WO2022186098A1 - Nouvel ester d'acide boronique aromatique stable - Google Patents
Nouvel ester d'acide boronique aromatique stable Download PDFInfo
- Publication number
- WO2022186098A1 WO2022186098A1 PCT/JP2022/008131 JP2022008131W WO2022186098A1 WO 2022186098 A1 WO2022186098 A1 WO 2022186098A1 JP 2022008131 W JP2022008131 W JP 2022008131W WO 2022186098 A1 WO2022186098 A1 WO 2022186098A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- group
- compound
- formula
- salt
- mol
- Prior art date
Links
- -1 aromatic boronic acid ester Chemical class 0.000 title abstract description 187
- 150000001875 compounds Chemical class 0.000 claims abstract description 186
- 150000003839 salts Chemical class 0.000 claims abstract description 68
- 238000004519 manufacturing process Methods 0.000 claims abstract description 45
- 125000005843 halogen group Chemical group 0.000 claims description 92
- 238000006243 chemical reaction Methods 0.000 claims description 55
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 40
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 35
- 239000003054 catalyst Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 22
- 125000005915 C6-C14 aryl group Chemical group 0.000 claims description 18
- 229910052751 metal Inorganic materials 0.000 claims description 16
- 239000002184 metal Substances 0.000 claims description 16
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 14
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000002950 monocyclic group Chemical group 0.000 claims description 10
- 125000001544 thienyl group Chemical group 0.000 claims description 10
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- DBTNVRCCIDISMV-UHFFFAOYSA-L lithium;magnesium;propane;dichloride Chemical compound [Li+].[Mg+2].[Cl-].[Cl-].C[CH-]C DBTNVRCCIDISMV-UHFFFAOYSA-L 0.000 claims description 9
- 125000001624 naphthyl group Chemical group 0.000 claims description 9
- 125000002541 furyl group Chemical group 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 claims description 5
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 2
- 238000010898 silica gel chromatography Methods 0.000 abstract description 20
- 238000007306 functionalization reaction Methods 0.000 abstract description 10
- 125000001424 substituent group Chemical group 0.000 description 75
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 62
- 239000002904 solvent Substances 0.000 description 51
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 30
- 238000000034 method Methods 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 21
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 20
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 19
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 19
- 239000000741 silica gel Substances 0.000 description 19
- 229910002027 silica gel Inorganic materials 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 18
- 239000002585 base Substances 0.000 description 15
- 125000004093 cyano group Chemical group *C#N 0.000 description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 15
- 238000012360 testing method Methods 0.000 description 15
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 14
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 12
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 11
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 11
- 230000000052 comparative effect Effects 0.000 description 11
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 description 10
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 238000005481 NMR spectroscopy Methods 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 10
- 125000000623 heterocyclic group Chemical group 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 125000004414 alkyl thio group Chemical group 0.000 description 9
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 9
- 235000011056 potassium acetate Nutrition 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 230000035484 reaction time Effects 0.000 description 9
- LZPWAYBEOJRFAX-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2$l^{2}-dioxaborolane Chemical compound CC1(C)O[B]OC1(C)C LZPWAYBEOJRFAX-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 125000005947 C1-C6 alkylsulfonyloxy group Chemical group 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 8
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 7
- 229910052796 boron Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 238000006161 Suzuki-Miyaura coupling reaction Methods 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 6
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 6
- 125000005620 boronic acid group Chemical group 0.000 description 6
- JUPWRUDTZGBNEX-UHFFFAOYSA-N cobalt;pentane-2,4-dione Chemical compound [Co].CC(=O)CC(C)=O.CC(=O)CC(C)=O.CC(=O)CC(C)=O JUPWRUDTZGBNEX-UHFFFAOYSA-N 0.000 description 6
- 238000010511 deprotection reaction Methods 0.000 description 6
- 150000008282 halocarbons Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical class CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical compound COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 6
- 235000019798 tripotassium phosphate Nutrition 0.000 description 6
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 5
- HDXDBVSPBNTNNA-UHFFFAOYSA-N 3,4-diethylhexane-3,4-diol Chemical compound CCC(O)(CC)C(O)(CC)CC HDXDBVSPBNTNNA-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 101150003085 Pdcl gene Proteins 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 235000001014 amino acid Nutrition 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 150000001543 aryl boronic acids Chemical class 0.000 description 5
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000012046 mixed solvent Substances 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 150000004965 peroxy acids Chemical class 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- 235000017281 sodium acetate Nutrition 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-Bis(diphenylphosphino)propane Substances C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 4
- 125000005974 C6-C14 arylcarbonyl group Chemical group 0.000 description 4
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 230000002411 adverse Effects 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- WDVGNXKCFBOKDF-UHFFFAOYSA-N dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical group COC1=CC=C(OC)C(C=2C(=CC(=CC=2C(C)C)C(C)C)C(C)C)=C1P(C1CCCCC1)C1CCCCC1 WDVGNXKCFBOKDF-UHFFFAOYSA-N 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000004896 high resolution mass spectrometry Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- XRKQMIFKHDXFNQ-UHFFFAOYSA-N n-cyclohexyl-n-ethylcyclohexanamine Chemical compound C1CCCCC1N(CC)C1CCCCC1 XRKQMIFKHDXFNQ-UHFFFAOYSA-N 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 4
- JAMNHZBIQDNHMM-UHFFFAOYSA-N pivalonitrile Chemical compound CC(C)(C)C#N JAMNHZBIQDNHMM-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000011698 potassium fluoride Substances 0.000 description 4
- 235000003270 potassium fluoride Nutrition 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 4
- 150000003462 sulfoxides Chemical class 0.000 description 4
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- NCWDBNBNYVVARF-UHFFFAOYSA-N 1,3,2-dioxaborolane Chemical compound B1OCCO1 NCWDBNBNYVVARF-UHFFFAOYSA-N 0.000 description 3
- LDFBXJODFADZBN-UHFFFAOYSA-L 3-diphenylphosphanylpropyl(diphenyl)phosphane;palladium(2+);dichloride Chemical compound Cl[Pd]Cl.C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LDFBXJODFADZBN-UHFFFAOYSA-L 0.000 description 3
- UOJCDDLTVQJPGH-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 UOJCDDLTVQJPGH-UHFFFAOYSA-N 0.000 description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 3
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 3
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Natural products P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 3
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 3
- 150000001502 aryl halides Chemical class 0.000 description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 3
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- MXFYYFVVIIWKFE-UHFFFAOYSA-N dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane Chemical compound CC(C)OC1=CC=CC(OC(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 MXFYYFVVIIWKFE-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000004210 ether based solvent Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000007429 general method Methods 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 3
- 238000012423 maintenance Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 3
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- WPFGFHJALYCVMO-UHFFFAOYSA-L rubidium carbonate Chemical compound [Rb+].[Rb+].[O-]C([O-])=O WPFGFHJALYCVMO-UHFFFAOYSA-L 0.000 description 3
- 229910000026 rubidium carbonate Inorganic materials 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001179 sorption measurement Methods 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- 125000006717 (C3-C10) cycloalkenyl group Chemical group 0.000 description 2
- 125000006553 (C3-C8) cycloalkenyl group Chemical group 0.000 description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- KTVKQTNGWVJHFL-UHFFFAOYSA-N 2-ethylchromen-4-one Chemical compound C1=CC=C2OC(CC)=CC(=O)C2=C1 KTVKQTNGWVJHFL-UHFFFAOYSA-N 0.000 description 2
- RJOVKNVJGPMWDT-UHFFFAOYSA-N 3,4-dimethylhexane-3,4-diol Chemical compound CCC(C)(O)C(C)(O)CC RJOVKNVJGPMWDT-UHFFFAOYSA-N 0.000 description 2
- KKLCYBZPQDOFQK-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-phenyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=CC=C1 KKLCYBZPQDOFQK-UHFFFAOYSA-N 0.000 description 2
- JCWWGQQDZHKYOQ-UHFFFAOYSA-N 4,5-dipropyloctane-4,5-diol Chemical compound CCCC(O)(CCC)C(O)(CCC)CCC JCWWGQQDZHKYOQ-UHFFFAOYSA-N 0.000 description 2
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 2
- OVRKATYHWPCGPZ-UHFFFAOYSA-N 4-methyloxane Chemical compound CC1CCOCC1 OVRKATYHWPCGPZ-UHFFFAOYSA-N 0.000 description 2
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 description 2
- 125000005914 C6-C14 aryloxy group Chemical group 0.000 description 2
- SSUFDOMYCBCHML-UHFFFAOYSA-N CCCCC[S](=O)=O Chemical group CCCCC[S](=O)=O SSUFDOMYCBCHML-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241001139947 Mida Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- FZIZEIAMIREUTN-UHFFFAOYSA-N azane;cerium(3+) Chemical compound N.[Ce+3] FZIZEIAMIREUTN-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 150000005347 biaryls Chemical class 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- VYLVYHXQOHJDJL-UHFFFAOYSA-K cerium trichloride Chemical compound Cl[Ce](Cl)Cl VYLVYHXQOHJDJL-UHFFFAOYSA-K 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 2
