tetrazolyl, benzoxazolyl, thiadiazolyl, dioxolanyl, imidazopyridinyl,
1,3-benzoxazinyl, 1,3-benzothiazinyl, oxazolopyridinyl, triazolyl, triazinyl, imidazolyl, morpholino, benzofuranyl, pyrazolinyl, quinolinyl, quinazolinyl, dihydroquinazolinyl or benzothiazolyl. The heterocyclyl group may be substituted, e.g. as described for phenyl.
The term ’’acyl includes the residue of sulfonic and phosphorus containing acids as well as carboxylic acids.
Amino groups may be substituted, e.g. by one or two alkyl groups or two substituents can form a ring, e.g. to form a morpholino or piperidino ring. In the compounds of the invention, alkyl groups, which may be branched or straight chains, are preferably of 1 to 8 carbon atoms. R1 is generally of 1 to 4 carbon atoms, especially methyl or ethyl. Alkenyl and alkynyl groups are generally of three to ten carbon atoms.
It is generally preferred that n is 0 or 1, especially 0.
R1 is preferably methyl, ethyl, methoxy, ethoxy or halogen, e.g. chlorine or bromine. It is particularly preferred that R1 is methyl, methoxy or chlorine.
R2 is preferably heteroaryl or phenyl, optionally substituted by one or more of the same or different halogen, alkyl, haloalkyl, C3.8-cycloalkyl, alkoxy, haloalkoxy, cyanoalkoxy, alkylthio, alkanoyl, alkoxycarbonyl, alkoxyalkoxy, optionally substituted phenyl, optionally substituted phenylalkoxy, optionally substituted phenylalkyl, optionally substituted phenoxyalkoxy, alkenyl, alkenyloxy, alkynyl, alkynyloxy, alkylsulfonyl, haloalkylsulfonyl, alkoxycarbonylalkyl, alkoxyiminoalkyl, cyano, nitro, dialkylaminoalkyl or heterocyclyl, in which substituents on any optionally substituted phenyl group are halogen, alkyl, haloalkyl, alkoxy, nitro or cyano, any aliphatic group is of 1 to 8 carbon atoms and any heteroaryl group comprises 5 or 6 ring atoms including up to 3 hetero atoms selected from nitrogen, sulfur and oxygen, and any heterocyclyl substituent is itself optionally substituted by alkyl, halo or optionally substituted phenyl.
Compounds of the invention exist as structural isomers and the invention includes individual isomers as well as mixtures of these. Preferred compounds are those where the methoxypropenoate or (methoxyimino)acetate attached directly to the benzene ring shown in formula I is in the E-configuration.
The compounds of formula I have pesticidal activity and especially fungicidal activity. This activity manifests itself especially against fungal diseases of plants, e.g. mildews and particularly barley powdery mildew (Ervsiphe graminis) and vine downy mildew (Plasmopara viticola), rice blast (Pvricularia oryzae), cereal eyespot (Pseudocercosporella herpotrichoides), grey mould (Botrvtis cinerea), wheat brown rust (Puccinia recondita), late tomato or potato blight (Phytophthora infestans), apple scab (Venturia inaequalis), rice sheath blight (Pellicularia sasakii), glume blotch (Leptosphaeria nodorum). Other fungi against which the compounds may be active include other powdery mildews, other rusts, and general pathogens of Deuteromycete, Ascomycete,
Phycomycete and Basidiomycete origin.
Some compounds of the invention also have insecticidal, acaricidal and nematicidal activity and are particularly useful in combating a variety of economically important insects, acarids and plant nematodes, including animal ectoparasites. They may also have herbicidal activity.
The invention thus also provides a method of combating pests (i.e. fungi, insects, nematodes, acarids and weeds, but especially fungi) at a locus infested or liable to be infested therewith, which comprises applying to the locus a compound of formula I.
The invention also provides an agricultural composition comprising a compound of formula I in admixture with an agriculturally acceptable diluent or carrier.
The composition of the invention may of course include more than one compound of the invention.
In addition the composition can comprise one or more additional active ingredients, for example compounds known to possess plant-growth regulant, herbicidal, fungicidal, insecticidal or acaricidal properties. Alternatively the compounds of the invention can be used in sequence with the other active ingredient.
The diluent or carrier in the composition of the invention can be a solid or a liquid optionally in association with a surface-active agent, for example a dispersing agent,
emulsifying agent or wetting agent. Suitable surface-active agents include anionic compounds such as a carboxylate, for example a metal carboxylate of a long chain fatty acid; an N-acylsarcosinate; mono- or di-esters of phosphoric acid with fatty alcohol ethoxylates or salts of such esters; fatty alcohol sulfates such as sodium dodecyl sulfate, sodium octadecyl sulfate or sodium cetyl sulfate; ethoxylated fatty alcohol sulfates; ethoxylated alkylphenol sulfates; lignin sulfonates; petroleum sulfonates; alkyl-aryl sulfonates such as alkyl-benzene sulfonates or lower alkylnaphthalene sulfonates, e.g. butyl-naphthalene sulfonate; salts of sulfonated naphthalene-formaldehyde condensates; salts of sulfonated phenol-formaldehyde condensates; or more complex sulfonates such as the amide sulfonates, e.g. the sulfonated condensation product of oleic acid and N-methyl taurine or the dialkyl sulfosuccinates, e.g. the sodium sulfonate of dioctyl succinate. Nonionic agents include condensation products of fatty acid esters, fatty alcohols, fatty acid amides or fatty-alkyl- or alkenyl-substituted phenols with ethylene oxide, fatty esters of polyhydric alcohol ethers, e.g. sorbitan fatty acid esters, condensation products of such esters with ethylene oxide, e.g. polyoxyethylene sorbitan fatty acid esters, block copolymers of ethylene oxide and propylene oxide, acetylenic glycols such as 2,4,7,9-tetramethyl5-decyne-4,7-diol, or ethoxylated acetylenic glycols.
Examples of a cationic surface-active agent include, for instance, an aliphatic mono-, di-, or polyamine as an acetate, naphthenate or oleate; an oxygen-containing amine such as an amine oxide or polyoxyethylene alkylamine; an amide-linked amine prepared by the condensation of a carboxylic acid with a di- or polyamine; or a quaternary ammonium salt.
The compositions of the invention can take any form known in the art for the formulation of agrochemicals, for example, a solution, a dispersion, an aqueous emulsion, a dusting powder, a seed dressing, a fumigant, a smoke, a bait, a dispersible powder or granule, an emulsifiable concentrate or granules. Moreover it can be in a suitable form for direct application or as a concentrate or primary composition which requires dilution with a suitable quantity of water or other diluent before application.
An emulsifiable concentrate comprises a compound of the invention dissolved in a water-immiscible solvent which is formed into an emulsion with water in the presence of an emulsifying agent.
A dusting powder comprises a compound of the invention intimately mixed and ground with a solid pulverulent diluent, for example, kaolin.
A granular solid comprises a compound of the invention associated with similar diluents to those which may be employed in dusting powders, but the mixture is granulated by known methods. Alternatively it comprises the active ingredient absorbed or adsorbed on a pre-granular diluent, for example, Fuller's earth, attapulgite or limestone grit.
Wettable powders, granules or grains usually comprise the active ingredient in admixture with a suitable surfactant and an inert powder diluent such as china clay.
Another suitable concentrate is a flowable suspension concentrate which is formed by grinding the compound with water or other liquid, a wetting agent and a suspending agent.
The concentration of the active ingredient in the composition of the present invention, as applied to plants is preferably within the range of 0.0001 to 3.0 per cent by weight, especially 0.001 to 0.1 per cent by weight. In a primary composition the amount of active ingredient can vary widely and can be, for example, from 5 to 95 per cent by weight of the composition.
In the method of the invention the compound is generally applied to seeds, plants or their habitat. Thus the compound can be applied directly to the soil before, at or after drilling so that the presence of active compound in the soil can control the growth of fungi which may attack seeds. When the soil is treated directly the active compound can be applied in any manner which allows it to be intimately mixed with the soil such as by spraying, by broadcasting a solid form of granules, or by applying the active ingredient at the same time as drilling by inserting it in the same drill as the seeds. A suitable application rate is within the range of from 0.05 to 20 kg per hectare, more preferably from 0.1 to 10 kg per hectare.
Alternatively the active compound can be applied directly to the plant by, for example, spraying or dusting either at the time when the fungus has begun to appear on the plant or before the appearance of fungus as a protective measure. In both such cases the preferred mode of application is by foliar spraying. It is generally important to obtain good control of fungi in the early stages of plant growth as this is the time when the plant can be most severely damaged. The spray or dust can conveniently contain an insecticide if this is thought necessary. Sometimes, it is practicable to treat the roots of a plant before or during planting, for example,
by dipping the roots in a suitable liquid or solid composition. When the active compound is applied directly to the plant a suitable rate of application is from 0.001 to 5 kg per hectare, preferably from 0.01 to 0.5 kg per hectare.
The compounds of the invention may be obtained by various methods. For example when X is CH, a compound of formula II
where R9 is methyl, can be reacted with a phosphorus ylide derived from a phosphonium salt of formula
Ph3P+CH2OMe Hal' under basic conditions.
When X is N, the compound of formula II can be reacted with methoxyamine hydrochloride.
Alternatively when X is CH, a compound of formula III
(HI) can be reacted with methyl formate under basic conditions, followed by methylation of the resulting hydroxypropenoate.
The compounds of formula II, where R9 is hydrogen, can be obtained by reacting a benzo[b]thiophene-2,3-dione of
with a compound of formula V
R2-CH2-Z (V) where Z is a leaving group, e.g. halogen, generally under basic conditions. This can then be esterified to a compound of formula II, where R9 is methyl, e.g. by reacting with methyl chloroformate in the presence of a tertiary amine.
The compounds of formula III can be obtained by reacting a benzo[b]thiophen-2(3H)-one of formula VI
with a compound of formula V
R2-CH2-Z (V) where Z is a leaving group, eg halogen, generally under basic conditions, followed by esterification in conventional manner.
The compounds of formula III can also be obtained by reducing the compounds of formula II, preferably where where R9 is hydrogen, in a Wolff-Kischner reduction, e.g. by using hydrazine in the presence of a base e.g. an alkali metal alkoxide. When R9 is hydrogen, the WolffKischner reduction is followed by esterification to the methyl ester.
The compounds of formulae IV, V and VI are known or can be obtained in known manner.
The compounds of formula II and III are novel and the invention also includes these compounds of this type.
Many of these compounds also have pesticidal activity.
The compounds of the invention may also be obtained by the method described in our PCT application WO 91/07385.
The invention is illustrated in the following Examples. Structures of isolated novel compounds were confirmed by elemental and/or other appropriate analyses. Temperatures are in °C.
Example 1
A mixture of 7-methylbenzo[b]thiophene-2,3-dione (4.1 g) and aqueous sodium hydroxide (1.84 g in 80 ml water) was heated under reflux for one hour. To the resulting solution at 50°, was added 4-chloro-3-methoxybenzyl bromide (5.42 g) and the mixture refluxed for a further 2 hours and allowed to cool. It was acidified to pH 1, extracted with ether and the extract dried and evaporated. The residue was recrystallised from diisopropyl ether to give 2-(2-(4-chloro-3-methoxybenzylthio)-3-methyIphenyl]2-oxoacetic acid, m.p. 117-8°. (Intermediate A)
To a solution of Intermediate A (5.8 g) in dichloromethane (100 ml) was added triethylamine (1.84 g), followed by dropwise addition of methyl chloroformate (1.64 g). The mixture was heated under reflux for 0.5 hours, cooled, washed with aqueous sodium hydrogen carbonate, dried and evaporated. The residue was recrystallised from diisopropyl ether to give methyl 2-[2-(4-chloro-3-methoxybenzylthio)-3-methyIphenyl]-2-oxoacetate, m.p. 118-9°
(Intermediate Β).
