AP150A - Novel imidate insecticides. - Google Patents
Novel imidate insecticides. Download PDFInfo
- Publication number
- AP150A AP150A APAP/P/1988/000108A AP8800108A AP150A AP 150 A AP150 A AP 150A AP 8800108 A AP8800108 A AP 8800108A AP 150 A AP150 A AP 150A
- Authority
- AP
- ARIPO
- Prior art keywords
- hydrogen
- conpound
- alkyl
- nitrogen
- phenyl
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title abstract description 13
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 title abstract description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 223
- -1 monosubstituted phenyl Chemical group 0.000 claims description 102
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 87
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 84
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 73
- 150000001875 compounds Chemical class 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 45
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 229910052736 halogen Inorganic materials 0.000 claims description 35
- 241000238631 Hexapoda Species 0.000 claims description 33
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 33
- 150000002367 halogens Chemical class 0.000 claims description 33
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 239000000460 chlorine Substances 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 239000002585 base Substances 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 125000001188 haloalkyl group Chemical group 0.000 claims description 14
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 13
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims description 12
- 230000000749 insecticidal effect Effects 0.000 claims description 12
- 125000001153 fluoro group Chemical group F* 0.000 claims description 10
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 150000001408 amides Chemical class 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 9
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 8
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 8
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 6
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 5
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- 241000258937 Hemiptera Species 0.000 claims description 4
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 4
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000005554 pyridyloxy group Chemical group 0.000 claims description 4
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims description 3
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 3
- 241000254173 Coleoptera Species 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 125000003368 amide group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001475 halogen functional group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 241000255777 Lepidoptera Species 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 8
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 287
- 125000001246 bromo group Chemical group Br* 0.000 description 100
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 46
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 30
- 239000002904 solvent Substances 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 125000001424 substituent group Chemical group 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 20
- 238000012360 testing method Methods 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 239000007787 solid Substances 0.000 description 17
- 238000002360 preparation method Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000007788 liquid Substances 0.000 description 14
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 10
- 235000021186 dishes Nutrition 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 150000003932 ketenimines Chemical class 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 150000003512 tertiary amines Chemical class 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 150000002465 imidoyl halides Chemical class 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 6
- ULOIAOPTGWSNHU-UHFFFAOYSA-N 2-butyl radical Chemical compound C[CH]CC ULOIAOPTGWSNHU-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 241000256244 Heliothis virescens Species 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 229940086542 triethylamine Drugs 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 241000257159 Musca domestica Species 0.000 description 5
- 241000255993 Trichoplusia ni Species 0.000 description 5
- 150000004703 alkoxides Chemical class 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000012085 test solution Substances 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- 241001124076 Aphididae Species 0.000 description 4
- 241001425390 Aphis fabae Species 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000254171 Curculionidae Species 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- 241001454293 Tetranychus urticae Species 0.000 description 4
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000013601 eggs Nutrition 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 150000002463 imidates Chemical class 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- GBFUISVVTYNAKO-UHFFFAOYSA-N 1-(3-phenoxyphenyl)prop-2-yn-1-ol Chemical compound C#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GBFUISVVTYNAKO-UHFFFAOYSA-N 0.000 description 3
- 239000005660 Abamectin Substances 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- 241001674044 Blattodea Species 0.000 description 3
- 241001414720 Cicadellidae Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 241000254154 Sitophilus zeamais Species 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 230000009969 flowable effect Effects 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 2
- NFGXHKASABOEEW-UHFFFAOYSA-N 1-methylethyl 11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- YSEMCVGMNUUNRK-UHFFFAOYSA-N 3-chloro-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Cl)=C1 YSEMCVGMNUUNRK-UHFFFAOYSA-N 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 235000007558 Avena sp Nutrition 0.000 description 2
- 235000016068 Berberis vulgaris Nutrition 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 241000256113 Culicidae Species 0.000 description 2
- 241000489975 Diabrotica Species 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 241000353522 Earias insulana Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- 241000966204 Lissorhoptrus oryzophilus Species 0.000 description 2
- 241001414662 Macrosteles fascifrons Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000488581 Panonychus citri Species 0.000 description 2
- 241000488583 Panonychus ulmi Species 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000255969 Pieris brassicae Species 0.000 description 2
- 241000500437 Plutella xylostella Species 0.000 description 2
- 241000952063 Polyphagotarsonemus latus Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000344246 Tetranychus cinnabarinus Species 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000003927 aminopyridines Chemical class 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 229940093499 ethyl acetate Drugs 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000013101 initial test Methods 0.000 description 2
- 239000002949 juvenile hormone Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229930002897 methoprene Natural products 0.000 description 2
- 229950003442 methoprene Drugs 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- FXWHFKOXMBTCMP-WMEDONTMSA-N milbemycin Natural products COC1C2OCC3=C/C=C/C(C)CC(=CCC4CC(CC5(O4)OC(C)C(C)C(OC(=O)C(C)CC(C)C)C5O)OC(=O)C(C=C1C)C23O)C FXWHFKOXMBTCMP-WMEDONTMSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- ZCVAOQKBXKSDMS-PVAVHDDUSA-N (+)-trans-(S)-allethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(CC=C)C(=O)C1 ZCVAOQKBXKSDMS-PVAVHDDUSA-N 0.000 description 1
- CXBMCYHAMVGWJQ-CABCVRRESA-N (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCN1C(=O)C(CCCC2)=C2C1=O CXBMCYHAMVGWJQ-CABCVRRESA-N 0.000 description 1
- YATDSXRLIUJOQN-SVRRBLITSA-N (2,3,4,5,6-pentafluorophenyl)methyl (1r,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)OCC1=C(F)C(F)=C(F)C(F)=C1F YATDSXRLIUJOQN-SVRRBLITSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- XUNYDVLIZWUPAW-UHFFFAOYSA-N (4-chlorophenyl) n-(4-methylphenyl)sulfonylcarbamate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)OC1=CC=C(Cl)C=C1 XUNYDVLIZWUPAW-UHFFFAOYSA-N 0.000 description 1
- PHXXNWVSXYIPEI-UHFFFAOYSA-N (5-benzylfuran-2-yl)methanol Chemical compound O1C(CO)=CC=C1CC1=CC=CC=C1 PHXXNWVSXYIPEI-UHFFFAOYSA-N 0.000 description 1
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 1
- XGWIJUOSCAQSSV-XHDPSFHLSA-N (S,S)-hexythiazox Chemical compound S([C@H]([C@@H]1C)C=2C=CC(Cl)=CC=2)C(=O)N1C(=O)NC1CCCCC1 XGWIJUOSCAQSSV-XHDPSFHLSA-N 0.000 description 1
- ZFHGXWPMULPQSE-SZGBIDFHSA-N (Z)-(1S)-cis-tefluthrin Chemical compound FC1=C(F)C(C)=C(F)C(F)=C1COC(=O)[C@@H]1C(C)(C)[C@@H]1\C=C(/Cl)C(F)(F)F ZFHGXWPMULPQSE-SZGBIDFHSA-N 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- BOTNFCTYKJBUMU-UHFFFAOYSA-N 2-[4-(2-methylpropyl)piperazin-4-ium-1-yl]-2-oxoacetate Chemical compound CC(C)C[NH+]1CCN(C(=O)C([O-])=O)CC1 BOTNFCTYKJBUMU-UHFFFAOYSA-N 0.000 description 1
- RFONJRMUUALMBA-UHFFFAOYSA-N 2-methanidylpropane Chemical compound CC(C)[CH2-] RFONJRMUUALMBA-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- HXFSSJXRCCRQIG-UHFFFAOYSA-N 4-phenoxybut-2-yn-1-ol Chemical compound OCC#CCOC1=CC=CC=C1 HXFSSJXRCCRQIG-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IBSREHMXUMOFBB-JFUDTMANSA-N 5u8924t11h Chemical compound O1[C@@H](C)[C@H](O)[C@@H](OC)C[C@@H]1O[C@@H]1[C@@H](OC)C[C@H](O[C@@H]2C(=C/C[C@@H]3C[C@@H](C[C@@]4(O3)C=C[C@H](C)[C@@H](C(C)C)O4)OC(=O)[C@@H]3C=C(C)[C@@H](O)[C@H]4OC\C([C@@]34O)=C/C=C/[C@@H]2C)/C)O[C@H]1C.C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 IBSREHMXUMOFBB-JFUDTMANSA-N 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- 241000218473 Agrotis Species 0.000 description 1
- 241000256186 Anopheles <genus> Species 0.000 description 1
- 241001414827 Aonidiella Species 0.000 description 1
- 241001600408 Aphis gossypii Species 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 241000254127 Bemisia tabaci Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 241001643374 Brevipalpus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000661305 Busseola fusca Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- 241000661337 Chilo partellus Species 0.000 description 1
- 241000426497 Chilo suppressalis Species 0.000 description 1
- STUSTWKEFDQFFZ-UHFFFAOYSA-N Chlordimeform Chemical compound CN(C)C=NC1=CC=C(Cl)C=C1C STUSTWKEFDQFFZ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RAPBNVDSDCTNRC-UHFFFAOYSA-N Chlorobenzilate Chemical compound C=1C=C(Cl)C=CC=1C(O)(C(=O)OCC)C1=CC=C(Cl)C=C1 RAPBNVDSDCTNRC-UHFFFAOYSA-N 0.000 description 1
- 239000005944 Chlorpyrifos Substances 0.000 description 1
- 241001498622 Cixius wagneri Species 0.000 description 1
- PITWUHDDNUVBPT-UHFFFAOYSA-N Cloethocarb Chemical compound CNC(=O)OC1=CC=CC=C1OC(CCl)OC PITWUHDDNUVBPT-UHFFFAOYSA-N 0.000 description 1
- 239000005654 Clofentezine Substances 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009852 Cucurbita pepo Nutrition 0.000 description 1
- 241000256054 Culex <genus> Species 0.000 description 1
- 239000005891 Cyromazine Substances 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- 239000005892 Deltamethrin Substances 0.000 description 1
- 241000489973 Diabrotica undecimpunctata Species 0.000 description 1
- 239000005893 Diflubenzuron Substances 0.000 description 1
- AQZGPSLYZOOYQP-UHFFFAOYSA-N Diisoamyl ether Chemical compound CC(C)CCOCCC(C)C AQZGPSLYZOOYQP-UHFFFAOYSA-N 0.000 description 1
- 239000005947 Dimethoate Substances 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 241001127120 Dysdercus fasciatus Species 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005958 Fenamiphos (aka phenamiphos) Substances 0.000 description 1
- KVKHBPGBGOVMBN-PWLVHAGJSA-N Flubenzimine Chemical compound C=1C=CC=CC=1N/1C(=N/C(F)(F)F)/S\C(=N/C(F)(F)F)\C\1=N/C1=CC=CC=C1 KVKHBPGBGOVMBN-PWLVHAGJSA-N 0.000 description 1
- 239000005661 Hexythiazox Substances 0.000 description 1
- 241000500891 Insecta Species 0.000 description 1
- IIWNDLDEVPJIBT-OLZOCXBDSA-N Juvabione Chemical compound COC(=O)C1=CC[C@H]([C@H](C)CC(=O)CC(C)C)CC1 IIWNDLDEVPJIBT-OLZOCXBDSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001414659 Macrosteles Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241000171274 Megoura Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 241000721621 Myzus persicae Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- UYZYPVZCLTUIPB-UHFFFAOYSA-N N-(1,3-benzodioxol-5-yloxy)-2-methyl-3-(3-phenoxyphenyl)propanamide Chemical compound CC(CC1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)NOC3=CC4=C(C=C3)OCO4 UYZYPVZCLTUIPB-UHFFFAOYSA-N 0.000 description 1
- 241000358422 Nephotettix cincticeps Species 0.000 description 1
- 241001556089 Nilaparvata lugens Species 0.000 description 1
- 241000256259 Noctuidae Species 0.000 description 1
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- MOMWFXLCFJOAFX-UHFFFAOYSA-N OOOOOOOO Chemical compound OOOOOOOO MOMWFXLCFJOAFX-UHFFFAOYSA-N 0.000 description 1
- 239000005950 Oxamyl Substances 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000238675 Periplaneta americana Species 0.000 description 1
- 241001608568 Phaedon Species 0.000 description 1
- 241001608567 Phaedon cochleariae Species 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000005921 Phosmet Substances 0.000 description 1
- 241000497192 Phyllocoptruta oleivora Species 0.000 description 1
- 239000005923 Pirimicarb Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- OTSMHWLYYJVJDL-UHFFFAOYSA-N SSSSSSSSS Chemical compound SSSSSSSSS OTSMHWLYYJVJDL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 239000005939 Tefluthrin Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000005942 Triflumuron Substances 0.000 description 1
- 241000208241 Tropaeolum Species 0.000 description 1
- 240000001260 Tropaeolum majus Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- GBAWQJNHVWMTLU-RQJHMYQMSA-N [(1R,5S)-7-chloro-6-bicyclo[3.2.0]hepta-2,6-dienyl] dimethyl phosphate Chemical compound C1=CC[C@@H]2C(OP(=O)(OC)OC)=C(Cl)[C@@H]21 GBAWQJNHVWMTLU-RQJHMYQMSA-N 0.000 description 1
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 1
- 229950008167 abamectin Drugs 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002506 adulticidal effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- QGLZXHRNAYXIBU-WEVVVXLNSA-N aldicarb Chemical compound CNC(=O)O\N=C\C(C)(C)SC QGLZXHRNAYXIBU-WEVVVXLNSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940009868 aluminum magnesium silicate Drugs 0.000 description 1
- WMGSQTMJHBYJMQ-UHFFFAOYSA-N aluminum;magnesium;silicate Chemical compound [Mg+2].[Al+3].[O-][Si]([O-])([O-])[O-] WMGSQTMJHBYJMQ-UHFFFAOYSA-N 0.000 description 1
- 229960002587 amitraz Drugs 0.000 description 1
- QXAITBQSYVNQDR-ZIOPAAQOSA-N amitraz Chemical compound C=1C=C(C)C=C(C)C=1/N=C/N(C)\C=N\C1=CC=C(C)C=C1C QXAITBQSYVNQDR-ZIOPAAQOSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- RRZXIRBKKLTSOM-XPNPUAGNSA-N avermectin B1a Chemical compound C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 RRZXIRBKKLTSOM-XPNPUAGNSA-N 0.000 description 1
- CJJOSEISRRTUQB-UHFFFAOYSA-N azinphos-methyl Chemical group C1=CC=C2C(=O)N(CSP(=S)(OC)OC)N=NC2=C1 CJJOSEISRRTUQB-UHFFFAOYSA-N 0.000 description 1
- ONHBDDJJTDTLIR-UHFFFAOYSA-N azocyclotin Chemical compound C1CCCCC1[Sn](N1N=CN=C1)(C1CCCCC1)C1CCCCC1 ONHBDDJJTDTLIR-UHFFFAOYSA-N 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- XEGGRYVFLWGFHI-UHFFFAOYSA-N bendiocarb Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)O2 XEGGRYVFLWGFHI-UHFFFAOYSA-N 0.000 description 1
- 150000008047 benzoylureas Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- OMFRMAHOUUJSGP-IRHGGOMRSA-N bifenthrin Chemical compound C1=CC=C(C=2C=CC=CC=2)C(C)=C1COC(=O)[C@@H]1[C@H](\C=C(/Cl)C(F)(F)F)C1(C)C OMFRMAHOUUJSGP-IRHGGOMRSA-N 0.000 description 1
- 229960001901 bioallethrin Drugs 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- FOANIXZHAMJWOI-UHFFFAOYSA-N bromopropylate Chemical compound C=1C=C(Br)C=CC=1C(O)(C(=O)OC(C)C)C1=CC=C(Br)C=C1 FOANIXZHAMJWOI-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 210000000234 capsid Anatomy 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- IRUJZVNXZWPBMU-UHFFFAOYSA-N cartap Chemical compound NC(=O)SCC(N(C)C)CSC(N)=O IRUJZVNXZWPBMU-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- BIWJNBZANLAXMG-YQELWRJZSA-N chloordaan Chemical compound ClC1=C(Cl)[C@@]2(Cl)C3CC(Cl)C(Cl)C3[C@]1(Cl)C2(Cl)Cl BIWJNBZANLAXMG-YQELWRJZSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- SBPBAQFWLVIOKP-UHFFFAOYSA-N chlorpyrifos Chemical compound CCOP(=S)(OCC)OC1=NC(Cl)=C(Cl)C=C1Cl SBPBAQFWLVIOKP-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- UXADOQPNKNTIHB-UHFFFAOYSA-N clofentezine Chemical compound ClC1=CC=CC=C1C1=NN=C(C=2C(=CC=CC=2)Cl)N=N1 UXADOQPNKNTIHB-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 235000011655 cotton Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 1
- 229960001591 cyfluthrin Drugs 0.000 description 1
- QQODLKZGRKWIFG-QSFXBCCZSA-N cyfluthrin Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@@H](C#N)C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QQODLKZGRKWIFG-QSFXBCCZSA-N 0.000 description 1
- ZXQYGBMAQZUVMI-UNOMPAQXSA-N cyhalothrin Chemical compound CC1(C)C(\C=C(/Cl)C(F)(F)F)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 ZXQYGBMAQZUVMI-UNOMPAQXSA-N 0.000 description 1
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 1
- LVQDKIWDGQRHTE-UHFFFAOYSA-N cyromazine Chemical compound NC1=NC(N)=NC(NC2CC2)=N1 LVQDKIWDGQRHTE-UHFFFAOYSA-N 0.000 description 1
- 229950000775 cyromazine Drugs 0.000 description 1
- 229960002483 decamethrin Drugs 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- OWZREIFADZCYQD-NSHGMRRFSA-N deltamethrin Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@H]1C(=O)O[C@H](C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 OWZREIFADZCYQD-NSHGMRRFSA-N 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- 229950001327 dichlorvos Drugs 0.000 description 1
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 description 1
- DFBKLUNHFCTMDC-PICURKEMSA-N dieldrin Chemical compound C([C@H]1[C@H]2[C@@]3(Cl)C(Cl)=C([C@]([C@H]22)(Cl)C3(Cl)Cl)Cl)[C@H]2[C@@H]2[C@H]1O2 DFBKLUNHFCTMDC-PICURKEMSA-N 0.000 description 1
- 229950006824 dieldrin Drugs 0.000 description 1
- NGPMUTDCEIKKFM-UHFFFAOYSA-N dieldrin Natural products CC1=C(Cl)C2(Cl)C3C4CC(C5OC45)C3C1(Cl)C2(Cl)Cl NGPMUTDCEIKKFM-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 229940019503 diflubenzuron Drugs 0.000 description 1
- IIWNDLDEVPJIBT-UHFFFAOYSA-N dihydroatlantonic acid methyl ester Natural products COC(=O)C1=CCC(C(C)CC(=O)CC(C)C)CC1 IIWNDLDEVPJIBT-UHFFFAOYSA-N 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002058 ecdysones Chemical class 0.000 description 1