- 239000004913 cyclooctene Substances 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- MWPIIMNHWGOFBL-UHFFFAOYSA-N dichloromethane;toluene Chemical compound ClCCl.CC1=CC=CC=C1 MWPIIMNHWGOFBL-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- SKOWZLGOFVSKLB-UHFFFAOYSA-N hypodiboric acid Chemical compound OB(O)B(O)O SKOWZLGOFVSKLB-UHFFFAOYSA-N 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000008204 material by function Substances 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- SKTCDJAMAYNROS-UHFFFAOYSA-N methoxycyclopentane Chemical compound COC1CCCC1 SKTCDJAMAYNROS-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- KBJMLQFLOWQJNF-UHFFFAOYSA-N nickel(ii) nitrate Chemical compound [Ni+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O KBJMLQFLOWQJNF-UHFFFAOYSA-N 0.000 description 2
- 125000004355 nitrogen functional group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 1
- JRTIUDXYIUKIIE-KZUMESAESA-N (1z,5z)-cycloocta-1,5-diene;nickel Chemical compound [Ni].C\1C\C=C/CC\C=C/1.C\1C\C=C/CC\C=C/1 JRTIUDXYIUKIIE-KZUMESAESA-N 0.000 description 1
- BIWQNIMLAISTBV-UHFFFAOYSA-N (4-methylphenyl)boronic acid Chemical compound CC1=CC=C(B(O)O)C=C1 BIWQNIMLAISTBV-UHFFFAOYSA-N 0.000 description 1
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 description 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 1
- 125000006649 (C2-C20) alkynyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- MUGJUOWJTRLDCB-UHFFFAOYSA-N 1-propan-2-yloxy-4-(4-propan-2-yloxyphenyl)benzene Chemical group C1=CC(OC(C)C)=CC=C1C1=CC=C(OC(C)C)C=C1 MUGJUOWJTRLDCB-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- XWSGEVNYFYKXCP-UHFFFAOYSA-N 2-[carboxymethyl(methyl)amino]acetic acid Chemical compound OC(=O)CN(C)CC(O)=O XWSGEVNYFYKXCP-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- GKSSEDDAXXEPCP-UHFFFAOYSA-N 4,4,5,5-tetramethyl-2-(4-methylphenyl)-1,3,2-dioxaborolane Chemical compound C1=CC(C)=CC=C1B1OC(C)(C)C(C)(C)O1 GKSSEDDAXXEPCP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- IQTHEAQKKVAXGV-UHFFFAOYSA-N 4-ditert-butylphosphanyl-n,n-dimethylaniline Chemical compound CN(C)C1=CC=C(P(C(C)(C)C)C(C)(C)C)C=C1 IQTHEAQKKVAXGV-UHFFFAOYSA-N 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZYUZLEUJKZZXNN-UHFFFAOYSA-N C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 Chemical group C1=CC(CC(N)C(O)=O)=CC=C1OS(=O)(=O)C1=CC=C(C=CC=C2)C2=C1 ZYUZLEUJKZZXNN-UHFFFAOYSA-N 0.000 description 1
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- 229910004664 Cerium(III) chloride Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical class CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005033 Fourier transform infrared spectroscopy Methods 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229910021577 Iron(II) chloride Inorganic materials 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- 229910021568 Manganese(II) bromide Inorganic materials 0.000 description 1
- 229910021574 Manganese(II) iodide Inorganic materials 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 101100482220 Sulfurisphaera tokodaii (strain DSM 16993 / JCM 10545 / NBRC 100140 / 7) triC gene Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 240000000581 Triticum monococcum Species 0.000 description 1
- 101100020289 Xenopus laevis koza gene Proteins 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- XYPYRLZNYLFLQL-UHFFFAOYSA-M [Cl-].[Na+].I(=O)(=O)(=O)O Chemical compound [Cl-].[Na+].I(=O)(=O)(=O)O XYPYRLZNYLFLQL-UHFFFAOYSA-M 0.000 description 1
- RAFKCLFWELPONH-UHFFFAOYSA-N acetonitrile;dichloromethane Chemical compound CC#N.ClCCl RAFKCLFWELPONH-UHFFFAOYSA-N 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000002078 anthracen-1-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([*])=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000000748 anthracen-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([H])=C([*])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000005116 aryl carbamoyl group Chemical group 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 125000005200 aryloxy carbonyloxy group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 125000000707 boryl group Chemical group B* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 238000001460 carbon-13 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- VLRZJYLZIRECFV-UHFFFAOYSA-L copper(1+) trifluoromethanesulfonate Chemical compound S(=O)(=O)(C(F)(F)F)[O-].FC(S(=O)(=O)[O-])(F)F.[Cu+].[Cu+] VLRZJYLZIRECFV-UHFFFAOYSA-L 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 description 1
- 125000005201 cycloalkylcarbonyloxy group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- URYYVOIYTNXXBN-UPHRSURJSA-N cyclooctene Chemical compound C1CCC\C=C/CC1 URYYVOIYTNXXBN-UPHRSURJSA-N 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- KFGVRWGDTLZAAO-UHFFFAOYSA-N cyclopenta-1,3-diene dicyclohexyl(cyclopenta-1,3-dien-1-yl)phosphane iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.C1CCC(CC1)P(C1CCCCC1)c1ccc[cH-]1 KFGVRWGDTLZAAO-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000005959 diazepanyl group Chemical group 0.000 description 1
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical compound Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 description 1
- QMMLUKRVXWXKSI-UHFFFAOYSA-J dichloromethane;titanium(4+);tetrachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].ClCCl QMMLUKRVXWXKSI-UHFFFAOYSA-J 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical compound CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 1
- 125000005435 dihydrobenzoxazolyl group Chemical group O1C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000005072 dihydrothiopyranyl group Chemical group S1C(CCC=C1)* 0.000 description 1
- AXAZMDOAUQTMOW-UHFFFAOYSA-N dimethylzinc Chemical compound C[Zn]C AXAZMDOAUQTMOW-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000004612 furopyridinyl group Chemical group O1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 150000004693 imidazolium salts Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- LZKLAOYSENRNKR-LNTINUHCSA-N iron;(z)-4-oxoniumylidenepent-2-en-2-olate Chemical compound [Fe].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O LZKLAOYSENRNKR-LNTINUHCSA-N 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 1
- QWYFOIJABGVEFP-UHFFFAOYSA-L manganese(ii) iodide Chemical compound [Mn+2].[I-].[I-] QWYFOIJABGVEFP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000816 matrix-assisted laser desorption--ionisation Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- NALMPLUMOWIVJC-UHFFFAOYSA-N n,n,4-trimethylbenzeneamine oxide Chemical compound CC1=CC=C([N+](C)(C)[O-])C=C1 NALMPLUMOWIVJC-UHFFFAOYSA-N 0.000 description 1
- FPHFMZTUFVNDQL-UHFFFAOYSA-N n-butyl-4-methylaniline Chemical compound CCCCNC1=CC=C(C)C=C1 FPHFMZTUFVNDQL-UHFFFAOYSA-N 0.000 description 1
- NTNWKDHZTDQSST-UHFFFAOYSA-N naphthalene-1,2-diamine Chemical compound C1=CC=CC2=C(N)C(N)=CC=C21 NTNWKDHZTDQSST-UHFFFAOYSA-N 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 1
- AIYYMMQIMJOTBM-UHFFFAOYSA-L nickel(ii) acetate Chemical compound [Ni+2].CC([O-])=O.CC([O-])=O AIYYMMQIMJOTBM-UHFFFAOYSA-L 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003551 oxepanyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- VUYVXCJTTQJVKJ-UHFFFAOYSA-L palladium(2+);tricyclohexylphosphane;dichloride Chemical compound Cl[Pd]Cl.C1CCCCC1P(C1CCCCC1)C1CCCCC1.C1CCCCC1P(C1CCCCC1)C1CCCCC1 VUYVXCJTTQJVKJ-UHFFFAOYSA-L 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011697 sodium iodate Substances 0.000 description 1
- 235000015281 sodium iodate Nutrition 0.000 description 1
- 229940032753 sodium iodate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006337 tetrafluoro ethyl group Chemical group 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- 125000001730 thiiranyl group Chemical group 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B61/00—Other general methods
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
- C07F5/02—Boron compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Definitions
- the present invention relates to novel aromatic boronic esters that are useful for various functionalizations, are not adsorbed even during silica gel chromatography, are stable and can be isolated and purified.
- the present invention also relates to a method for producing the aromatic boronate ester.
- Aromatic boronic acid derivatives are widely used in the field of synthetic organic chemistry as substrates for various reactions represented by Suzuki-Miyaura coupling.
- aromatic boronic acids with an unprotected boronic acid group (-B(OH) 2 ) are easily dehydrated to give cyclic trimeric anhydrides, boroxines, or are strongly adsorbed on silica gel. It has drawbacks such as difficulty in its isolation, purification, structure determination by NMR, and functional group conversion while retaining the boronic acid group.
- Non-Patent Document 1 Several solutions have been reported so far to solve the above drawbacks by protecting the boronic acid group of the aromatic boronic acid with a protective group.
- an aromatic boronic acid pinacol ester is one of the most widely used protected boronic acids, and can be used as it is as a substrate for a coupling reaction.
- the yield often decreases. technology was required (Non-Patent Document 2).
- ArB(dan) Non-Patent Document 3
- ArB(mida) Non-Patent Document 4
- boronic acid derivatives obtained by dehydration condensation with diaminonaphthalene (dan) or N-methyliminodiacetic acid (mida) have been developed.
- the instability of aromatic boronic acid pinacol esters was improved, but these boronic acid derivatives are difficult to synthesize, extremely polar, and difficult to convert functional groups later. Many problems still remain, such as the difficulty of protection.
- the object of the present invention is to provide a novel aromatic boronic ester that is stable without being adsorbed even in silica gel chromatography, can be easily isolated and purified, and is applicable to a wide range of functional group transformations.
- n represents an integer of 1 or greater.
- the compound represented by or a salt thereof is extremely stable even on ordinary silica gel column chromatography or thin layer chromatography, and its decomposition is not observed, and it can be easily isolated and purified.
- a salt thereof in the Suzuki-Miyaura coupling reaction it was found that it exhibited almost the same reactivity as the aromatic boronic acid pinacol ester and could be converted into the corresponding biaryls.