A solution of Intermediate B (4.2 g) in ether (60 ml) was added dropwise to a mixture of potassium tert butoxide (2.6 g) and a suspension of (methoxymethyl)tripheny1phosphonium chloride (7.9 g) in ether (100 ml), which had been stirred for 45 minutes. The reaction mixture was stirred for 4 hours, washed with water, dried and evaporated. The residue was dissolved in dichloromethane, filtered through silica gel and evaporated. The residue was recrystallised from diisopropyl ether to give methyl (E)-3-methoxy-2-[2-(4-chloro-3-methoxybenzylthio)3-methylphenyl]prop-2-enoate, m.p. 100-2°. (Compound 1)
In a similar manner the following compounds of formula I, and their type A and B intermediates were obtained. Where no parameters are given for an intermediate then it was not isolated in a pure form but used in its crude form in the next reaction stage. Generally the compounds are obtained as E-isomers; compounds obtained as Z-isomers are indicated by an asterisk (’) , and are obtained from the reaction mixture by chromatography on silica gel using ethyl acetate/petoleum ether as eluent.
m.p.(°) or physical state Cpd. R1 R2 (R3)n Compound of Intermediates
No. formula I A B
| 2 | Me | 3-Me-Ph | - | 141-3 | 131-3 | oil |
| 3 | Me | 4-CF-j-Ph | - | 103-5 | 105-7 | 70-2 |
| 4 | Me | 3-MeO-Ph | - | 89-90 | 73-5 | 55-7 |
| 5 | Me | 3-F-Ph | - | 110-2 | 122-4 | 55-7 |
| 6 | Me | 2-Br-Ph | - | 130-1 | 141-3 | 68-70 |
| 7 | Me | 2-Cl-Ph | - | 100-2 | 105-7 | 68-70 |
Cpd. R1 R2
m.p.(°) or physical state (R3)n Compound of Intermediates
| No. | formula | I A | B | |||
| 8 | Me | 4-Et-Ph | - | 68-70 | 84-5 | oil |
| 9 | Me | 3,5-Me2-Ph | - | 120-2 | 142-4 | 68-70 |
| 10 | Me | 2,5-Me2-Ph | - | 132-3 | 110-2 | 82-3 |
| 11 | Me | Ph | - | 120-2 | 103-5 | 44-5 |
| 12 | Me | 2- (PhCH2CH2) -Ph | - | 75-7 | 107-9 | Oil |
| 13 | Me | 2,5-(CF3) 2-Ph | - | oil* | 75-6 | 80-1 |
| 14 | Me | 3,5-Cl2-Ph | - | 130-1 | 131-3 | 101-3 |
| 15 | Me | 3-(4-Cl-Ph)1,2,4-triazol-l-yl | • | 107-9 | 197-9 | 95-6 |
| 16 | Et | 4-Me-Ph | - | 92-3 | 79-80 | oil |
| 17 | Me | 4-F-3-Me-Ph | - | 142-3 | 112-4 | 73-4 |
| 18 | Me | 3-MeO-Ph | - | 83-5* | 73-5 | 55-7 |
| 19 | Me | Ph | - | 103-5* | 103-5 | 44-5 |
| 20 | Me | 3-(PhCH2O) -Ph | - | 102-4 | 98-100 | 88-90 |
| 21 | Me | 3-EtO-Ph | - | 80-1 | 110-2 | oil |
| 22 | Me | 3-(C5HhO) -Ph | - | 78-80 | oil | |
| 23 | Me | 3-(C6H13OCO) -Ph | - | Oil* | oil | |
| 24 | Me | 3—(C6H13OCO) -Ph | - | 74-6 | oil | |
| 25 | Me | 2,5-(CF3) 2-Ph | - | 77-8 | 75-6 | 80-1 |
| 26 | Cl | 3-Me-Ph | - | 101-2 | 133-4 | 80-1 |
| 27 | Me | 4-(CF3O)-Ph | - | 79-80 | 116-7 | oil |
| 28 | Me | 4-(CF3O) -Ph | - | 87-8* | 116-7 | oil |
| 29 | Me | 4-Cl-Ph | - | 95-7* | 135-7 | 68-70 |
| 30 | Me | 3-(3-Me-Ph)-1,2,4triazol-l-yl | • | gum | oil | |
| 31 | Me | 4-MeCONH-Ph | - | 70-2 | 130-2 | |
| 32 | Et | 3-F-Ph | - | 96-8 | 97-9 | 73-5 |
| 33 | Me | 4-Cl-Ph | - | 115-7 | 135-7 | 68-70 |
| 34 | Et | 3-MeO-Ph | - | oil | 74-4,5 | 51.5-2.5 |
| 35 | Et | 3-F-Ph | - | oil* | 73-75 |
m.p.(°) or physical state (R3)n Compound of Intermediates
Cpd. R1 R2
| No. | formula | I A | B | |||
| 36 | Me | 3-Bu-Ph | - | oil* | oil | |
| 37 | Et | 4-Cl-Ph | - | 86-7 | 89.5-90.5 | gum |
| 38 | Me | 2-CF3-Ph | - | 84-6 | 123-4 | 73-4 |
| 39 | Me | 3-Bu-Ph | - | oil | oil | |
| 40 | Me | 2-CF3-Ph | - | 76-7* | 123-4 | 73-4 |
| 41 | Et | 3,5-Me2-Ph | - | 116.5-8 | .5 80-1 | 52-3.5 |
| 42 | Me | 3,5-(MeO)2-Ph | - | 115-6 | 156-8 | 80-1 |
| 43 | Me | 3,5-(MeO)2-Ph | - | oil* | 156-8 | 80-1 |
| 44 | Me | 3-CF3-Ph | - | oil* | ||
| 45 | Et | 3-(C5HnOCO) -Ph | - | oil | oil | oil |
| 46 | Et | S-CCjHnOCO) -Ph | - | oil* | oil | oil |
| 47 | Me | 2-Me-Ph | - | 105-6 | 123-4 | 45-6 |
| 48 | Me | 2-Me-Ph | - | 99-100* | 123-4 | 45-6 |
| 49 | Me | 2,5-Cl2-Ph | - | 111-2 | 148-9 | 110-1 |
| 50 | Me | 2,5-Cl2-Ph | - | 105-6* | 148-9 | 110-1 |
| 51 | Me | 3-CF3O-Ph | - | 52.5-4 | 100.5-2 | oil |
| 52 | Me | 3,5-F2-Ph | - | 86-7* | 117-8 | 63-4 |
| 53 | Me | 3-CF3O-Ph | - | gum* | 100.5-2 | oil |
| 54 | Me | 2-CF3O-Ph | - | 72.5-3. | 5 124-5 | 61.5-3 |
| 55 | Me | 3-CF3-Ph | - | 90-1 | 103-4 | 72-3 |
| 56 | Me | 3-CHF2O-5-Me-Ph | - | gum | 127-8.5 | oil |
| 57 | Me | 3-CHF2O-5-Me-Ph | - | 93-4* | 127-8.5 | oil |
| 58 | Me | 3-Cl-5-Me-Ph | - | 132-3.5 | 150-1 | 98-9.5 |
| 59 | Me | 3-MeO-5-Me-Ph | - | 88-9 | 112-3 | 50-1.5 |
| 60 | Me | 3,5-F2-Ph | - | 118-9 | 117-8 | 63-4 |
| 61 | Et | 3,5-Cl2-Ph | - | 126-7 | 100-1 | 55-7 |
| 62 | Me | 3-MeOCO-Ph | - | oil | 115-6 | |
| 63 | Me | 3-Cl-Ph | - | 126-7 | 127-9 | 99-100.5 |
| 64 | Me | 3-MeO-5-Me-Ph | - | 74-5.5* | 112-3 | 50-1.5 |
| 65 | Et | 3,5-Cl2-Ph | - | 118-9* | 100-1 | 56-7 |
Cpd. R1 R2
m.p.(e) or physical state (R3)n Compound of Intermediates
| No. | formula I | A | B | |||
| 66 | Et | Ph | - | 61-2* | 108-10 | 43-4 |
| 67 | Me | 2-MeO-Ph | - | 108-9 | 121-2 | 83-4 |
| 68 | Me | 2-MeO-Ph | - | 112-3* | 121-2 | 83-4 |
| 69 | Et | Ph | - | 86-7 | 108-10 | 43-4 |
| 70 | Et | 4-Et-Ph | - | 60* | oil | 52-4 |
| 71 | Me | 3- (C5HuOCO) -5-Me-Ph | - | oil | oil | oil |
| 72 | Me | 4-(4,6-Me2- pyrimidin-2-yl)-Ph | 158-8.5 | 182.5-3. | 5 103.5-6 | |
| 73 | Me | 3-(4,6-Me2pyrimidin-2-yl)-Ph | 128- 129.5 | 209.5- 212.5 | 109- 111.5 | |
| 74 | Me | 3-(4,6-Me2-pyr- imidin-2-yl)-Ph | 110.5- 112.5* | 209.5- 212.5 | 109.5- 111.5 | |
| 75 | Et | 4-Et-Ph | - | 87-9 | oil | 52-4 |
| 76 | Me | 4-MeO-Ph | - | 76-7 | 100-0.5 | oil |
| 77 | Me | 4-MeO-Ph | - | 108.5-9. | 5* 100-0. | 5 oil |
| 78 | Me | 2-Et-Ph | - | 98-9 | 105-6 | 54-5 |
| 79 | Me | 2-Et-Ph | - | 58-60* | 105-6 | 54-5 |
| 80 | Me | 2,5-F2-Ph | - | 123-4* | 92-5 | 67-8 |
| 81 | Me | 3,4-Me2-Ph | - | 129-31 | 118-20 | 55-6 |
| 82 | Me | 3-Et-Ph | - | 103-5 | oil | |
| 83 | Me | 3-(CH2=CH-) -Ph | - | 104-7 | 211 | oil |
| 84 | Me | 3-(CH2=CH-) -Ph | - | gum* | 211 | oil |
| 85 | Et | 3- (CjH^OCO) -5-Me-Ph | - | oil* | oil | oil |
| 86 | Me | 3-(CHF2O) -Ph | - | 111-2* | 200(dec) | oil |
| 87 | Me | 3-(pyrimidin-2-yl)- | Ph - | 115-6* | 135-7 | 88-9 |
| 88 | Me | 3-(CHF2O) -Ph | - | gum | 200(dec) | oil |
| 89 | Me | 3-(pyrimidin-2-yl)- | Ph - | 110-2 | 135-7 | 88-9 |
| 90 | Me | 2,5-F2-Ph | - | 104-6 | 92-5 | 67-8 |
| 91 | Me | 3-Et-Ph | - | 69.5-71* | oil | |
| 92 | Me | 2,4,5-Me3-Ph | - | 169-70 | 148-9.5 | 66.5-66.8 |
m.p.(°) or physical state (R3)a Compound of Intermediates
Cpd. R1 R2
| No. | formula I | A | B | ||
| 93 | Me | 2-F-5-CF3-Ph | 78-80 | 93-5 | 100-2 |
| 94 | Me | 2-F-5-CF3-Ph | 96-8* | 93-5 | 100-2 |
| 95 | Me | 2-F-6-CF3-Ph | 80-2 | 125-6 | 73-5 |
| 96 | Me | 2-F-6-CF3-Ph | 98-100* | 125-6 | 73-5 |
| 97 | Me | 4-F-3-CF3-Ph | 82.5-4 | 140-1.5 | 82.5-3.5 |
| 98 | Me | 4-F-3-CF3-Ph | 88-9* | 140-1.5 | 82.5-3.5 |