- 230000001586 eradicative effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HEZNVIYQEUHLNI-UHFFFAOYSA-N ethiofencarb Chemical compound CCSCC1=CC=CC=C1OC(=O)NC HEZNVIYQEUHLNI-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- YREQHYQNNWYQCJ-UHFFFAOYSA-N etofenprox Chemical compound C1=CC(OCC)=CC=C1C(C)(C)COCC1=CC=CC(OC=2C=CC=CC=2)=C1 YREQHYQNNWYQCJ-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- ZCJPOPBZHLUFHF-UHFFFAOYSA-N fenamiphos Chemical compound CCOP(=O)(NC(C)C)OC1=CC=C(SC)C(C)=C1 ZCJPOPBZHLUFHF-UHFFFAOYSA-N 0.000 description 1
- 229950006668 fenfluthrin Drugs 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- DIRFUJHNVNOBMY-UHFFFAOYSA-N fenobucarb Chemical compound CCC(C)C1=CC=CC=C1OC(=O)NC DIRFUJHNVNOBMY-UHFFFAOYSA-N 0.000 description 1
- XQUXKZZNEFRCAW-UHFFFAOYSA-N fenpropathrin Chemical compound CC1(C)C(C)(C)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 XQUXKZZNEFRCAW-UHFFFAOYSA-N 0.000 description 1
- XDNBJTQLKCIJBV-UHFFFAOYSA-N fensulfothion Chemical compound CCOP(=S)(OCC)OC1=CC=C(S(C)=O)C=C1 XDNBJTQLKCIJBV-UHFFFAOYSA-N 0.000 description 1
- KVGLBTYUCJYMND-UHFFFAOYSA-N fonofos Chemical compound CCOP(=S)(CC)SC1=CC=CC=C1 KVGLBTYUCJYMND-UHFFFAOYSA-N 0.000 description 1
- 239000002316 fumigant Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- FYQGBXGJFWXIPP-UHFFFAOYSA-N hydroprene Chemical compound CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C FYQGBXGJFWXIPP-UHFFFAOYSA-N 0.000 description 1
- 229930000073 hydroprene Natural products 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 239000003621 irrigation water Substances 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 229930014550 juvenile hormone Natural products 0.000 description 1
- 150000003633 juvenile hormone derivatives Chemical class 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000003120 macrolide antibiotic agent Substances 0.000 description 1
- 229940041033 macrolides Drugs 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NNKVPIKMPCQWCG-UHFFFAOYSA-N methamidophos Chemical compound COP(N)(=O)SC NNKVPIKMPCQWCG-UHFFFAOYSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- ZLBGSRMUSVULIE-GSMJGMFJSA-N milbemycin A3 Chemical class O1[C@H](C)[C@@H](C)CC[C@@]11O[C@H](C\C=C(C)\C[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 ZLBGSRMUSVULIE-GSMJGMFJSA-N 0.000 description 1
- KRTSDMXIXPKRQR-AATRIKPKSA-N monocrotophos Chemical compound CNC(=O)\C=C(/C)OP(=O)(OC)OC KRTSDMXIXPKRQR-AATRIKPKSA-N 0.000 description 1
- MWFRUXNDMRPXPR-UHFFFAOYSA-N n-(3-chloro-4-fluorophenyl)-2-methylpropanimidoyl chloride Chemical compound CC(C)C(Cl)=NC1=CC=C(F)C(Cl)=C1 MWFRUXNDMRPXPR-UHFFFAOYSA-N 0.000 description 1
- YIFUPROJAQGGGQ-UHFFFAOYSA-N n-(4-chlorophenyl)cyclopropanecarboxamide Chemical compound C1=CC(Cl)=CC=C1NC(=O)C1CC1 YIFUPROJAQGGGQ-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- KZAUOCCYDRDERY-UHFFFAOYSA-N oxamyl Chemical compound CNC(=O)ON=C(SC)C(=O)N(C)C KZAUOCCYDRDERY-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CKFBFQHBUCDOHL-UHFFFAOYSA-N phenoxy(phenyl)methanol Chemical compound C=1C=CC=CC=1C(O)OC1=CC=CC=C1 CKFBFQHBUCDOHL-UHFFFAOYSA-N 0.000 description 1
- 239000003016 pheromone Substances 0.000 description 1
- BULVZWIRKLYCBC-UHFFFAOYSA-N phorate Chemical compound CCOP(=S)(OCC)SCSCC BULVZWIRKLYCBC-UHFFFAOYSA-N 0.000 description 1
- IOUNQDKNJZEDEP-UHFFFAOYSA-N phosalone Chemical compound C1=C(Cl)C=C2OC(=O)N(CSP(=S)(OCC)OCC)C2=C1 IOUNQDKNJZEDEP-UHFFFAOYSA-N 0.000 description 1
- LMNZTLDVJIUSHT-UHFFFAOYSA-N phosmet Chemical compound C1=CC=C2C(=O)N(CSP(=S)(OC)OC)C(=O)C2=C1 LMNZTLDVJIUSHT-UHFFFAOYSA-N 0.000 description 1
- RGCLLPNLLBQHPF-HJWRWDBZSA-N phosphamidon Chemical compound CCN(CC)C(=O)C(\Cl)=C(/C)OP(=O)(OC)OC RGCLLPNLLBQHPF-HJWRWDBZSA-N 0.000 description 1
- ATROHALUCMTWTB-OWBHPGMISA-N phoxim Chemical compound CCOP(=S)(OCC)O\N=C(\C#N)C1=CC=CC=C1 ATROHALUCMTWTB-OWBHPGMISA-N 0.000 description 1
- 229950001664 phoxim Drugs 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- QHOQHJPRIBSPCY-UHFFFAOYSA-N pirimiphos-methyl Chemical group CCN(CC)C1=NC(C)=CC(OP(=S)(OC)OC)=N1 QHOQHJPRIBSPCY-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920000056 polyoxyethylene ether Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- SMKRKQBMYOFFMU-UHFFFAOYSA-N prallethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OC1C(C)=C(CC#C)C(=O)C1 SMKRKQBMYOFFMU-UHFFFAOYSA-N 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- QYMMJNLHFKGANY-UHFFFAOYSA-N profenofos Chemical compound CCCSP(=O)(OCC)OC1=CC=C(Br)C=C1Cl QYMMJNLHFKGANY-UHFFFAOYSA-N 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- ZYHMJXZULPZUED-UHFFFAOYSA-N propargite Chemical compound C1=CC(C(C)(C)C)=CC=C1OC1C(OS(=O)OCC#C)CCCC1 ZYHMJXZULPZUED-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 1
- 229940070846 pyrethrins Drugs 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 230000000384 rearing effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 235000020354 squash Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- JXHJNEJVUNHLKO-UHFFFAOYSA-N sulprofos Chemical compound CCCSP(=S)(OCC)OC1=CC=C(SC)C=C1 JXHJNEJVUNHLKO-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- 229960005199 tetramethrin Drugs 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- OPASCBHCTNRLRM-UHFFFAOYSA-N thiometon Chemical compound CCSCCSP(=S)(OC)OC OPASCBHCTNRLRM-UHFFFAOYSA-N 0.000 description 1
- AMFGTOFWMRQMEM-UHFFFAOYSA-N triazophos Chemical compound N1=C(OP(=S)(OCC)OCC)N=CN1C1=CC=CC=C1 AMFGTOFWMRQMEM-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- XAIPTRIXGHTTNT-UHFFFAOYSA-N triflumuron Chemical compound C1=CC(OC(F)(F)F)=CC=C1NC(=O)NC(=O)C1=CC=CC=C1Cl XAIPTRIXGHTTNT-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/66—Nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/52—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing groups, e.g. carboxylic acid amidines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/08—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/61—Carboxylic acid nitriles containing cyano groups and nitrogen atoms being part of imino groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Abstract
A series of novel imidate insecticides
Description
NOVEL ΙΜΙΡΑΊΈ INSECTICIDES
This invention relates to a series of novel imidate insecticides distinguished by the general formula (I) in which
R-j is an optionally substituted aryl group in which the substituents are halo, Cj-C4 alkyl, (J-C4 haloalkoxy, <j-C4 alkoxy, C^-C4 haloalkylthio, Οβ-Όθ cycloalkyl, nitro, C-|-C4 haloalkyl, C2-C5 carboalkoxy, Ci~C4 alkylthio, cyano, C-,-C4 alkylsulfonyl, C]-C4 haloalkyl sulfonyl,
C2-C5 alkylcarbony1, C2-C4 alkyleneoxy, C-|-C4 alkylenedioxy, C1-C3 halosubstituted alkylenedioxy, phenyl, mono-substituted phenyl, pyridyloxy, C2-C4 alkylene, C2-C4 alkenyl, and/or amido;
R2 is C;-C7 alkyl, C^-Cg haloalkyl, cyclopropyl, cyclobutyl, mono- or poly- halo- or methyl-substituted cyclopropyl, cyano, C2-C4 alkoxyalkyl, C2~Cg haloalkenyl or C2~Cg alkenyl; and
R3 is (a) an optionally substituted 3-phenoxyphenalkyl,
3-phenoxypyridylalky1, 3-(pyridyloxyJphenalkyl, 3-phenylaminophenalky1,
3- benzylphenalkyl or benzyloxyphenalkyl moiety; (b) a benzyl fur any Ime thy 1 moiety; (c) a 3- or 4-substituted benzyl or tetrafluorobenzyl moiety; (d)
4- phenoxy-2-butyn-2-yl; (e) 2-methy1-3-phenylbenzy1; or (f) 4-(4-trifluoromethyl-2-pyridyloxy) benzyl.
Conpounds of this invention demonstrate activity in controlling various types of insects, including lepidoptera, hemiptera and coleoptera, particularly in foliar application.
Another aspect of this invention involves insecticidal conpositions conprising an insecticidally effective amount of a conpound of the invention with an insecticidally suitable diluent or carrier.
AP000150
PR-7713/7874/7924/8029/8443A
In another aspect, this invention involves a method for controlling insects by administration of an insecticidally effective amount of a conpound or composition of this invention to a locus where control is desired.
The term insects as used herein refers to the broad and commonly understood usage rather than to those creatures which in the strict biological sense are classified as insects. In addition to those belonging to the class Insecta, this term includes some classes of acarids such as mites and the like.
More particularly, the compounds of formula (I) are those in which:
Ri is naphthyl, optionally substituted by up to 2 halogens; or 15 phenyl, optionally substituted by one or more of the following: C2-C5 carboalkoxy, C1-C4 alkylsulfonyl, C1-C4 haloalkylsulfonyl, C2-C5 alkylcarbonyl, C2-C4 alkenyl, Cj-C4 haloalkylthio, Cj-Cg cycloalkyl, phenyl, monosubstituted phenyl, pyridyloxy, C2-C4 alkyleneoxy, C1-C4 alkylenedioxy, C-j—C3 haloalkylenedioxy, C2-C4 alkylene, amido, nitro, cyano, up to two C1-C4 alkylthio groups, up to three C1-C4 alkoxy groups, up to three C1-C4 haloalkoxy groups, up to three C1-C4 alkyl groups, up to three C1-C4 haloalkyl groups, or up to five halogens;
R2 is methyl; ethyl; n-propyl; C3-C7 branched alkyl; Cj-C$ haloalkyl, cyclopropyl optionally substituted by up to 4 methyl groups or up to 2 halogens, cyclobutyl, cyano, C2-C4 alkoxyalkyl, C2-Cg alkenyl or C2-Cg haloalkenyl; and
R3 is (a)
-CH-(CH2)
in vtfiich ra is 0 or 1;
A, B and C are each carbon or nitrogen, provided that A, B and C are not all nitrogen and if two of A, B and C are nitrogen, then A and C are nitrogen;
PR-7713/7874/7924/8029/8443A
R4 is hydrogen, monohalo or dihalo;
Rg is hydrogen, methyl, fluoro or ethynyl; and R7 is (i) ^5 in which D and E are each carbon or nitrogen provided that both D and E are not nitrogen, and further provided that if any of A, B or C is nitrogen, then D and E are both carbon; and
R5 is hydrogen, C1-C4 alkyl, C1-C4 alkoxy, trifluoromethyl, cyano, C1-C4 alkylthio, C1-C4 alkylsulfonyl, or mono- or polyhalo;
| r ΪΊ | |
in which Rq is hydrogen or halogen; or
AP 0 0 0 1 5 0
(i) Rg is 4-fluoro, 4-methoxymethyl, or 4-propargyl, and R-|q is fluoro or (ii) Rg is 3- or 4-allyl, 3- or 4-propargyl, or 3- or 4-(monoor dihalo)allyl, and R^q is hydrogen or fluoro;
PR-7713/7874/7924/8029/8443A
(d) 4-phenoxy-2-butyn-2-yl ?
(e) 3-bromo-4-f luorobenzyl;
(f) 4-(benzyloxy)benzyl;
(g) 4-( 4-fluorobenzyloxy Jbenzyl;
(h) 4-{4-trifluromethyl-2-pyridyloxy)benzyl; or
provided that:
(i) R^ is not 2,3-dichlorophenyl, 2,6-di fluorophenyl,
2,6-di(C1-C4 alkyl)phenyl, 2,4,6-tribromophenyl or 2,4,6-tri(Cp-C4 alkoxy)phenyl;
(ii) when R2 is tertiary butyl, R1 is not phenyl,
3- methyl-phenyl, 4-{n-butyl)phenyl or 4-(t-butyl)phenyly and (iii) when R2 is a C5 alkyl group, then is not
4- isopropylphenyl.
A more preferred class of conpounds are those in which R·, does not contain substituents at both ortho positions on the phenyl ring, i.e., in which R-, does not contain a 2,6-disubstitution, 2,3,6-trisubstitution, or a 2,4,6-trisubstitution on the phenyl ring.
An even more preferred class is that in which the phenyl ring of R·, is substituted at the 3-, 4-, and/or 5-positions, including mono-, diand tri-substituted phenyl conpounds, as well as phenyl compounds having a
3,4-alkylene, alkeneoxy, alkylenedioxy, or haloalkylenedioxy substitution. Such compounds more particularly have the formula
PR-7713/7874/7924/8029/8443A in which R2 and R3 are as defined above; R-, -, is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C4 alkoxy, Cj-C4 alkylthio, <^-<4 haloalkoxy, C1-C4 haloalkyl thio, C2-C5 carboalkoxy, C2-C5 alkylearbonyl, nitro or cyano; R12 is hydrogen, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C4 alkoxy, C1-C4 haloalkoxy, C^-C4 alkylthio, nitro, cyano, C2-C5 alkylcarbonyl, C1-C4 alkylsulfonyl or C2-C5 carboalkoxy; and R13 is hydrogen, halogen, C1-C4 haloalkyl or C1-C4 alkoxy, or R-jj and R12 taken together are C2-C4 alkylene, C2-C4 alkyleneoxy, C-|-C4 alkylenedioxy or halo-C^-C^ alkylenedioxy; provided that R^, Rj2 and R-,3 are not all hydrogens.
Another preferred class of compounds is that in which R·, has the formula in which R14 is halogen and R15 is hydrogen or halogen. Examples of such phenyl groups are 2,3-difluoro-, 2,4-difluoro-3-chloro-, and 2,3,4-trifluorophenyl.
Also of interest are oonpounds having a 2,5-, 2,3,4- or 2,4,5substitution pattern.
As used herein, these terms have the following meanings:
Alkyleneoxy and alkylenedioxy refer to linking groups having or 2 oxygen atoms, respectively, and at least one carbon atom (optionally substituted) in a chain. Ihe alkyleneoxy moieties have between 2 and 4 carbon atoms in this chain and include, for instance, ethyleneoxy (-O-C2H4-) and the like. Alkylenedioxy moieties include methylenedioxy (-O-CH2-O-), 1,2-ethylenedioxy (-Ο<2Η4“θ)' mono- or di-halomethylenedioxy (a methylenedioxy group in which one or both hydrogens are replaced by a halogen) and isopropylenedioxy (-O-C(013)2-0-).
PR-7713/7874/7924/8029/8443A The term carboalkoxy refers to a group having the formula
in which R^g is an alkyl group. The carbon atom content of the carbo5 alkoxy group is meant to include the carbon atom of the carbonyl moiety in that group. Thus, C2~carboalkoxy refers to carbomethoxy, etc. Similarly, the carbon atom content of an alkylcarbonyl group includes the carbon atom in the carbonyl moiety. The sinplest member of this group is thus acetyl, CH3C (0)-.
When R·) represents a phenyl ring substituted by a second phenyl ring, the second phenyl ring may be unsubstituted or mono-substituted in which the substituent is halogen, C1-C4 alkyl, C1-C4 haloalkyl, nitro, cyano, C1-C4 alkylsulfonyl, C1-C4 haloalkylsulfonyl, or C1-C4 alkylene15 dioxy (optionally further substituted by up to 2 halogens).
Terms defining halogenated groups such as haloalkyl, haloalkoxy, haloalkenyl and the like include mono- and polyhalogenated groups of the indicated number of carbon atoms. In polyhalogenated groups the halogens may be the same or different.
Propargyl refers to the 2-propynyl group -<H2-C=CH and allyl refers to the 2-propenyl group -032-01=02.
Cyclopropyl groups for R2 may be substituted by up to 4 methyl groups or alternatively up to 2 halogen atoms.
For the various subgroups falling within the general definition of R3, preferred types are:
For R4: hydrogen and 2-, 4- or 6-monohalo, particularly monochloro or monofluoro;
For R5: 2-, 3- or 4-halo, 2,4-, 3,4- or 3,5-dihalo, particularly difluoro, pentahalo, particularly pentafluoro, 4-methyl,
4-trifluoromethyl, 4-methoxy, 4-methylthio and 4-methylsulfonyl.
PR-7713/7874/7924/8029/8443A
The following are exanples of specific embodiments of groups falling within the definition of R3. For convenience in specifying positions of substitution of conpounds of the type
the position of attachment of the group
-0H-(CH2)mwas given the number 1 and the position of attachment of group R7, the number 3. When A, B or C was a nitrogen atom, the conpounds were designated pyrid-2-yl, pyrid-6-yl or pyrid-4-yl, respectively.
3-phenoxybenzyl,
3-phenoxy-(alpha-methyl)benzyl,
3-phenoxyphenethyl,
3-(4-pyridyloxy)benzyl,
3-(4-fluorophenoxy)benzyl,
3-(4-chlorophenoxy)benzyl,
3-(4-brcroophenoxy)benzyl,
3-( 4-iodophenoxy) benzyl,
3-(2,4-d i fluorophenoxy)benzyl,
3-(3,4-d if1uorophenoxy)benzy1,
3-(3,5-difluorophenoxy)benzyl,
3-(2,3,4,5,6-pentafluorophenoxy)benzyl,
3-(4-fluorophenoxy)-4-fluorobenzyl,
3-(4-fluorophenoxy)-4-chlorobenzyl,
3-(4-chlorophenoxy)-4-fluorobenzyl,
3-phenoxy-4-fluorobenzyl,
3-(4-fluorophenoxy)-6-chlorobenzy1,
3-(4-fluorophenoxy)-5-fluorobenzyl,
3-(4-fluorophenoxy)-4,6-d i fluorobenzyl,
3-(4-fluorophenoxy)-6-fluorobenzyl, sIOOOdV
PR-7713/7874/7924/8029/8443A
3-(4-fluorophenoxy)-2-fluorobenzyl,
3-(4-cyanophenoxy)benzyl,
3-(4-methylphenoxy)benzy1,
3-(4-methoxyphenoxy)benzyl,
3-( 3,4-di f luorophenoxy) -4-f luorobenzyl,
3-(3-fluorophenoxy)benzyl,
3-(2-fluorophenoxy)benzyl,
3-(3-chlorophenoxy)benzyl,
3-(4-trifluorome thylphenoxyJbenzyl,
3-(4-methylthiophenoxy)benzyl,
3-(4-fluorophenoxy)-(alpha-fluoro) benzyl, 3-phenoxy-pyrid-2-yl-methyl,
3-phenoxy-pyrid-4-yl-methyl,
3-phenoxy-pyr id-6-yl-methyl,
3-( 4-f luorophenoxy )pyrid-2-ylmethyl,
3-( 4-chlorophenoxy )pyr id-2-ylmethyl,
3-( 4-f luorophenoxy )pyrid-4-ylraethyl,
3-( 4-chlorophenoxy )pyr id-2-ylmethyl,
3-( 4-chlorophenoxy )pyrid-4-ylmethyl,
3-( 4-chlorophenoxy )pyrid-6-ylmethy 1,
3-( 3,4-difluorophenoxy )pyrid-2-ylmethyl, 3-( 4-methylphenoxy )pyrid-2-ylmethy 1,
3-( 4-f luorophenoxy )pyrid-6-ylmethyl, 3-(pyrid-2-yloxy )benzyl,
3- (4-chloropyrid-2-yloxy)benzyl,
2,3,4,5,6-tetrafluorobenzyl,
4- methoxymethyl-2,3,5,6-tetrafluorobenzyl,
4-propargyl-2,3,5,6-tetrafluorobenzyl, 3-allyloxybenzyl,
3-(benzyl)benzyl,
3-(benzyloxy)benzyl,
3-(4-fluorobenzyloxy)benzy1,
3-(phenylami no)benzyl,
3-(4-fluorophenylamino)benzyl,
1- (3-phenoxyphenyl)prop-2-ynyl,
3- bromo-4-fl uorobenzyl,
4- phenoxy-2-butyn-2-yl,
4-(benzyloxy)benzyl,
4-(4-fluorobenzyloxy) benzyl,
4- (4-trifluoromethyl-2-pyridyloxy )benzyl
2- methyl-3-phenylbenzyl,
5- benzyl-3-f ur any line thyl.
PR-7713/7874/7924/8029/8443A Processes for Preparation of Conpounds of This Invention
Process (A)
Compounds of this inventiion in general are prepared by reaction of an imidoyl halide (preferably chloride) with an alkali metal alkoxide according to the general reaction:
R1-N=c-R2 + R3OM -¥ R-|-N=C
\)R3 in which M is an alkali metal, preferably sodium or potassium and Hal is a 10 halogen, particularly chloro or bromo.
This reaction is conducted at a temperature of from about -70*C to about +65*C, most preferably at about room tenperature, for a time which may range from about 5 minutes to about 24 hours. The reaction is conducted in the presence of a solvent, for exanple, an aromatic hydrocarbon such as benzene, toluene, xylene or naphthalene, or an ether, such as diethyl ether, diisopropyl ether, diisoamyl ether, dibutyl ether, furan, 1,2-dimethoxyethane, or tetrahydrofuran (preferably tetrahydrofuran). In some instances, apparent to those skilled in the art, it is advantageous to add the solution of the alkali metal alkoxide to a solution of the imidoyl halide or to use substantial excesses of alkoxide.
The resulting product may be recovered by conventional techniques.
The alkoxide R3CM is produced by reaction of an appropriate alcohol, such as 3-phenoxybenzyl alcohol, with an alkali metal-containing base, for instance, an alkali metal hydride (e.g., potassium or preferably sodium hydride) in the presence of a solvent such as that used in reaction of the alkali metal alkoxide with the imidoyl halide. In general, this reaction is conducted at reflux tenperature under an inert atmosphere for a time which may range up to about 2 hours.
The alcohols, if not commercially available, can be prepared according to known methods such as those described in the following references: U. S. patents 4,256,893; 4,261,920; and 4,329,518, and Volume
7 of the text Chemie der Pflanzenschutz und Schadlingsbekanpfungsmittel (phenoxybenzyl, phenoxypyridylmethyl and pyridyloxy type alcohols);
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A
Elliott et al, J. Chem Soc. (C), 1971, pp. 2551-1554 (5-benzyl-2-furanylmethanol); Pesticide Science 14, 560-570 (1983) (2-methyl-3-phenylbenzyl alcohol); 0. S. patents 4,370,346 and 4,594,355; British patent 2,122,616; European patent applications 196,156 and 271,240; and J. Sci. Pood & Agriculture 18, 167 (1967) for various substituted benzyl alcohols; European patent application 211,561 for 3-phenylaminobenzyl alcohols;
Swiss patent 549,342 for 4-phenoxy-2-butyn-1-ol; and Japanese patent 49-27331 for 1-( 3-phenoxyphenyl )-2-propyn-1-ol.