- the present inventors have found that the same compound or a salt thereof can be applied to conversion to oxygen functional groups by NaBO 3 and conversion to nitrogen functional groups using a copper catalyst, and completed the present invention. .
- a compound represented by (hereinafter sometimes referred to as compound (I)) or a salt thereof (hereinafter, compound (I) and a salt thereof may be collectively referred to as "the compound of the present invention").
- R 1 and R 3 are each independently a linear C 1-4 alkyl group
- R 2 and R 4 are each independently a linear C 2-4 alkyl
- Each group represented by represents an aryl group or aromatic heterocyclic group which may be further substituted, and n represents an integer of 1 or more.
- R 1 and R 3 each independently represent a linear C 1-6 alkyl group; R 2 and R 4 each independently represent a linear C 2-6 alkyl group.
- Formula (I) comprising reacting a compound of formula (I):
- X 1 represents a halogen atom
- n represents an integer of 1 or greater.
- R 1 and R 3 each independently represent a linear C 1-6 alkyl group; R 2 and R 4 each independently represent a linear C 2-6 alkyl group.
- R 1 and R 3 each independently represent a linear C 1-6 alkyl group; R 2 and R 4 each independently represent a linear C 2-6 alkyl group.
- R 1 and R 3 each independently represent a linear C 1-6 alkyl group; R 2 and R 4 each independently represent a linear C 2-6 alkyl group.
- a compound represented by [12] The compound or salt thereof according to any one of [1] to [7] above is treated with the formula (VII) in the presence of a metal catalyst and a base:
- R represents an optionally substituted alkyl group, an optionally substituted aryl group, or an optionally substituted heterocyclic group.
- Formula (XI) comprising reacting with a compound of formula (XI):
- the compound of the present invention has the advantage that it is extremely stable without being decomposed even on silica gel column chromatography or thin layer chromatography, and can be easily isolated and purified.
- the compounds of the present invention exhibit almost the same reactivity as aromatic boronic acid pinacol esters, they can be applied to Suzuki-Miyaura coupling reaction and various functional group reactions, and can be used for various pharmaceuticals and functional materials. It is useful as a raw material compound or a synthetic intermediate.
- FIG. 1 shows the results of developing compound (I-2) and compound (I-4), and their corresponding pinacol esters (Comparative Examples 7 and 2) by thin-layer chromatography (silica gel plate) (ammonium cerium molybdate staining) is shown.
- halogen atom includes, for example, fluorine, chlorine, bromine, and iodine.
- the "hydrocarbon group” includes an alkyl group (e.g., C 1-6 alkyl group), an alkenyl group (e.g., C 2-6 alkenyl group), an alkynyl group (e.g., C 2-6 alkynyl group). ), cycloalkyl group (e.g., C 3-10 cycloalkyl group), cycloalkenyl group (e.g., C 3-10 cycloalkenyl group), aryl group (e.g., C 6-14 aryl group), aralkyl group (e.g., C 7-16 aralkyl group).
- alkyl group e.g., C 1-6 alkyl group
- an alkenyl group e.g., C 2-6 alkenyl group
- an alkynyl group e.g., C 2-6 alkynyl group
- cycloalkyl group e.g., C 3-10 cycloalkyl group
- alkyl group means a group obtained by removing one hydrogen atom from any carbon atom of a straight-chain or branched-chain alkane having 1 or more carbon atoms. Unless otherwise specified, it is a C 1-20 alkyl group, preferably a C 1-6 alkyl group, more preferably a C 1-4 alkyl group.
- C 1-6 alkyl group includes, for example, methyl, ethyl, propyl, isopropyl, butyl, isobutyl, sec-butyl, tert-butyl, pentyl, isopentyl, neopentyl, 1-ethylpropyl, hexyl , isohexyl, 1,1-dimethylbutyl, 2,2-dimethylbutyl, 3,3-dimethylbutyl, 2-ethylbutyl and the like.
- C 1-4 alkyl group includes, for example, methyl, ethyl, propyl, isopropyl, butyl, isobutyl, sec-butyl and tert-butyl.
- linear C 1-6 alkyl group includes, for example, methyl, ethyl, n-propyl, n-butyl, n-pentyl, n-hexyl, and among them, linear A C 1-4 alkyl group of is preferred.
- linear C 2-6 alkyl group includes, for example, ethyl, n-propyl, n-butyl, n-pentyl, n-hexyl, and among them, linear C 2-4 alkyl groups are preferred.
- alkenyl group means a group obtained by removing one hydrogen atom from any carbon atom of a straight-chain or branched-chain alkene having 2 or more carbon atoms. Unless otherwise specified, it is a C 2-20 alkenyl group, with a C 2-6 alkenyl group being preferred.
- C 2-6 alkenyl group includes, for example, ethenyl, 1-propenyl, 2-propenyl, 2-methyl-1-propenyl, 1-butenyl, 2-butenyl, 3-butenyl, 3- methyl-2-butenyl, 1-pentenyl, 2-pentenyl, 3-pentenyl, 4-pentenyl, 4-methyl-3-pentenyl, 1-hexenyl, 3-hexenyl and 5-hexenyl.
- alkynyl group means a group obtained by removing one hydrogen atom from any carbon atom of a linear or branched alkyne having 2 or more carbon atoms, particularly Unless otherwise specified, it is a C 2-20 alkynyl group, with a C 2-6 alkynyl group being preferred.
- C 2-6 alkynyl group includes, for example, ethynyl, 1-propynyl, 2-propynyl, 1-butynyl, 2-butynyl, 3-butynyl, 1-pentynyl, 2-pentynyl, 3- Pentynyl, 4-pentynyl, 1-hexynyl, 2-hexynyl, 3-hexynyl, 4-hexynyl, 5-hexynyl, 4-methyl-2-pentynyl.
- cycloalkyl group means a cyclic alkyl group, and unless there is a particular limitation on the carbon number range, it is a C 3-10 cycloalkyl group, especially C 3-8 cycloalkyl groups are preferred.
- C 3-10 cycloalkyl group includes, for example, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, cycloheptyl, cyclooctyl, bicyclo[2.2.1]heptyl, bicyclo[2.2. 2]octyl, bicyclo[3.2.1]octyl and adamantyl.
- C 3-8 cycloalkyl group includes, for example, cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, cycloheptyl and cyclooctyl.
- cycloalkenyl group means a cyclic alkenyl group, and unless there is a particular limitation on the carbon number range, it is a C 3-10 cycloalkenyl group, especially C 3-8 cycloalkenyl groups are preferred.
- C 3-8 cycloalkenyl group includes, for example, cyclopropenyl, cyclobutenyl, cyclopentenyl, cyclohexenyl, cycloheptenyl and cyclooctenyl.
- aryl group refers to a monocyclic or polycyclic (condensed) hydrocarbon group exhibiting aromaticity, preferably a C 6-14 aryl group.
- C 6-14 aryl group includes, for example, phenyl, 1-naphthyl, 2-naphthyl, 1-anthryl, 2-anthryl, 9-anthryl and biphenylyl.
- aralkyl group means a group in which an alkyl group is substituted with an aryl group, and although the carbon number range is not particularly limited, it is preferably a C 7-16 aralkyl group.
- C 7-16 aralkyl group includes, for example, benzyl, 1-phenylethyl, 2-phenylethyl, (naphthyl-1-yl)methyl, (naphthyl-2-yl)methyl, 1- (naphthyl-1-yl)ethyl, 1-(naphthyl-2-yl)ethyl, 2-(naphthyl-1-yl)ethyl, 2-(naphthyl-2-yl)ethyl, biphenylylmethyl, phenylpropyl be done.
- alkoxy group means a group in which a straight or branched chain alkyl group is bonded to an oxygen atom, and the carbon number range is not particularly limited, but is preferably a C 1-6 alkoxy group. be.
- C 1-6 alkoxy group includes, for example, methoxy, ethoxy, propoxy, isopropoxy, butoxy, isobutoxy, sec-butoxy, tert-butoxy, pentyloxy, isopentyloxy, neopentyloxy, and hexyloxy. Among them, a C 1-4 alkoxy group is preferred.
- the "C 7-16 aralkyloxy group” includes, for example, benzyloxy, 1-phenylethyloxy, 2-phenylethyloxy, (naphthyl-1-yl)methyloxy, (naphthyl-2-yl ) methyloxy, 1-(naphthyl-1-yl)ethyloxy, 1-(naphthyl-2-yl)ethyloxy, 2-(naphthyl-1-yl)ethyloxy, 2-(naphthyl-2-yl)ethyloxy, biphenylyl Examples include methyloxy and phenylpropyloxy.
- heterocyclic group includes, for example, (i) an aromatic (ii) non-aromatic heterocyclic groups; and (iii) 7- to 10-membered heterocyclic bridged ring groups.
- aromatic heterocyclic group includes, for example, a 5- to 14-membered ring containing 1 to 4 heteroatoms selected from nitrogen, sulfur and oxygen atoms in addition to carbon atoms as ring-constituting atoms. (preferably 5- to 10-membered) aromatic heterocyclic groups.
- aromatic heterocyclic group examples include thienyl, furyl, pyrrolyl, imidazolyl, pyrazolyl, thiazolyl, isothiazolyl, oxazolyl, isoxazolyl, pyridyl, pyrazinyl, pyrimidinyl, pyridazinyl, 1,2,4-oxadiazolyl, , 3,4-oxadiazolyl, 1,2,4-thiadiazolyl, 1,3,4-thiadiazolyl, triazolyl, tetrazolyl, 5- or 6-membered monocyclic aromatic heterocyclic groups such as triazinyl; Benzothiophenyl, benzofuranyl, benzimidazolyl, benzoxazolyl, benzisoxazolyl, benzothiazolyl, benzisothiazolyl, benzotriazolyl, imidazopyridinyl, thienopyri
- non-aromatic heterocyclic group includes, for example, 3 to 14 heteroatoms containing 1 to 4 heteroatoms selected from nitrogen, sulfur and oxygen atoms in addition to carbon atoms as ring-constituting atoms.