| 99 | Me | 3-F-5-CF3-Ph | 87.5-8.5 | * 97.5-8. | 5 50-0.5 |
| 100 | Me | 3- (1-Me-pentyl-OCO)-Ph - | oil | oil | |
| 101 | Me | 4-(Me0C0)-Ph | 92-2.5 | 110.5-11 | 80-1 |
| 102 | Me | 4-(MeOCO)-Ph | 80-82.5* | 110.5-11 | . 80-1 |
| 103 | Et | 4-(MeOCO)-Ph | 81.5-2* | 89.5-90. | 5 54-5.50 |
| 104 | Me | 4-(pyrimidin-2-yl)-Ph - | 131-3* | 141-3 | 133-4 |
| 105 | Me | 4-(pyrimidin-2-yl)-Ph - | 103-5 | 141-3 | 133-4 |
| 106 | Et | 3-cyano-Ph | 98.5-9.5 | 137.5-8.5 | ί 82.5-3.5 |
| 107 | Me | 3-Pr‘O-Ph | 65-6 | 87-88 | oil |
| 108 | Me | 3-F-Ph | 98-100* | 122-4 | 55-7 |
| 109 | Et | 4-(MeOCO)-Ph | 80-1 | 89.5-90. | 5 54-5.5 |
| 110 | Et | 3-MeO-Ph | 100.5-1. | 5* 74-4.5 | 51.5-2.5 |
| 111 | Me | 2,4-Me2-Ph | 114-6 | 121-22.5 | |
| 112 | Me | 3-F-5-Me-Ph | 127-8.5 | 124-6 | |
| 113 | Me | 3-F-5-Me-Ph | 109-110* | 124-6 | |
| 114 | Me | 4-(CHF2O)-Ph | 88.5-89 | oil | 61.5-2 |
| 115 | Me | 4-(CHF2O)-Ph | 89-91* | oil | 61.5-2 |
| 116 | Me | 3-I-Ph | 88-90 | 140-3 | 102-4 |
| 117 | Me | 3-I-Ph | 108-9.5* | 140-3 | 102-4 |
| 118 | Me | 3-Br-5-Me-Ph | 113-5 | 138-40 | 96-8 |
| 119 | Me | 3-Br-5-Me-Ph | 105-7* | 138-40 | 96-8 |
| 120 | Me | 3-Pr*O-Ph | oil* | 87-88 | oil |
| 121 | Me | 2-Cl-5-MeS-Ph | 130-1 | 116-8 | 79-80 |
| 122 | Me | 2-Cl-5-MeS-Ph | 85-6* | 116-8 | 79-80 |
m.p.(°) or physical state
| Cpd. No. | R1 | R2 | (R3) n | Compound of formula I | Intermediates | |
| A | B | |||||
| 123 | Me | 3-MeCOO-5-Me-Ph | - | oil | oil | 96-8 |
| 124 | Me | 4-(4 -NO2-PhCH2O) -Ph | - | 82-3.5 | 127-8.5 | oil |
| 125 | Me | 3-Me-5-EtOCO-Ph | - | 89-90 | 103-4.5 | 67-8.5 |
| 126 | Me | 3-Me-5-EtOCO-Ph | - | oil* | 103-4.5 | 67-8.5 |
| 127 | Me | 3-MeS-Ph | - | 108-10 | 128-9 | oil |
| 128 | Me | 3-MeS-Ph | - | 65-6* | 128-9 | oil |
| 129 | Et | 2,5-Cl2-Ph | - | 99-100 | 118-20 | 102-3 |
| 130 | Et | 2,5-Cl2-Ph | - | oil | 118-20 | 102-3 |
| 131 | Me | 3-F-5-CF3-Ph | - | 42.5-4.5 | 97.5-8. | 5 50-50.5 |
| 132 | Et | 3-cyano-Ph | - | 98-9* | 137.5—8 | .5 82-3.5 |
| 133 | Et | 2,5-Me2-Ph | - | 69.5-70.S | i* 96.5-' | 7.5 oil |
| 134 | Et | 2,5-Me2-Ph | - | 130-1 | 96.5-7. | 5 oil |
| 135 | Me | 3-EtOCO-Ph | - | 76-8 | 93.5-4 | 48.5-50 |
| 136 | Me | 2-MeOCOCH2-Ph | - | 101-3 | 70-2 | |
| 137 | Me | 4-Me-Ph | 5-Me | 142-3 | 123-4 | 82-3 |
| 138 | Me | 4-Me-Ph | 5-Me | 129-30* | 123-4 | 82-3 |
| 139 | Me | 3-MeO-Ph | 5-Me | 140-1 | 108-9 | Oil |
| 140 | Me | 3-MeO-Ph | 5-Me | 82-3* | 108-9 | oil |
| 141 | Me | 2-F-Ph | 5-Me | 92-3 | 130-1 | 67-8 |
| 142 | Me | 2-F-Ph | 5-Me | 101-3* | 130-1 | 67-8 |
| 143 | Me | 4-Me-Ph | 6-Me | oil* | 99-100 | 79-80 |
| 144 | Me | 3-MeO-Ph | 6-Me | oil* | 70-1 | 65-6 |
| 145 | Me | 4-Me-Ph | 5-C1-6- | -Me oil* | 156-7 | 79-80 |
| 146 | Me | 2-F-Ph | 6-Me | oil* | 121-2 | 124-5 |
| 147 | Me | 3,5-Me2-Ph | 5-Me | 115-7 | 131-3 | 85-7 |
| 148 | Me | 3,5-Me2-Ph | 6-Me | oil* | 125-6 | 112-3 |
| 149 | Me | 4-F-Ph | 5-Me | 122-3* | 152-4 | 61-2 |
| 150 | Me | 3-F-Ph | 5-Me | 99-100 | 124-5 | oil |
| 151 | Me | 4-F-Ph | 5-Me | 116-8 | 152-4 | 61-2 |
| 152 | Me | Ph | 4-Me | 110-1 | 132-3 | oil |
| _---— | —-—' |
m.p.(e) or physical state
| Cpd. No. | R1 | R2 | (R3)„ | Compound formula I | of Intermediates | |
| A | B | |||||
| 153 | Me | 4-Me-Ph | 4-Me | 99-100* | 128-30 | 92-3 |
| 154 | Me | 3,5-Me2-Ph | 4-Me | 94-5 | 150-1 | 83-4 |
| 155 | Me | 3,5-Me2-Ph | 4-Me | 82-3* | 150-1 | 83-4 |
| 156 | Me | 2-F-Ph | 6-Me | 113-4+ | 121-2 | 124-5 |
| 157 | Me | 3-MeO-Ph | 4-Me | oil | 95-7 | 101-2 |
| 158 | Me | 3-PhCH2O-Ph | 4-Me | oil | 104-5 | 94-5 |
| 159 | Me | 4-Me-Ph | 5-F | 124-5* | 148-9 | 78-9 |
| 160 | Cl | 3-MeO-Ph | - | 82-3 | 89-92 | 58-60 |
| 161 | Cl | 4-Me-Ph | - | 86-7 | 122-3 | 75-6 |
| 162 | Cl | 4-Me-Ph | - | 122-3* | 122-3 | 75-6 |
| 163 | Cl | 2,5-Me2-Ph | - | 120-2 | 117-8 | 83-4 |
| 164 | Cl | 2,5-Me2-Ph | - | 108-9* | 117-8 | 83-4 |
| 165 | Cl | Ph | - | 100-1 | 266-82 | 58-60 |
| 166 | Cl | Ph | - | 127-8* | 266-82 | 58-60 |
| 167 | Cl | 2,5-(CF3) 2-Ph | - | 109-10* | 105-7 | 70-2 |
| 168 | Br | 3-MeO-Ph | - | 75-6 | 112-4 | 52-3 |
| 169 | Br | 4-Me-Ph | - | 96-7 | 141-3 | 64-5 |
| 170 | Br | 3, 5-Me2-Ph | - | 119-20 | 132-3 | 82-3 |
| 171 | Br | 2,5-Me2-Ph | - | 136-7 | 109-10 | 84-5 |
| 172 | Cl | 2,5-(CF-j) 2-Ph | - | 84-5 | 105-7 | 70-2 |
| 173 | Cl | 3- (nC6H13OCO) -Ph | - | 52-4 | oil | oil |
| 174 | Cl | 3-(nC6H13OCO)-Ph | - | oil* | oil | oil |
| 175 | Br | 3-Cl-Ph | - | 121-2 | 135-6 | 123-4 |
| 17 6 | Br | 3-F-Ph | - | 106-8 | 131-3 | 75-6 |
| 177 | Br | 3-F-Ph | - | 114-6* | 131-5 | 75-6 |
| 178 | Br | 3-Cl-5-Me-Ph | - | 132-3* | 88-9 | |
| 179 | Cl | 4-Et-Ph | - | gum | oil | |
| 180 | Cl | 4-Et-Ph | - | 84-6* | oil | |
| 181 | Cl | 3-MeOCO-Ph | - | oil* | 86-8 | |
| 182 | Cl | 3-MeOCO-Ph | - | oil | 86-8 |
m.p.(e) or physical state
| Cpd. | R1 | R2 | (r3)d | Compound | of Intermediates | ||
| No. | formula I | A | B | ||||
| 183 | Br | 3-Cl-5-Me-Ph | - | 110-2 | 88-9 | ||
| 184 | Cl | 3-F-5-Me-Ph | - | 92-5 | 129-31 | 74-5 | |
| 185 | Cl | 3-F-5-Me-Ph | - | 107-8* | 129-31 | 74-5 | |
| 186 | Br | 4-Et-Ph | - | gum | |||
| 187 | Br | 4-Et-Ph | - | gum* | |||
| 188 | Br | 3-MeO-5-Me-Ph | - | 95-7* | 63-5 | ||
| 189 | Cl | 3-Cl-5-Me-Ph | - | 95-7 | 94-5 | ||
| 190 | Cl | 3-Cl-5-Me-Ph | - | 120-1* | 94-5 | ||
| 191 | Br | 3-MeO-5-Me-Ph | - | 62-3 | 63-5 | ||
| 192 | Cl | 3-F-Ph | - | 110-2 | 72-3 | ||
| 193 | Cl | 3-F-Ph | - | 115-6* | 72-3 | ||
| 194 | Cl | 4-Cl-Ph | - | gum | 83-4.5 | ||
| 195 | Cl | 3,5-Me2-Ph | - | 121-2.5* | 140-1 | 85.5-6.5 | |
| 196 | Cl | 3,5-Me2-Ph | - | 100-2 | 140-1 | 85.5-6.5 | |
| 197 | Cl | 3-nCsHllO-Ph | - | 57-9 | oil | ||
| 198 | MeO | 4-Me-Ph | - | 112-3 | 115-6 | 82-3 | |
| 199 | MeO | 3-MeO-Ph | - | 88-9 | 124-6 | 77-8 | |
| 200 | MeO | 3-MeO-Ph | - | 73-4* | 124-6 | 77-8 | |
| 201 | MeO | 3-Cl-Ph | - | 81-2 | 153-4 | 72-3 | |
| 202 | MeO | 3-Cl-Ph | - | 84-5* | 153-4 | 72-3 | |
| 203 | MeO | 3,5-Me2-Ph | - | 127-8 | 140-1 | 79-80 | |
| 204 | MeO | 3,5-Me2-Ph | - | 83-4* | 140-1 | 79-80 | |
| 205 | EtO | Ph | - | 101-2 | 76-78 | ||
| 206 | MeO | 3-F-Ph | - | 87-8 | 135-6 | 69-70 | |
| 207 | MeO | 3-F-5-Me-Ph | - | 100-1 | 135-6 | 82-3 | |
| 208 | MeO | 4-Et-Ph | - | 76-7 | 34-5 | ||
| 209 | MeO | 4-Et-Ph | - | 60-1* | 34-5 | ||
| 210 | MeO | 3-MeOCO-Ph | - | 80-1 | 95-6 | ||
| 211 | MeO | 3-Cl-5-Me-Ph | - | 108-9 | 149-51 | 99-101 | |
| 212 | MeO | 2,5-Me2-Ph | - | 98-9 | 142-4 | 68-70 | |
| 213 | MeO | 2,5-Me2-Ph | - | 120-2* | 142-4 | 68-70 | |
| —------ | ____-— |
m.p.(°) or physical state
| Cpd. R1 No. | R2 | (R3)tt | Compound of Intermediates | |||
| formula I | A | B | ||||
| 214 | EtO | 4-Me-Ph | - | 110-1 | 91-2 | |
| 215 | EtO | 4-Me-Ph | - | 114-5* | 91-2 | |