The imidoyl halide may be prepared from a starting amine having the formula R-|NH2 or amide having the formula
depending on availability. “Hie amines are either generally available or may be prepared by procedures known in the art, for exanple, those described in Conpendium of Organic Synthetic Methods, Harrison et al. (Wiley-Interscience, New York, 1971).
The amides, if not available, may be produced by reaction of the amine with an appropriate acid chloride having the formula
The tenperature of this reaction ranges from about -40*C to about +80*C. Suitable solvents include hydrocarbon solvents such as toluene and chlorinated hydrocarbon solvents such as methylene chloride, chloroform, carbon tetrachloride, ethylene dichloride, tetrachloroethane and the like, preferably methylene chloride. This reaction is conducted in the presence of a base, preferably a tertiary amine. Suitable bases include triethylamine, quinoline, dimethylaniline, diethylaniline, and pyridine. Triethyl amine is the preferred base. The resulting amide is recovered and purified by conventional means.
The imidoyl halide may be prepared from the amide by reacting it with a halogenating agent such as phosphorus pentachloride or phosgene in an organic solvent such as that utilized in the amide production (preferably methylene chloride) or alternatively using phosphorus oxychloride as
PR-7713/7874/7924/8029/8443A the solvent. The reaction is carried out under an inert atmosphere for a time which may be up to 24 hours, preferably from 1 to 24 hours, at a temperature of from about 0*C to about 110*C. Before the imidoyl chloride-containing product is passed to the final step, all substances, such as phosphorus oxychloride or hydrogen chloride, which can react with the alkoxide in the final step, should be removed. This can generally be accomplished by evaporation or distillation.
Alternatively, the compounds of this invention may be prepared 10 by a two-step process indicated as follows:
Process (B)
R-:
(1) R2CN + R3OH
HX (2)
C=NH2'HX + RlNH2
R]N=C
OR3 in which HX represents a mineral acid.
APO 00 1 5
In the first step, the appropriate alcohol (for instance a phenoxybenzyl alcohol) is mixed with a nitrile having the formula R2CN at a tenperature of from about -20*C to about +40*C. Then, a solution of a mineral acid such as hydrochloric, hydrobromic, sulfuric or phosphoric acid (preferably hydrochloric acid) dissolved in a suitable organic sol25 vent is added at temperatures from about -5 to about 40*C, preferably 0*C, then stirred at room tenperature, to produce the corresponding imidate salt. Suitable solvents for this reaction include aromatic hydrocarbons such as benzene, toluene, xylene or naphthalene and ethers such as diethyl ether, diisopropyl ether, dianyl ether, furan, tetrahydrofuran and dioxane (preferably dioxane). Time for the reaction may be up to 52 hours. The imidate salts are novel and constitute an aspect of this invention.
In the second step, the imidate salt is suspended in an organic solvent such as that utilized in the previous step, preferably benzene, and reacted with an amine having the formula R^NH2 . The mixture is reacted, optionally with stirring, at a tenperature of between about -50
PR-7713/7874/7924/8029/8443A and +80*C, most preferably at room temperature, for a period of time necessary to conduct the reaction, which may be up to 120 hours. The final imidate product may be recovered as in process (A).
5 Process (Ch
A third process may be used for producing many of the conpounds of this invention, with the exception of those in which R£ is a group having no alpha-hydrogen, such as cyano, tertiary butyl, vinyl or halovinyl. This process proceeds by way of an intermediate ketenimine, which may be prepared from the amide or from the imidoyl halide. In the first case, the amide (prepared for instance, as described in process A) is reacted with an inexpensive base and a trivalent phosphorus conpound, preferably triphenylphosphine. The base is preferably a tertiary amine such as tr iethylamine. The reaction is carried out at a temperature of from about -10*C to 40*C in the presence of a halogen, preferably chlorine or bromine, and an aromatic or chlorinated hydrocarbon solvent such as benzene, toluene, xylene, methylene chloride, ethylene dichloride, chloroform, carbon tetrachloride, tetrachloroethane and the like, v preferably methylene chloride. The reaction may then be conducted under reflux tenperature of the solvent and the ketenimine recovered according to methods known in the art.
Alternatively, the ketenimine may be prepared by reaction of the imidoyl halide with a base, as just described, but no halogen or trivalent phosphorus conpound present.
In the second step of this process, the ketenimine is reacted with an alcohol having the formula R3OH in the presence of a solvent, preferably an ether solvent, such as diethyl ether, dipropyl ether, di iso30 propyl ether, dibutyl ether, tetrahydrofuran or 1,2-dimethoxyethane and an alkali metal base such as potassium or sodium hydride, preferably sodium hydride. This reaction is conducted under reflux for a time as necessary which may be up to 48 hours, preferably from about 2 to about 10 hours, at the end of which the reaction mixture is cooled and the imidate product recovered as described above.
PR-7713/7874/7924/8029/8443A
This process can be depicted by the general scheme:
fl *17 (3) R^NHCR? (CfiHq)qP \ base/halogen »17 (4) RrW=C=C + R3OH *18 ‘18
Λ
A. R1-N-C, or3 in which R·,, R2 and R3 are as previously described and R17 and R-jg are 10 independently hydrogen, C-|-C6 alkyl, halo, CJ-C5 haloalkyl, Cj-Cg alkoxy,
C2-C5 alkenyl or C2-C5 haloalkenyl, or R17 and R^g taken together are a C2-C3 alkylene chain optionally substituted by up to 4 methyl groups or up to 2 halogens.
Z'7
Ketenimines R-|-N=OC>. are novel.
*18
Process (D):
This process may be used as an alternative to process (A) for 20 preparation of conpounds of this invention from alcohols (R3OH) which are sensitive to, and could be adversely affected (e.g. decomposed) by, strong bases such as the alkali metal-containing bases (e.g. alkali metal hydrides) used to prepare the alkoxides (R3CM). Alcohols which may be sensitive to such strong bases include phenoxypyridyl alkanols, alpha25 ethynyl alcohols (Rg is ethynyl) such as 1-( 3-phenoxyphenyl)-2-propyn-1-ol and tetrafluoropropargylbenzyl alcohol.
AP 0 0 0 1 5 0
Conpounds of this type may be made by direct reaction of the alcohol with the imidoyl chloride in the presence of a tertiary amine base and a reaction-promoting amount of a 4-di (lower alkyl) ami nopyridine, preferably 4-dimethylaminopyridine.
Tertiary amines which may be used in this process include trialky 1 amines such as trimethyl-, triethyl-, tri-n-butylamine and the like, including tertiary amines having mixed alkyl groups, N,N-dialkylanilines such as Ν,Ν-dimethylaniline, pyridine and various substituted pyridines.
PR-7713/7874/7924/8029/8443A
Preferred tertiary amines, primarily for economic reasons, are triethylamine, Ν,Ν-dimethylaniline, and pyridine. The tertiary amine may even be an additional amount of the promoter 4-di(lower alkyl)aminopyridine, over and above that amount needed for promoting the reaction.
The tertiary amine is preferably used in a stoichiometric amount with respect to the alcohol, but may be used in excess of that amount.
The promoter 4-di (lower alkyl Jaminopyridine may be used in an amount from about 0.05 to about 1 equivalent per equivalent of alcohol, preferably from about 0.05 to about 0.15 equivalent per equivalent, most preferably about 0.1.
This process is preferably conducted at temperatures of from about 10*C to about 50*C. Lower temperatures may be used, but the reaction rate would be much slower. The process is carried out in the presence of an inert solvent such as an aromatic hydrocarbon (for instance, benzene, toluene or xylene), a chlorinated solvent (such as methylene chloride, ethylene dichloride or chlorobenzene) or an ether (such as diethyl ether, dioxane or tetrahydrofuran).
While this process is particularly suitable for producing compounds from base-sensitive alcohols, it may be used to produce compounds of this invention in general from other alcohols as described.
Alpha-fluorophenoxybenzyl compounds are made from the alphafluorobenzyl halide (preferably bromide) rather than the alcohol by reaction with an amide, R]NHCOR2, in the presence of a halide ion binding agent such as silver oxide or a silver salt, and an inert solvent. Reaction temperatures are from about -20*C to about 100*C.
The following are representative exanples of the preparation of compounds of this invention according to the processes described above.
PR-7713/7874/7924/8029/8443A
EXAMPLE 1
Preparation of
N- (3-Chloro-4-f luorophenyl) -O- (3-phenoxybenzyl) i sobutyryl imidate (Conpound 88 herein) (Process A) (a) Preparation of the Anilide
Ito a stirred solution of 3-chloro-4-fluoroaniline (10.0 g, 0.069 mol) and triethylamine (11.2 ml, 0.08 mol) in 100 ml methylene chloride was added isobutyryl chloride (7.8 ml, 0.075 mol) dropwise, with cooling, in an ice bath. After the addition, the reaction mixture was permitted to reach room temperature at which point 100 ml of water was added. The aqueous and organic layers were separated; the organic layer was dried over anhydrous sodium sulfate and the solvent evaporated to provide 15.2 g (103% of theoretical yield) of a tan solid, spectroscopically identified as 3-chloro-4-fluoroisobutyrylanilide, m.p. 114-117*0.
(b) Preparation of the Imidoyl chloride
To a solution of the anilide prepared in step (a) (2.1 g, 9.3 mmol) in 50 ml methylene chloride under an argon atmosphere there was added phosphorus pentachloride (1.93 g, 9.3 mmol). After two hours, the solvent was evaporated at 20 mmHg and the resulting brown oil was further evaporated at 40*C and less than 1 mmHg. The product, N-(1-chloro-2methylpropylidene)-3-chloro-4-fluoroaniline, was transferred to the next step without further purification.
(c) Preparation of the Sodium Alkoxide
A suspension of sodium hydride (0.26 g, 11 mmol) in tetrahydrofuran (40 ml) was prepared and stirred under an argon atmosphere. To this suspension there was added 3-phenoxybenzyl alcohol (1.75 ml, 10 mmol).
The resulting mixture was heated to reflux 0.5 hour and then cooled.
There was obtained a pale yellow solution of sodium 3-phenoxybenzylalkoxide which contained a small amount of gray solid.
(d) Preparation of the Imidate
To the alkoxide solution produced in step (c) there was added the imidoyl chloride prepared in step (b), dissolved in about 10 ml tetrahydrofuran, at room temperature with cooling over several minutes. At the end of one hour, the product mixture was poured into about 200 ml hexanes
PR-7713/7874/7924/8029/8443A and filtered through a pad of silica gel. The solvent was evaporated to produce 3.0 g (82% of theoretical yield) of a tan oil, which was further purified by chromatography over silica gel. Evaporation of the solvent from the product fraction gave 2.4 g (65% of theoretical yield) of a nearly colorless, viscous oil, identified spectroscopically as the desired product.
EXAMPLE 2 (Process B)
This example illustrates the preparation of the conpound of Example 1 by the second described process, through the intermediate imi date salt.
(a) A solution of 3-phenoxybenzyl alcohol (10 ml, 57.4 mmol) and isobutyronitrile (5.2 ml, 57.88 mmol) was cooled to 0*C. There was then added 12.5 ml of a 4.1 molar solution of anhydrous HC1 (62.5 mmol) in dioxane, dropwise, followed by stirring at 25*C for 16 hours. The product, 0-(3-phenoxybenzyl)isobutyrylimidate hydrochloride, separated out as a white solid.
(b) The imidate hydrochloride salt obtained above (0.99 g, 3.2 nmol) was suspended in 15 ml benzene and 0.60 g (4.1 mmol) 3-chloro-4fluoroaniline was added. The mixture was then stirred at 25*C for 72 hours and filtered through silica gel. The combined filtrates were concentrated at reduced pressure and purified on silica gel using 5% ethylacetate in hexanes as eluent. There was obtained 0.78 g of the desired product of 77% purity.
EXAMPLE 3 Preparation of
M-(3,4-Difluorophenyl )-O-( 4'-fluoro-3-phenoxybenzyl) isobutyryl imidate (Compound 66 herein) (Process C)
This example illustrates production of a conpound of this invention according to the third process, through an intermediate ketenimine.
PR-7713/7874/7924/8029/8443A (a) A mixture was prepared which contained 3,4-difluoroisobutyrylanilide (4.0 g, 20.1 mmol, prepared analogously to Exanple 1, step (a)), triethylamine (6 ml, 43 nmol) and triphenylphosphine (5.3 g, 20.2 mmol) and 50 ml methylene chloride. The mixture was cooled to O’C; then bromine (1.0 ml, 20 nmol) was added dropwise. The mixture was then refluxed for 2 hours, cooled to room temperature and concentrated at reduced pressure. The residue was extracted with 50 ml hexanes; the extract was filtered and concentrated at reduced pressure to yield 3.84 g of the crude ketenimine.
(b) The ketenimine thus prepared was combined with 3-(4-fluorophenoxy)benzy1 alcohol (obtained, for instance, by the method of Fuchs et al., U.S. Pat. 4,242,357) (0.80 g, 3.7 mmol) and the resulting mixture dissolved in 50 ml 1,2-dimethoxyethane. Sodium hydride (0.10 g, 4.2 mmol) was added and the mixture heated at reflux for 2 hours. The resulting mixture was allowed to cool, filtered, and concentrated. The crude product was purified by chromatography on silica gel using 5% ethyl acetate in hexanes as eluent. There was obtained 1.05 g (72% of theoretical yield) of the desired product.
EXAMPUB 4 Preparation of
M-( 4-Chlorophenyl )-O-( 3-phenoxybenzyl )cyclopropylcarboximidate (Conpound 35 herein) (Process A)
N-(4-chlorophenyl)cyclopropane carboxamide (4.0 g, 20.4 mrol), prepared from 4-chloroaniline and cyclopropane carboxylic acid chloride analogously to Example 1, step (a)) was dissolved in 50 ml methylene chloride and treated with PCI5 (4.25 g, 20.4 mmol) all at once, under an argon atmosphere. After 20 minutes, n-pentane was added and the solid was filtered. The solvents were evaporated at 50*C yielding a residual light brown oil, the desired imidoyl chloride. This was taken up in a small amount of dry tetrahydrofuran.
The imidoyl chloride thus prepared was then added to a solution of sodium 3-phenoxybenzyl alkoxide prepared using 4.1 g of 3-phenoxybenzyl alcohol and 0.5 g of sodium hydride as in Example 1, step (c). The mixture was let stand for 4 hours at room temperature then briefly heated
PR-7713/7874/7924/8029/8443A to reflux and cooled. Water and hexanes were added and the aqueous and organic phases separated. The organic layer was washed with water, dried over magnesium sulfate and evaporated. The residue was redissolved in hexanes and filtered through silica gel. Evaporation gave a colorless oil, identified spectroscopically as the desired product.
EXAMPLE 5 Preparation of
N-( 3-Trif luoromethylphenyl )-0-( 3-phenoxybenzyl )dichloroacetimidate (Conpound 72 herein) (Process A)
In a flask were combined 4.2 g (20.2 mol) phosphorus pentachloride, 3-trifluoromethyldichloroacetanilide [5.4 g, 19.8 mole, prepared analogously to Example 1, step (a)) and phosphorus oxychloride (solvent) under argon. The mixture was heated to 60*C for several hours; then hexanes were added and the resulting solution filtered. The filtrate was evaporated and the product imidoyl chloride, an oil, was taken up in a small amount of dry tetrahydrofuran.
Itie imidoyl choride thus prepared was added to a solution of “ -¼ sodium 3-phenoxybenzyl alkoxide (prepared analogously to Example 1 step (c) from 4.0 g 3-phenoxybenzyl alcohol and 0.5 g sodium hydride).
Ihe resulting mixture was stirred overnight at ambient tenperature; then water and hexanes were added, the mixture was phase separated, washed with 5% HC1 and saturated sodium bicarbonate solution, dried over magnesium sulfate and evaporated to produce an oil. This oil was then purified by chromatography over silica gel to give a pale yellow oil, identified spectroscopically as the desired product.
30 EXAMPLE 6
Preparation of
N-( 3,4-Methylenedioxyphenyl )-O-( 3-phenoxybenzyl )propionimidate (Conpound 189 herein) (Process A)
This conpound was prepared analogously to Exanple 1 from 2.0 g (10.4 mmol) 3,4-methylenedioxypropionanilide (itself prepared from
PR-7713/7874/7924/8029/8443A
3,4-methylenedioxyaniline and propionyl chloride), 2.26 g 3-phenoxybenzyl alcohol and 0.29 g sodium hydride. There was obtained 1.9 g (50% of theoretical yield) of a colorless viscous oil, identified spectroscopically as the desired product.
EXAMPLE 7
Preparation of
N-( 3-chloro-4-f luorophenyl) -O- [ 1 -(3-phenoxyphenyl
2-propyn-l—yi Ji sobutyrimidate (Conpound 533 herein) (Process D) )(a) Preparation of the alcohol
A solution was prepared containing 2.4 g (24 mmol) trimethylsi lyl acetylene in 50 ml tetrahydrofuran. The tenperature was kept at -78*C with stirring. Then 10.0 ml of a 2.5 M solution of n-butyllithium in hexanes was slowly added. After further stirring for 15 minutes, 3.5 ml (4.0 g, 20 mmol) 3-phenoxybenzaldehyde was added. The solution was stirred at -78*C for 10 minutes and was allowed to warm to room tenperature over 30 minutes.
The reaction was quenched with 5% sodium bicarbonate. The tetrahydrofuran was removed in vacuo, the aqueous phase was extracted with methylene chloride and the organic layers combined and dried to produce a light oil.
A solution of the light oil in methanol was stirred with potassium carbonate, then concentrated, dissolved in water and extracted with ether. The desired alcohol, 1-(3-phenoxyphenyl)-2-propyn-1-01 (4.3 g, 96% of theoretical yield), a light yellow oil, was obtained from the ether extracts.
(b) Preparation of the imidate
To a solution of 0.7 g (3.0 mmol) of N-3-chloro-4-fluorophenyl i sobutyr imidoyl chloride (prepared as in Example 1 (a)-(b)] was added triethylamine (0.63 ml, 0.45 g, 4.5 mmol), 1-(3-phenoxyphenyl)-2-propyn-1-ol (prepared as above) (1.0 g, 4.5 mmol) and 4-dimethylaminopyridine (50 mg, 0.4 mmol). The mixture was stirred for 24 hours at room tenperature ,
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A concentrated and diluted with 100 ml hexanes. The resulting slurry was filtered through alumina and concentrated to give 0.90 g {70% of theoretical yield) of the desired compound.
Tables 1 and 2 depict representative conpounds of this invention, prepared according to a method as described above. Table 1 contains conpounds in which R3 is a substituted or unsubstituted 3-phenoxybenzyl moiety. Table 2 contains conpounds in which R3 represents other moieties. Nearly all conpounds were produced as oils? all structures were confirmed by spectroscopic analysis.
For convenience, since nearly all conpounds in the tables are of the type in which Ri is a substituted or unsubstituted phenyl ring, the tables only depict the substituents (if any) on that ring, with H = unsub15 stituted phenyl, 3-C1 » 3-chlorophenyl, 3-Cl,4F 3 3-chloro-4-fluorophenyl, and the like. Naphthyl conpounds are indicated as such.