- a membered (preferably 4- to 10-membered) non-aromatic heterocyclic group can be mentioned.
- non-aromatic heterocyclic group examples include aziridinyl, oxiranyl, thiiranyl, azetidinyl, oxetanyl, thietanyl, tetrahydrothienyl, tetrahydrofuranyl, pyrrolinyl, pyrrolidinyl, imidazolinyl, imidazolidinyl, oxazolinyl, oxazolidinyl, pyrazolinyl, pyrazolidinyl, Thiazolinyl, thiazolidinyl, tetrahydroisothiazolyl, tetrahydrooxazolyl, tetrahydroisoxazolyl, piperidinyl, piperazinyl, tetrahydropyridinyl, dihydropyridinyl, dihydrothiopyranyl, tetrahydropyrimidinyl,
- preferred examples of the "7- to 10-membered heterocyclic bridged ring group” include quinuclidinyl and 7-azabicyclo[2.2.1]heptanyl.
- the "acyl group” includes a formyl group, a hydrocarbon-carbonyl group (C 1-6 alkyl-carbonyl group, a C 2-6 alkenyl-carbonyl group (eg, crotonoyl), a C 3-10 cycloalkyl -carbonyl groups (e.g. cyclobutanecarbonyl, cyclopentanecarbonyl, cyclohexanecarbonyl, cycloheptanecarbonyl), C 3-10 cycloalkenyl-carbonyl groups (e.g.
- 2-cyclohexenecarbonyl C 6-14 aryl-carbonyl groups, C 7 -16 aralkyl-carbonyl group), heterocyclic carbonyl group (e.g., 5- to 14-membered aromatic heterocyclic carbonyl group such as nicotinoyl, isonicotinoyl, thenoyl, furoyl, morpholinylcarbonyl, piperidinylcarbonyl, pyrrolidinylcarbonyl, etc.
- heterocyclic carbonyl group e.g., 5- to 14-membered aromatic heterocyclic carbonyl group such as nicotinoyl, isonicotinoyl, thenoyl, furoyl, morpholinylcarbonyl, piperidinylcarbonyl, pyrrolidinylcarbonyl, etc.
- alkoxy-carbonyl group e.g., C 1-6 alkoxy-carbonyl group such as methoxycarbonyl, ethoxycarbonyl
- aryloxy-carbonyl group e.g., phenyloxycarbonyl, C 6-14 aryloxy-carbonyl groups such as naphthyloxycarbonyl
- aralkyloxy-carbonyl groups e.g.
- C 7-16 aralkyloxy-carbonyl groups such as benzyloxycarbonyl, phenethyloxycarbonyl), carbamoyl groups, mono- or di-hydrocarbon-carbamoyl group (mono- or di-C 1-6 alkyl-carbamoyl group (e.g. methylcarbamoyl, ethylcarbamoyl, dimethylcarbamoyl, diethylcarbamoyl, N-ethyl-N-methylcarbamoyl), mono- or di- —C 2-6 alkenyl-carbamoyl group (e.g.
- diallycarbamoyl mono- or di-C 3-10 cycloalkyl-carbamoyl group (e.g. cyclopropylcarbamoyl), mono- or di-C 6-14 aryl-carbamoyl (e.g., phenylcarbamoyl), mono- or di-C 7-16 aralkyl-carbamoyl groups (e.g., benzylcarbamoyl, phenethylcarbamoyl)), heterocyclic carbamoyl groups (e.g., 5- to 14-membered aromatic heteroaromatic groups such as pyridylcarbamoyl).
- cycloalkyl-carbamoyl group e.g. cyclopropylcarbamoyl
- mono- or di-C 6-14 aryl-carbamoyl e.g., phenylcarbamoyl
- cyclic carbamoyl group thiocarbamoyl group, mono- or di-hydrocarbon-thiocarbamoyl group (mono- or di-C 1-6 alkyl-thiocarbamoyl group (e.g., methylthiocarbamoyl, N-ethyl-N-methylthiocarbamoyl) , mono- or di-C 2-6a alkenyl-thiocarbamoyl group (e.g. diallylthiocarbamoyl), mono- or di-C 3-10 cycloalkyl-thiocarbamoyl group (e.g.
- aryl-thiocarbamoyl group e.g., phenylthiocarbamoyl
- mono- or di-C 7-16 aralkyl-thiocarbamoyl group e.g., benzyl
- C 1-6 alkyl-carbonyl group eg, acetyl, propionyl, butyryl, isobutyryl, pentanoyl, hexanoyl, heptanoyl
- C 3-10 cycloalkyl-carbonyl group eg, cyclobutanecarbonyl, cyclo pentanecarbonyl, cyclohexanecarbonyl, cycloheptanecarbonyl
- C 6-14 aryl-carbonyl groups eg, benzoyl, 1-naphthoyl, 2-naphthoyl
- C 7-16 aralkyl-carbonyl groups eg, phenylacetyl, phenylpropionyl
- C 1-6 alkoxy-carbonyl groups e.g.
- acyloxy group means a group in which an acyl group is bonded to an oxygen atom, preferably formyloxy group, C 1-6 alkyl-carbonyloxy group (e.g., acetyloxy, propionyloxy, butyryloxy, isobutyryloxy, pentanoyloxy, hexanoyloxy, heptanoyl), C 3-10 cycloalkyl-carbonyloxy groups (e.g.
- cyclobutanecarbonyloxy cyclopentanecarbonyloxy, cyclohexanecarbonyloxy, cycloheptanecarbonyloxy
- C 6-14 aryl-carbonyloxy group e.g., benzoyloxy, 1-naphthoyloxy, 2-naphthoyloxy
- C 7-16 aralkyl-carbonyloxy group C 1-6 alkoxy-carbonyloxy group (e.g., methoxycarbonyloxy, ethoxycarbonyloxy, propoxycarbonyloxy, isopropoxycarbonyloxy, butoxycarbonyloxy, isobutoxycarbonyloxy, sec-butoxycarbonyloxy, tert-butoxycarbonyloxy, pentyloxycarbonyloxy, hexyloxycarbonyloxy), C 6-14 aryloxy-carbonyloxy group (e.g., benzyloxycarbonyloxy), C 7-16 aralkyloxy-
- C 1-6 alkylsulfanyl group means a group in which a straight or branched chain C 1-6 alkyl group is bonded to a sulfur atom, for example, methylsulfanyl, ethylsulfanyl, propylsulfanyl , isopropylsulfanyl, butylsulfanyl, isobutylsulfanyl, sec-butylsulfanyl, tert-butylsulfanyl, pentylsulfanyl, isopentylsulfanyl, neopentylsulfanyl, hexylsulfanyl.
- a C 1-4 alkylsulfanyl group is preferred.
- C 1-6 alkylsulfonyloxy group means a group in which a C 1-6 alkylsulfonyl group is bonded to an oxygen atom, such as methylsulfonyloxy, ethylsulfonyloxy, propylsulfonyloxy, isopropylsulfonyloxy, butylsulfonyloxy, isobutylsulfonyloxy, sec-butylsulfonyloxy, tert-butylsulfonyloxy, pentylsulfonyloxy, isopentylsulfonyloxy, neopentylsulfonyloxy, hexylsulfonyloxy.
- a C 1-4 alkylsulfonyloxy group is preferred.
- trisubstituted silyl group means three substituents selected from the group consisting of the same or different C 1-6 alkyl groups, C 6-14 aryl groups and C 1-6 alkoxy groups means a silyl group substituted with, for example, a trialkylsilyl group such as a trimethylsilyl group, a triethylsilyl group, a triisopropylsilyl group, a tert-butyldimethylsilyl group (preferably a triC 1-6 alkylsilyl group), A tert-butyldiphenylsilyl group and a triphenylsilyl group can be mentioned.
- a trialkylsilyl group such as a trimethylsilyl group, a triethylsilyl group, a triisopropylsilyl group, a tert-butyldimethylsilyl group (preferably a triC 1-6 alkylsilyl group)
- substituted means unsubstituted or substituted with a substituent at any substitutable position (an arbitrary hydrogen atom is replaced with a substituent) .
- substituted is not particularly limited, but includes substituents selected from the following (substituent group Z 1 ) or (substituent group Z 2 ). ) may be further substituted with a substituent selected from
- Substituent group Z (1) a halogen atom, (2) a cyano group, (3) a nitro group, (4) a hydroxy group, (5) a carboxy group, (6) an azide group, (7) a C 1-6 alkyl group, (8) a C 3-10 cycloalkyl group, (9) a C 6-14 aryl group, (10) a C 1-6 alkoxy group, (11) a formyl group, (12) C 1-6 alkyl-carbonyl group, (13) a C 1-6 alkoxy-carbonyl group, (14) a C 1-6 alkylsulfonyl group, (15) C 1-6 alkyl-carbonyloxy group, (16) a C 1-6 alkylsulfanyl group, (17) a trisubstituted silyl group, (18) a C 1-6 alkylsulfonyloxy group, and (19) C 6-14 arylsulfonyloxy group.
- the optionally substituted "substituent” is preferably a substituent selected from the following (substituent group Z 3 ) or (substituent group Z 4 ).