| 216 | MeO | 3-Me-Ph | - | 81-2 | 130-31 | 65-6 |
| 217 | MeO | 3-Me-Ph | - | 82-3* | 130-1 | 65-6 |
| 218 | MeO | 4-F-Ph | - | 113-4.5 | 113.5-15 | 97-100 |
| 219 | MeO | 3-PhCH2O-Ph | - | gum | 90-91 | 63-4 |
| 220 | MeO | 4-F-Ph | - | 105-7* | 113.5-15 97-100 | |
| 221 | MeO | 4-CF3O-Ph | - | 68-70 | 118-19.5 | 67-9 |
| 222 | MeO | 4-CF3O-Ph | - | 79-81* | 118-19.5 | 67-9 |
| 223 | MeO | Ph | - | 108-9 | 132-4 | 81.5-3 |
| 224 | MeO | Ph | - | 137-8.5* | 132-4 | 81.5-3 |
| 225 | MeO | 3-CF3-Ph | - | gum | 125-7 | 81-3 |
| 226 | MeO | 3-CF3-Ph | - | 103-4.5* | 125-7 | 81-3 |
| 227 | MeO | 2-CF3-Ph | - | 85-7 | 146-7 | 96-7 |
| 228 | MeO | 2-CF3-Ph | - | 93-5.5* | 146-7 | 96-7 |
| 229 | Me | 4-Me-Ph | 4-Me | 123-4 | 128-30 | 92-3 |
| 230 | MeO | 3-MeO-5-Me-Ph | - | 130-1 | 85-6 | |
| 231 | Me | 3-PhCH2O-Ph | 4-Me | 99-100* | 104-5 | 94-5 |
| 232 | Me | 5-Cl-2-F-Ph | - | 85-7 | 117-20 | 78-80 |
| 233 | Me | 5-Cl-2-F-Ph | - | 85-7* | 117-20 | 78-80 |
| 234 | Me | 3-Br-Ph | - | 97-8* | 136-7 | 104-5 |
| 235 | Me | 2-F-3-CF3-Ph | - | 50-2 | 111-2 | 93-4 |
| 236 | Me | 2-F-3-CF3-Ph | - | 81-2* | 111-2 | 93-4 |
| 237 | Me | 4-MeO-3-Me-Ph | - | 72-4* | ||
| 238 | Me | 3-Br-Ph | - | 115-7 | 136-7 | 104-5 |
| 239 | Me | 3-[3-(4-Cl-Ph)-1,2, | 4- - | 166-8* | 157-9 | 110-20 |
| oxadiazol-5-yl]-Ph | ||||||
| 240 | BuSCH2 3-MeO-Ph | - | oil | oil | ||
| 241 | Me | 2-Br-5-F-Ph | - | 96-7* | ||
| 242 | Me | 2-Br-5-F-Ph | - | 97-8 |
Cpd. R1 R2
No.
m.p.(°) or physical state (R3)n Compound of Intermediate formula I A B
| 243 | Me | 2-F-4-CF3-Ph | — | 93-4 | 109-11 | 64-5 |
| 244 | Me | 2-F-4-CF3-Ph | - | 84-5* | 109-11 | 64-5 |
| 245 | Me | 2-F-3-Me-Ph | - | 98-101 | 70-2 | |
| 246 | Me | 2-F-3-Me-Ph | - | 72-5* | 70-2 | |
| 247 | Me | 3-[3-(4-Cl-Ph)-1,2,4 oxadiazol-5-yl]-Ph | — — | 123-4 | 157-9 | 110-20 |
| 248 | MeSCH2 2,5-Me2-Ph | - | oil | oil | ||
| 249 | MeSCH2 2,5-Me2-Ph | - | oil* | oil | ||
| 250 | Me | 4-Ph-Ph | - | 87-8.5 | 137-8 | 95-6.5 |
| 251 | Me | 4-Ph-Ph | - | 87-8.5* | 137-8 | 95-6.5 |
| 252 | Et | 4-Cl-3-MeO-Ph | - | 108.5-9 | .5 129-30 | 101-2.5 |
| 253 | Me | 4-F-2-CF3-Ph | - | 74-5.5 | 145-7 | 108-9 |
| 254 | Me | 4-F-2-CF3-Ph | - | 70-2* | 145-7 | 108-9 |
| 255 | Me | 2-F-5-MeO-Ph | - | 86-7* | ||
| 256 | Me | 4-Me-Ph | 5-F | 124-5* | 148-9 | 78-9 |
| 257 | Me | 3-(thiazol—2-yl)-Ph | - | gum* | 171-3 | 65-6 |
| 258 | Cl | 2-Me-Ph | - | 121-3 | 120-2 | 73-5 |
| 259 | Cl | 2-Me-Ph | - | 116-7* | 120-2 | 73-5 |
| 260 | Me | 2-(4-Cl-Ph) thiazol-4-yl | 85-7 | 175-7 | 73-5 | |
| 261 | Cl | 3-Pr’O-Ph | - | oil* | 98-100 | 67-8 |
| 262 | Cl | 5-Cl-2-Me-Ph | - | 112-3* | 142-4 | 120-1 |
| 263 | Me | 2-F-5-MeO-Ph | - | 77-8 | ||
| 264 | Cl | 2-F-5-MeO-Ph | - | 58-9* | 122-3 | 71-3 |
| 265 | Cl | 4-F-Ph | - | 93-4 | 151-2 | 100-1 |
| 266 | Cl | 3-CF3-Ph | - | 58-60 | 118-9 | 81-2 |
| 267 | Me | 4-Me-Ph | 5-F | 102-3 | 148-9 | 78-9 |
| 268 | Me | 4-Me-Ph | 4-F | 115-6 | 134-5 | oil |
| 269 | Me | 4-Me-Ph | 4-F | 97-8* | 134-5 | oil |
| 270 | Me | 3-(thiazol-2-yl)-Ph | - | gum | 171-3 | 65-6 |
| 271 | MeO | 4-Cl-3-MeO-Ph | - | 88-90* | 135-7 | 109-11 |
m.p.(°) or physical state (R3)n Compound of Intermediates
Cpd. R1 R2
| No. | formula I | A | B | |||
| 272 | Cl | 3,5-Cl2-Ph | - | 89-90 | 111-3 | |
| 273 | Cl | 3,5-Cl2-Ph | - | 127-8* | 111-3 | |
| 274 | Cl | 5-Cl-2-Me-Ph | - | 144-6 | 142-4 | 120-1 |
| 275 | MeO | 4-MeO-3-Me-Ph | - | 84-6 | ||
| 276 | Me | 4-Cl-3-CF3-Ph | - | 107.5-9 | 135-6 | 55-6 |
| 277 | Me | 4-Cl-3-CF3-Ph | - | 77-8* | 135-6 | 55-6 |
| 278 | MeO | 3,5-Cl2-Ph | - | 116-8 | 153-4.5 | 120-121.5 |
| 279 | MeO | 3,5-Cl2-Ph | - | 109.5-11* | 153-4.5 | 120-1.5 |
| 280 | MeO | 4-CF3-Ph | - | 83.5-4.5 | 114-5.5 | 85-6 |
| 281 | MeO | 4-CF3-Ph | - | 106.5-8* | 114-5.5 | 85-6 |
| 282 | Me | 3-Ph-Ph | - | 124-6 | 89-91 | 82-3.5 |
| 283 | Me | 3-(Me-CsC~)-Ph | - | 71.5-85 | 166-8 | 71-83.5 |
| 284 | Me | 4-Cl-3-CHF2O-Ph | - | oil | 114.5-6 | 65.5-6.5 |
| 285 | Me | 5-Cl-2-Me-Ph | - | 137-8 | 116-7 | 90-1 |
| 286 | Me | 5-Cl-2-Me-Ph | - | 121-2* | 116-7 | 90-1 |
| 287 | Me | 2-Cl-5-MeO-Ph | - | 91-2 | 141-2 | 83-4 |
| 288 | Cl | 2-F-5-MeO-Ph | - | oil | 122-3 | 71-3 |
| 289 | Cl | 2-Cl-5-MeO-Ph | - | 97-8 | 143-5 | 78-91 |
| 290 | Cl | 2-Cl-5-MeO-Ph | - | 80-1* | 143-5 | 79-81 |
| 291 | MeO | 4-Cl-3-MeO-Ph | - | 116-8 | 135-7 | 109-11 |
| 292 | Me | 3-Bul-5-Me-Ph . | - | oil | oil | oil |
| 293 | Me | 3-Bu'-5-Me-Ph | - | oil* | oil | oil |
| 294 | Me | 3-(Me-C=C)-Ph | - | 120.5-4* | 166-8 | 71-83.5 |
| 295 | Me | 3-cyclopropy1-Ph | - | gum | 115.5-8 | oil |
| 296 | Me | 5-Cl-2-MeO-Ph | - | 100-1 | 129-30 | 99-100 |
| 297 | Me | 5-Cl-2-MeO-Ph | - | 92-3* | 129-30 | 99-100 |
| 298 | Me | 2-Br-5-Me-Ph | - | 137-8 | 121-2 | 63-4 |
| 299 | Me | 2-Br-5-Me-Ph | - | 124-5* | 121-2 | 63-4 |
| 300 | Me | 3-(2-thiazolin-2-yl) | -Ph - | 110-1 | 72-4 | |
| 301 | Cl | 2,5-Cl2-Ph | - | 142-3 | 115-20 | 112-4 |
| 302 | Cl | 2,5-Cl2-Ph | - | 103-4* | 115-20 | 112-4 |
m.p.(’) or physical state
| Cpd. R1 No. | R2 | (R3)n | Compound of Intermediates | ||||
| formula I | A | B | |||||
| 5 | 303 | Et | 4-Cl-3-MeO-Ph | - | gum* | 129-30 | 101-2.5 |
| 304 | Me | 3-Ph-Ph | - | oil* | 89-91 | 82-3.5 | |
| 305 | MeO | 2,5-Cl2-Ph | - | 119-20* | 159-60 | 104-5 | |
| 306 | MeO | 2,5-Cl2-Ph | - | 94-5.5 | 159-60 | 104-5 | |
| 307 | Me | 3-cyclopropy1-Ph | - | 56.5-8.5 | * 115.5- | •8 oil | |
| 10 | 308 | Cl | 3-Me-Ph | - | 88-90* | 133-4 | 80-1 |
| 309 | Cl | 4-CFj-Ph | - | 85-6 | 135-7 | 62-3 | |
| 310 | Cl | 4-CF3-Ph | - | oil* | 135-7 | 62-3 | |
| 311 | Me | 2,5-Br2-Ph | - | 124-5 | 90-5 | 107-9 | |
| 312 | Me | 2,5-Br2-Ph | - | 87-8* | 90-5 | 107-9 | |
| 15 | 313 | Me | 3- [PhO- (CH2) 2“O) -Ph | - | 95-7 | ||
| 314 | Cl | 4-Me-Ph | 5-Me | 128-9 | 85-6 | ||
| 315 | Me | 4 - [ MeO- (CH2) 2—O ] Ph | - | 96-7 | oil | ||
| 316 | Me | 3-(CH=C-CH2) -Ph | - | 83-5 | |||
| 317 | Me | 2-MeS-5-Cl-Ph | - | 92-4 | 143-5 | 89-90 | |
| 20 | 318 | Me | 2-MeS-5-Cl-Ph | - | 93.5-4.5 | * 143-5 | 89-90 |
| 319 | Me | 4-MeS-Ph | - | 93-4 | 128-30 | 81-3 | |
| 320 | Me | 4-MeS-Ph | - | 104-6* | 128-30 | 81-3 | |
| 321 | Me | 4-F-Ph | - | 124-5 | 117-9 | 78-80 | |
| 322 | Me | 4-F-Ph | - | 118-20* | 117-9 | 78-80 |
2 = Na salt + = contains 14% Z-isomer
Example 2
A mixture of 7-methylbenzo[b]thiophen-2(3H)-one (5.0 g), sodium hydroxide (2.44 g) and water (50 ml) was heated under reflux for one hour. 4-Methylbenzyl chloride (4.49 g) was added and the mixture refluxed for a further 1¾ hours. It was then cooled, acidified with hydrochloric acid and the solid precipitate filtered off, washed with water and dried to give [2-(4-methylbenzylthio)-3-methylphenyl] acetic acid, m.p. 110-2°.