PR-7713/7874/7924/8029/8443A
TABLE 1
| Rr | r2 -N=fc-O-CH2_ | ||||
| I | 0¼ to | Ζ*5 | |||
| (Ri | * unsubstituted or substituted phenyl) | ||||
| Cmpd. | |||||
| No. | Phenyl | Subst. | R2 | *5 | |
| 1 | 3-C1 | chci2 | H | H | |
| 2 | 4-C1 | 1-C3H7 | H | H | |
| 3 | 4-C1 | -CC12CH3 | H | H | |
| 4 | 2,4-Cl | CHC12 | H | H | |
| 5 | 4-C1 | CH3 | H | H | |
| CH3 | |||||
| 6 | 4-C1 | -c=ch2 | H | H | |
| 7 | 3-C1 | 1-C3H7 | H | H | |
| 8 | 4-C1 | H | H | ||
| 9 | 3,4-Cl | i-C3H7 | H | H | |
| 10 | 3,5-Cl | i-C^Hg | H | H | |
| 11 | 4-C1 | C2«5 | H | H | |
| 12 | 3-C1 | t-C^Hg | H | H | |
| 13 | 2,5-Cl | i-C3H7 | H | H | |
| 14 | 3,4-Cl | i-C3H7 | H | H |
AP 0 0 0 1 5 0
TABLE 1
PR-7713/7874/7924/8029/8443A
| (continued) | |||
| Phenyl Subst. | «2 | r4 | Rs |
| 4-C1 | H | a | |
| 3,5-Cl | i-C3H7 | B | a |
| 2-C1 | i-C3H7 | H | H |
| 2,4,5-Cl | i-C3H7 | B | a |
| 2,4,6-Cl | i-C3H7 | H | a |
| 3,4,5-Cl | i-<3H7 | H | H |
| 4-C1 | -CN | H | a |
| 4-C1 | -CH(CH3)OCH3 | H | a |
| 4-C1 | i-C3H7 | 4-F | a |
| 3-C1 | -< | H | H |
| 3,4-Cl | t-C^Hg | H | a |
| 4-C1 | sec-C4Hg | B | a |
| 3,4-Cl | -chcich3 | H | H |
| 2,3-Cl | c2h5 | a | a |
| 4-C1 | chci2 | H | a |
| 4-C1 | t-C4H9 | a | a |
| 4-Cl | CH2C1 | a | a |
| 4—Cl | X] | H | H |
| 4-C1 | -chcich3 | a | H |
| 2-Cl | chci2 | a | a |
| 4-Cl | cf3 | H | H |
| 3,4-Cl | C2H5 | H | H |
| 3,4-Cl | i-C3H7 | a | 4-F |
| 3,4-Cl | n-C3H7 | a | a |
| 3,4-Cl | sec~c4H9 | a | H |
TABLE 1
PR-7713/7874/7924/8029/8443A
| (continued) | |||
| Phenyl Subst. | R2 | R* | *5 |
| 3,4-Cl | X-C3H7 | H | 3-F |
| H | CHC12 | H | H |
| H | ch3 | H | H |
| H | i-OjH? | H | H |
| 4-F | CHC12 | H | H |
| 4-F | -< | H | H |
| 4-F | i_c3H7 | H | H |
| 3-F | 1-C3H7 | H | H |
| 4-F | t-G^Hg | H | H |
| 4-F | -OCC12 Cl | H | H |
| 4-F | chf2 | H | H |
| 2,3,4,5,6-F | X-C3H7 | H | H |
| 2,4-F | i-c3H7 | H | H |
| 4-F | i-C^H? | 4-F | H |
| 3,4-F | i-C3 H7 | H | H |
| 3,5-F | 1-C3H7 | H | H |
| 2,5-F | i-C3H7 | H | H |
| 2,3,5,6-F | X-C3H7 | H | H |
| 2,4,5-F | i_c3H7 | H | H |
| 2,4-F | c2h5 | H | H |
| 3,4-F | i_c3H7 | H | 4-F |
| 4-CF3 | CHC12 | H | H |
| 4-CF3 | -< | H | H |
| 4-OCF3 | H | H | |
| 4-OCF3 | CHC12 | H | H |
| 2-Cl,4-CF3 | -< | H | H |
AP 0 0 0 1 5 o
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
| Phenyl Subst. | Rd | Rs | |
| 3-CF3 | chci2 | H | H |
| 3-CF3 | i_c3H7 | H | H |
| 4-CF3 | i-C3H7 | H | H |
| 2,5-OCH3 | ί<3Η7 | H | H |
| 4-OCF3 | i-C3H7 | H | H |
| 3-CF3,4-Cl | 1-C3H7 | H | H |
| 2-CF3 | 1-C3H7 | H | H |
| 2-CH3,3-F | 1-C3H7 | H | H |
| 2-CH3,5-F | ΐ-<3Η7 | H | H |
| 3-F,4-CH3 | i-C3H7 | H | H |
| 3-OCH3,5-CF3 | i-C3 H7 | H | H |
| 3-CF3,5-F | i-c3H7 | H | H |
| 3,5-CF3 | i-C3H7 | H | H |
| 2-F,4-Br | i-c3H7 | H | H |
| 3-CF3 | i-C3 H7 | 4-F | H |
| 3-Cl,4-F | ί-<3Η7 | H | H |
| 3-Cl,4-F | i-C3H7 | 4-F | H |
| 3-Cl,4-CF3 | X-C3H7 | H | H |
| 2-F,5-CF3 | i-c3B7 | H | H |
| 3-Cl,4-F | C2H5 | H | H |
| 3-CF3 | H | H | |
| 3-CH3,4-F | i<3H7 | H | H |
| 3-CF3 | t-C4H9 | H | H |
| 3-Cl,4-F | X-C3H7 | H | 4-F |
| 3-Cl,4-CH3 | X-C3H7 | H | H |
| 3,5-Cl,4-OCH3 | X-C3H7 | H | H |
| 2,6-Cl,4-NO2 | i“c3H7 | H | H |
| 2-Cl,5-CH3 | i-c3H7 | H | H |
| 2-Cl,4-CH3 | i-C3H7 | H | H |
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
Cnpd.
| No. | Phenyl Subst. | «2 | Rd | Rs |
| 95 | 3-Cl,4-OCH3 | i-C3 H7 | H | H |
| 96 | 2-CH3,4-Cl | i-C3H7 | H | H |
| 97 | 2-CH3,3-Cl | chci2 | H | H |
| 98 | (4-chloro-alphanaphthyl) | chci2 | H | H |
| 99 | 2,5-OCH3,4-Cl | i-C3H7 | H | H |
| 100 | 2-Cl,3,6-OCH3 | i_c3H7 | H | H |
| 101 | 3,5-Cl,4-CH3 n | i-C3H7 | H | H |
| 102 | π 3-O0C2H5,4-Cl | i<3H7 | H | H |
| 103 | 3-Cl,4-SC2H5 o | 1-C3H7 | H | H |
| 104 | it 3-Cl,4-COC2H5 | 1-C3H7 | H | H |
| 105 | 3-N32/4-<l | t-C4H9 | H | H |
| 106 | 3-Cl,4-Br | t-C4H9 | H | H |
| 107 | 3-Cl,4-CH3 | t-C4Hg | H | H |
| 108 | 3-C1,4-CN | -C(CH3 )7(21 | H | H |
| 109 | 2-CH3,4-Cl | t-C4H9 | H | H |
| 110 | 3-Cl,4-OCH3 | i-C3H7 | H | 4-F |
| 111 | (4-chloro-alphanaphthyl) | -CiCH^TCl | H | H |
| 112 | 3-Cl,4-SO2C2H5 | I-C3H7 | H | H |
| H | H | |||
| 113 | 3-Cl,4-F | <3 | H | H |
| 114 | 3-(pyrid-2-yloxy) | 1-C3H7 | H | H |
| 115 | 3-Cl,4-F | C2h5 | H | 4-F |
| 116 | 3-Cl,4F | -< | H | 4-F |
| 117 | 3-Cl,4-F | C2F5 | H | H |
| 118 | 3-Cl,4-F | CHBrCH3 | H | H |
APO00150
TABLE 1
PR-7713/7874/7924/8029/8443A (continued)
| Phenyl Subst. | R2 | R4 | R5 |
| 3-Cl,4-F | i-C3H7 | H | 2-F |
| 3-CF3,4-F | i-C3H7 | H | 4-F |
| 3-Cl,4-F | n-C4H9 | H | H |
| 3-Cl,4-P | sec-C4H9 | H | H |
| 3-Cl,4-F | n-C3H7 | H | H |
| 3-Cl,4-F | X | H | H |
| 3-Cl,4-F | i<3H7 | H | 3-F |
| 3-CN | i-C3H7 | H | H |
| 3-CH3,4-Br | i_C3H7 | H | H |
| 3-Br | i-C3H7 | H | H |
| 2,4-F,6-Br | i_c3H7 | H | H |
| 2,6-Br,4-F | i-C3H7 | H | H |
| 4-Br | i-C3H7 | H | H |
| 2-Br | i-C3H7 | H | H |
| 2—CH3,4-Br | I-C3H7 | H | H |
| 3-Br | t-C4Hg | H | H |
| 4-Br | t-C4H9 | H | H |
| 3-1 | i-C3H7 | H | H |
| 4-1 | i-C3 H7 | H | H |
| 4-OC2H5 | CHC12 | H | H |
| 4-CH3 | chci2 | H | H |
| 4-(t-C4H9) | chci2 | H | H |
| 4-SCH3 | chci2 | H | H |
| 4-SCH3 | i-C3H7 | H | H |
| 3-OCH3 | i_c3H7 | H | H |
| 4-(i-C3H7) | i-C3H7 | H | H |
| 2-OCH3 | i-C3H7 | H | H |
| 2,4-OCH3 4-S-CH3 | i-C3H7 | H | H |
| i-C3H7 | H | H |
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
| Phenyl Subst. | R? | Rd | r5 |
| 2,3-CH3 | 1-C3H7 | H | H |
| 2-013,4-0013 | I-C3H7 | H | H |
| 2-0013,5-013 | i-C3 H7 | H | H |
| 4-80013 | 1-O3H7 | H | H |
| 4-(n-C4H9) | i-C3H7 | H | H |
| 4-{t-C4H9) | I-O3H7 | H | H |
| 3-C2h5 | 1-C3H7 | H | H |
| 3-013 | I-C3H7 | H | H |
| 4-Ol3 | 1-C3H7 | H | H |
| 4-c2h5 | c2H5 | H | H |
| 3,4-013 | i-C3H7 | H | H |
| 4-C2H5 | ΐ-Ο3Η7 | H | 4-F |
| 4-OCH3 | i-C3H7 | H | H |
| 4-O2H5 | i-C3 H7 | H | H |
| 3-C2H5 | t-C4H9 | H | H |
| 4-C2H5 | t-C4H9 | H | H |
| 4-OC2H5 | t-O4H9 | H | H |
| 4-(i-C3H7) | t-C4H9 | H | H |
| 3-3313 | i-C3H7 | H | H |
| 3,4-013 0 | t-C4H9 | H | H |
| P 3-OOC2H5 | t-C4H9 | H | H |
| 3,4-0013 Q | i-C3H7 | H | H |
| 3-0-013 | I-C3H7 | H | H |
| 3-OC2H5 | 1-O3H7 | H | H |
| 4-ON | 1-C3H7 | H | H |
| 4-NO2 | chci2 | H | H |
| 3-N02 | chci2 | H | H |
| 3-NO2 | t-C4H9 | H | H |
| 3,4-(-0CH2O-) | 1-C3H7 | H | 4-F |
AP 0 0 0 1 5 0
| 28 TABLE 1 (continued) | PR-7713/7874/7924/8029/8443A | ||
| Phenyl Subst. | *2 | r4 | |
| 3,4-(-OCH2O-) | H | H | |
| 3,4-(-OCH2O-) | c2h5 | H | H |
| 3,4-{OC2H4°-) | i-c3H7 | H | H |
| 3,4-(-OCH2O-) | i-C3H7 | H | H |
| 3,4-(-OCH2O-) | 1-C3H7 | 4-F | H |
| 3,4-[-OC(CH3)2O-] | i-c3H7 | H | H |
| 3,4-(OCH2O-) | i-C3H7 | H | 2-F |
| 4-OCH3 | n-C3H7 | H | H |
| 3,4-(OCH2O-) | Sec-C4H9 | H | H |
| 4-C6 h5 | i-C3H7 | H | H |
| 3,4-(-0^2^2-) | i-C3H7 | H | H |
| 3-4-(-0020-) | n-C3H7 | H | H |
| 4-C1 | i-C3H7 | H | 4-F |
| 3,4-(-0020-) | i-c3H7 | H | 2-F |
| 3-Cl,4-F | I-C3H7 | H | 2,4-F |
| 3-CF3 | i_c3H7 | H | 3-F |
| 3-CF3,4-Cl | i-C3 H7 | H | 4-F |
| 3-0 | i-C3H7 | H | 4-F |
| 3-CF3,4-Cl | i-c3H7 | H | 3-F |
| 3-Cl,4-F | i-c3H7 | H | 4-0 |
| 4-F | i-O3H7 | H | 4-F |
| 2,3,4,5,6-F | ΐ-<:3Η7 | H | 4-F |
| 3,5-F | i-C3H7 | H | 4-F |
| 3-F | i_c3H7 | H | 4-F |
| 3-OCH3 | i-C3H7 | H | 4-F |
| 3-CF3 | i-C3H7 | H | 4-F |
| 3-Cl,4-F | i-C3H7 | H | 3-C1 |
| 3-Cl,4-F | t-C4H9 | H | 4-F |
| 4-F | i-C3H7 | H | 3-C1 |
| 4-F | i_c3H7 | H | 2,4-F |
TABLE 1
PR-7713/7874/7924/8029/8443A (continued)
| Phenyl Subst. | «2 | R4 | Rs |
| 3,4-Cl | I-C3H7 | H | 3-C1 |
| 4-CN | i-C3H7 | H | 3-C1 |
| 2,4-F | i-C3B7 | H | 4-F |
| 3-Cl,4-F | sec-C4H9 | H | 4-F |
| 3,4-Cl | sec-C4H9 | H | 4-F |
| 3,4-F | i-C3H7 | H | 4-CN |
| 3,4-Cl | i-C3 H7 | H | 2,4-F |
| 3,4-F | i-C3H7 | H | 2,4-F |
| 3-Cl,4-F | i-C3H? | H | 3,5-F |
| 3-Cl,4-F | i-C3H7 | 4-F | 4-F |
| 3-Cl,4-F | i-C3H7 | H | 3,4-F |
| 3,4-Cl | t-C3B7 | H | 3,4-F |
| 3-4-[-OC(CH3)2<>] | i-C3 H7 | H | 4-F |
| 4-F | i-C3H7 | H | 4-OCH3 |
| 3-Cl,4-F | i-C3H7 | H | 4-OCH3 |
| 3-F,4-CN | i-C3H7 | H | 4-F |
| 3,4-Cl | i^3H? | H | 4-OCH3 |
| 3-Cl,4-F | -C(CH3)2C1 | H | 4-F |
| 3-Cl,4-F | i-C-jH? | H | 4-CH3 |
| 4-Br | i-C3 H7 | R | 4-F |
| 4-CN | i-C3 H7 | H | 4-F |
| 4-(i-C3H7) | 1-C3H7 | H | 4-F |
| 3-Br | i-C3H7 | H | 4-F |
| 3-Cl,4-F | 1-C3H7 | 6-F | 4-F |
| 4-F | i-C3H7 | H | 4-CH3 |
| 2,3,4,5,6-F | i-C3 H7 | H | 2,4-F |
| 3-F,4-CN | i-C3H7 | H | H |
| 4-1 | i-C3 H7 | H | 4-F |
| 4-(t-C4H9) | i-C3 H7 | H | 4-F |
| 3-CH3,4-F | i-C3 H7 | H | 4-F |
| 4-C1 | i-C3H7 | H | 4-Br |
AP 0 0 0 1 5 0
| 30 TABLE 1 (continued) | PR-7713/7874/7924/8029/8443A | ||
| Phenyl Subst. | Ra | ||
| 3-Cl,4-F | i-C3H7 | H | 4-Br |
| 3-Cl,4-F | i-C3H7 | H | 4-C1 |
| 3,4-(-OCH2°-) | i-C3H7 | H | 4-C1 |
| 3,4-[-0C(CH3)2O-] | i_C3H7 | H | 4-C1 |
| 3,4-(-0C(CH3)2O-] | i-C3H7 | 4-F | H |
| 3,4-(-0^(^0-) | i-c3h7 | H | H |
| 3,4-(-0CF2O-) | i-C3H7 | H | 4-F |
| 3,4-(-OCF2O-) | i_c3H7 | H | H |
| 3,4-(-0CH2O-) | i-C3H7 | H | 4-CF3 |
| 3-Cl,4-F | i-C3H7 | H | 4-CF3 |
| 3,4,5-OCH3 | i-C3H7 | H | H |
| 2,3-CH3 | i-C#? | H | H |
| 2,5-CH3 | i-C3H7 | H | H |
| 3,4-Br | i-C3H7 | H | 4-F |
| 3,4-Br | i-C3H7 | H | H |
| 3-Br,4-F | i-C3H7 | H | 4-F |
| 3-Br,4-F | ΐ-Ο3 Η7 | H | H |
| 3-1 | i-C3 H7 | H | 4-F |
| 3-Cl,4-F | i-C3B7 | H | 4-SCH3 |
| 4-F | i-C3H7 | H | 4-SCH3 |
| 3-Cl,4-F | c2f5 | H | 4-F |
| 4-F | i-C3H7 | H | 4-Br |
| 3-C1 | i-€3H7 | H | 4-Br |
| 3-Cl,4-F | sec-C4H9 | 4-F | H |
| 3-Cl,4-F | ί-€3Η7 | 2-F | 4-F |
| 2-CH3,5-Cl | i-^H? | H | H |
| 2-OCH3,5-Cl | i_c3H7 | H | H |
| 4-F | 1-C3H7 | H | 3,4-F |
| 3-CF3 | i^3H7 | 4-F | 4-C1 |
| 3-Cl,4-F | I-C3H7 | 4-F | 4-C1 |
| 3-CF3 | i-OjH? | 4-F | 4-F |
TABLE 1
PR-7713/7874/7924/8029/8443A (continued)
| Phenyl Subst. | R2 | ||
| 4-C1 | i-C3H7 | H | 4-0 |
| 3-C1 | i-CjH? | H | 4-0 |
| 3-N02 | i-OjH? | H | 4-0 |
| 3-SCF3 | i-C3H7 | H | 4-F |
| 3-Br,4-F | i-C3 H7 | 4-F | 4-F |
| 3,4-(-OCH2<» | i-C3H7 | 6-0 | 4-F |
| 3,4-F | i-C3H7 | H | 4-Br |
| 3-Br,4-F | i-C3H7 | H | 4-Br |
| 3-CF3,4-F | i-€3H7 | 4-F | 4-F |
| 3,4-F | I-C3H7 | 4-F | 4-F |
| 3-1 | i-C3H7 | 4-F | 4-F |
| •0 | i-C3H7 | H | 4-F |
| 3-1,4-F | i-C3H7 | 4-F | 4-F |
| 3-F,4-Br | 1-C3H7 | 4-F | 4-F |
| 3,4-[0C(CH3)2O-] | 1-C3H7 | 4-F | 4-F |
| 3,4-(-OCF2O-) | i-C3H7 | 4-F | 4-F |
| 3,4-(-OCF20) | i-C3H7 | 4-F | H |
| 4-OCF3 | i-C3H7 | 4-F | 4-F |
| 4-CF3 | i-C3H7 | 4-F | 4-F |
| 3-OCF2CHF2 | i-C3 H7 | H | 4-F |
| 3,4-Cl | i_c3H7 | 4-F | 4-F |
| 4-0 | -CH(C2H5)2 | H | 4-F |
| 3-CF3 | -CH(C2H5)2 | H | 4-F |
| 2,4-Cl,5-F | I-C3H7 | 4-F | 4-F |
| 3-^,4^ | i-C3H7 | H | H |
| 3-CF3 | <] | H | 4-F |
| 3,4-F | 1-C3H7 | 4-F | 4-0 |
| 3,4-Cl | i-C3 H7 | 4-F | 4-0 |
o $ V 0 0 0 dV
TABLE 1
PR-7713/7874/7924/8029/8443A (continued)
| Phenyl Subst. | R2 | Rs | |
| 3-CF3,4-F | i_c3H7 | 4-F | 4-C1 |
| 3-Br,4-F | i-C3H7 | 4-F | 4-C1 |
| 3-Br,4-F | i_c3H7 | 4-F | H |
| 3-CF3,4-F | i-C3H7 | 4-F | H |
| 4-(t-C4H9) | i-C3H7 | 4-F | 4-C1 |
| 3-NO2 | i_c3H7 | H | H |
| 2-C1/5-F | i-C3H7 | 4-F | 4-F |
| 2,3,5,6-F | i-C3H7 | H | 4-F |
| 3-C1/4-F | CHBrCHg | H | 4-F |
| 3,4-(0CH2O) | CHBrCH3 | H | H |
| 3-CF3,4-NO2 | i-C3H7 | H | H |
| 3-O,4-(t-C4H9) | i<3H7 | H | 4-F |
| 3-Cl,4-F | CF(CH3)2 | H | 4-F |
| 3-Cl,4-F | CF(CH3)2 | 4-F | 4-F |
| 2,4-Cl | i-CgH? | H | H |
| 2,4-Cl | I-C3H7 | 8 | 4-F |
| 3,4-(-OCH2O-) | i-C3H7 | 4-F | 4-C1 |
| 4-CF3 | i-C3H7 | 4-F | 4-F |
| 3-Cl,4-F | CF(CH3)2 | H | 2,4-F |
| 3-Cl,4-F | CF(CH3)2 | 6-F | 4-F |
| 4-(i-C3H7) | sec-C4H9 | H | H |
| 3,4-F | CF(CH3)2 | H | 4-F |
| 3-CF3 | CF(CH3)2 | H | 4-F |
| 4-(i-C3H7) | c2h5 | H | 4-F |
| 4-(i-C3H7) | CH(C2H5)2 | H | H |
| 4-(i-C3H7) | t-C4H9 | H | 4-F |
| 4-OCF3 | i-C3H7 | 4-F | 4-C1 |
| 4-CF3 | i-C3H7 | 4-F | 4-C1 |
| 4-F | i-C3H7 | 4-F | 4-C1 |
| 3-1,4-F | i-C3H7 | 4-F | 4-C1 |
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
| Phenyl Subst. | r2 | *4 | R5 |
| 3-Cl,4-F | i_c3H7 | 5-F | 4-F |
| 3-Cl,4-OCF3 | i_<3H7 | 5-F | 4-F |
| 4-(i-C3H7) | i-C4H9 | H | 4-F |
| 2,4-F,3-Cl | i-c3H7 | 4-F | 4-F |
| 2,4-F,3-Cl | i-C3H7 | H | 4-C1 |
| 2,4-F,3-Cl | 1-C3H7 | H | H |
| 4-Br | i-C3H7 | 4-F | 4-F |
| 3-1,4-F | i<3H7 | 4-F | H |
| 4-1 | i-C3H7 | 4-F | 4-F |
| 3,4-F | i-C3H? | 4-F | H |
| 4-CF3 | i-C3H7 | 4-F | H |
| 4-OCF3 | 1-C3H7 | 4-F | H |
| 4-(i-C3H7) | 0 | H | H |
| 3-CF3,4-Cl | i_c3H7 | 4-F | 4-F |
| 3-C1 | i-C3H7 | 4-F | 4-F |
| 3-F | i-C3B7 | 4-F | 4-F |
| 3-Cl,4-F | i-C3H7 | 4,6-F | 4-F |