- a C 6-14 aryl group optionally substituted with 1 to 3 substituents, (10) a C 1-6 alkoxy group optionally substituted with a halogen atom, (11) a formyl group, (12) a C 1-6 alkyl-carbonyl group optionally substituted with a halogen atom, (13) a C 1-6 alkoxy-carbonyl group optionally substituted with a halogen atom, (14) a C 1-6 alkylsulfonyl group optionally substituted with a halogen atom, (15) a C 1-6 alkyl-carbonyloxy group optionally substituted with a halogen atom, (16) (a) a C 1-6 alkyl group optionally substituted with a halogen atom, (b) a C 3-10 cycloalkyl group optionally substituted with a halogen atom, (c) selected from the group consisting of a halogen atom, a cyano group, a nitro group
- a C 6-14 aryl group optionally substituted with 1 to 3 substituents, (9) a C 1-6 alkoxy group optionally substituted with a halogen atom, (10) a formyl group, (11) a C 1-6 alkyl-carbonyl group optionally substituted with a halogen atom, (12) a C 1-6 alkoxy-carbonyl group optionally substituted with a halogen atom, (13) a C 1-6 alkylsulfonyl group optionally substituted with a halogen atom, (14) a C 1-6 alkyl-carbonyloxy group optionally substituted with a halogen atom, (15) (a) a C 1-6 alkyl group optionally substituted with a halogen atom, (b) a C 3-10 cycloalkyl group optionally substituted with a halogen atom; (c) selected from the group consisting of a halogen atom, a cyano group, a nitro group
- the number of "substituents” that may be substituted is not particularly limited as long as it can be substituted, but is preferably 1 to 6, more preferably 1 to 3. When multiple substituents are present, each substituent may be the same or different.
- optionally substituted aryl group (phenyl group) "optionally substituted heterocyclic group” or “optionally substituted aromatic heterocyclic group (5- or 6-membered
- the optionally substituted “substituent” in “a monocyclic aromatic heterocyclic group or an 8- to 14-membered condensed aromatic heterocyclic group” is a substituent selected from the above (substituent group Z).
- a substituent selected from optionally substituted (substituent group Z 1 ) or (substituent group Z 3 ) is exemplified.
- the optionally substituted "substituent" in the “optionally substituted alkyl group” may be further substituted with a substituent selected from the above (substituent group Z) ( Substituent group Z 2 ) or a substituent selected from (substituent group Z 4 ).
- C 1-6 alkyl group optionally substituted with halogen atoms includes, for example, C 1 optionally substituted with 1 to 6, preferably 1 to 3 halogen atoms.
- -6 alkyl groups include methyl, chloromethyl, difluoromethyl, trichloromethyl, trifluoromethyl, ethyl, 2-bromoethyl, 2,2,2-trifluoroethyl, tetrafluoroethyl, pentafluoroethyl, propyl, 2,2- difluoropropyl, 3,3,3-trifluoropropyl, isopropyl, butyl, 4,4,4-trifluorobutyl, isobutyl, sec-butyl, tert-butyl, pentyl, isopentyl, neopentyl, 5,5,5-trifluoropropyl fluoropentyl, hexyl, 6,6,6-trifluorobutyl, is
- C 1-6 alkoxy group optionally substituted with halogen atoms includes, for example, C 1 optionally substituted with 1 to 6, preferably 1 to 3 halogen atoms.
- -6 alkoxy groups include methoxy, difluoromethoxy, trifluoromethoxy, ethoxy, 2,2,2-trifluoroethoxy, propoxy, isopropoxy, butoxy, 4,4,4-trifluorobutoxy, isobutoxy, sec-butoxy, pentyl oxy and hexyloxy.
- C 1-6 alkylsulfanyl group optionally substituted with halogen atoms is, for example, C optionally substituted with 1 to 6, preferably 1 to 3 halogen atoms
- a 1-6 alkylthio group can be mentioned. Specific examples include methylthio, difluoromethylthio, trifluoromethylthio, ethylthio, propylthio, isopropylthio, butylthio, 4,4,4-trifluorobutylthio, pentylthio and hexylthio.
- C 1-6 alkyl-carbonyl group optionally substituted with halogen atoms may be substituted with, for example, 1 to 6, preferably 1 to 3 halogen atoms. and C 1-6 alkyl-carbonyl groups. Specific examples include acetyl, chloroacetyl, trifluoroacetyl, trichloroacetyl, propanoyl, butanoyl, pentanoyl and hexanoyl.
- C 1-6 alkyl-carbonyloxy group optionally substituted with halogen atoms is, for example, substituted with 1 to 6, preferably 1 to 3 halogen atoms.
- good C 1-6 alkyl-carbonyloxy groups include acetoxy, chloroacetoxy, trifluoroacetoxy, trichloroacetoxy, propanoyloxy, butanoyloxy, pentanoyloxy and hexanoyloxy.
- C 1-6 alkylsulfonyl group optionally substituted by halogen atoms is, for example, C optionally substituted by 1 to 6, preferably 1 to 3 halogen atoms
- a 1-6 alkylsulfonyl group can be mentioned.
- Specific examples include methylsulfonyl, difluoromethylsulfonyl, trifluoromethylsulfonyl, ethylsulfonyl, propylsulfonyl, isopropylsulfonyl, butylsulfonyl, 4,4,4-trifluorobutylsulfonyl, pentylsulfonyl and hexylsulfonyl.
- C 1-6 alkylsulfonyloxy group optionally substituted with halogen atoms may be substituted with, for example, 1 to 6, preferably 1 to 3 halogen atoms. and C 1-6 alkylsulfonyloxy groups. Specific examples include methylsulfonyloxy, difluoromethylsulfonyloxy, trifluoromethylsulfonyloxy, ethylsulfonyloxy, propylsulfonyloxy, isopropylsulfonyloxy, butylsulfonyloxy, 4,4,4-trifluorobutylsulfonyloxy, pentylsulfonyloxy. oxy, hexylsulfonyloxy;
- salt thereof refers to a salt produced by reacting with a base or an acid when the compound has an acidic group or a basic group. salts, salts with inorganic bases, salts with organic bases, ammonium salts, salts with amino acids, and the like.
- the group represented by represents an aryl group or an aromatic heterocyclic group, each of which may be further substituted.
- a C 6-14 aryl group is preferably a C 6-14 aryl group, a 5- or 6-membered monocyclic aromatic heterocyclic group or an 8- to 14-membered condensed aromatic heterocyclic group, more preferably phenyl group, naphthyl group, or 5- or 6-membered monocyclic aromatic heterocyclic group, more preferably phenyl group, naphthyl group, pyridyl group, furyl group or thienyl group, particularly preferably phenyl group, It is a naphthyl group, a pyridyl group, a furyl group or a thienyl group, each of which may further have a substituent at a substitutable position.
- the number of substituents is not particularly limited as long as it can be substituted, but is preferably 1 to 6, more preferably 1 to 3. When multiple substituents are present, each substituent may be the same or different.
- the "substituent” that may be further substituted may be further substituted with a substituent selected from the above-described substituent group (for example, (substituent group Z) (substituent group Z 1 ), or a substituent selected from (substituent group Z 3 )).
- R 1 and R 3 each independently represent a linear C 1-6 alkyl group.
- R 1 and R 3 are preferably each independently a linear C 1-4 alkyl group, more preferably a methyl group, an ethyl group or an n-propyl group, still more preferably ethyl is the base.
- R 2 and R 4 each independently represent a linear C 2-6 alkyl group.
- R 2 and R 4 are preferably linear C 2-4 alkyl groups, more preferably ethyl groups or n-propyl groups, still more preferably ethyl groups.
- n an integer of 1 or more.
- n is preferably an integer of 1 to 3, more preferably 1 or 2.
- Each of the groups represented by may be further substituted with a substituent selected from (substituent group Z) (substituent group Z 1 ) (preferably, (substituted a C 6-14 aryl group, a 5- or 6-membered monocyclic aromatic heterocyclic group, or an 8- to 14-membered condensed aromatic heterocyclic group optionally substituted with a substituent selected from group Z 3 )); is a cyclic group; R 1 and R 3 are each independently a linear C 1-4 alkyl group; R 2 and R 4 are each independently a linear C 2-4 alkyl group, and n is an integer from 1 to 3; Compound (I).
- Each of the groups represented by may be further substituted with a substituent selected from (substituent group Z) (substituent group Z 1 ) (preferably, (substituted a phenyl group, a naphthyl group, or a 5- or 6-membered monocyclic aromatic heterocyclic group optionally substituted with a substituent selected from group Z 3 );
- R 1 and R 3 are each independently a linear C 1-4 alkyl group;
- R 2 and R 4 are each independently a linear C 2-4 alkyl group, and n is an integer from 1 to 3;
- Compound (I) is preferably, (substituted a phenyl group, a naphthyl group, or a 5- or 6-membered monocyclic aromatic heterocyclic group optionally substituted with a substituent selected from group Z 3 );
- R 1 and R 3 are each independently a linear C 1-4 alkyl group;
- R 2 and R 4 are each independently a linear C 2-4
- R 1 and R 3 are each independently a linear C 1-4 alkyl group;
- R 2 and R 4 are each independently a linear C 2-4 alkyl group, and n is an integer from 1 to 3;
- Compound (I) is a phenyl group, a naphthyl group, a pyridyl group, a furyl group or a thienyl group, each optionally substituted with a substituent selected from the above (substituent group Z 3 ),
- R 1 and R 3 are each independently a linear C 1-4 alkyl group;
- R 2 and R 4 are each independently a linear C 2-4 alkyl group, and n is an integer from 1 to 3;
- Compound (I) is a phenyl group, a naphthyl group, a pyridyl group, a furyl group or a thienyl group, each optionally substituted with a substituent selected from the above (substituent group Z 3 ),
- R 1 and R 3 are a methyl group, an ethyl group or an n-propyl group, R 2 and R 4 are an ethyl group or an n-propyl group, and n is 1 or 2; Compound (I).