To a solution of this compound (7.1 g) in dichloromethane (50 ml) was added triethylamine (2.62 g), followed by methyl chloroformate (2.43 g). The mixture was heated under reflux for 0.5 hours, cooled, washed with water and aqueous sodium hydrogen carbonate, dried and evaporated to give methyl [2-(4-methylbenzylthio)-3-methylphenyl]acetate, as an oil.
This compound (5.5 g) was added to a stirred suspension of sodium hydride (0.58 g, 80% dispersion in mineral oil) in dimethylformamide (75 ml) . After a further 1 hour methyl formate (5.5 g) was added dropwise. The mixture was stirred overnight at room temperature to give methyl [ (E) -3-hydroxy-2-[2-(4-methylbenzylthio) 3-methylphenyl]prop-2-enoate, which was not isolated. Methyl iodide (2.73 g) was added, the reaction mixture stirred for 3 hours and evaporated. Diethyl ether and water were added, the organic phase separated and washed with water, dried and evaporated to give methyl [ (E) -3-methoxy-2-[2- (4-methylbenzylthio) -3-methylphenyl ]prop-2-enoate, m.p. 109-11°, (compound 2a).
Example 3
In a similar manner to Example 1, there was obtained 2-[2-(4-methylbenzylthio)-3-methyIpheny1]-2-oxoacetic acid, m.p. 128-9°, which was converted to the methyl ester, m.p. 42-3°. Methoxyamine hydrochloride (1.67 g) was added to a solution of this (6 g) in methanol (100 ml) and the mixture heated under reflux, with stirring, for 24 hours. The mixture was poured into water and extracted with ether. The extract was dried and evaporated and the residue recrystallised from diisopropyl ether up to give methyl 2-methoxyimino-2-[2-(4-methylbenzylthio)-3-methylphenyl]acetate, m.p. 93-5°. (Compound 400)
In a similar manner there was obtained:
(i) methyl 2-[3-chloro-2-(4-methylbenzyl-thio)phenyl]2—(methoxyimino)acetate, m.p. 86-7°. (Compound 401) and (ii) methyl 2-(3-bromo-2-(4-methylbenzylthio)phenyl]2-(methoxyimino)-acetate, m.p. 97-8°. (Compound 402)
Example 4
In a similar manner to Example 1# 7-methylbenzo(b]thiophene-2,3-dione was reacted with l-bromo-6,6-dimethylhept-2-en-4-yne to give 2-(2-(6,6-dimethylhept-2-en4-ynylthio)-3-methyIpheny1]-2-oxoacetic acid, as an oil. This was obtained as a 2:1 mixture of the E:Z isomers.
This was then methylated to give the methyl ester, as an oil, in a 2:1 mixture of the E:Z isomers. This in turn was converted to methyl 2-(2-(6,6-dimethylhept-2-en-4-ynylthio) -3-methylphenyl]-3-methoxyprop-2-enoate, as an oil. The oil was subjected to chromatographic separation and the following isomers were obtained:
i) E-propenoate-E/Z-enyne (compound 451a) ii) Z-propenoate-E-enyne, (compound 451b) and iii) Z-propenoate-Z-enyne (compound 451c).
In a similar manner to Example 1, 7-chlorobenzo[b]thiophene-2,3-dione was reacted with l-bromo-6,6-dimethylhept-2-en-4-yne to give 2-[3-chloro-2-(6,6-dimethylhept2-en-4-ynylthio)phenyl]-2-oxoacetic acid, as an oil. This was obtained as a 2:1 mixture of the E:Z isomers. This was then methylated to give the methyl ester, as an oil, in a 2:1 mixture of the E:Z isomers. This in turn was converted to methyl 2-[3-chloro-2-(6,6-dimethyl-hept-2-en-4-ynylthio)phenyl]-3-methoxyprop-2-enoate, as an oil. The oil was subjected to chromatographic separation and the following isomers were obtained:
i) E-propenoate-E-enyne (compound 452a) ii) E-propenoate-Z-enyne, (compound 452b) and iii) a 2:1 mixture of Z-propenoate-E-enyne and Z-propenoate-Z-enyne (compound 453c).
In a similar manner, there was obtained:
2-[3-bromo-2-(6,6-dimethylhept-2-en-4-ynylthio)phenyl]2-oxoacetic acid, as an oil, obtained as a 2:1 mixture of the E:Z isomers, which was then methylated to give the methyl ester, as an oil, in a 2:1 mixture of the E:Z isomers. This in turn was converted to methyl 2-[3-bromo2- (6,6-dimethyl-hept-2-en-4-ynylthio)phenyl]-3-methoxyprop-2-enoate, as an oil. The oil was subjected to chromatographic separation and the following isomers were obtained, as oils:
i) E-propenoate-E/Z-enyne (compound 453a), ii) E-propenoate-Z-enyne, (compound 453b), and ii) E-propenoate-Z-enyne, (compound 453c).
Example 5
In a similar manner to that described in Example 1, 7-methylbenzo[b]thiophen-2(3H)-one was reacted with 2-bromomethyl-5-phenylpyrimidine to give crude [2-(5-phenylpyrimidin-2-yImethylthio)-3-methyl-
phenyl]acetic acid, which was esterified to give the methyl ester. A mixture of this product (5 g), dimethylformamide dimethylacetal (2.5 ml) and pyridininm tosylate (0.4 g) in toluene (100 ml) was heated at 105° for 2¾ hours. The mixture was distilled to remove methanol, toluene and then the excess dimethylformamide dimethylacetal was evaporated in vacuo. Further dimethylformamide dimethylacetal (1.8 ml) was added and the mixture heated at 105° for a further 2 hours. The mixture was again distilled and the cycle repeated three times. The mixture was evaporated and the residue worked up to give methyl 3-dimethylamino-2-[2-(5-phenylpyrimidin2-ylmethylthio)-3-methyIphenyl]prop-2-enoate. A mixture of this crude product (1 g), dissolved in acetone (100 ml) and Amberlyst 15 (an acidic ion-exchange resin; 5 g) and water (0.5 ml) was stirred at room temperature for 1 hour. The mixture was filtered and the filtrate evaporated to give crude methyl 3-hydroxy-2-[2-(5-phenylpyrimidin-2ylmethyl-thio)-3-methylphenyl]prop-2-enoate. This (0.4 g) was dissolved in dimethylformamide (20 ml) and sodium hydride (0.44 g of 60% dispersion in oil) was added and the mixture stirred for 1 hour at room temperature. A solution of methyl iodide (1 ml) in dimethylformamide (19 ml) was added and the mixture stirred at room temperature overnight. Solvent was evaporated and the resulting oil was partitioned between ether and water and the organic phase washed with water, dried and evaporated. The residue was purified by silica gel chromatography to give methyl 3-methoxy-2-[2-(5-phenylpyrimidin-2yImethylthio)-3-methylphenyl]prop-2-enoate, m.p. 124-7°. (compound 5a)
In a similar manner there was obtained:
a) methyl 3-methoxy-2-{2-[5-(4-chlorophenyl)pyrimidin2- yImethylthio]-3-methylphenyl}prop-2-enoate, m.p. 123-5°. (compound 5b), and
b) methyl 3-methoxy-2-[2-(3-methyl-5-nitrobenzylthio)3- methylphenyl]prop-2-enoate, m.p. 135-6°. (compound 5c)
Example 6
This example illustrates an alternative method of preparing compound 163.
A solution of sodium methoxide (lO.l.g) in ethanol (300 ml) was added to a mixture of intermediate A to compound 163 (6.2.g) and hydrazine hydrate (4.65 g) with stirring. The mixture was heated, ethanol and excess hydrazine hydrate distilled off and the residue maintained at 185° for 15 minutes. Excess 5% hydrochloric acid was added to the cooled residue, followed by diethyl ether.
The organic phase was separated, washed with water, dried over magnesium sulfate, evaporated and the residue recrystallised from diisopropyl ether to give [3-chloro2-(2,5-dimethylbenzylthio)phenyl]acetic acid, m.p. 132-3°.
Then, following the method described in Example 2, this was converted to the methyl ester, m.p. 79-80°, which in turn was converted to methyl [(E)-3-hydroxy-2-[3-chloro2-(2,5-dimethylbenzylthio)phenyl]prop-2-enoate, m.p. 76-8°, which then was methylated to give compound
163.