| 4-(t-C4H9) | i-C3 H7 | H | 4-CH3 |
| 4-(t-C4H9) | i-C3H7 | H | 4-OCH3 |
| 3-Cl,4-F | i-OjH? | 4-F | 3,4-F |
| 4-CCF3 | ί-<3 Η7 | 4-F | 3,4-F |
| 2,3,4-F | i-OjH? | H | 4-F |
| 2,3,4-F | i-C3H7 | 4-F | 4-F |
| 3-(t-C4H9) | i-c3H7 | H | 4-F |
| 2-F,4-Br | ϊ-<3Η7 | H | 4-F |
| 2,4-F,3-Cl | i-C3H? | H | 4-F |
| 4-SCH3 | i_c3H7 | 4-F | H |
| 3-F,4-CH3 | i-C3H7 | 4-F | H |
| 3-F,4-CH3 | 1-C3H7 | 4-F | 4-F |
AP 0 0 0 1 5 o
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
| Phenyl Subst. | R2..... | r4 | Rs |
| 3-Cl,4-CH3 | 1-C3H7 | 4-F | H |
| 3-Cl,4-CH3 | i-C3 H7 | 4-F | 4-F |
| 3-CH3,4-Br | i-C3 H7 | 4-F | H |
| 3-CH3,4-Br | i-c3^7 | 4-F | 4-F |
| 4-C2H5 | i_c3H7 | 4-F | H |
| 4-C2H5 | 1-C3H7 | 4-F | 4-F |
| 3-SCH3 | ΐ-<:3Η7 | 4-F | H |
| 3,4-OCH3 | i-C3H7 | 4-F | 4-F |
| 3-CF3,4-Br | i-C3H7 | 4-F | 4-F |
| 4-CF3 | 1-C3H7 | H | 4-C1 |
| 3,4-(-OCH2O-) | i-C3H7 | 4-F | 4-C1 |
| 3,4-(-CCH2O-) | i_c3H7 | H | 4-(t-C4H9) |
| 3-Cl,4-OC2H5 | i-C3 H7 | H | H |
| 3-Cl,4-OC2H5 | i-c3H7 | 4-F | 4-C1 |
| 3-Cl,4-OC2H5 | i-C3 H7 | 4-F | H |
| 4-OC2H5 | i-c3H7 | H | H |
| 4-OC2H5 | i^3H7 | 4-F | 4-C1 |
| 4-OC2H5 | 1-C3H7 | 4-F | H |
| 3-Cl,4-I | i-C3H7 | H | 4-F |
| 3-F | i-C3H7 | 4-F | 4-C1 |
| 3,4-Cl | i-C3 H7 | 4-F | H |
| 3-Br,4-CF3 | i-C3H7 | 4-F | 4-C1 |
| 4-Br | i_c3H7 | 4-F | 4-C1 |
| 3-Br,4-F | 1-C3H7 | 4-F | 4-C1 |
| 3-Cl,4-Br | 1-C3H7 | H | 4-C1 |
| 3-Cl,4-Br | i-C3H7 | 4-F | 4-C1 |
| 3-Cl,4-Br | i-C3H7 | 4-F | 4-F |
| 3,4-Br | i-C3H7 | 4-F | 4-F |
| 3,4-Br | i-OjH? | 4-F | H |
| 3-Cl,4-I | i^3H7 | 4-F | 4-F |
| 3-Br | 1-C3H7 | 4-F | 4-C1 |
PR-7713/7874/7924/8029/8443A
TABLE 1 (continued)
| Phenyl Subst. | R? | R4 | Rs |
| 3-Br | 1-C3H7 | 4-F | H |
| 3-CF3,4-Cl | 1-C3H7 | 4-F | H |
| 3-1 | I-C3H7 | H | 4-C1 |
| 3-C1 | 1-C3H7 | 4-F | 4-C1 |
| 4-Cl | 1-C3H7 | 4-F | 4-0 |
| 4-CN | X-C3H7 | 4-F | 4-0 |
| 4-CN | I-C3H7 | H | 4-0 |
| 4-CN | i-C3H7 | 4-F | 4-F |
| 2,4-F,3-Cl | i-C3 H7 | 4-F | 4-0 |
| 3-CH3,4-F | i-C3fl7 | 4-F | 4-F |
| 3-CH3,4-F | i-C3H7 | H | 4-0 |
| 3-Br,4-F | i-C^? | H | 4-0 |
| 3-CH3,4-F | i-C3H7 | 4-F | 4-0 |
| 3-CH3,4-F | i-€3H7 | 4-F | H |
| 3-CH3 | i-C3 H7 | 4-F | 4-0 |
| 3-Cl,4-CH3 | i_c3H7 | H | 4-F |
| 3-Cl,4-CH3 | 1-C3H7 | H | 4-0 |
| 3-Cl,4-CH3 | I-C3H7 | 4-F | 4-0 |
| 3-CH3 | I-C3H7 | H | 4-F |
| 3,4-CH3 | 1-C3H7 | 4-F | 4-0 |
| 3-CH3,4-Br | I-C3H7 | 4-F | 4-0 |
| 3-Cl,4-OCH3 | 1-C3H7 | 4-F | 4-F |
| 3-Cl,4-OCH3 | i-C3H7 | 4-F | H |
| 3-Cl,4-OCH3 | i-c3H7 | 4-F | 4-0 |
| 2-C2H5 | X-C3H7 | H | 4-F |
| 4-OCH3 | i_c3H7 | 4-F | 4-0 |
| 3-1,4-F | i_c3H7 | H | 4-0 |
| 4-SC>2CH3 | X-C3H7 | 4-F | 4-F |
| 3-Cl,4-F | -C (CH3)=CH2 | 4-F | 4-C1 |
| 3-Cl,4-F | -C (CH3)=CH2 | 4-F | H |
| 3-Cl,4-F | -c (CH3)=CH2 | H | H |
AP 0 0 0 1 5 0
TABLE 1
PR-7713/7874/7924/8029/8443A
| Phenyl Subst. | (continued) | ||
| R2 | -*dL- | *5 | |
| 4-OCP2CHPCI | i-C3 H7 | H | H |
| 4-OCF2CHFCl | K3H7 | 4-F | H |
| 3-C1,4-OCH2CF3 | 1-C3H7 | H | 4-F |
| 3-Cl,4-OCH2CF3 | i-c3H7 | H | 4-C1 |
| 4-OCH2CF3 | i_<:3H7 | 4-F | H |
| 4-OCH2CF3 | i<3H7 | H | H |
| 3-Cl,4-OCH2CF3 | 1-C3H7 | 4-F | H |
| 3-C1,4-001^3 | 1-C3H7 | H | H |
| 3-OC2H5 | K3H7 | 4-F | 4-F |
| 2-Cl,4-CF3 | I-C3H7 | H | 4-F |
| 2-Cl,4-CF3 | i-C3H7 | 4-F | H |
| 3-F,4-OCH2CF3 | 1-C3H7 | H | Cl |
| 4-CF3 | -C (CH3)=CH2 | H | H |
| 4-CF3 | -C (CH3)=CH2 | 4-F | H |
| 4-CF3 | -C (CH3)=CH2 | 4-F | 4-C1 |
| 3-Br,4-CF3 | i-C3 H7 | 4-F | 4-C1 |
| 3-Br,4-CF3 | i_c3H7 | 4-F | H |
| 3-F,4-OCH3 | 1-C3H7 | 4-F | H |
| 3-OCF3 | 1-C3H7 | 4-F | 4-C1 |
| 3-OCF3 | i-C3H7 | 4-F | H |
| 3-Cl,4-C2H5 | 1-C3H7 | H | 4-F |
| 3-F,4-OC2H5 | 1-C3H7 | 4-F | H |
| 4—n-C3H7 | i^3H7 | 4-F | 4-F |
| 3-F,4-Cl | I-C3H7 | 4-F | 4-F |
| 4-CF3 | -C (CH3)=CH2 | H | 4-F |
| 4-CF3 | 4-F | H | |
| 4-CF3 | X] | 4-F | 4-C1 |
| Cnpd. No. | Phenyl Subst. | 37 TABLE 1 (continued) r2 | PR-7713/7874/7924/8029/8443A | |
| Rd | Rr | |||
| 445 | 2-ND2,4-CF3 | i-C3H7 | 4-F | H |
| 446 | 3-Br,4-OC2H5 | i_c3H7 | H | 4-F |
| 447 | 3-Cl,4-F | i-C3H7 | H | 4-1 |
| 448 | 3-Cl,4-F | 1-C3H7 | 4-C1 | 4-F |
| 449 | 3-1,4-F | i-c3H7 | H | 4-F |
| 450 | 3,4-(-OCF2O~) | i-C3H7 | H | 4-C1 |
| 451 | 2,4-F,3-Cl | i_c3H7 | 4-F | H |
| 452 | 3-OCH2CF3,4-Cl | i-c3H7 | 4-F | 4-C1 |
Q.
<
TABLE 2
PR-7713/7874/7924/8029/8443A r-i-n=c VxOR3 (Ri = unsubstituted or substituted phenyl)
Cnpd.
| NO. | Phenyl Subst. | R2 |
| 453 | 4-Cl | chci2 |
| 454 | 2,3-Cl | chci2 |
| 455 | 4-Cl | i-C3H7 |
| 456 | 4-F | i-C3H7 |
| 457 | 4-Cl | i-C3 H7 |
| 458 | 4-F | i-C3H7 |
| 459 | 3-CF3 | i_c3H7 |
| 460 | 3-Cl,4-F | i-C3H7 |
TABLE 2
PR-7713/7874/7924/8029/8443A (continued)
Phenyl Subst.
3-Cl,4-F
3-C1/4-F
3-Cl,4-F
3,4-(-0020-)
3,4-(-0020-)
3,4-(-0020-)
3.4- (-0020-)
3.4- [-OC(CH3)20-]
3-CF3
3-Cl,4-F i-<3H7
1-C3H7 i_c3H7 i-C3H7 i_c3H7
1-C3H7 i_c3H7 i_c3H7 i_c3H7 i_C3H7
-02^
-O
PR-7713/7874/7924/8029/8443Α
ΤΑΒΓ£ 2 (continued)
Phenyl Subst. R?
3-0,4-1 1-C3H7
3-0,4-F 1-^3^7
3-0,4-F 1-C3H7
3-0,4-F i-C3H7
3-0,4-F 1-C3H7
3-CF3 1-0387
3-CF3 1-C3H7
4-Br 1-C3H7
3-0-4-F 1-C3H7
3-CF3
I-C3H7
-CH2 i-OCH2CH=CH2
TABLE 2
PR-7713/7874/7924/8029/8443A (continued)
Phenyl Subst. R?
3.4- Cl i-C3H7
3- CF3 1-C3H7
3.4- (-OCH2O) 1-C3H7
4— Cl 1-C3H7
3.4- F 1-C3H7
2.4- F 1-C3H7
3-Cl,4-F i-C3H7
3-CF3 i-C3H7
3-CF 3 1-C3H7
3-Cl,4-F i-C3H7
1-C3H7
4-F
TABLE 2
PR-7713/7874/7924/8029/8443A (continued)
Phenyl Subst. R;
3-Cl,4-P 1-C3H7
3-CF3 i-C3H7
3-Cl,4-F 1-C3H7
3- CF3 i~C3 H7
4- (t-C4H9) i~C3 H7
4-(t-C4H9) X-C3H7
3-Cl,4-F 1-C3H7
3-CFj 1-C3H7
2.4- F,3-Cl i”C3 H7
3.4- (-OCH2O-) 1-C3H7
TABLE 2
PR-7713/7874/7924/8029/8443A (continued)
Cnpd.
No.
Phenyl Subst. R?
«a
502
3-Cl,4-F i-c3H7
503
3-CF3 i-C3H7
504
4-CF3
1-^7
505
3-Cl,4-F
1-C3H7
506
3-CF3
1-0311-7 —CH
ς v 0 0 0 dV
507
3-CF3
1-0311-7 -CH
508
3-CF3 i-C3H7
509
3-CF3 i_C3H7
510
3-01,4-F i-c3H7
PR-7713/7874/7924/8029/8443A
TABLE 2 (continued)
Cnpd.
No. Phenyl Subst.
J*2.
511 3-Cl,4-F i-C3 H7 *2
-CH
512 3-Cl,4-F i-C3 H7
513 3-CF3 i-c3H7
514 3,4-Cl i-C3H7
515 3,4-(-OCH2O-) i-C3 H7
516 3-Cl,4-F i-C3H7
517 3-CF3
1-C3H7
518 3-CF3
1-C3H7
519 3-CF3 i-€3H7
PR-7713/7874/7924/8029/8443A
TABLE 2 (continued)
Phenyl Subst.
3-Cl,4-F
2,4-F,3-Cl
2.4- F,3-Cl
3.4- Cl
3.4- F
3,4-F
3,4-F
3-Cl,4-F
3-CF3
3-Cl,4-F
1-C3H7 ΐ-^Η?
ΐ-03Η7 i-C3H7
C2H5 t-C4Hg
CH3 i_c3H7
I-C3H7 i_c3H7
F-γ ^F pL-V Λ-,ρ
-CH
-ch2
-CH
“CH-CH2
-CH
-ch2.
ί )
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A
TABLE 2 (continued)
Phenyl Subst. R?
4-CF3 I-C3H7
3-C1.4-F i_c3H7
3,4-(-0020-) 1-C3H7
3-Cl,4-F 1-C3H7
3- Cl,4-F 1-C3H7
4- CF3 I-C3H7
4-(t-C4H9) i-C3H7
3- Cl,4-F 1-C3H7
4- CCF3 1-C3H7
4-NO2 1-C3H7
1-C3H7
3,4-(-0020-)
PR-7713/7874/7924/8029/8443A
Cnpd.
No.
541
542
543
544
545
546
547
548
549
TABLE 2
| (continued) | ||
| Phenyl Subst. | R2 | R3 |
| 3-Cl,4-F | i-C3H7 | ^ΟρΓ*2© |
| 4-OCF3 | i-C3H7 | |
| 4-CF3 | ΐ-Ο3Η7 | ^2ΤρΡΐρ) Fp~PF |
| 4-(t-C4H9) | i-C3H7 | -^2-/0)-^20^3 F F |
| 3-CH3 | i-C3H7 |
OJ LOLci
| 3-CF3 | i“c3H7 | fL P -^2-/0/^2^ |
| 3,4-(0CH2O-) | i-C3H7 | F-. ^-—F -€H2-/0/-CH2CsCH |
| 3-CF3 | 1-C3H7 | -CH2-CgC-QH2-O^Q^> |
| 3-Cl,4-F | 1-C3H7 | -CH^ O'Px |
OJ TQ
PR-7713/7874/7924/8029/8443A
TABLE 2 (continued)
Cnpd.
No.
550
Phenyl Subst. R?
4-OCF3 i-C3H7
551
3-F,4-Br i-C3H7
552
4-C2H5 1-C3H-7
553
4-C1 i-<3H7
-CH
554
4-C1 i-c3H7
555
3-CF3,4-Cl i-C3H7 —CH
556
3.4-OCF2O
1-C3H7
557
3-Br i-€3H7
PR-7713/7874/7924/8029/8443A
TABLE 2 (continued)
Cnpd.
No.
Phenyl Subst. R?
558
3-Br,4-F
X-C3H7
559
3,4-F i-€3H7 *3.
560
4-CF3
-C (CH3)=CH2
0.
<
PR-7713/7874/7924/8029/8443A
Insecticidal Evaluation Tests
The conpounds in Tables 1 and 2 above were tested for insecticidal activity using the following testing procedures.
Housefly (HF) (Musca domestica):
Test conpounds were diluted in acetone and aliquots pipetted onto the bottom of aluminum dishes to provide 100^jg of the test conpound. To ensure even spreading of the chemical on the bottom of the dishes, 1 ml of acetone containing 0.01% peanut oil was also added to each dish. After all solvents had evaporated, the dishes were placed in circular cardboard cages containing 25 female houseflies, 1-2 days old. The cages were covered on the bottom with cellophane and on the top with tulle netting, and each contained a sugar-water saturated cotton plug for maintenance of the flies. Mortality was recorded after 48 hours.
Blade Bean Aphid (BBA) (Aphis fabae (Seep.)];
Nasturtium plants (Tropaeolum sp.) approximately 5 cm tall, were transplanted into sandy loam soil in small cups and infested with 25-50 black bean aphids of mixed ages. Twenty-four hours later they were sprayed to the point of runoff with 50-50 acetone-water solutions containing 0.05% of the test conpounds. Treated plants were held in the greenhouse and mortality was recorded after 48 hours.
Tobacco Budworm (Heliothis virescens (Fabricius)]:
(a) Contact; (IBW-C) Test conpounds were diluted to a concentration of 0.1% in a 50-50 acetonewater solution. Cotton (Gossypium sp.) cotyledons were immersed in the test solutions for 2-3 seconds and placed on a wire screen to dry. The dried leaves were placed in petri dishes containing a moistened piece of filter paper and infested with 5 seoond-instar tobacco budworm larvae. The dishes were placed in a high humidity chamber for 5 days, and percent mortality of the larvae recorded.
PR-7713/7874/7924/8029/8443A (b). Eggs: (TBW-E) Paper towel patches of 2-day old eggs of the tobacco budworm were dipped in acetone solutions containing 0.1% of the test oonpound and placed in petri dishes containing a portion of larval rearing medium. Treated eggs were maintained at 78’F and mortality was recorded after all control eggs had hatched and the young larvae were feeding on the media.
Cabbage Looper (CL) (Trichoplusia ni (Hubner)]:
Test compounds were diluted to a concentration of 0.1% in a
50-50 acetone-water solution. Cotyledons of hyzini squash (Calabacita abobrinha), approximately 1 x 1.5 inches, were immersed in the test solutions for 2-3 seconds and placed on a wire screen to dry. The dried leaves were placed in petri dishes containing a moistened piece of filter paper and infested with 5 second-instar cabbage looper larvae. The dishes were placed in a high humidity chamber. Mortality of the larvae was recorded 3-5 days later.
Beet Arnyworm (BAW) (Spodoptera ex igua):
Test compounds were diluted to a concentration of 0.1% in a
50-50 acetone-water solution. Young leaves of sugar beets (Beta vulgaris) were immersed in the test solutions for 2-3 seconds and placed on a wire screen to dry. The dried leaves were placed in petri dishes containing a moistened filter paper and infested with five second-instar beet arnyworm larvae. The dishes were placed in a high humidity diamber. Mortality of the larvae was recorded 3-5 days later.
Aster Leafhopper (LH) [Macrosteles fascifrens (Stal)]
Oat seedlings (Avena sp) were grown in a commercial potting soil in cups. When the plants were approximately 10 cm tall they were thinned to three plants per cup and dipped for 2-3 seconds in 50-50 acetone-water solutions of the test compounds. When the plants had dried, a clear plastic tube was placed over them and the bottom end pressed into the cup.
Ten aster leafhopper adults/nynphs were then placed in each tube and the tops of the tubes covered with white organdy cloth. Mortality counts were made after 48 hours.
AP 0 0 0 1 5 o
PR-7713/7874/7924/8029/8443A
Maize weevil (MW) [Sitophilus Zeamais (Motschulsky)l:
Test conpounds were diluted to a concentration of 0.01% in a 50:50 acetone:water solution. Pour com seeds [Zea mays (L.)] which had been immersed in test solutions for 2-3 seconds and allowed to dry were placed in containers together with 10 adult weevils. The containers were covered and kept at a tenperature of about 25*C. Mortality was recorded after 48 hours.
Rice water weevil (FWW) (Lissorhoptrus oryzophilus (Kuschel)]:
Test conpounds were diluted in acetone. Droplets (1 ul) of test solutions were applied to the ventral abdomens of ten female adult weevils such that 2.5 >»g of test compound was applied to each weevil. The treated weevils were placed in containers with wet cotton balls and rice foliage. The containers were covered and kept at a tenperature of about
25*C. Mortality was recorded after 48 hours.