- R 1 , R 2 , R 3 and R 4 are ethyl groups or n-propyl groups, and n is 1 or 2; Compound (I).
- compound (I) include the compounds of Examples I-1 to I-21.
- salts include, for example, salts with inorganic bases, ammonium salts, salts with organic bases, salts with inorganic acids, salts with organic acids, basic Examples include salts with amino acids, salts with acidic amino acids, and the like.
- salts with inorganic bases include alkali metal salts such as sodium salts and potassium salts; alkaline earth metal salts such as calcium salts, magnesium salts and barium salts; and aluminum salts.
- salts with organic bases include salts with trimethylamine, triethylamine, pyridine, picoline, ethanolamine, diethanolamine, triethanolamine, dicyclohexylamine, N,N'-dibenzylethylenediamine, and the like.
- salts with inorganic acids include salts with hydrochloric acid, hydrobromic acid, nitric acid, sulfuric acid, phosphoric acid, and the like.
- Suitable examples of salts with organic acids include formic acid, acetic acid, trifluoroacetic acid, fumaric acid, oxalic acid, tartaric acid, maleic acid, citric acid, succinic acid, malic acid, methanesulfonic acid, benzenesulfonic acid, p- Salts with toluenesulfonic acid and the like are included.
- salts with basic amino acids include salts with arginine, lysine, ornithine and the like.
- salts with acidic amino acids include salts with aspartic acid, glutamic acid, and the like.
- Compound (I) includes solvates (eg, hydrates, ethanolates, dimethylsulfoxide solutes, etc.) and non-solvates (eg, non-hydrates, etc.) within its scope.
- solvates eg, hydrates, ethanolates, dimethylsulfoxide solutes, etc.
- non-solvates eg, non-hydrates, etc.
- Compound (I) may be a compound labeled or substituted with an isotope (eg, 2 H, 3 H, 11 C, 14 C, 18 F, 35 S, 125 I, etc.).
- an isotope eg, 2 H, 3 H, 11 C, 14 C, 18 F, 35 S, 125 I, etc.
- isomers such as enantiomers or diastereomers may exist. All such isomers and mixtures thereof are included within the scope of this invention. Further, isomers may be produced due to conformation or tautomerism, and such isomers or mixtures thereof are also included in the compound (I) of the present invention.
- the raw materials and reagents used in each step of the manufacturing method below, as well as the resulting compound, may each form a salt.
- Such salts include, for example, the same salts as those of compound (I) described above.
- the compound obtained in each step is a free compound, it can be converted into the desired salt by a method known per se. Conversely, when the compound obtained in each step is a salt, it can be converted into the free form or other desired salt by a method known per se.
- the compound obtained in each step can be used in the next reaction after being obtained as a reaction solution or as a crude product, or the compound obtained in each step can be concentrated from the reaction mixture in accordance with a conventional method. , crystallization, recrystallization, distillation, solvent extraction, fractionation, chromatography, and the like.
- the raw materials and reagent compounds for each process are commercially available, the commercially available products can be used as they are.
- reaction in each step is a method known per se, for example, 5th edition Jikken Kagaku Koza, vols. 13-19 (edited by The Chemical Society of Japan); Chemistry Society ed.); Fine Organic Chemistry Revised 2nd Edition (L. F. Tietze, Th.
- the protection or deprotection reaction of the functional group is performed by a method known per se, for example, Wiley-Interscience 2007 "Protective Groups in Organic Synthesis, 4th Ed.” (Theodora W. Greene, Peter G. M. Wuts by P. J. Kocienski), or according to the method described in Examples.
- compound (I) contains optical isomers, stereoisomers, positional isomers, and rotational isomers, known synthetic techniques and separation techniques (concentration, solvent extraction, column chromatography, recrystallization, etc.) Each can be obtained as a single item by
- Optical isomers can be produced by methods known per se. Specifically, optical isomers are obtained by using optically active synthetic intermediates or by optically resolving the racemic form of the final product according to a conventional method.
- This production method is a method for producing compound (I), which includes a step of reacting compound (II) with compound (III) in a solvent that does not adversely affect the reaction.
- the amount of compound (III) to be used is generally 1 mol-1.5 mol, preferably 1 mol-1.2 mol, per 1 mol of the boronic acid group of compound (II).
- the solvent is not particularly limited, but ether solvents such as diethyl ether, methyl tert-butyl ether, 1,4-dioxane, cyclopentyl methyl ether, and 4-methyltetrahydropyran; halogenated hydrocarbons such as chloroform and dichloromethane; toluene , aromatic hydrocarbons such as benzene, etc., which separate from water, among which dichloromethane is preferred.
- the reaction temperature is usually 0° C. to 100° C., preferably room temperature (15° C. to 30° C.).
- the reaction time is usually 2 to 24 hours, preferably 8 to 24 hours.
- a catalytic amount of acetic acid may also be added to accelerate the reaction.
- This production method comprises a step of reacting compound (IV) with isopropylmagnesium chloride-lithium chloride complex (i-PrMgCl-LiCl) or n-butyllithium (n-BuLi) in a solvent that does not adversely affect the reaction (step 1)
- a method for producing compound (I) comprising a step (step 3) of reacting with compound (III) via a step of reacting with trimethoxyborane (B(OMe) 3 ) (step 2).
- Step 1 The amount of isopropylmagnesium chloride-lithium chloride complex (i-PrMgCl—LiCl) or n-butyllithium (n-BuLi) to be used is generally 1 mol-1.5 per 1 mol of X 1 group in compound (IV). mol, preferably 1.2 mol.
- the solvent is not particularly limited, but includes ether solvents such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane, among which tetrahydrofuran is preferred.
- the reaction temperature is usually -78°C to -10°C, preferably -78°C to -40°C.
- the reaction time is usually 0.5 to 24 hours, preferably 1 to 12 hours.
- Step 2 The amount of trimethoxyborane (B(OMe) 3 ) to be used is generally 1.5 mol-3 mol, preferably 2 mol, per 1 mol of X 1 group of compound (IV).
- the solvent the solvent used in step 1 is preferred.
- the reaction temperature is generally 0° C. to 60° C., preferably room temperature (15° C. to 30° C.).
- the reaction time is usually 2 to 24 hours, preferably 8 to 24 hours.
- the reaction mixture of step 2 can be directly subjected to step 3 after work-up.
- the amount of compound (III) to be used is generally 1-1.5 mol, preferably 1 mol-1.2 mol, per 1 mol of X 1 group of compound (IV).
- the solvent is not particularly limited, but ether solvents such as diethyl ether, methyl tert-butyl ether, 1,4-dioxane, cyclopentyl methyl ether, and 4-methyltetrahydropyran; halogenated hydrocarbons such as chloroform and dichloromethane; toluene , aromatic hydrocarbons such as benzene, etc., which separate from water, among which dichloromethane is preferred.
- the reaction temperature is generally 0° C. to 60° C., preferably room temperature (15° C. to 30° C.).
- the reaction time is usually 2 to 24 hours, preferably 8 to 24 hours.
- This production method is a method for producing compound (I), which includes a step (step 1) of reacting compound (V) with compound (VI) in the presence of a metal catalyst in a solvent that does not adversely affect the reaction.
- the amount of compound (VI) to be used is generally 1 mol-2 mol, preferably 1.5 mol, per 1 mol of X 2 group of compound (V).
- Metal catalysts include palladium(II) acetate, palladium(II) chloride, [1,3-bis(diphenylphosphino)propane]palladium(II) dichloride (PdCl 2 (dppp)), 1,1-bis(diphenyl palladium catalysts such as phosphino)ferrocene-palladium(II) dichloride, dichlorobis(triphenylphosphine)palladium(II), dichlorobis(tricyclohexylphosphine)palladium(II); zinc catalysts such as dimethylzinc, diethylzinc; iron catalysts such as ferric iron(III) (Fe(acac) 3 ), iron(II) chloride; Ni 2 (Icy) 4 ( ⁇ -( ⁇ 2 :
- the amount of the metal catalyst to be used is generally 0.001 mol to 0.5 mol, preferably 0.01 mol to 0.2 mol, more preferably 1 mol of X 2 groups in compound (V). is 0.01 to 0.1 mol.
- the solvent can be arbitrarily selected depending on the type of metal catalyst used, but ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents; halogenated hydrocarbons such as chloroform and dichloromethane; nitrile solvents such as acetonitrile; amide solvents such as N,N-dimethylformamide and N,N-dimethylacetamide; sulfoxide solvents such as dimethylsulfoxide; Among them, tetrahydrofuran and dimethylsulfoxide are preferred.
- a base may be added as necessary.
- bases include sodium tert-butoxide, potassium methoxide, sodium methoxide, magnesium tert-butoxide, potassium acetate, sodium acetate, tripotassium phosphate, cesium carbonate, potassium carbonate, sodium hydrogen carbonate, triethylamine, diisopropylethylamine, dicyclohexylethylamine. , potassium fluoride, cesium fluoride, etc. Among them, potassium acetate and sodium acetate are preferable.
- the amount of the base to be used is generally 1 mol to 10 mol, preferably 1 mol to 5 mol, more preferably 1.5 to 3 mol, per 1 mol of X 2 group of compound (V). .
- the reaction temperature is generally 0°C to 100°C, preferably 60°C to 100°C, more preferably 80°C.
- the reaction time is usually 1 to 12 hours, preferably 1 to 3 hours.
- Compound (VI) used in production method (3) can be produced by a method represented by the following Reaction Scheme 4 or a method analogous thereto.
- Reaction formula 4
- This production method includes a step of dehydration condensation of tetrahydroxydiboron (compound (XII)) with compound (III) in the presence of a base in a solvent that does not adversely affect the reaction.
- the amount of compound (III) to be used is generally 2 mol-3 mol, preferably 2 mol, per 1 mol of compound (XII).