Example 7
Meta-chloroperbenzoic acid (0.128 g, 60%) in dichloromethane (5 ml) was added dropwise to a stirred solution of compound 248 (0.18 g) in dichloromethane (10 ml). The resultant solution was then stirred for 30 minutes at room temperature. The reaction mixture was washed with 10% aqueous sodium bicarbonate, the organic layer dried over magnesium sulfate and the solvent removed in vacuo to give a yellow oil. The product was purified by silica gel flash chromatography with ethyl acetate as the eluent to give methyl 2-[2-(2,5-dimethylbenzylthio)3-(methylsulfinyImethyl)phenyl]-3-methoxyprop-2-enoate, as a yellow oil. (compound 7a)
In a similar manner, there was obtained from compound 240, methyl 2-[3-(butylsulfinyImethyl)-2-[(3-methoxybenzyl)thio]phenyl]-3-methoxyprop-2-enoate, m.p. 94-7°.
(compound 7b)
Preparation of starting materials
7-Methvlbenzoiblthiophen-2(3H)-one
7-Methylbenzo[b]thiophene (18.95 g) was dissolved in ether under nitrogen and the solution cooled to 0°. Butyl lithium (51.1 ml of 2.5M in hexane) was added whilst maintaining the temperature at 0-5°. The mixture was stirred at 0° for 10 minutes, then for 45 minutes at room temperature. It was cooled to 0° and tributyl borate (34.3 ml) added dropwise. After stirring for 1 hour at 0°, the mixture was warmed to room temperature and allowed to stand overnight. It was cooled and 2M hydrochloric acid (225 ml) added. The aqueous phase was extracted with ether and the extract extracted with aqueous sodium hydroxide (2M). The basic extract was acidified with concentrated hydrochloric acid to pH 2. The precipitate was filtered and washed with water to give tris-(7-methylbenzo[b]thiophen-2-yl)cyclotriboroxane. This product (21.4 g) was suspended in water, the mixture heated to 50° and hydrogen peroxide (19.7 ml) added dropwise whilst maintaining the temperature between 55° and 60°. The temperature was kept at 60-68° after the addition. After 1 hour, the mixture was allowed to cool down to room temperature, then extracted with ethyl acetate. The extract was washed with aqueous sodium sulfite (10%), dried and evaporated. The residue was purified by silica gel column chromatography (ethyl acetate:hexane 1:2), followed by recrystallisation from hexane to give 7-methylbenzo[b]thiophen-2(3H)-one.
7-Ethvlbenzorblthiophene-2,3-dione
2-Ethylbenzenethiol (9.10 g) was added dropwise with stirring and cooling to a solution of oxalyl chloride (12.56 g) in diethyl ether (100 ml). The mixture was stirred at room temperature for 1 hour then evaporated.
The residual oil was dissolved in carbon disulfide (100 ml) and cooled to 5®C. Aluminium chloride (13.2 g) was added portionwise over 10 minutes with stirring. The mixture was allowed to warm to room temperature. A black tar was deposited and the stirring became difficult. The mixture was warmed on a warm water bath for 20 minutes, cooled and the carbon disulfide decanted off. Hydrochloric acid (IM) was added and the black tar decomposed to give a sticky red solid. This was extracted with ethyl acetate and the extract washed with water, dried and evaporated to give 7-ethylbenzo[b]thiophene-2,3-dione, m.p. 57-58*.
In a similar manner, there was obtained:
5,7-dimethylbenzo[b]thiophene-2,3-dione, m.p. 148-50®. and 4,7-dimethylbenzo[b]thiophene-2,3-dione. m.p. 123-4®.
5-Chloro-4,7-dimethvlbenzorbi thiophene-2,3-dione
4-Chloro-2,5-dimethylbenzenethiol (40.9 g) was added to 30% sodium hydroxide solution (200 ml). The mixture was stirred vigorously and chloroacetic acid (45.3 g) was added portionwise. The mixture was stirred at 90* for 2 hours, cooled and poured onto ice (750 g). Concentrated hydrochloric acid (60 ml) was added with brisk stirring. The white solid was filtered, washed well with water and dried in vacuo to give (4-chloro-2,5-dimethylphenylthio)acetic acid. This was suspended in chlorobenzene (300 ml) and phosphorus trichloride (41.2 g) was added dropwise with stirring. The mixture was heated on a steam bath for 40 minutes and the supernatant liquid decanted from a sticky yellow oil. The supernatant was cooled to room temperature and aluminium trichloride (33.8 g) was added portionwise. The mixture was stirred and heated on a steam bath for 30 minutes to give a deep red solution, poured onto ice (1000 g) and filtered. The solid was washed with water to give 5-chloro-4,7-dimethylbenzo[b]thiophen-3(2H)-one. This was suspended in 10% sodium hydroxide solution (400 ml) and warmed to 60°. A suspension of N,N-dimethyl-4-nitrosoaniline (34.3 g) in 5% hydrochloric acid (200 ml) was added with vigorous stirring. The mixture was stirred for 30 minutes and filtered. The purple solid was washed with water, treated with 15% hydrochloric acid (700 ml) and the mixture heated under reflux with stirring for 45 minutes, cooled, filtered and the solid washed with water. It was then treated with 20% aqueous sodium carbonate (700 ml) and the mixture heated under reflux with stirring for 40 minutes. It was filtered hot to remove purple solid by-product. The cooled filtrate was acidified to give an orange solid which was filtered and washed well with water and dried in vacuo to give the title product, m.p. 144-5°.
7-methoxvbenzorblthiophene-2,3-dione
A solution of 2-methoxybenzenethiol (21 g) in ether (100 ml) was added dropwise to a mixture of Ν,Ν,Ν',N'-tetramethylethylenediamine (34.9 g) and butyl lithium (2.5 M in hexane) (120 ml) in ether (500 ml) at 0“ under nitrogen. The mixture was stirred at room temperature for 18 hours and then cooled to -40°. A solution of dimethyl oxalate (17.7 g) in ether (200 ml) was added dropwise. The reaction mixture was stirred at room temperature for 1 hour, poured onto crushed ice and stirred vigorously. The aqueous layer was acidified to pH 1, extracted with dichloromethane and the extract dried and evaporated. The residue was purified silica gel column chromatography to give the title compound, m.p. 156-157°.
In a similar manner there was obtained 7-ethoxybenzo[b]thiophene-2,3-dione, m.p. 116-8°.
7-chlorobenzorblthiophene-2.3-dione
Sodium nitrite (203 g) was added portionwise with stirring at room temperature over 2 hours to a solution of
7-chlorobenzo[b]thiophen-3(2H)-one (113g) in acetic acid (1200 ml). The mixture was stirred for 2 hours, poured into ice/water (2000 ml), the solid filtered off, washed well with water and filtered dry to give
7-chlorobenzo[b]thiophene-2,3-dione 2-oxime, m.p. 205-10°. This was then treated with 50% sulfuric acid at reflux, with stirring for 2 hours. The mixture was cooled and poured into ice/water (2500 ml), filtered and washed well with water and recrystallised from ethanol to give the title product.
In a similar manner there was obtained:
a) 5-fluoro-7-methylbenzo[b]thiophene-2,3-dione 2-oxime, m.p. 220° (dec), which was converted to the dione,
m.p. 105-6°,
b) 6-fluoro-7-methylbenzo[b]thiophene-2,3-dione 2-oxime, m.p. 218-20’ (dec), which was converted to the dione, m.p. 101-2°, and
c) 7-chloro-5-methylbenzo[b]thiophene-2,3-dione 2-oxime, m.p. 230’ (dec), which was converted to the dione,
m.p. 152-3°,
Example 8
Tests were carried out to determine the photostability of a number of compounds of the inventions. Acetone solutions of the compounds were applied to pre-coated silica-gel tic plates at a rate of 10 jxg/cm'2. After the solvent had evaporated the plates were exposed for one hour in a Sol 2 sunlight simulator (manufactured by Dr K Honle GmbH, Germany). The plates were then developed in dichloromethane/ethyl acetate (95:5). For the purpose of
comparison, certain analogues were similarly treated in which R1 is hydrogen and in some cases the phenyl is substituted by methyl at the 4 position.
Examination of the plates of the comparison compounds indicated formation of significant amounts of sulfoxide, whereas in the case of the compounds of the invention, little or no sulfoxide was obtained.
The compounds tested were as follows:
a) R2 = Ph
| Compound No | El | A |
| 11 | Me | - |
| 19 | Me | - |
| 69 | Et | - |
| 152 | Me | 4-Me |
| 205 | EtO | — |
| Comparison | H | - |
| ' = 3-MeO-Ph | ||
| Compound No | si | |
| 4 | Me | - |
| 34 | Et | - |
| 139 | Me | 5-Me |
| 144 | Me | 6-Me |
| 157 | Me | 4-Me |
| 160 | Cl | - |
| 168 | Br | - |
| 199 | MeO | — |
| Comparison | H | - |
| H | 4-Me |
| Compound No | Ri | IBZla |
| 2 | Me | - |
| 16 | Et | - |
| 138 | Me | 5-Me |
| 161 | Cl | - |
| 169 | Br | - |
| 198 | MeO | - |
| 214 | EtO | - |
| 229 | Me | 4-Me |
| Comparison | H | - |
| H | 4-Me | |
| R2 = 3-CFj-Ph | ||
| Compound No | e! | |
| 55 | Me | - |
| 225 | MeO | - |
| 226 | MeO | - |
| Comparison | H | - |
| R2 = 3-F-Ph | ||
| Compound No | r1 | |
| 5 | Me | - |
| 32 | Et | - |
| 108 | Me | - |
| 150 | Me | 5-Me |
| 176 | Br | - |
| 192 | Cl | - |
| 206 | MeO | — |
| Comparison | H | - |
Test Example A
Compounds are assessed for activity against one or more of the following:
Phvtophthora infestans: late tomato blight (PI) Plasmopara viticola: vine downy mildew (PV)
Ervsiphe qraminis: barley powdery mildew (EG) Pvricularia oryzae: rice blast (PO)
Pellicularia sasakii: rice sheath blight (PS)
Botrvtis cinerea: grey mould of tomato (BC)
Venturia inaecrualis: apple scab (VI)
Leptosphaeria nodorum: glume blotch (LN) Pseudocercosporella herpotrochoides; eyespot (PH)
Aqueous solutions or dispersions of the compounds at the desired concentration, including a wetting agent, were applied by spray or by drenching the stem base of the test plants. These plants were then inoculated with appropriate test pathogens and kept under controlled environment conditions suitable for maintaining plant growth and development of the disease. After an appropriate time, the degree of infection of the leaf surface or stem base, as appropriate, was visually estimated. Compounds were considered active if they gave greater than 50% control of the disease at a concentration of 500 ppm (w/v) or less.