The results of these tests are shown in Table 3. Symbols in that table are as follows:
+= 50% or grater mortality at the testing level
- » less than 50% mortality at the testing level
NT test not conducted
PR-7713/7874/7924/8029/8443A n n u u π £ ι £ ι ι S ι
I + I I I I + Z +
Isi+S+lS^+lS kJ u
+ + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (Ι£5ω) bu
X *>
+ 1 I+ + +I + I I I I + + + + + δ s δ + δ I + I + I + I + + + 1+ + + + + + + I + + I + + + ++1 + + + + + + + + + + I + 1 I + I + + I 1+ + (Ncn^invot—oooio (ΝΓΟ^ΤίηνΟΟ'ΟΟσιΟ.-ΟΙ r-r-^-r-F-r-^-^-OJOJCN
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A ggg SSS g m m g m m δ I + δ δ § δ g 1 g g g + δ . δ + δ δ δ δ •J
CJ + + + + + + + + + + + + + + + + + + +
TABLE 3 (I£sn) +δδδδδ+δ++++δδδδδδδ ι + +t I I I + I 1 + 1 Ι + Ι+ +Ι++Ι δδδδδδ++++++δδ+δδδ+ + + ι δ δ δ + ι + + + ι δ δ δ δ δ δ + + + I I I I + I Ι++Ι+ + + +Ι+ + +
ΓΟ^ιηχοΓ-'Οοσ*©·— ίΝΓΩ^·ιη\θΓ*αο<τιθ»— cm CMCMCMCMCMtNfMmmcnpocococommn·^^·^·
PR-7713/7874/7924/8029/8443A δ h s . n u
S δ S S S I SSSSSSSSS +
S ι + + S i i + + S + + S + SS + + + + + + + + + + + + +
IO
TABLE 3 (LCsn)
SS + + + SSSS + + + + SSSSS o
Q.
<
+ + + + +1 I I + I + + + I + + I + s++s+sss+++++s§^^+ co + + + + + i + + + + + + + + + + SS + + + +1 I+ + + + +I + 1+ + + fo^finvor-coCTiO»— csco'^'invor-coo'o ^•^•^•^•^•^•^•ιηΐΛΐηιηΐΛΐΛΐηιηιηιΛκο
PR-7713/7874/7924/8029/8443A
I I I I
S S S I <: iS £ t £ £ £ £ I £ £ £ +
I I + I Ι+ + +Ι I + I
J υ
+ + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn)
CQ
Cb
X ω
S δ υ
+ + + I +
+ + + + ι + + + ι + + ι + + + + + | + + + +++++δέ§δδ+δ+++δ+δδ++ + + + + I + + + I + + | + + + + + + + + + + + + +Ι+ + + Ι++Ι++ + + +Ι+ + +
T-fMn’rinvor^oooor-fNn^rinvor'aoo'O’— ^'ί'Ό'Όΐΐίΐ^'ΰΓ'Γ'Γ'Γ'Γ'Γ'Γ'Γ'Γ'Γ'®®
PR-7713/7874/7924/8029/8443A
3+
I δ S δ I
-2 !s x? I I + + I δ + έ§§ + + + I S δ δ I δ + υ
+ + + + + + + + ι + + + + + + + + + + +
TABLE 3 (I£sn)
α.
<
ω + 1 + 1 Ι + Ι+ +Ι I Ι+ + + + +Ι I I
CQ + + + + + + Ι+ + +Ι+ + + + +Ι I 1 +
Cl,
Ι+ + + +Ι + Ι+ Ι+ + + + +Ι Ι+ + c\if>*rmx©r~ooat©«— (ΝΜ^ιΓ'ΰΓ'Οοσ' ®οοοοοοοοοοοοοοσ>σισλσ»σ\σ>©σισ\σ>
100
PR-7713/7874/7924/8029/8443A ggggggggggg,ggggg ggggggggggiggg, , g gggggigggtgggg + g kJ u
+ + + + + + + + + + + + + + + + +
TABLE 3 (LC\n) ggggggggggggggggg
Ed
I I I I I I I I I I I ggggggggggggggggg s
co
Cb
X + + έ δ ι δ
I I I I I 1 + 1 + ( 1+ + + + + + (Nrn'rin'iir'oooto
OOOOOOOO»•-{Nm^rinvot^co
PR-7713/7874/7924/8029/8443A
I I
J υ
+ + δ
I Ζ I I
S δ + + § + I £ £ I § + I £ + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn) π + π η u π η ω
+ +Ι + Ι Ι + Ι+ +Ι I I I + I Ι+ + + +
ΑΡ 0 0 0 1 5 0
<*
1+^1^1+^ + + + + + + + 1 I + + + +
S + + I + I + + I + + I Ι+ + +Ι I + + + +
00.-0/0^0101^0000.-040^010(^0001 ^-(ΝΟΙ010Ι(ΜΟΙΟΙΟΙΟΙ(ΝΟΟΟΟΟΟΟΟΟΟ
PR-7713/7874/7924/8029/8443A
Η Η δ H S H δ δ I I l-S I I g δ g
Hfi δ δ i + + i δ δ § δ δ i s + i i . δ δ + + + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCSn) δ δ δ δ , δ δ δ δ δ δ δ δ δ δ δ δ δ δ δ δ
I Ι+ + +Ι I I++I I I+ + + +I+ + + i δδδ+++++δδδδδδδδδδδ
CD
OP + + + + + I + + + + + + + + + + + + + + +
I + + + + 1+ + + + + + I 1+ + + + + + +
Ο’-ίΝη^'ΐη^οι^οοσιο^-ίΜη^'ΐηκοΓ-οοσιο
PR-7713/7874/7924/8029/8443A δδ I + +
OP + I I /?
+ + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn)
QQ gggggggggggg . + g + ggg +
IIIIIIII + III + III +
Π . n + m + + I I I I + I I + £: £s i t +
AP 0 0 0 1 5 + 1 I I l + l I + + + + + + I + + + + + «-{ΝΟτΤίηνΟΟ-ΟΟΟιΟ·— 040^1/700-0000 νΟΌΟνΟνΟΌΟΟνΟΡ-Ο'Γ'-Ο'Γ'Ο'Ο-Ο-Ο'Γ'ΟΟ
PR-7713/7874/7924/8029/8443A . ggggggggg . g g g g gggg|ggig + g <x>
(M>
J u
ggggg| + l+ glg + + g + + + + + + + + + + + + + + +
TABLE 3 (ΙΓςη)
+ + +I + I I I+ + + +I +
g g + g g + g + + + + + I + + + + + + + + I «— (Νη^ιηνοΓ^αοσΟ’-Γ'ίΓο^νη αοοοοοοοοοοοαοοοοοσσσσσσ g g I
I g +
I g + + + + g g g
I + I + g g g g g +
Ό σ>
197
PR-7713/7874/7924/8029/8443A u u u u η . η δ δ ι ι ι δ δ δ δ ι ι δδδδδ++δ
OP δδδ+δδδδδδ+δδδδδδ+ ι δ δ + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LC50) <Μ>
δδδδ^δδδδδδδδδδδδ^δδδ
Ι + Ι 1 + 1 I I I Ι++Ι + Ι + Ι+ + + +
APO 0 0 15 0 + δδ + δ + δδδδ + -«·δδδδδ + δ
CQ δδδ++δ++δ+++++++
Eb
X + + + + + I + + Ι+ + + + + I + + + + σ\ ο -- (ΝΜ^ιη^Γ^οοσίΟ — (νπ^ιπόγ'ΧΦ (ΤιΟΟΟΟΟΟΟΟΟΟ·— 1— ,-ΝΝΝίΝΝΝ(ΝΝ<ΝΝ<Ν<ΝΝίΝΝΝΝ<ΝΝ<Ν
PR-7713/7874/7924/8029/8443A
+ + I I +
5: £ £ £ 2 I + S l£££££ + ££g I +
TABLE 3 (ΙΓςη)
J u
+ + + + + + + + + + + + + + + + + + + + + δ Η §§ Η S Η Η δ ω
I I Ι++Ι I + I Ι++Ι+ + + + + υ
<1 co + + + + + + + + + + + + I + + + + + + + +
b.
X + + + +1 Ι++Ι++Ι Ι++Ι+ + + + +
00’-<Nn<,m'X>f^ooo>0’-CNrO'i,invor'«o\o
ZtN<N(NfMCir«j<N<NCNiNm<nfnf9co<ncoronnTr (NN(NiN(N(N(N(NNfMN(N(N(N(N(NM(N<N(MfM
PR-7713/7874/7924/8029/8443A + ι ££££££££ i <s S §
g + i i i j
u + + + + + + + + + + + + + + + + +
TABLE 3 (UC5n)
Cb
X ω
5) s
I + I I I + + + + I + + + I I g + + Η gg + S + + + + + I + + + + + + + + + +
1+ + + + + I + + + + + + + + I I
| e— | CN | co | m | CO | Γ | CO | C3C | O | r— | CN | cn | N | in | Ό | Γ | |
| Ν' | ** | M· | N | N | N | N· | in | in | in | in | in | in | m | in | ||
| CM | CN | CM | CM | CM | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN |
ir>
o o
Q.
<
258
PR-7713/7874/7924/8029/8443A
I £ I I Is S § δ + δ I Ii I: Ι: I I? I?
+ + + I I I I: + !ϊ Is dP + + + + ι δ + δ δ + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn)
+ 1 + 1 I Ι+ + + + +Ι + Ι + Ι + + + + + ι I + I δ gi
CQ
Gu,
X + + + +Ι I I 1 + 1 I I I 1 + + + + +Ι Ι+ + + + + + +Ι + Ι +
| σι | ο | Γ>1 | η | ιη | Ό | Γ- | 00 | σ | ο | r- | <Ν | C7 | ιη | |||
| ιη | ΙΟ | νθ | Ό | ιο | ΙΟ | ιο | ΙΟ | \Ο | Ό | ιο | Γ» | Γ' | Γ' | Γ» | Γ | Γ' |
| CN | <Ν | <\| | <Ν | ΓΊ | <Ν | (Ν | <Ν | <Ν | <Ν | <Ν | <Ν | <Ν | (Μ | ηι | <Ν | <Ν |
δ + + δ δ I + I δ + + + + + + + δ + + + + + + +
Is + + + δ + + + + + + + ιο η» ίΝ
277
PR-7713/7874/7924/8029/8443A δ ι + + + ι + § ι § + ^ + +1+ + +^^1^^1 I I+S + +I + + + + ι £ + + + + £ + dp d
+ + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn) ω
+ + +§ + +! ι + ι ι + I 1+ + + + + +
S + + + + + + §δδ^δδδ + + + + 2 +
AP 0 0 0 1 5 0 δ + δδ + δ + δ^ + έ^δ ι δ + + δδδ +
X §3 i
I+ + + + + +I l + l I + + I + + + + + +
| o | CN | m | N | in | IO | γ- | 00 | σ | O | CN | m | Ν' | in | 10 | Γ- | 00 | σ | o | ||
| 00 | 00 | 00 | oo | 00 | 00 | oo | οο | 00 | 00 | σ | σ | σ | σ | σ | σ | σ | σ | σ | σ | o |
| CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | CN | m |
PR-7713/7874/7924/8029/8443A m m m , m * m
SiSi iSSSSSSS gSS + SSSSSSSSS^S i i + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn)
Cd m m m m n m
I I I I I + + I + + + I + + I 1 + sssssssssssssssss
I td m m m + m &
I + + I I + I + I
| Ι- | CM | CO | in | VO | r* | 00 | <J1 | o | 1— | <N | on | ’’T | in | VO | r-* | |
| Ο | o | o | o | o | O | o | o | o | r- | »— | r™ | Γ- | ||||
| co | co | co | co | co | co | co | co | co | co | on | CO | on | CO | on | co | η |
s s s s s s s s s s s s + + + + s s s s
I I I I s s s s s s s s + + I I
ΓΌ
319
PR-7713/7874/7924/8029/8443A
S + + I S S S § + I S S I + + + δ S δ δ + δδδδδδ + δδι ι ι + + + ι +
H0 δ + δ δ δ δ δ δ + δ δ δ δ δ δ δ δ δ δ δ + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (ΙΓ5η) dP δ + + + + δδδδ + + ι δ ι + + δ δ δ δ
I + + + + I I I + + + + + + + + + I + + + ο
ιη
α.
++++δδδ++++δ++++δδδδ £§
CQ dP
I + + I I I I + I 1+ + + + + + + + + +
Ct,
X
I 1+ + I 1+ + + + + + + + + + I + +
| CM | co | in | i£> | r— | 00 | σι | o | T— | CM | ro | *r | in | 10 | Γ- | OO | σ | |
| CM | CM | (N | cm | CM | CM | CM | CM | co | co | CO | co | co | co | co | ΟΟ | co | co |
| co | co | co | co | co | co | co | co | co | co | CO | co | co | co | co | co | co | co |
340
ΊΟ PR-7713/7874/7924/8029/8443A hmm,gggggggggggggg
IIIIIIIII + I+ +I + IIIIII + + I + I+ + + + + + + +I , + + +1+ + + + + +1 I I I I 1 I + + I I
TABLE 3 (I£sn) δ is ι +
llllllllll + l + ll + l + l + δζ + + + + δδ + δδδδδδδδδ§§
I
CQ + + + + + +1 1+ + + + + + + + + + + + +
Cl4
X + I I + + + + I + + + + + + + + + + + + + rn-vmtor'oooio'— (ΝΓΊ^τιηνοΓ'ΟοσιΟ’— ^•^•^•^^•^«•ίΐηΐΛΐηΐΛΐηιηΐΛΐηιηιηκοκο mcororofofofocororomrororofoponmro
362
PR-7713/7874/7924/8029/8443A δ δ S δ I I S δ δ δ I + I I δ I I I δ δ
I I I I I I I I I I I I + I I I I I I I I + + + ι
J o
+ + + + + + + +1 I + I+ + + +I+ + +I
TABLE 3 (LCsn) δδ g g g Η Η H ω
+ + +1 + ( + 1 I I+ + +I++I+ + + +
ID
CL <
+ + + I + + + + + + + + + + + + + + + + +
b.
X + I + I + I+ +I+ + + + + + +I+ + + +
| •*r | in | vo | Γ·' | 00 | σν | o | r— | <N | co | *r | m | vo | Γ | 00 | ov | o | T— | C*J | co | 'J· |
| VO | vo | vo | vo | VO | vo | r* | Γ* | r* | r* | r* | I-' | Γ | I | η» | 00 | 00 | 00 | 00 | 00 | |
| co | co | co | co | co | CO | co | co | CO | co | co | co | co | co | co | co | co | co | co | co | co |
PR-7713/7874/7924/8029/8443A i ι is ι
I I I I I I I I I I + I I I I I I I I I I
kJ u
·+ + + + + + + + + + + + + + + + I I I I
TABLE 3 (LCsn) ω
o
I + I 1+ + + 1+ + + + + + + + I I + I
Π δ Η Η δ δ Η δ Η δ H <*>
1+ + + + + + + 1+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
| in | so | r~ | 00 | OS | O | r— | CM | CQ | in | so | 00 | OS | O | r— | CM | ro | <r | ||
| 00 | co | 00 | CO | CO | OS | OS | Os | OS | Os | os | os | os | os | OS | O | o | O | © | o |
| CQ | PQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | CQ | ΊΤ | XT | *3· | ^31 |
405
PR-7713/7874/7924/8029/8443A is;ggggggggggggggggggggg
I I I I I I I I I I I I I I I I I I I I I gggggggggggggggggggggg
I I l + l I I + + + + + I 1+ + + + + + +
TABLE 3 (LCsn)
Η Η Π H _ + + + +1 I I + I+ + +I I+ + +I + I I
1.
<
g Η Η H gg Η Π δ H S do
Cl.
X + + + + +I + I I+ + +I l + l I 1+ + + + I+ + + + + + + + + +I I I l + l I I νοΓ^βσίο.-οΐίη'τιηκοΓ^οοσ'Ο.-ίΝΓ'Ί’ΐΓ OOOO«- .- f\| fN {N CN <N * *
425 r
PR-7713/7874/7924/8029/8443A
PR-7713/7874/7924/8029/8443A h U S 5 - g . S S s S S i U 5 i s s s
I I + + I + + I I ggggggggggggggggggggg
J
Q + + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn)
Cb
X ggggggggggggggggggggg
I I+ + + + +I+ + + +I+ + + + +I + I ggggg+ggggggggggggggg + + + + + + + + + + + + + + + + + + + +
I I I+ + + + + + + +I I 1+ + +( + ( + (''ΟΟσιΟ’-ΠΓΠ^ί'ίΛνΟΓ'ΟΟβ'Ο’— CNd^J·
445
PR-7713/7874/7924/8029/8443A
g+ + + + ggg I g g I I + I + g g + g g ξδδδ+δδδδ. ( g g j
cj + + + + + + + + + + + + + + + + + + + +
TABLE 3 (LCsn) δδ+δδδδδδδδδδ+δ+δδδδδ + + +Ι+2Ι I I I I + I+ + +I + I + δδ++δδδδδδδδδδ+δδδδδδ
AP 0 0 0 1 5 + + I I + + I I I + + + g g g δ +
Cl.
X + + +( I I I I l + l I+ + +I+ + + + x^Or-nnvtn'cr'tcuiOr-NnvinvDr'O *4* *4* ^4* *4* ^4· <4· *4* <4· *4* ^J· *4* *4*
PR-7713/7874/7924/8029/8443A h n s u s; m u u s ·; s δ δ I ι δ + I I δ I I δ <#>
J u
§§ H I H g . g + + + + + + + + + + + + + + + +
TABLE 3 (ΙΙ\η) ω
Cb
X ξ
ι + ι ι ι ι ι ι ι ι ι + »
Η H H H g Π S
I I + + + + δ § I δ 2 δ ι S + I I + + + I 1+ + + ^O’-p'im'i'mvor'-ooaiO.-cMM’a· \ΟΓ'Γ·'Γ*Γ'Γ'·Γ'·Γ*Γ^(''Γ*®®®®®
S I S δ S δ δ δ δ δ
I I + + +
I I I I I δ g δ δ £ s £ δ § δ + + I I I ιη «
ΊΤ
486
PR-7713/7874/7924/8029/8443A h s g s s § s s e § e e h g δ i δδδδδδδδδδ » +
OP δδδδδδδδδδδδδδδδδδ +++++++++++δ+ +++++++
TABLE 3 (LCsn) δδδδδδδδδ+δδδδδδδδδ i + + + i + I I i i + o
a.
<
δδδδδδδδδδ+δδδδδδδδδδ §5 tb
X δ + + + + + δ
I+ + + +I I I + + + + + + + + + + I + +
| o | r— | CM | <*> | •*r | in | Ό | r* | 00 | σι | Ο | Τ- | ΓΜ | m | ιη | Ό | Γ'· | οο | σ | ο | |
| σ | σ | σ | σ | σ | σ* | σι | σι | σι | σ | Ο | Ο | ο | ο | ο | ο | ο | ο | ο | ο | τ— |
| ««r | *1· | ’Φ | μ· | Ό· | ιη | ιη | ιη | ιη | ιη | ιη | ιη | m | ιη | ιη | m |
PR-7713/7874/7924/8029/8443A h s s s s i U t . S S S 2 ϊ 5 g S
I I I I I I I I I I I I I I I I I I I I I df>
IIIIIIII+ + +IIIIIII + I + + + + + + +I + I + I + I+ +I + I
TABLE 3 (t£Sn) <*>
Ed
S 5 5 5 U S 5 5 U U U S 5 S 5 U
IIIIII + IIIIIIIII + II + ggsgggggs++s+gggggg+ + II + IIIII+ + + +III + II + I fc.
X + + + I + I + I + + + + + + I + + + + + +
| T— | CN | m | in | Ό | r~ | co | σ | o | <— | CN | co | N· | in | vo | Γ' | co | |
| »·— | T·» | «- | r™· | CN | CN | CN | CN | CN | CN | CN | CN | CN | |||||
| in | in | in | in | in | in | in | in | m | in | in | in | in | in | in | in | in | in |
529
PR-7713/7874/7924/8029/8443A
I I I I I I I I I I I I I I + I I I I dP
I I I I I I I I
I + I I + + I I Is kJ u
+ I + I + I I I + + I + I I + + + I +
TABLE 3 (ΙΓ5η) ω
m m m £ m m m
I I I
I I I I I I I I I I + I I I
AP 0 0 0 1 5 0 £ m m m m m m
QQ t,
X
I I l + l I I I + I+ + + + +I 1 +
I + I + I+ + +I + I + I+ + +I+ + is
| OI | 07 | m | IO | O' | 00 | σ* | o | 04 | 07 | •*r | in | IO | O' | 00 | σ> | o | ||
| 07 | 07 | oi | 07 | 07 | 07 | 07 | 07 | XJ> | in | |||||||||
| U7 | in | in | in | in | in | in | in | in | in | m « | in | in | m | in | in | in | in | in |
PR-7713/7874/7924/8O29/8443A
η £
£
I
j o
+ + + + + + + + + +
TABLE 3 (LCsn)
Cd υ
Cu
X
Η δδ Π + I + + I + I |+ +
+ + + + + + + + + + + 1 + 1 + + + + + +
| T— | <N | m | in | iC | r* | 00 | σ> | © | |
| in | in | in | in | m | in | in | in | m | © |
| in | m | in | m | in | in | in | in | in | 1C |
PR-7713/7874/7924/8029/8443A
The conpounds in Tables 1 and 2 were also tested for activity against the two-spotted mite (Tetranychus urticae (Koch)] and Western spotted cucumber beetle larvae [Diabrotica undecinpunctata undecinpunctata (Mannerheim)]. Initial testing levels were 0.05% (in solution) against the mite, and 25 ppm (in soil) against the beetle. Some conpounds demonstrated 50% or more mortality against one or the other insect at the initial testing level, but most did not.