- bases include sodium tert-butoxide, potassium methoxide, sodium methoxide, magnesium tert-butoxide, potassium acetate, sodium acetate, tripotassium phosphate, cesium carbonate, potassium carbonate, sodium hydrogen carbonate, triethylamine, diisopropylethylamine, dicyclohexylethylamine.
- potassium acetate is preferred.
- the amount of the base to be used is generally 2 mol-5 mol, preferably 2 mol-3 mol, per 1 mol of compound (XII).
- the solvent include, but are not particularly limited to, aromatic hydrocarbon solvents such as benzene, toluene, and xylene. Among them, toluene is preferred.
- the reaction temperature is preferably the heating reflux temperature of the solvent, and this step is usually carried out using a Dean-Stark apparatus.
- the reaction time is usually 2 to 36 hours, preferably 12 to 24 hours.
- Compound (I) obtained by the above production methods (1) to (3) is extremely stable as compared to the corresponding boronic acid pinacol ester, and therefore can be subjected to silica gel chromatography (silica gel) as described in the test examples described later. column chromatography, thin-layer silica gel chromatography, etc.) can be easily purified with a good recovery rate.
- compound (I) can stably exist and is acidic. It was confirmed to exhibit high stability under the conditions.
- Compound (I) is not only superior in stability as compared with the corresponding boronic acid pinacol ester, but also can be widely used in various functionalization reactions like the corresponding boronic acid pinacol ester. Typical examples of various functionalization methods using compound (I) are described below, but applicable functionalization methods are not limited to these. Compound (I) is generally applicable to various conventionally known functionalization reactions using pinacol boronic acid esters.
- the amount of compound (VII) to be used is generally 0.5 mol-0.7 mol, preferably 0.7 mol, per 1 mol of the boron ester group of compound (I).
- Metal catalysts include palladium(II) acetate, palladium(II) chloride, tris(dibenzylideneacetone)dipalladium(0), bis(dibenzylideneacetone)palladium(0), tetrakis(triphenylphosphine)palladium(0).
- the amount of the metal catalyst to be used is generally 0.001 mol to 0.5 mol, preferably 0.005 mol to 0.1 mol, and more preferably 1 mol of the boron ester group of compound (I). is 0.005 to 0.05 mol.
- the solvent can be arbitrarily selected depending on the type of metal catalyst used, but ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents; chloroform, halogenated hydrocarbons such as dichloromethane; nitrile solvents such as acetonitrile; amide solvents such as N,N-dimethylformamide and N,N-dimethylacetamide; sulfoxide solvents such as dimethylsulfoxide; aromatic hydrocarbon solvents such as toluene and xylene; and mixed solvents of these organic solvents and water.
- ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents
- chloroform, halogenated hydrocarbons such
- bases include potassium hydroxide, potassium acetate, sodium acetate, tripotassium phosphate, cesium carbonate, potassium carbonate, sodium hydrogen carbonate, triethylamine, diisopropylethylamine, dicyclohexylethylamine, potassium fluoride, cesium fluoride, rubidium carbonate, and the like.
- tripotassium phosphate is preferred.
- the amount of the base to be used is generally 1 mol to 10 mol, preferably 1 mol to 5 mol, more preferably 1.5 to 3 mol, per 1 mol of the boron ester group of compound (I).
- the reaction temperature is generally 60°C to 120°C, preferably 90°C to 120°C, more preferably 110°C.
- the reaction time is usually 1 to 48 hours, preferably 12 to 24 hours.
- the amount of the peracid to be used is generally 1 mol-2 mol, preferably 1 mol-1.5 mol, per 1 mol of the boron ester group of compound (I).
- peracids include sodium perborate (NaBO 3 ), sodium periodate (under acidic conditions), hydrogen peroxide, and the like. Among them, sodium perborate (NaBO 3 ) and its hydrates are preferred.
- the solvent can be arbitrarily selected depending on the type of peracid used, but ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents; chloroform, halogenated hydrocarbons such as dichloromethane; nitrile solvents such as acetonitrile; amide solvents such as N,N-dimethylformamide and N,N-dimethylacetamide; sulfoxide solvents such as dimethylsulfoxide; aromatic hydrocarbon solvents such as toluene and xylene; and mixed solvents of these organic solvents and water.
- the reaction temperature is usually 0° C. to 100° C., preferably room temperature (15° C. to 30° C.).
- the reaction time is generally 1 to 48 hours, preferably 8 to 24 hours.
- Compound (XI) can be produced by reacting compound (I) with compound (X) in the presence of a metal catalyst and a base according to the method shown in Reaction Scheme 7 below or a method analogous thereto. Reaction formula 7
- the amount of compound (X) to be used is generally 0.5 mol-2 mol, preferably 0.5 mol-1 mol, per 1 mol of the boron ester group of compound (I).
- Metal catalysts include copper (II) acetate, copper (I) chloride, copper (I) bromide, copper (I) iodide, copper (II) nitrate, copper (I) bis(trifluoromethanesulfonate), bis Copper catalysts such as copper (I) (trifluoroacetate); nickel catalysts such as nickel (II) chloride, nickel (II) acetate, and nickel (II) nitrate; Copper acetate is more preferred.
- the amount of the metal catalyst to be used is generally 0.001 mol to 0.5 mol, preferably 0.005 mol to 0.1 mol, and more preferably 1 mol of the boron ester group of compound (I). is 0.01 to 0.05 mol.
- the solvent can be arbitrarily selected depending on the type of metal catalyst used, but ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents; chloroform, halogenated hydrocarbons such as dichloromethane; nitrile solvents such as acetonitrile; amide solvents such as N,N-dimethylformamide and N,N-dimethylacetamide; sulfoxide solvents such as dimethylsulfoxide; aromatic hydrocarbon solvents such as toluene and xylene; and mixed solvents of these organic solvents and water.
- ethers such as diethyl ether, tetrahydrofuran, methyl tert-butyl ether, 1,2-dimethoxyethane, and 1,4-dioxane system solvents
- chloroform, halogenated hydrocarbons such
- Examples of the base include potassium acetate, sodium acetate, tripotassium phosphate, cesium carbonate, potassium carbonate, sodium hydrogen carbonate, triethylamine, diisopropylethylamine, dicyclohexylethylamine, potassium fluoride, cesium fluoride, rubidium carbonate, and the like. Among them, cesium fluoride is preferred.
- the amount of the base to be used is generally 0.5 mol to 10 mol, preferably 0.5 mol to 3 mol, more preferably 0.5 to 1 mol, per 1 mol of the boron ester group of compound (I). 1 mol.
- the reaction temperature is generally 15°C to 100°C, preferably 20°C to 60°C, more preferably 40°C.
- the reaction time is usually 1 to 48 hours, preferably 12 to 24 hours.
- room temperature means a temperature of 15 to 30°C unless otherwise specified.
- the ratios shown for mixed solvents are volume ratios unless otherwise specified. % indicates % by weight unless otherwise specified.
- the zinc powder was stirred in 1.0 M hydrochloric acid under a nitrogen stream for 30 minutes, washed with distilled water and diethyl ether, dried under reduced pressure for 6 hours, and stored in an argon atmosphere to be used as active zinc powder.
- a dichloromethane (0.40 L) suspension of active zinc powder 13 g, 0.20 mol
- a 1.0 M titanium tetrachloride dichloromethane solution (0.10 L, 0.10 mol)
- pivalonitrile 40 mL, 0 .40 mol
- a dichloromethane solution (50 mL, 50 mmol) of 1.0 M titanium tetrachloride was added to a dichloromethane (0.20 L) suspension of active zinc powder (6.5 g, 0.10 mol) prepared by the same method as in Production Example 1. After that, pivalonitrile (22 mL, 0.20 mol) was slowly added dropwise at 0°C. After stirring the reaction suspension for another 30 minutes at room temperature, a solution of 4-heptanone (7.0 mL, 50 mmol) in dichloromethane (0.15 L) was slowly added dropwise at 0°C.
- reaction mixture was stirred at room temperature for 16 hours, and saturated aqueous ammonium chloride solution was added at room temperature to quench the reaction.
- Tetrahydroxydiboron (0.38 g, 4.2 mmol), 3,4-diethylhexane-3,4-diol (1.5 g, 8.4 mmol) and potassium acetate (1.0 g, 11 mmol) were added under a nitrogen stream. Diluted in toluene (40 mL) and heated to reflux using a Dean-Stark apparatus for 16 hours. Thereafter, the reaction mixture was allowed to cool to room temperature, filtered through celite, and the solvent was distilled off to obtain 4,4,4',4',5,5,5',5'-octaethyl-2,2'.
- Examples I-1 to I-21 (synthesis of compounds (I-1) to (I-21)) (Manufacturing method 1) General method for producing 3,4-diethylhexane-3,4-diol ester of boronic acid (1) Under a nitrogen stream, a dichloromethane suspension (0.10 M) of arylboronic acid (boronic acid group: 1.0 mol) and 3,4-diethylhexane-3,4-diol (1.0 mol) was prepared at room temperature for 16 hours. After stirring, water was added to stop the reaction. The reaction mixture was extracted three times with dichloromethane and dried over anhydrous magnesium sulfate.
- trimethoxyborane (2.0 mol) was added dropwise, and after stirring overnight at room temperature, a saturated aqueous ammonium chloride solution was added to stop the reaction.
- the reaction mixture was extracted three times with ethyl acetate and dried over anhydrous magnesium sulfate. After distilling off the solvent, 3,4-diethylhexane-3,4-diol (1.0 mol) and dichloromethane were added to the residue, and the mixture was stirred at room temperature.
- the resulting reaction solution was diluted with ethyl acetate, filtered through silica gel, and the solvent was distilled off under reduced pressure.