Activities were demonstrated as follows (+ = active).
| Compound | PI | PV | EG | PO | PS | BC | VI | LN | PH |
| 1 | + | + | + | + | + | + | + | + | |
| 2 | + | + | |||||||
| 3 | + | + | + | + | |||||
| 4 | + | + | + | + | + | ||||
| 5 | + | + | + | + | + | + | |||
| 6 | + | + | + | ||||||
| 7 | + | + | + | + | |||||
| 8 | + | + | + | ||||||
| 9 | + | + | + | + | + | + | |||
| 10 | + | + | + | + | + | + | |||
| 11 | + | + | + | + | + | ||||
| 12 | + | ||||||||
| 14 | + | + | + | + | + | ||||
| 15 | + | + | |||||||
| 16 | + | + | + | + | + | ||||
| 17 | + | + | + | + | + | ||||
| 18 | + | + | |||||||
| 19 | + | + | + | ||||||
| 20 | + | + | + | + | |||||
| 21 | + | + | + | + | |||||
| 22 | + | + | |||||||
| 24 | + | + | |||||||
| 25 | + | + | + | + | + | ||||
| 27 | + | + | + | + | + | ||||
| 28 | + | + | |||||||
| 30 | + | + | + | + | |||||
| 32 | + | + | + | + | |||||
| 33 | + | + | + | ||||||
| 34 | + | ||||||||
| 35 | + | ||||||||
| 37 | + | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN | PH |
| 38 | + | + | + | + | |||||
| 39 | + | + | + | ||||||
| 41 | + | + | + | ||||||
| 42 | + | ||||||||
| 43 | + | ||||||||
| 45 | + | + | + | ||||||
| 47 | + | + | + | + | + | ||||
| 49 | + | + | + | + | + | + | |||
| 51 | + | + | + | + | |||||
| 53 | + | ||||||||
| 54 | + | + | + | + | + | ||||
| 55 | + | + | + | ||||||
| 56 | + | + | + | + | + | ||||
| 57 | + | + | |||||||
| 58 | + | + | + | ||||||
| 59 | + | + | + | + | |||||
| 60 | + | + | + | + | + | ||||
| 61 | + | + | |||||||
| 62 | + | + | + | ||||||
| 63 | + | + | + | + | |||||
| 64 | + | + | + | ||||||
| 65 | + | + | |||||||
| 66 | + | + | + | + | |||||
| 67 | + | + | + | + | |||||
| 69 | + | + | + | ||||||
| 70 | + | ||||||||
| 71 | + | + | + | ||||||
| 72 | + | + | + | + | |||||
| 73 | + | + | + | ||||||
| 74 | + | + | |||||||
| 75 | + | + | |||||||
| 76 | + | + | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN | PH |
| 77 | + | ||||||||
| 78 | + | + | + | + | |||||
| 79 | + | + | |||||||
| 80 | + | ||||||||
| 81 | + | + | + | + | + | ||||
| 82 | + | + | |||||||
| 83 | + | + | + | + | + | ||||
| 84 | + | ||||||||
| 85 | + | + | + | ||||||
| 86 | + | + | + | ||||||
| 87 | + | ||||||||
| 88 | + | + | + | + | |||||
| 89 | + | + | + | + | + | ||||
| 90 | + | + | + | + | + | ||||
| 91 | + | + | + | ||||||
| 92 | + | + | + | ||||||
| 93 | + | + | + | + | + | + | |||
| 94 | + | ||||||||
| 95 | + | + | + | + | + | + | |||
| 97 | + | + | + | ||||||
| 100 | + | + | + | ||||||
| 101 | + | + | + | ||||||
| 102 | + | + | |||||||
| 103 | + | + | |||||||
| 104 | + | + | + | + | |||||
| 105 | + | + | + | + | + | ||||
| 136 | + | ||||||||
| 137 | + | + | + | + | |||||
| 138 | + | + | |||||||
| 139 | + | + | + | ||||||
| 140 | + | + | + | ||||||
| 141 | + | + | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN |
| 142 | + | + | ||||||
| 143 | + | + | + | |||||
| 145 | + | + | ||||||
| 146 | + | + | + | |||||
| 147 | + | + | + | + | ||||
| 148 | + | |||||||
| 149 | + | |||||||
| 150 | + | + | + | |||||
| 151 | + | + | ||||||
| 152 | + | + | ||||||
| 154 | + | + | + | |||||
| 155 | + | |||||||
| 156 | + | + | ||||||
| 160 | + | + | + | |||||
| 161 | + | + | + | + | + | + | + | |
| 163 | + | + | + | |||||
| 165 | + | + | + | + | + | |||
| 167 | + | + | + | |||||
| 168 | + | + | + | + | + | |||
| 169 | + | + | + | + | + | |||
| 170 | + | + | + | + | ||||
| 171 | + | + | + | + | ||||
| 172 | + | + | + | |||||
| 173 | + | + | ||||||
| 174 | + | + | ||||||
| 175 | + | + | + | |||||
| 176 | + | + | + | + | ||||
| 177 | + | + | ||||||
| 178 | + | |||||||
| 179 | + | + | + | |||||
| 180 | + | + | ||||||
| 181 | + | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN | PH |
| 182 | + | ||||||||
| 183 | + | + | |||||||
| 184 | + | + | + | ||||||
| 185 | + | ||||||||
| 186 | + | + | + | + | + | ||||
| 187 | + | + | + | ||||||
| 188 | + | ||||||||
| 189 | + | + | + | + | + | ||||
| 190 | + | ||||||||
| 191 | + | + | |||||||
| 192 | + | + | |||||||
| 193 | + | ||||||||
| 195 | + | + | + | ||||||
| 197 | + | + | |||||||
| 198 | + | + | + | + | + | ||||
| 199 | + | + | + | + | + | ||||
| 200 | + | + | + | ||||||
| 201 | + | + | + | ||||||
| 202 | + | + | + | + | |||||
| 203 | + | + | |||||||
| 204 | + | + | + | ||||||
| 205 | + | + | |||||||
| 206 | + | + | |||||||
| 207 | + | + | + | + | |||||
| 208 | + | + | |||||||
| 210 | + | + | + | + | + | ||||
| 211 | + | + | + | + | + | ||||
| 212 | + | + | + | + | + | + | |||
| 213 | + | ||||||||
| 214 | + | ||||||||
| 216 | + | + | |||||||
| 217 | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN |
| 218 | + | + | + | + | + | |||
| 219 | + | + | ||||||
| 220 | + | + | + | |||||
| 221 | + | + | ||||||
| 222 | + | |||||||
| 223 | + | + | + | + | ||||
| 225 | + | + | + | + | ||||
| 226 | + | + | ||||||
| 227 | + | + | + | + | + | |||
| 228 | + | + | + | |||||
| 229 | + | + | + | + | ||||
| 230 | + | + | + | + | ||||
| 231 | + | + | ||||||
| 232 | + | + | + | + | + | + | ||
| 233 | + | + | + | |||||
| 234 | + | + | ||||||
| 235 | + | + | + | + | ||||
| 236 | + | |||||||
| 237 | + | + | ||||||
| 238 | + | + | + | |||||
| 239 | + | |||||||
| 240 | + | + | + | |||||
| 241 | + | + | ||||||
| 242 | + | + | + | |||||
| 243 | + | + | + | + | ||||
| 244 | + | |||||||
| 245 | + | + | ||||||
| 247 | + | + | ||||||
| 248 | + | |||||||
| 250 | + | + | + | + | ||||
| 251 | + | + | ||||||
| 252 | + | + | + | + |
Compound PI PV EG PO PS BC VI LN PH
| 253 | + | + | + | + | ||
| 254 | + | + | + | + | ||
| 255 | + | |||||
| 257 | + | |||||
| 258 | + | + | + | |||
| 259 | + | |||||
| 260 | + | |||||
| 263 | + | + | + | + | ||
| 264 | + | |||||
| 265 | + | + | ||||
| 266 | + | + | ||||
| 267 | + | |||||
| 268 | + | + | ||||
| 270 | + | |||||
| 271 | + | + | ||||
| 272 | + | + | ||||
| 274 | + | + | ||||
| 275 | + | + | + | + | ||
| 276 | + | |||||
| 277 | + | |||||
| 278 | + | + | ||||
| 279 | + | + | ||||
| 280 | + | + | ||||
| 281 | + | + | ||||
| 282 | + | + | ||||
| 313 | + | + | ||||
| 314 | + | |||||
| 400 | + | + | + | + | ||
| 401 | + | + | + | + | ||
| 402 | + | + | + | + | ||
| 451a | + | |||||
| 451c | + |
| Compound | PI | PV | EG | PO | PS | BC | VI | LN | |
| 452a | + | + | |||||||
| 5 | 452b | + | |||||||
| 452C | + | ||||||||
| 453a | + | + | |||||||
| 2a | + | + | + | + | + | ||||
| 5a | + | + | + | + | |||||
| 10 | 5b | + | + | + | + | + | |||
| 5c | + | + |
PH /
The following intermediates demonstrated activity as follows:
Intermediate to Compound PI PV EG PO PS BC VI LN PH No (A or B type)
| IB | + | |||||
| 2A | + | + | + | |||
| 3B | + | + | + | + | ||
| 4B | + | + | ||||
| 5A | + | |||||
| 5B | + | + | + | + | ||
| 6A | + | + | ||||
| 6B | + | + | ||||
| 8B | + | |||||
| 9A | + | |||||
| 10B | + | |||||
| 14A | + | |||||
| 14B | + | |||||
| 17A | + | |||||
| 20A | + | |||||
| 20B | + | + | ||||
| 22B | + | |||||
| 24B | + | |||||
| 29B | + | + | ||||
| 32A | + | + | ||||
| 32B | + | |||||
| 38A | + | |||||
| 38B | + | + | ||||
| 42A | + | + | + | |||
| 42B | + | + | + | + | ||
| 45A | + | + | ||||
| 45B | + | |||||
| 49B | + |
Intermediate to Compound PI PV EG PO PS BC VI LN No (A or B type)
PH
| 47A | + | ||||||
| 51B | + | + | |||||
| 52A | + | + | |||||
| 52B | + | ||||||
| 53A | + | + | + | ||||
| 54A | + | + . | |||||
| 55A | + | + | |||||
| 55B | + | + | |||||
| 56A | + | ||||||
| 56B | + | ||||||
| 58A | + | ||||||
| 58B | + | ||||||
| 66A | + | + | |||||
| 66B | + | ||||||
| 67A | + | + | + | + | |||
| 67B | + | ||||||
| 70A | + | + | |||||
| 70B | + | ||||||
| 7 IB | + | ||||||
| 72A | + | ||||||
| 72B | + | ||||||
| 73A | + | ||||||
| 74B | + | + | |||||
| 76A | + | + | |||||
| 78A | + | ||||||
| 79B | + | + | |||||
| 81A | + | ||||||
| 83B | + | ||||||
| 84A | + | ||||||
| 85A | + |
Intermediate to Compound PI PV EG PO PS BC VI LN PH
No (A or B type)
| 8 6A | + | ||
| 86B | |||
| 94B | + | + | |
| 96B | + | ||
| 98B | + | + | |
| 99A | + | + | + |
| 106A | + | ||
| 107A | + | ||
| 107B | + | ||
| 109A | + | ||
| 118A | |||
| 118B | |||
| 122A | + | ||
| 122B | + | ||
| 123B | + | ||
| 124A | + | ||
| 127A | + | ||
| 127B | + | ||
| 130A | + | ||
| 130B | + | ||
| 133B | |||
| 135A | + | + | |
| 136B | + | ||
| 137A | + | ||
| 138B | + | ||
| 139A | + | + | |
| 140B | + | ||
| 141A | + | ||
| 141B | + | ||
| 143A | + |
+ +
+ + +
+ +
+ + +
+ + +
+ +
+ +
+ + + +
+ +
+ + + +
+ +
Intermediate to Compound PI PV EG PO PS BC VI LN No (A or B type)
PH
| 143B | + |
| 144A | + |
| 145A | |
| 145B | |
| 146A | |
| 146B | |
| 147A | |
| 147B | |
| 149A | |
| 150A | |
| 150B | + |
| 152A | + |
| 152B | |
| 153A | |
| 153B | |
| 154A | + |
| 154B | + |
| 157A | + |
| 157B | + |
| 158A | + |
| 160B | |
| 161B | |
| 168A | + |
| 168B | + |
| 169A | + |
| 169B | + |
| 170B | + |
| 17 IA | + |
| 171B | + |
| 175A |
+ + + + + +
+ + + + + +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ + + +
Intermediate to Compound PI PV EG PO PS BC VI LN No (A or B type)
PH
| 181B | + | ||||||
| 184B | + | ||||||
| 188B | + | ||||||
| 189B | + | ||||||
| 192B | + | ||||||
| 194A | + | + | + | ||||
| 195B | + | + | + | ||||
| 198A | + | ||||||
| 199A | + | ||||||
| 199B | + | ||||||
| 2 01A | + | ||||||
| 201B | + | + | |||||
| 207A | + | ||||||
| 211B | + | + | |||||
| 212A | + | ||||||
| 212B | + | ||||||
| 216A | + | + | |||||
| 219A | + | ||||||
| 219B | + | + | |||||
| 221A | + | ||||||
| 223A | + | ||||||
| 223B | + | + | |||||
| 227A | + | ||||||
| 227B | + | ||||||
| 230B | + | ||||||
| 234A | + | ||||||
| 238B | + | ||||||
| 265A | + | + | |||||
| 266A | + | ||||||
| 266B | + | + |
HAVING NOW pa: .ULARLY DFSCR'RED AND ASCERTAINED r.’v ; 7,.5 INV, :»N and in wka· manner the S-'-me '5 - ; , . BfC-’MED -VE DECLARE THAI '.'.HAT Ι;7Έ CLAIM IS
Claims (5)
1. A compound of formula I wherein
X is CH or N;
n is 0, 1, 2 or 3;
R1 and R3, which may be the same or different, are alkyl, alkoxy or alkylthio, each of which is optionally substituted, halogen, nitro, cyano, COOR4, -NR5R6, CONR5R6, COR7 or R8S(O)q; or R1 and an adjacent R3 group, or two adjacent R3 groups, together with the carbon atoms to which they are attached can form a 5 to 8 membered ring which can include 1 to 3 heteroatoms and may be substituted;
R2 is an optionally substituted aliphatic hydrocarbon radical, which may be unsaturated, aryl or heterocycly1;
R4 is hydrogen or an ester forming group;
R5 and R6 are the same or different and are hydrogen, optionally substituted alkyl, acyl or aryl, or together with the nitrogen to which they are attached, form a 5 to 7 membered ring which can contain other hetero atoms;
R7 is hydrogen, optionally substituted alkyl or aryl;
R8 is optionally substituted alkyl or aryl; and q is 1 or 2.