Other conpounds within the scope of this invention which have been prepared and have shown 50% or greater mortality against at least one insect in tests as described above are listed below. Most of these compounds are analogous to a conpound in Table 1 or 2, that is, they have the same groups indicated for R2 and R3 (or R4 and R=5 of Table 1), differing only in having different substituents on the phenyl ring from the indicated compound. These were:
Analogous to conpound 81 in which the substituents on the phenyl ring are: 3-Cl,4-Br; 3-CF3,4-Br; 4-SO2CH3; 2-Cl,4-CF3;
3-F,4-OCH2CF3; 3-OCH3,4-Br; 3-Br,4-OCH3; 3-F,4-OCH3; 3-Cl,4-C2H5;
2- Cl,5-C2H5; 3-F,4-OC2H5; 4-n-C3H7; 2,3,4-F; 3-Cl,4-OC2H5; 3-OC2H5,4-Br;
3- Br,4-OC2H5; 3-OCH3,4-Cl; 3-OCH3,4-CF3; 3-OC2H5,4-Cl; 2-NO2,4-CF3;
3-F,4-1; 3-Cl,4-OCHF2; 3-Bt,4-C2H5; and 2,3-F;
Analogous to conpound 82 in which the substituents on the phenyl ring are: 4-CH3; 4-OCH3; 2,3-013; 2,4-013; 3,4-Ol3; 3,4-0013; 3-C2H5; 3-013; 3-C1; 4-Br; 3-CF3,4-Br; 4-1; 3-F; 3-Cl,4-Br; 3-Cl,4-I; 3-1; 4-CN; 3-OCH3; 4-SO2CH3; 3-OC2H5; 3-0013,4-Br; 3-Br,4-OCH3; 3-Cl,4-C2H5; 3-OCH3,4-Cl; 3-OCH3,4-CF3; 3-OCH3,4-Br; 3-F,4-Cl; 3-Br,4-OC2H5;
3- Cl,4-OCHF2; 3-F,4-I and 2,3-F;
Analogous to compound 89 in which the substituents on the phenyl ring are: 4-OCF3; 3-Cl,4-Br; 3-F,4-Br; 3-NO2,4-F; 3-CF3; 3-F,4-CH3;
2-Cl,5-F; 2,5-F; 3-CF3,4-NO2; 4-t-C4H9; 3-CF3,4-Br; 2-Br,4-t-C4H9;
2- Br,4-i-C3H7; 3,5-CH3; 3-CH3; 2,4-CH3; 3,4-Ol3; 3-CH3,4-Br; 2,3-CH3;
4- OCH3; 4-SCH3; 3,4-OCH3; 3-OC2H5; 3-OCH3,4-Br; 4-OC2H5; 4-Cl,4-OC2H5;
3- Br,4-OCH3; 3-F,4-OCH3; 3-OCF3; 2-Cl,5-OC2H5; 3-F,4-OC2H5; 4-n-C3H7;
3-OCH3,4-Cl; 3-CCH3,4-CF3; 3-OC2H5,4-Cl; 3-OCH3,4-Br; 3-Br,4-OC2H5;
3-Cl,4-OCHF2; 3-F,4-1; and 3-Br,4-C2H5;
PR-7713/7874/7924/8029/8443A
Analogous to conpound 191 in vhich the substituents on the phenyl ring are: 4-F; 2,3,4-F and 2,4-F,3-Cl;
Analogous to conpound 216 in which the substituents on the phenyl ring are: 3,4-(-OCH2O-); 3-Br; 4-C1; 4-F; 4-CH3; 2,4-CH3; 4-OCH3;
2.3- CH3; 3,4-CH3; 3-C2H5; 3-SCH3; 3-CH3; 3-Cl,4-I; 3-OCH3; 4-SCH3;
2- Cl,4-CF3; 3-OCH3,4-Br; 3-F,4-OCH3; 3-Br,4-OCH3; 3-OCF3; 3-Cl,4-€2H5;
3- F,4-OC2H5; 3-OCH3,4-Cl; 3-CF3,4-€CH3; 3-CC2H5,4-Cl; 3-OC2H5,4-Br;
3-Br,4-OC2H5; 3-F,4-1 and 3-Br,4-C2 H5?
Analogous to conpound 238 in which the substituents on the phenyl ring are: 3-CF3; 3-F; 3-1; 3-F,4-CF3; and 4-Br;
Analogous to conpound 239 in which the substituents on the phenyl ring are: 3-CF3; 3,4-F; 3-CCH3; 3-CH3; 4-OC2H5; 2-Cl; 2-CH3;
3- NO2,4-F; 3-4-C1; 3-F,4-CF3; 4-t-C4H9; 3-C1; 3-F; 3-CF3,4-Br; 4-Br; 4-1;
4- C2H5; 3-F,4-Br; 3,4-Br; 3-CF3,4-Cl; 4-OCF3; 3-SCH3; 4-F; 2,4-CH3; 4-CH3;
3.4- CH3; 3-CH3,4-Br; 3-Cl,4-OCH3; 2,3-CH3; 4-OCH3; 4-SCH3; 3-Cl,4-OCH2 CF3; 2-Cl,4-CF3; 3-OCH3,4-Br; 3-Br,4-OCH3; 3-OCF3; 3-Cl,4-C2H5;
3-F,4-OC2H5; 2,3,4-F; 3-F,4-CH3; 3-CF3,4-OCH3; 3-OC2H5,4-Cl; 3-OC2H5,4-Br;
3-Br,4-CC2H5; 3-Cl,4-OCHF2; 3-F, 4-1 and 3-Br,4-C2H5;
Analogous to conpound 267 in which the substituents on the phenyl ring are: 4-1; 4-C2H5; 3,4-Br, 3-Cl,4-I; 3-1; 3-SCH3; 2,4-CH3;
2- C2H5; 3-OCH3; 4-SO2CH3; 2-Cl,4-CF3; 3,4-OCH3; 3-OC2H5; 3-OCH3,4-Br;
3- Br,4-OCH3; 3-F,4-OCH3; 4-001^3,- 3-Cl,4-CCH3; 3-F,4-CH3; 3-OCH3,4-Cl;
3-CF3,4-OCH3; 3-OC2H5,4-Cl; 3-OC2H5,4-Br; 3-F,4-Cl; 2-NO2,4-CF3;
3-Br,4-OC2H5; 3-F,4-1; 3-Br,4-C2H5 and 2,3-F;
Analogous to conpound 274 in which the substituents on the phenyl ring are 3-Cl,4-F;
Analogous to conpound 447 in which the substituent on the phenyl ring is 4-1;
Analogous to conpound 461, in which the substituent on the phenyl ring is 4-CF3;
PR-7713/7874/7924/8029/8443A
Analogous to conpound 462 in which the substituents on the phenyl ring are: 3-Cl,4-OCHF2; 3-Cl,4-CH3; 2,3-013; 3-CF3,4-Br;
3.4- (-00120-); 3-N02; 2-C1; 2-Ol3; 3-CF3,4-F; 3-P,4-Ol3; 3-Cl,4-OCH3;
3.4- OCH3; 4-Br; 4-CF3; 2,4-F,3-Cl; 4-01; 3-F,4-Br; 4-C2H5; 3-013,4-F;
3-Br; 4-1; 2-Cl,4-CF3; 3,4-F; 3-C1; 3-C2H5; 4-F; 4-Ol3; 3-CH3; 3-OCH3;
3-01,4-001; 3-F; 4-001^3; 4-OC2H5; 3,4-OC2H5; 3,4-ai3; 3-01,4-1; 2,4-Cl and 3,4-Cl;
Analogous to conpound 510 in which the substituent on the phenyl 10 ring is 3-Cl,4-F;
Analogous to conpound 516 in which the substituents on the phenyl ring are 3,4-(-00120-) and 2,4-F,3-Cl;
Analogous to conpound 517 in which the substituent on the phenyl ring is 3,4-(-00120-);
Analogous to conpound 518 in which the substituents on the phenyl ring are 2,4-F,3-Cl;
ir>
Analogous to conpound 520 in which the substituent on the phenyl ring is 3-CF3;
And the conpounds shown below in Table 4.
TABLE 4
PR-7713/7874/7924/8029/8443A
Phenyl Subst. R?_ R4
| 3-Cl,4-F | CHC12 | H | 4-F |
| 4-1-C3H7 | sec.-C4H9 | H | 4-F |
| 4-I-C3H7 | c2h5 | H | H |
| 4-1-^3117 | CHBrCH3 | H | 4-F |
| 4-i-C3H7 | CHBrCH3 | H | H |
| 4-CF3 | -C (CH3)=CH2 | 4-F | 4-F |
| 4-F | -C (CH3)=CH2 | H | H |
| 4-F | -C iCH3)=CH2 | 4-F | 4-C1 |
| 4-F | -C (CH3)=CH2 | 4-F | H |
| 3,4-F | —CJ (CH3)=CH2 | H | H |
| 3,4-F | -C (CH3)=CH2 | 4-F | 4-C1 |
| 3,4-F | -C (CH3)=CH2 | 4-F | H |
| 3,4-( -OCH2O-) | -C (CH3)=CH2 | H | H |
| 3,4-(-OCH2O-) | -C (CH3)-CH2 | 4-F | 4-C1 |
| 3,4-(-OCH2O-) | -c (CH3)=CH2 | 4-F | H |
| 4-OCF3 | -C (CH3)<H2 | H | H |
| 4-OCF3 | -C (CH3)=CH2 | 4-F | 4-C1 |
| 4-OCF3 | -C (CH3)=CH2 | 4-F | H |
PR-7713/7874/7924/8029/8443A
For information, the following Table 5 lists a very small number of compounds within the definition of the class of this invention which did not produce 50% or greater mortality in an insecticidal evaluation test to date.
TABLE 5
J2
R]-N=C-QR3
Phenyl Subst. _R2
4-C1 CHC12 r3
F^_ F
4-OCF3 CHC1CH2CH2C1
-CHo OX
Wig
2,3-Cl 1-C3H7
H C(CH3)2CH2C1
3,5-CF3 i-<3H7
3-C1 i-C3H7
3,5-Cl i-C3H7
2.4- Cl i-C3H7
3.4- Cl i-C3H7
Phenyl Subst.
3—Cl t—C^Hg
PR-7713/7874/7924/8029/8443A
Table 5 - continued *2
3,4-CCH3 I-C3H7
4-0 -CH=C(CH3)2
The insecticidal activity, and therefore the inclusion of a canpound not mentioned specifically herein within the class of compounds of this invention, as determined by the general formula (I), may be determined by evaluating such a compound using one or more of the above-described procedures. If a test oonpound demonstrates activity against one or more of the insects mentioned, by virtue of causing 50 percent or greater mortality at the initial evaluation level, it is considered insecticidal for the purposes of this invention.
In practice, a pure compound (active compound) can be used as an insecticide. However, in general, the compounds are first formulated with one or more inert (i.e. non-chemical ly reactive, plant compatible or herbicidally inert) carriers or diluents suitable for insecticidal use, before being applied.
The compositions or formulations, including a compound as described herein, may take any one of a number of solid or liquid forms. Examples of solid forms are dusts, granules, tablets, powders and the like. Examples of liquid forms are emulsions, solutions, suspensions, flowables, emulsifiable concentrates and pastes. Such compositions may contain, in addition to the active compound or compounds, various carriers or diluents; surface-active agents (wetting agents, dispersing agents and/ or emulsifying agents); solvents (water, or organic solvents such as aromatic solvents or chlorinated aliphatic solvents); adhesives; thickeners;
PR-7713/7874/7924/8029/8443A binders; anti-foaming agents; and other substances as mentioned herein. Solid carriers or diluents included in such oonpositions or formulations may include, for example, ground natural minerals such as kaolins, alumina, calcined diatomaceous earth, calcium carbonate, silica, kieselguhr, clays, etc.; ground synthetic minerals such as various silicates and alumino-silicates and ground vegetable products such as bark, cornmeal, sawdust, cellulose powder and the like. Conpositions containing sorptive clays will usually also contain a stabilizer, such as a glycol, to prevent or minimize degradation of the active ingredient.
To manufacture solid conpositions, the active conpounds are mixed with solid carriers or diluents such as those mentioned above and the mixture is ground to the appropriate size. Granules can be manufactured by dissolving an active compound in an organic solvent and applying the mixture, for exanple, by atomization, onto an absorptive granulated inert material, such as silica. Adhesives may be utilized to assist in the incorporation of the compound onto the solid particles.
Wettable powders and pastes are obtained by mixing and grinding an active compound with one or more dispersing agents and/or solid carriers or diluents. Also included may be wetting agents and/or dispersing agents, for exanple, lignins, methyl cellulose, naphthalenesulfonic acid derivatives, fatty alcohol sulfates and various types of alkali and alkaline earth metal salts of fatty acids.
Emulsifiable concentrates are generally obtained by dissolving the active compound in an organic solvent, for exanple, butanol, cyclohexanone, xylenes, or higher boiling aromatic hydrocarbons. To obtain suspensions or emulsions in water, wetting agents may also be added.
Flowables are prepared by mixing an active compound with one or more dispersing agents and/or solid additives, and a liquid (which may be water or an organic solvent) in which the active compound is relatively insoluble, and grinding the mixture.
ς VO 0 0 dV
PR-7713/7874/7924/8029/8443A
Both liquid and solid conpositions may be in microcapsule or encapsulated form, to permit release of the enclosed active conpound at a controlled rate over a period of time. Liquid conpositions of this type contain encapsulated droplets of approximately 1-50 microns in diameter, including the active conpound and optionally a solvent. The encapsulating material is an inert porous membrane of a polymeric material.
Solid encapsulated conpositions generally take the form of granules, in which the liquid containing the active conponent is trapped in the pores of the granular support by a porous polymeric membrane through which the active ingredient may migrate at a controlled rate, or which membrane breaks down at a controlled rate to permit escape of the active ingredient.
Typical encapsulating materials include natural and synthetic rubbers, cellulosic materials, styrene-butadiene copolymers, polyacrylonitriles, polyacrylates, polyamides, poly isocyanates, polyurethanes, mixed copolymers of the foregoing and starch xanthates.
It is possible to use highly concentrated liquid conpositions containing up to about 95% by weight of the active conpound, or even the 100% active conpound alone, when applying the conpound in the form of a finely divided liquid by use of various atomizing equipment, for exanple by airplane spraying techniques. For other purposes, however, the various types of conpositions which can be utilized for these conpounds will contain varying amounts of the conpound according to the type of conposition and the intended use.
In general, insecticidal conpositions may contain from 5 to 95% of the active conpound, more preferably from 10 to 85%. Seme typical canpositions will contain an active conpound as follows; wettable powders:
to 80% active conpound; oil suspensions, emulsions, solutions, flowables, and emulsifiable concentrates: 5 to 85% active conpound; aqueous suspensions: 20 to 50% active conpound; dusts and powders: 5 to 20% active conpound; granules and pellets: 5 to 20% active conpound.
PR-7713/7874/7924/8029/8443A
In addition to the active conpound and the various agents utilized in preparing conpositions and formulations mentioned, such oonpositions may also contain one or more other active conpounds of the type mentioned herein as well as other active pesticidal agents, such as herbicides, fungicides, insecticides, acaricides, nematocides, bactericides, and plant growth regulators. Ihe particular pesticide included in the mixture will depend upon its intended utility and the type of conplementary action required. Exanples of suitable insecticides include the following:
(a) natural pyrethrins or pyrethroids such as permethrin, fenvalerate, deltamethrin, cyhalothrin, biphenthrin, fenpropathrin, cyfluthrin, tefluthrin, enpenthrin, ethofenprox, tetramethrin, bioallethrin, fenfluthrin, prallethrin, 5-benzyl-3-furylmethyl-(E)-{1R,3S)~2,2dimethyl-3-( 2-oxothiolan-3-yli dene- methyl )cyclopropane carboxylate and pentafluorobenzyl (cis)-3-[ -2-fluoro-2-(methoxycarbonyl )e thenyl)-2,2-d imethy Icy clopropane carboxy late;
(b) organophosphates such as profenofos, sulprofos, phosmet, dichlorvos, methyl parathion, azinphos-methyl, dimeton-s-methyl, heptenophos, thiometon, fenamiphos, monocrotophos, triazophos, methamidophos, dimethoate, phosphamidon, malathion, chlorpyrifos, phosalone, fensulfothion, fonofos, phorate, phoxim, pyrimiphosmethyl, fenitrothion and diazinon;
(c) carbamates (including aryl carbamates) such as pirimicarb, cloethocarb, carbofuran, ethiofencarb, aldicarb, thiofurox, carbosulfan, bendiocarb, fenobucarb, propoxur and oxamyl;
(d) benzoyl ureas such as triflumuron, chlorofluazuron;
(e) organic tin conpounds such as cyhexatin, fenbutatin oxide and azocyclotin;
(f) macrolides such as avermectins or milbemycins, for exanple such as abamectin, avermectin, and milbemycin;
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A (g) hormones and synthetic mimics thereof such as juvenile hormone, juvabione, ecdysones, methoprene and hydroprene;
(h) pheromones; and (i) organochlorine compounds such as benzene hexachloride, DDT, chlordane or dieldrin.
In addition to the major chemical classes of insecticide listed above, other insecticides having particular targets may be employed in the mixture if appropriate for the intended utility of the mixture. For instance selective insecticides for particular crops, for example stemborer specific insecticides for use in rice such as cartap or buprofesin, can be employed. Alternatively, insecticides specific for particular insect species/stages, for exanple ovolarvicides such as clofentezine, amitraz, chlordimeform flubenzimine, hexythiazox and tetradifon, motilicides such as dicofol or propargite, adulticides such as bromopropylate, chlorobenzilate, or insect growth regulators such as hydramethylon, cyromazine, methoprene, chlorofluazuron and diflubenzuron may also be included in the compositions. Such compounds may also contain soil disinfectants or fumigants and may further contain fertilizers, thus making it possible to provide multi-purpose compositions containing one or more of the active compounds described herein as well as, optionally, other pesticides and also fertilizers, all intended and formulated for use at the same locus.
Control of insect pests is accomplished by applying a composition containing an insecticidally effective amount of an active compound as described herein to the insect, to a locus at which insecticidal control is desired, or to food sources (including seeds) on which the insects feed. For use in the last mentioned manner it is preferable to utilize a compound which is not volatile. Thus, control may be achieved by direct application of the active compounds to the insects and indirectly by application of the compounds to a locus to be protected (such as crop lands, grass ranges and forests), to a source of food for insects or to other insect habitats (for exanple, breeding or swarming areas). The rates of application of the active compound, and the concentration
PR-7713/7874/7924/8029/8443A applied, will vary according to whether the conpound or composition is being directly applied to the insect or indirectly, to a locus, food or habitat. In the latter case the rate of the application, depending on the nature of the insect or insects to be controlled, and the plant environment, will generally vary from about 0.01 to about 100 pounds per acre (about 0.011 to about 111 kg/ha).
It should be noted that the active oonpound need not be insecticidally active per se to effect insect control. The purposes of this invention are fully served if such compounds are rendered active by external influences, such as light or heat, or by some physiological action which occurs when the oonpound is ingested into the body of the insect.
Conpounds of this invention could be used to control a variety of insects such as:
Myzus persicae (aphid)
Aphis gossypii (aphid)
Aphis fabae (aphid)
Megoura viceae (aphid)
Aedes aegypti (mosquito)
Anopheles spp. (mosquitos)
Culex spp. (mosquitos)
Dysdercus fasciatus (capsid)
Musca domestica (housefly)
Pieris brassicae (white butterfly)
Plutella maculipennis (diamond back moth)
Phaedon cochlaeriae (mustard beetle)
Aonidiella spp. (scale insects)
Trialeuroides spp. (white flies)
Bemisia tabaci (white fly)
Blattella germanica (cockroach)
Periplaneta americana (cockroach)
Blatta orientalis (cockroach)
Spodoptera littoralis (cotton leafworm)
Heliothis virescens (tobacco budworm)
Chortiocetes terminifera (locust)
AP 0 0 0 1 5 0
PR-7713/7874/7924/8029/8443A
Diabrotica spp. (rootworms)
Agrotis spp. (cutworms)
Chilo supressalis (stem borer
Chilo partellus (maize stem borer)
Nilaparvata lugens (planthopper)
Nephottex virescens (leafhopper
Nephotettix cincticeps (leafhopper)
Panonychus ulmi (European red mite)
Panonychus citri (citrus red mite)
Tetranychus urticae (two-spotted spider mite)
Tetranychus cinnabarinus (carmine spider mite)
Phyllcoptruta oleivora (citrus rust mite)
Polyphagotarsonemus latus (broad mite)
Brevipalpus spp. (mites) expositions containing one or more of the active conpounds described, in an insecticidally effective amount, may be applied to the plant, locus or insect habitat in any conventional manner.
When used in connection with crop or other plant protection, application may be made in a preventive (i.e. before infestation) or eradicative manner (i.e., after infestation). Thus, powders and various liquid conpositions containing the active conpound can be applied by the use of power dusters, boom and hand sprayers and spray dusters, or applied from airplanes as dusts or sprays. When applied in the latter method they may be effective in very low dosages.
Conpositions including active conpounds may also be applied by addition to irrigation waters supplied to the field to be treated. This method of application permits penetration of the conpounds into the soil as the water is absorbed therein.
Conpositions including active conpounds may additionally be used to protect plant seeds from being attacked by soil-borne insect pests after planting and during germination, by applying the composition to the seeds as a seed dressing. This is performed generally by mixing the seeds with an active conposition in either liquid or solid form (preferably
PR-7713/7874/7924/8029/8443A liquid) in a suitable mixing apparatus. Liquid compositions for this purpose may contain an adhesive or sticking agent, such as methyl cellulose, ethyl cellulose, etc., to assist the composition in adhering to the seed. If a solid composition is utilized for this purpose, an adhesive agent may be sprayed on the seeds during or after mixing.