- the residue was purified by silica gel column chromatography (n-hexane/ethyl acetate) to obtain 3,4-diethylhexane-3,4-diol ester of arylboronic acid.
- Examples I-1 to I-21 were synthesized according to or according to Production Method 1, Production Method 2, or Production Method 3.
- Tables 1-1 to 1-5 below show the chemical structure, yield and physical property data of each example compound.
- Test example 1 Stability evaluation of compound (I) against silica gel chromatography
- Comparison of compound (I-1), compound (I-18) and compound (I-19) with phenylboronic acid pinacol ester (Comparative Example 1)
- Experiment 100 mg each of pure compound (I-1), compound (I-18), compound (I-19) and phenylboronic acid pinacol ester (Comparative Example 1) were separately added to an eggplant flask as test compounds. It was dissolved in dichloromethane (1.0 mL) and silica gel (about 600 mg) was added. The solvent was distilled off from this suspension under reduced pressure using an evaporator, and the test compound was adsorbed onto silica gel (from mixing to adsorption within about 5 minutes).
- Test example 2 Stability evaluation of compound (I) against deprotection reaction conditions of pinacol ester Pinacol ester of p-tolylboronic acid (Comparative Example 7) is usually prepared in a mixed solvent of THF-water under acidic conditions of hydrochloric acid (1N hydrochloric acid), It was deprotected by sodium iodate and converted to arylboronic acid (yield: 62%). When compound (I-2) was subjected to the same deprotection conditions, deprotection hardly proceeded and compound (I-2) was recovered in a yield of 87%. In addition, it was confirmed to be stable under acidic conditions (acidic conditions with hydrochloric acid) and basic conditions (in the presence of sodium hydroxide and lithium hydroxide).
- Test Example 3 (various functionalization reactions using compound (I)) [1] Suzuki-Miyaura coupling reaction using compound (I) (manufacturing method 4) Compound (I) (boryl group: 1.5 mol), aryl halide (Compound (VII)) (1.0 mol), palladium acetate (1.0 mol%), SPhos (2. 0 mol %) and a toluene/water (10/1) solution (1.0 M) of tripotassium phosphate (2.0 mol) were heated at 110° C. and stirred for 24 hours.
- Compound (I) (boryl group: 1.5 mol), aryl halide (Compound (VII)) (1.0 mol), palladium acetate (1.0 mol%), SPhos (2. 0 mol %) and a toluene/water (10/1) solution (1.0 M) of tripotassium phosphate (2.0 mol) were heated at 110° C. and stirred for 24 hours.
- the present invention it is possible to provide a novel aromatic boronic ester that is extremely stable without being decomposed or adsorbed even on silica gel column chromatography or thin layer chromatography, and that can be easily isolated and purified. .
- the compound of the present invention exhibits reactivity equivalent to or superior to that of the conventionally widely used aromatic boronic acid pinacol ester, it can be applied to Suzuki-Miyaura coupling reactions and various functionalization reactions. and is extremely useful as a raw material compound or synthetic intermediate for various pharmaceuticals and functional materials.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Abstract
L'invention vise à fournir un nouvel ester d'acide boronique aromatique qui est utile dans divers types de fonctionnalisation et peut être isolé et purifié sans être adsorbé même dans une chromatographie sur gel de silice. La présente invention concerne un composé représenté par la formule (I) : [dans la formule, chaque symbole est tel que décrit dans la description], ou un sel de celui-ci, et son procédé de production.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2023503795A JPWO2022186098A1 (fr) | 2021-03-01 | 2022-02-28 |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP2021031904 | 2021-03-01 | ||
JP2021-031904 | 2021-03-01 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2022186098A1 true WO2022186098A1 (fr) | 2022-09-09 |
Family
ID=83154432
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/JP2022/008131 WO2022186098A1 (fr) | 2021-03-01 | 2022-02-28 | Nouvel ester d'acide boronique aromatique stable |
Country Status (2)
Country | Link |
---|---|
JP (1) | JPWO2022186098A1 (fr) |
WO (1) | WO2022186098A1 (fr) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN116655674A (zh) * | 2023-01-16 | 2023-08-29 | 中国科学院兰州化学物理研究所 | 一种合成高丰度硼10同位素的联硼酸酯的方法 |
Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP2012528084A (ja) * | 2009-05-27 | 2012-11-12 | レオ ファーマ アクティーゼルスカブ | 新規のカルシウム感知受容体調節化合物およびその医薬用途 |
WO2020117938A1 (fr) * | 2018-12-04 | 2020-06-11 | University Of Maryland, Baltimore | Promédicaments d'agents thérapeutiques contre le cancer et les maladies auto-immunes, et leurs procédés de production et d'utilisation |
-
2022
- 2022-02-28 JP JP2023503795A patent/JPWO2022186098A1/ja active Pending
- 2022-02-28 WO PCT/JP2022/008131 patent/WO2022186098A1/fr active Application Filing
Patent Citations (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JP2012528084A (ja) * | 2009-05-27 | 2012-11-12 | レオ ファーマ アクティーゼルスカブ | 新規のカルシウム感知受容体調節化合物およびその医薬用途 |
WO2020117938A1 (fr) * | 2018-12-04 | 2020-06-11 | University Of Maryland, Baltimore | Promédicaments d'agents thérapeutiques contre le cancer et les maladies auto-immunes, et leurs procédés de production et d'utilisation |
Non-Patent Citations (1)
Title |
---|
JACOBSEN MIKKEL F., ANDERSEN CASPER S., KNUDSEN MARTIN M., GOTHELF KURT V.: "Synthesis of Rigid Homo- and Heteroditopic Nucleobase-Terminated Molecules Incorporating Adenine and/or Thymine", ORGANIC LETTERS, vol. 9, no. 15, 1 July 2007 (2007-07-01), US , pages 2851 - 2854, XP055962921, ISSN: 1523-7060, DOI: 10.1021/ol071006x * |
Cited By (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN116655674A (zh) * | 2023-01-16 | 2023-08-29 | 中国科学院兰州化学物理研究所 | 一种合成高丰度硼10同位素的联硼酸酯的方法 |
CN116655674B (zh) * | 2023-01-16 | 2024-04-16 | 中国科学院兰州化学物理研究所 | 一种合成高丰度硼10同位素的联硼酸酯的方法 |
Also Published As
Publication number | Publication date |
---|---|
JPWO2022186098A1 (fr) | 2022-09-09 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP3008078A1 (fr) | Catalyseurs pour une métathèse z-sélective efficace | |
WO2022186098A1 (fr) | Nouvel ester d'acide boronique aromatique stable | |
EA026089B1 (ru) | Способ и промежуточные соединения для получения ингибиторов интегразы | |
EP3063154B1 (fr) | Couplage croisé d'acides boroniques secondaires non activés | |
Pietruszka et al. | Diastereo‐and Enantiomerically Pure Allylboronates: Their Synthesis and Scope | |
Cunningham et al. | On the use of mixtures of organotin species for catalytic enantioselective ketone allylation—A detective story | |
JP5271503B2 (ja) | 有機ホウ素化合物の製造方法 | |
US11053265B2 (en) | Optically active substituted 2,3-bisphosphinoquinoxalines and processes for producing the same | |
Talanov et al. | Highly selective preparation of conformationally rigid stereoisomeric calix [4] arenes with two carboxymethoxy groups | |
JP5896407B2 (ja) | トリアジン化合物 | |
Singh et al. | Synthesis and characterization of novel trifluoromethyl-containing alcohols with Ruppert's reagent | |
CN104994949B (zh) | 制备4‑甲基戊‑3‑烯‑1‑醇衍生物的方法 | |
US10221203B2 (en) | Chiral dihydrobenzooxaphosphole ligands and synthesis thereof | |
Xie et al. | A base-promoted desalicyloylative dimerization of 3-(1-alkynyl) chromones: An unusual approach to 2-alkynyl xanthones | |
JP4987197B2 (ja) | 光学活性トリハロアニリノ誘導体の製造方法および光学活性ホスフィン配位子 | |
CN111655708B (zh) | 2,3-双膦基吡嗪衍生物、其制造方法、配位化合物和催化剂、有机硼化合物的制造方法 | |
ES2942280T3 (es) | Procesos para preparar ácido 2-isoprenil-5-metil-4-hexenoico, 2-isoprenil-5-metil-4-hexen-1-ol y un éster carboxilato del mismo | |
CN112939827B (zh) | 基于CaC2催化的β-酮亚砜制备方法 | |
JP7069109B2 (ja) | 複素環化合物の製造方法 | |
Gärtner et al. | [1, 2]-Wittig rearrangement of acetals. Part 2: The influence of reaction conditions | |
Strazzolini et al. | The reaction between ethanedioyl (oxalyl) dihalides and Ag 2 C 2 O 4: a route to Staudinger’s elusive ethanedioic (oxalic) acid anhydride | |
KR101006737B1 (ko) | 구리 촉매를 이용한 2-술포닐이미노인돌린 제조방법 | |
US8822696B2 (en) | Ligand for asymmetric synthesis catalyst, and process for production of alpha-alkenyl cyclic compound using the same | |
CN105294675A (zh) | 千金藤啶碱及其衍生物的制备方法 | |
Xiao et al. | The Chemistry of Tetrafluoroallene: One‐pot Synthesis of Trifluoromethylindolizines from 1, 3‐Diiodo‐1, 1, 3, 3‐tetrafluoropropane by 1, 3‐Dipolar Cycloaddition |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 22763154 Country of ref document: EP Kind code of ref document: A1 |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2023503795 Country of ref document: JP |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
122 | Ep: pct application non-entry in european phase |
Ref document number: 22763154 Country of ref document: EP Kind code of ref document: A1 |