BAD OR'G'NAL
2. A compound of formula II wherein R1, R2, R3 and n have the meanings given in claim 1 and R9 is hydrogen or methyl.
3. A compound of formula III (HI)
CH2-COOMe wherein Rl, R2, R3 and n have the meanings given in claim
1.
4)
A fungicidal composition comprising a claimed claim 1, in admixture with an acceptable diluent or carrier.
compound as agriculturally
5) A method of combating phytopathogenic fungi which comprises applying to the fungus or its locus a compound claimed in claims 1.
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919112039A GB9112039D0 (en) | 1991-06-05 | 1991-06-05 | Propenoic acid derivatives |
| GB919112038A GB9112038D0 (en) | 1991-06-05 | 1991-06-05 | Propenoic acid derivatives |
| GB919112099A GB9112099D0 (en) | 1991-06-05 | 1991-06-05 | Propenoic acid derivatives |
| GB919112110A GB9112110D0 (en) | 1991-06-05 | 1991-06-05 | Propenoic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP9200396A0 AP9200396A0 (en) | 1992-07-31 |
| AP347A true AP347A (en) | 1994-07-29 |
Family
ID=27450688
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1992/000396A AP347A (en) | 1991-06-05 | 1992-06-04 | Propenoic acid derivatives. |
Country Status (21)
| Country | Link |
|---|---|
| EP (2) | EP0517301A1 (en) |
| JP (1) | JPH06507623A (en) |
| CN (1) | CN1069852A (en) |
| AP (1) | AP347A (en) |
| AT (1) | ATE121078T1 (en) |
| AU (1) | AU658894B2 (en) |
| BR (1) | BR9206069A (en) |
| CA (1) | CA2103463A1 (en) |
| CZ (1) | CZ258993A3 (en) |
| DE (1) | DE69202059T2 (en) |
| DK (1) | DK0606228T3 (en) |
| FI (1) | FI935293A0 (en) |
| HU (1) | HUT66206A (en) |
| IE (1) | IE921790A1 (en) |
| IL (1) | IL102099A0 (en) |
| MA (1) | MA22543A1 (en) |
| MX (1) | MX9202651A (en) |
| MY (1) | MY136227A (en) |
| TW (1) | TW217405B (en) |
| WO (1) | WO1992021653A1 (en) |
| YU (1) | YU58292A (en) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2068737A1 (en) * | 1992-12-14 | 1995-04-16 | Schering Agrochemicals Ltd | Propenoic acid derivatives |
| GB9307247D0 (en) * | 1993-04-07 | 1993-06-02 | Zeneca Ltd | Fungicidal compounds |
| KR20000057254A (en) * | 1996-11-26 | 2000-09-15 | 메리 이. 보울러 | Methyl substituted fungicides and arthropodicides |
| MXPA03002442A (en) * | 2000-09-19 | 2004-05-05 | Dow Agrosciences Llc | Thiazole derivatives of 2-methoxyimino-2-(pyridinyloxymethyl)-phenyl-acetamides useful as fungicides. |
| JP2008019241A (en) * | 2007-03-01 | 2008-01-31 | Mitsubishi Tanabe Pharma Corp | Oxime derivatives and process for producing the same |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0251082A2 (en) * | 1986-06-21 | 1988-01-07 | BASF Aktiengesellschaft | Substituted acrylic acid esters and fungicides containing these compounds |
| EP0254426A2 (en) * | 1986-07-18 | 1988-01-27 | Zeneca Limited | Fungicides |
| EP0299694A2 (en) * | 1987-07-11 | 1989-01-18 | AgrEvo UK Limited | Acrylate fungicides |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9018111D0 (en) * | 1990-08-17 | 1990-10-03 | Schering Agrochemicals Ltd | Fungicides |
-
1992
- 1992-05-25 AU AU18722/92A patent/AU658894B2/en not_active Ceased
- 1992-05-25 DK DK92917345.8T patent/DK0606228T3/en active
- 1992-05-25 JP JP4510138A patent/JPH06507623A/en active Pending
- 1992-05-25 CZ CS932589A patent/CZ258993A3/en unknown
- 1992-05-25 BR BR9206069A patent/BR9206069A/en not_active Application Discontinuation
- 1992-05-25 WO PCT/EP1992/001215 patent/WO1992021653A1/en not_active Ceased
- 1992-05-25 EP EP92201504A patent/EP0517301A1/en active Pending
- 1992-05-25 DE DE69202059T patent/DE69202059T2/en not_active Expired - Fee Related
- 1992-05-25 CA CA002103463A patent/CA2103463A1/en not_active Abandoned
- 1992-05-25 EP EP92917345A patent/EP0606228B1/en not_active Expired - Lifetime
- 1992-05-25 AT AT92917345T patent/ATE121078T1/en active
- 1992-05-26 TW TW081104086A patent/TW217405B/zh active
- 1992-05-26 HU HU9303450A patent/HUT66206A/en unknown
- 1992-06-03 YU YU58292A patent/YU58292A/en unknown
- 1992-06-04 AP APAP/P/1992/000396A patent/AP347A/en active
- 1992-06-04 IL IL102099A patent/IL102099A0/en unknown
- 1992-06-04 MY MYPI92000963A patent/MY136227A/en unknown
- 1992-06-04 MX MX9202651A patent/MX9202651A/en unknown
- 1992-06-04 CN CN92105636A patent/CN1069852A/en active Pending
- 1992-06-05 MA MA22833A patent/MA22543A1/en unknown
- 1992-07-01 IE IE179092A patent/IE921790A1/en not_active Application Discontinuation
-
1993
- 1993-11-29 FI FI935293A patent/FI935293A0/en unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0251082A2 (en) * | 1986-06-21 | 1988-01-07 | BASF Aktiengesellschaft | Substituted acrylic acid esters and fungicides containing these compounds |
| EP0254426A2 (en) * | 1986-07-18 | 1988-01-27 | Zeneca Limited | Fungicides |
| EP0299694A2 (en) * | 1987-07-11 | 1989-01-18 | AgrEvo UK Limited | Acrylate fungicides |
Also Published As
| Publication number | Publication date |
|---|---|
| AU658894B2 (en) | 1995-05-04 |
| CN1069852A (en) | 1993-03-17 |
| IE921790A1 (en) | 1992-12-16 |
| ATE121078T1 (en) | 1995-04-15 |
| DK0606228T3 (en) | 1995-09-04 |
| YU58292A (en) | 1995-01-31 |
| HUT66206A (en) | 1994-10-28 |
| CA2103463A1 (en) | 1992-12-06 |
| WO1992021653A1 (en) | 1992-12-10 |
| EP0517301A1 (en) | 1992-12-09 |
| FI935293A7 (en) | 1993-11-29 |
| AU1872292A (en) | 1993-01-08 |
| IL102099A0 (en) | 1993-01-14 |
| EP0606228B1 (en) | 1995-04-12 |
| EP0606228A1 (en) | 1994-07-20 |
| DE69202059T2 (en) | 1995-11-02 |
| HU9303450D0 (en) | 1994-04-28 |
| AP9200396A0 (en) | 1992-07-31 |
| BR9206069A (en) | 1994-12-27 |
| MA22543A1 (en) | 1992-12-31 |
| MX9202651A (en) | 1993-10-01 |
| FI935293A0 (en) | 1993-11-29 |
| CZ258993A3 (en) | 1994-08-17 |
| TW217405B (en) | 1993-12-11 |
| DE69202059D1 (en) | 1995-05-18 |
| JPH06507623A (en) | 1994-09-01 |
| MY136227A (en) | 2008-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6828441B2 (en) | 2-pyridylmethylamine derivatives useful as fungicides | |
| US5756524A (en) | Anilide derivatives as fungicides | |
| US5304530A (en) | Acrylate fungicides | |
| US6893650B1 (en) | N2-phenylamidine derivatives | |
| US5332752A (en) | Acrylate fungicides | |
| HU204168B (en) | Fungicide, insecticide, acaricide and nematocide compositions containing acrylic acid derivatives as active components and process for producing the active components | |
| WO1996029301A1 (en) | Fungicidal compounds | |
| US4748186A (en) | S-trifluorobutenyl derivatives and pesticidal uses thereof | |
| AP347A (en) | Propenoic acid derivatives. | |
| WO1996029305A1 (en) | Fungicidal compounds | |
| NZ243020A (en) | 2-[2-(substituted methyl)thiophenyl]-3-methoxypropenoic acid methyl ester | |
| WO1998051673A1 (en) | Novel imidazole and pyrrole derivatives useful as fungicides | |
| EP0416746A2 (en) | Fungicides containing an alkoxycarbonylvinyl group or an alkyloxyimino group |