For use as a soil insecticide, the active conpound, or compositions containing it, may be mixed with the soil in any conventional manner, before, during or after planting of the plant seeds. Liquid compositions may be applied by spraying onto the surface or by incorporation in irrigation or sprayed water. Solid or liquid compositions containing an active conpound may be incorporated into the soil prior to or during planting by discing, plowing or other mixing operations, in order to locate the active ingredient below the surface of the soil so as to be most effective in controlling undesirable larvae.
Some examples of compositions containing the active compounds of this invention are:
Composition A: Granular Solid
Conponent
Active conpound attapulgite clay granules triethylene glycol
Weight %
APO 00 1 5 o
Total 100%
Composition B: Wettable Powder
Component
Weight %
Active conpound 80 wetting agent (sodium dialkylnaphthalene sulfonate) dispersing agent (sodium lignosulfonate) diluent (aluminum magnesium silicate) _
Total
100%
PR-7713/7874/7924/8029/8443A
Composition C: Dilute Solution
Component
Active compound solvent (xylene)
Total
Composition D: Emulsifiable Concentrate
Component
Active compound
Emulsifier (blend of metal sulfonates and polyoxyethylene ethers) solvent (xylene)
Total
Composition E; Concentrated Solution
Component
Active compound solvent (xylene)
Total
Weight %
100«
Weight %
100%
Weight %
100%
Claims (29)
1. A compound having the formula (I) in which
R] is naphthyl, optionally substituted by up to 2 halogens; or phenyl, optionally substituted by one or more of: Cj-Cj carboalkoxy,
10 C1-C4 alkyl sulfonyl, C1-C4 haloalkylsulfonyl, C2-C5 alkylcarbonyl, C2--C4 alkenyl, C1-C4 haloalkylthio, C3-Cg cycloalkyl, phenyl, monosubstituted phenyl, pyridyloxy, C2-C4 alkyleneoxy, C]-C4 alkylenedioxy, Cj-C3 haloalkylenedioxy, C2-C4 alkylene, amido, nitro, cyano, up to two C]-<4 alkyl thio groups, up to three C1-C4 alkoxy groups, up to three C1-C4
15 haloalkoxy groups, up to three C1-C4 alkyl groups, up to three C1-C4 haloalkyl groups, or up to five halogens;
R2 is methyl; ethyl; n-propyl; C3-O7 branched alkyl; Cj-Cg haloalkyl, cyclopropyl optionally substituted with up to 4 methyl groups or up to 2 halogens, cyclobutyl, cyano, C2-C4 alkoxyalkyl, C2-C3 alkenyl or
20 C2-C3 haloalkenyl; and (a)
AP 0 0 0 1 5 0
A, B and C are each carbon or nitrogen, provided that A, B and C are not all nitrogen and if two of A, B and C are nitrogen, then A and C are nitrogen;
30 R4 is hydrogen or halo;
Rg is hydrogen, methyl, fluoro or ethynyl; and R7 is (i)
PR-7713/7874/7924/8029/8443A in which D and E are each carbon or nitrogen provided that both D and E are not nitrogen, and further provided that if any of A, B or C is nitrogen, then D and E are both carbon; and
R5 is hydrogen, C1-C4 alkyl, C1-C4 alkoxy, trifluoromethyl, cyano, C1-C4 alkylthio, C1-C4 alkylsulfonyl, or mono- or polyhalo;
in which R8 is hydrogen or halogen; or (iii) -OCH2-CH=CH2 '-^(R1O)4 in which (i) R9 is 4-fluoro, 4-methoxymethyl, or 4-propargyl, and R10 is fluoro or (ii) R9 is 3- or 4-allyl, 3- or 4-propargyl, or 3- or 4-(monoor dihalo)allyl, and R10 is hydrogen or fluoro;
(c) —CH2
PR-7713/7874/7924/8029/8443A (d) 4-phenoxy-2-butyn-2-yl;
(e) 3-bromo-4-f luorobenzyl ;
(f) 4-(benzyloxy)-benzyl;
(g) 4-(4-fluorobenzyloxy)benzyl;
(h) 4-(4-trifluoromethyl-2-pyridyloxyJbenzyl; or (i) R; is not 2,3-dichlorophenyl, 2,6-difluorophenyl, 2,6-di(Cj-C4 alkyl)phenyl, 2,4,6-tribromophenyl or 2,4,6-tri(C1-C4 alkoxy) phenyl;
(ii) when R2 is tertiary butyl, R-| is not phenyl, 3-methylphenyl, 4-(n-butyl)phenyl or 4-(t-butyl)phenyl; and (iii) when R2 is a C5 alkyl group, R·, is not 4-isopropylphenyl.
2. A oonpound according to Claim 1 in which R1 is
Riy^—7
APO 00150 wherein R-j 1 is hydrogen, halogen, C]-C4 alkyl, Cf-C4 haloalkyl, C1-C4 alkoxy, C1-C4 haloalkoxy, CJ-C4 alkylthio, Cj-<4 haloalkylthio, C2-C5 carboalkoxy, C2“<5 alkylcarbonyl, nitro or cyano; R^ is hydrogen, halogen, C1-C4 alkyl, CJ-C4 haloalkyl, C1-C4 alkoxy, C;-C4 haloalkoxy, C1-C4 alkylthio, nitro, cyano, C1-C4 alkylsulfonyl, C2-C5 alkylcarbonyl or C2-C5 carboalkoxy; and R13 is hydrogen, halogen, C1-C4 haloalkyl or C1-C4 alkoxy, or R11 and R12 taken together are C2-C4 alkylene, C1-C4 alkyleneoxy, C1-C4 alkylenedioxy or halo-C;-C3 alkylenedioxy; provided that R]1, R12 and R13 are not all hydrogen.
3. A conpound according to Claim 2 in which R13 is hydrogen and R^ 1 and R-,2 are other than hydrogen.
4. A conpound according to Claim 2 in which R]j and Rj3 are hydrogen.
98 PR-7713/7874/7924/8029/8443A
5. A oonpound according to Claim 2 in which R]2 and R]3 are hydrogen.
6. A compound according to Claim 2 in which R]2 is halogen and 5 R13 is hydrogen.
7. A oonpound according to Claim 2 in which R-μ is chloro, R^2 is fluoro and R13 is hydrogen.
10
8. A compound according to Claim 1 in which R-, is in which R]4 is halogen and R15 is hydrogen or halogen.
9. A oonpound according to any of Claims 1-8 in vhich R3 is
10. A oonpound according to any of Claims 1-9 in which R3 is
11. A compound according to any of Claims 1-8 or 10 in which R4 and R5 are both hydrogen.
12. A compound according to any of Claims 1-8 or 10 in which R4 and R5 are both 4-fluoro.
13. A oonpound according to any of Claims 1-8 or 10 in which R4
35 is 4-fluoro and R5 is 4-chloro.
99 PR-7713/7874/7924/8029/8443A
14. A conpound according to any of Claims 1-8 or 10 in which ie hydrogen and Rj is 4-halo.
15. A conpound according to any of Claims 1-8 or 10 in which 5 is 4-fluoro and Rg is hydrogen.
16. A compound according to Claim 14 in which R3 is -.0^
R4 is hydrogen and R5 is hydrogen or 4-halo.
17. A conpound having the formula
R)-iX?=C *17 \
R18
2-=—A-ccHpo«nd-aeeordif»g-to-Claim-4 in which R] is ,
r13^ wherein R^ is hydrogen, halogen, C^-C4 alkyl, C]-C4 haloalkyl, Cj-C4 alkoxy, Cj-C4 haloaltoxy, C]-<4 alkylthio, Cj-C4 haloalkyl thio, Cj-Cg carxKslkoxy, C2-C5 alkylcarbonyl, nitro or cyano; R12 is hydrogen^
25 halogen, C]-C4 alkyl, C^-C4 haloalkyl, C]-C4 alkoxy, C]-C4 haloalkoxy, C-|-C4 alkylthio, nitro, cyano, Cj-C4 alkylsulfonyl, C2-C5 alkylcarbonyl
C2-C5 carboalkoxy; and R^ is hydrogen, halogen, C^-C4 haloalkyl or Cj-C,· alkoxy, or R^j and R^2 taken together are C2-C4 alkylene, C|-C4 alkyleneoxy, C^-C4 alkylenedioxy or halo-C^-<3 alkylenedioxy; provided.--:;υ
0 ς V 0 0 0 dV
18. A process for preparing a eanpound according to Cl.u.a 17 ;cnprising reacting an amide having the formula r-— -n BAD ORIGINAL
R1NHCR2
V
100 PR-7713/7874/7924/8029/8443A with a base and a tri valent phosphorus conpound, in the presence of a halogen, in which R2 is methyl; ethyl; n-propyl; C3-C7 branched alkyl other than those having no alpha-hydrogen atoms; Cj-Cg haloalkyl, cyclopropyl optionally substituted with up to 4 methyl groups or up to 2 halo5 gens, cyclobutyl, C2-C4 alkoxyalkyl, C2-C3 alkenyl or C2-C3 haloalkenyl.
Claim
19. A process for the production of a conpound according to comprising reaction of a conpound having the formula
Z ''
Ri-N=C=C 1 \ r18 with an alcohol having the formula R3OH in the presence of an alkali metal base in which R17 and Rig are independently hydrogen, C]-Cg alkyl, halo, Cj-Cg haloalkyl, C1-C3 alkoxy, C2 alkenyl or C2 haloalkenyl or R17 and R]g taken together are a C2-C3 alkylene chain optionally substituted by up to four methyl groupe or up to two halogens.
20. A conpound having the formula c=nh2-hx
RjO^ in which
R2 is methyl; ethyl; n-propyl; C3-C7 branched alkyl; Cj-Cg haloalkyl, cyclopropyl optionally substituted with up to 4 methyl groups or up to 2 halogens, cyclobutyl, C2-C4 alkoxyalkyl, C2-C3 alkenyl or C2-C3 haloalkenyl; and (a)
A, B and C are each carbon or nitrogen, provided that A, B and C are not all nitrogen and if two of A, B and C are nitrogen, then A and C are nitrogen;
101
PR-7713/7874/7924/8029/8443A
R4 is hydrogen or halo;
R$ is hydrogen, methyl, fluoro or ethynyl; and
R7 is (i)
R5 in which D and E are each carbon or nitrogen provided that both D and E are not nitrogen, and further provided that if any of A, B or C is nitrogen, then D and E are both carbon; and
R5 is hydrogen, C1-C4 alkyl, C1-C4 alkoxy, trifluoromethyl, cyano, C^-C^ alkylthio, C1-C4 alkylsulfonyl, or mono- or polyhalo;
(ii) in which Rg is hydrogen or halogen; or (iii) -O-CH2“O1=Q32
AP 0 0 0 1 5 0 (i) Rg is 4-fluoro, 4-methoxymethyl, or 4-propargyl, and R^q is fluoro or (ii) R9 is 3- or 4-allyl, 3- or 4-propargyl, or 3- or 4-(monoor dihalo) allyl, and R]q is hydrogen or fluoro;
102
PR-7713/7874/7924/8029/8443A (c) —ch2 (d) 4-phenoxy-2-butyn-2-yl;
(e) 3-bromo-4-fluorobenzyl;
(f) 4-(benzyloxy)benzyl;
(g) 4-(4-fluorobenzyloxy Jbenzyl (h) 4-(4-trifluoromethyl-2-pyridyloxy)benzyl; or
HX represents a mineral acid.
; and
21. An insecticidal conposition oonprising (a) an insecticidal15 ly effective amount of a conpound according to any of Claims 1-16, and (b) an insecticidally suitable diluent or carrier.
22. A method for controlling insects oonprising applying to an insect, the locus of an insect or a locus at which insecticidal control is
20 desired, an insecticidally effective amount of a conpound or conposition according to any of Claims 1-16 or 21.
23. A method for controlling insects according to Claim 22 in which the insect is a member of the order Lepidoptera.
24. A method for controlling insects according to Claim 22 in vhich the insect is a member of the order Coleoptera.
25. A method for controlling insects according to Claim 22 in 30 which the insect is a member of the order Hemiptera.
103
IV
26. A compound of the general formula I set out in claim 1 substantially as herein described with reference to the examples and tables 1 S 2.
27. A process for the production of a compound of the general formula I set out in claim 1 substantially as herein described with reference to the examples and tables 1 & 2.
28. An insecticidal composition comprising an insecticidally effective amount of a compound according to claim 26 and a suitable diluent or carrier.
29. A method for controlling insects comprising applying to the insect or the locus thereof or of the desired control zone a compound according to claim 26 or a composition according to claim 28.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12287787A | 1987-11-07 | 1987-11-07 | |
| US26360588A | 1988-10-31 | 1988-10-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP8800108A0 AP8800108A0 (en) | 1989-01-31 |
| AP150A true AP150A (en) | 1991-10-31 |
Family
ID=26820985
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1988/000108A AP150A (en) | 1987-11-17 | 1988-11-17 | Novel imidate insecticides. |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US5189060A (en) |
| EP (1) | EP0317265B1 (en) |
| JP (1) | JP2809280B2 (en) |
| KR (1) | KR900006275A (en) |
| CN (1) | CN1033798A (en) |
| AP (1) | AP150A (en) |
| AT (1) | ATE106393T1 (en) |
| AU (1) | AU613680B2 (en) |
| BR (1) | BR8806010A (en) |
| DE (1) | DE3889861T2 (en) |
| DK (1) | DK640788A (en) |
| EG (1) | EG18713A (en) |
| GB (1) | GB2212495A (en) |
| HU (1) | HUT49575A (en) |
| IL (1) | IL88393A0 (en) |
| MY (1) | MY104112A (en) |
| OA (1) | OA08926A (en) |
| PL (1) | PL275832A1 (en) |
| PT (1) | PT89014B (en) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0177122B1 (en) * | 1984-07-03 | 1992-04-01 | Nippon Paint Co., Ltd. | Acrylamide derivatives |
| MY104112A (en) * | 1987-11-17 | 1993-12-31 | Ici America Inc | Novel imidate insecticides |
| WO1992004317A2 (en) * | 1990-09-06 | 1992-03-19 | Ici Americas Inc. | Novel imidate insecticides |
| WO2004087667A1 (en) * | 2003-03-31 | 2004-10-14 | Council Of Scientific And Industrial Research | Ester derivatives of (pyridinyloxy-phenyl)-methanol and process of preparation thereof |
| WO2007089346A2 (en) * | 2005-12-22 | 2007-08-09 | Fmc Corporation | Composition and method for controlling rice water weevils |
| JP2009046478A (en) * | 2007-07-25 | 2009-03-05 | Sumitomo Chemical Co Ltd | Imidate compounds and their use for pest control |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2944849A1 (en) * | 1979-11-07 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Insecticidal, acaricidal phenoxy-benzyl thio:ester derivs. - prepd. e.g. by reaction of a mono- or di-thio:carboxylic acid with a 3-phenoxy-benzyl halide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4254264A (en) * | 1979-12-10 | 1981-03-03 | Zoecon Corporation | (6-Phenoxy-2-pyridyl) methyl esters of imidates |
| US4942245A (en) * | 1987-04-20 | 1990-07-17 | Kyorin Pharmaceutical Co., Ltd. | Benzimidazole Derivatives |
| US5045566A (en) * | 1987-11-17 | 1991-09-03 | Ici Americas Inc. | Novel imidate insecticides |
| MY104112A (en) * | 1987-11-17 | 1993-12-31 | Ici America Inc | Novel imidate insecticides |
| US5089623A (en) * | 1987-11-17 | 1992-02-18 | Imperial Chemical Industries Plc | Certain imidate insecticides |
| US4994488A (en) * | 1988-10-31 | 1991-02-19 | Ici Americas Inc. | Novel imidate insecticides |
-
1988
- 1988-11-15 MY MYPI88001300A patent/MY104112A/en unknown
- 1988-11-15 GB GB8826675A patent/GB2212495A/en not_active Withdrawn
- 1988-11-15 AT AT88310775T patent/ATE106393T1/en not_active IP Right Cessation
- 1988-11-15 EP EP88310775A patent/EP0317265B1/en not_active Expired - Lifetime
- 1988-11-15 DE DE3889861T patent/DE3889861T2/en not_active Expired - Fee Related
- 1988-11-16 EG EG58788A patent/EG18713A/en active
- 1988-11-16 DK DK640788A patent/DK640788A/en not_active Application Discontinuation
- 1988-11-16 IL IL88393A patent/IL88393A0/en unknown
- 1988-11-16 CN CN88107891A patent/CN1033798A/en active Pending
- 1988-11-16 AU AU25623/88A patent/AU613680B2/en not_active Ceased
- 1988-11-16 KR KR1019880015090A patent/KR900006275A/en not_active Abandoned
- 1988-11-16 HU HU885932A patent/HUT49575A/en unknown
- 1988-11-16 PT PT89014A patent/PT89014B/en not_active IP Right Cessation
- 1988-11-16 PL PL27583288A patent/PL275832A1/en unknown
- 1988-11-17 AP APAP/P/1988/000108A patent/AP150A/en active
- 1988-11-17 JP JP29101988A patent/JP2809280B2/en not_active Expired - Lifetime
- 1988-11-17 OA OA59472A patent/OA08926A/en unknown
- 1988-11-17 BR BR888806010A patent/BR8806010A/en not_active Application Discontinuation
-
1990
- 1990-11-30 US US07/621,157 patent/US5189060A/en not_active Expired - Fee Related
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2944849A1 (en) * | 1979-11-07 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Insecticidal, acaricidal phenoxy-benzyl thio:ester derivs. - prepd. e.g. by reaction of a mono- or di-thio:carboxylic acid with a 3-phenoxy-benzyl halide |
Non-Patent Citations (2)
| Title |
|---|
| CHEM. ABST, Vol. 56, 1956, 11491i * |
| J. ORG. CHEM, 47, 1982, pp. 3998-4000 * |
Also Published As
| Publication number | Publication date |
|---|---|
| AU2562388A (en) | 1989-05-18 |
| JP2809280B2 (en) | 1998-10-08 |
| JPH02149A (en) | 1990-01-05 |
| EP0317265A3 (en) | 1990-10-17 |
| AP8800108A0 (en) | 1989-01-31 |
| EP0317265B1 (en) | 1994-06-01 |
| IL88393A0 (en) | 1989-06-30 |
| PL275832A1 (en) | 1989-08-07 |
| HUT49575A (en) | 1989-10-30 |
| AU613680B2 (en) | 1991-08-08 |
| ATE106393T1 (en) | 1994-06-15 |
| US5189060A (en) | 1993-02-23 |
| DK640788A (en) | 1989-05-18 |
| MY104112A (en) | 1993-12-31 |
| OA08926A (en) | 1989-10-31 |
| EP0317265A2 (en) | 1989-05-24 |
| PT89014A (en) | 1988-12-01 |
| EG18713A (en) | 1993-12-30 |
| CN1033798A (en) | 1989-07-12 |
| DE3889861T2 (en) | 1994-09-29 |
| KR900006275A (en) | 1990-05-07 |
| PT89014B (en) | 1993-02-26 |
| DK640788D0 (en) | 1988-11-16 |
| GB2212495A (en) | 1989-07-26 |
| BR8806010A (en) | 1989-08-08 |
| DE3889861D1 (en) | 1994-07-07 |
| GB8826675D0 (en) | 1988-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20110082181A (en) | Halogen-substituted compounds used as pesticides | |
| TW306864B (en) | ||
| CY1247A (en) | N-acylamino-2-oxo-3-oxazolidine derivatives and their use as fungicides | |
| EP0288275B1 (en) | Phenoxypropionic acid derivatives for use as herbicides | |
| AP150A (en) | Novel imidate insecticides. | |
| US4994473A (en) | Pyridyl containing insecticides | |
| JPH01113366A (en) | N-aryl nitrogen heterocyclyls | |
| US4436744A (en) | Fungicidal compositions comprising N-amino-2-oxo-3-oxazolidine derivatives and folpet or captan | |
| EP0271240B1 (en) | Fluorobenzyl esters | |
| JPH0393747A (en) | Substituted acrylic acid ester | |
| US5064846A (en) | Heterocyclic insecticides | |
| US5089623A (en) | Certain imidate insecticides | |
| JPH05395B2 (en) | ||
| US4994488A (en) | Novel imidate insecticides | |
| US5045566A (en) | Novel imidate insecticides | |
| US5070210A (en) | Novel ketenimines as intermediates for insecticides | |
| AP97A (en) | Fluorobenzyl esters. | |
| JPH02279676A (en) | Pyridazinone derivative | |
| US5049585A (en) | Certain 3,3-bis-(difluoro methyl)2,2-dimethyl-cyclopropane carboxylates having insecticidal activity | |
| US4891450A (en) | Process for intermediates for insecticidal compounds | |
| US5276205A (en) | Insecticides | |
| US4163791A (en) | 2-Phenyliminothiazoline compounds | |
| US5215998A (en) | Alkylphosphonothioate insecticides | |
| WO1992004317A2 (en) | Novel imidate insecticides | |
| JP3864216B2 (en) | Alkylenebis [1- (substituted or unsubstituted pyridylmethyl)]-2-nitroiminoimidazolidyl, process for producing the same, and insecticide |