WO2001010843A1 - Derives de 4-(phenyl substitue)-5-halopyrimidine et herbicides contenant ces derives comme ingredients actifs - Google Patents
Derives de 4-(phenyl substitue)-5-halopyrimidine et herbicides contenant ces derives comme ingredients actifs Download PDFInfo
- Publication number
- WO2001010843A1 WO2001010843A1 PCT/JP2000/005222 JP0005222W WO0110843A1 WO 2001010843 A1 WO2001010843 A1 WO 2001010843A1 JP 0005222 W JP0005222 W JP 0005222W WO 0110843 A1 WO0110843 A1 WO 0110843A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- group
- atom
- general formula
- compound
- hydrogen atom
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title claims abstract description 36
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title claims description 35
- 239000004480 active ingredient Substances 0.000 title claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 74
- 125000005843 halogen group Chemical group 0.000 claims abstract description 30
- 125000001424 substituent group Chemical group 0.000 claims abstract description 21
- -1 acryl group Chemical group 0.000 claims description 465
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 81
- 125000003342 alkenyl group Chemical group 0.000 claims description 44
- 125000000304 alkynyl group Chemical group 0.000 claims description 38
- 229910052757 nitrogen Inorganic materials 0.000 claims description 38
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 35
- 239000002253 acid Substances 0.000 claims description 29
- 229910052801 chlorine Inorganic materials 0.000 claims description 26
- 230000002363 herbicidal effect Effects 0.000 claims description 24
- 229910052731 fluorine Inorganic materials 0.000 claims description 23
- 229910052717 sulfur Inorganic materials 0.000 claims description 23
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 22
- 125000004434 sulfur atom Chemical group 0.000 claims description 22
- 125000001153 fluoro group Chemical group F* 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 16
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 13
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 5
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 4
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 3
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 150000003230 pyrimidines Chemical class 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims 9
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 claims 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 8
- 239000000543 intermediate Substances 0.000 abstract description 7
- 150000001639 boron compounds Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 483
- 150000001875 compounds Chemical class 0.000 description 329
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 321
- 238000006243 chemical reaction Methods 0.000 description 225
- 239000002904 solvent Substances 0.000 description 161
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 150
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 141
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 138
- 238000004519 manufacturing process Methods 0.000 description 134
- 239000000203 mixture Substances 0.000 description 120
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 109
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 109
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 99
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 99
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 91
- 239000000243 solution Substances 0.000 description 91
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 79
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 75
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 74
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 72
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 72
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 71
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 70
- 239000012044 organic layer Substances 0.000 description 65
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 64
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 63
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 62
- 229910052751 metal Inorganic materials 0.000 description 62
- 239000002184 metal Substances 0.000 description 62
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 57
- 238000003756 stirring Methods 0.000 description 55
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 54
- 239000012043 crude product Substances 0.000 description 50
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 50
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 48
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 48
- 239000002585 base Substances 0.000 description 48
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 46
- 235000017557 sodium bicarbonate Nutrition 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 42
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 42
- 229920006395 saturated elastomer Polymers 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 38
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 36
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 36
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 35
- 239000012046 mixed solvent Substances 0.000 description 33
- 239000011541 reaction mixture Substances 0.000 description 33
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 32
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 32
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 32
- 229910000029 sodium carbonate Inorganic materials 0.000 description 32
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 31
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 31
- 150000001298 alcohols Chemical class 0.000 description 31
- 150000002148 esters Chemical class 0.000 description 31
- 239000008096 xylene Substances 0.000 description 31
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 30
- 150000008282 halocarbons Chemical class 0.000 description 30
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 29
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 29
- 229940117389 dichlorobenzene Drugs 0.000 description 29
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 28
- 150000002576 ketones Chemical class 0.000 description 27
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 27
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 27
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 150000002170 ethers Chemical class 0.000 description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 26
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 25
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 25
- 229910052740 iodine Inorganic materials 0.000 description 25
- 239000002798 polar solvent Substances 0.000 description 25
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 25
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 24
- 238000001816 cooling Methods 0.000 description 24
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 24
- 238000010992 reflux Methods 0.000 description 24
- 238000010898 silica gel chromatography Methods 0.000 description 24
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 23
- 229930195733 hydrocarbon Natural products 0.000 description 23
- 150000002430 hydrocarbons Chemical class 0.000 description 23
- 239000012445 acidic reagent Substances 0.000 description 22
- 229910000027 potassium carbonate Inorganic materials 0.000 description 21
- 235000011181 potassium carbonates Nutrition 0.000 description 21
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 20
- 239000003795 chemical substances by application Substances 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 19
- 150000002825 nitriles Chemical class 0.000 description 19
- 150000003839 salts Chemical class 0.000 description 19
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 19
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 18
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 18
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 18
- 229910000019 calcium carbonate Inorganic materials 0.000 description 18
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 18
- 239000007864 aqueous solution Substances 0.000 description 17
- 239000011630 iodine Substances 0.000 description 17
- 239000007788 liquid Substances 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 239000010410 layer Substances 0.000 description 16
- 238000004587 chromatography analysis Methods 0.000 description 15
- 238000004440 column chromatography Methods 0.000 description 15
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 14
- 229910052783 alkali metal Inorganic materials 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 230000002140 halogenating effect Effects 0.000 description 14
- 239000011777 magnesium Substances 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- 238000000926 separation method Methods 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 13
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 12
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 12
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 12
- 150000001735 carboxylic acids Chemical class 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 125000006165 cyclic alkyl group Chemical group 0.000 description 12
- 238000000605 extraction Methods 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 12
- 229910052749 magnesium Inorganic materials 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 12
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 11
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 10
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 10
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 10
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 10
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 10
- 150000002736 metal compounds Chemical class 0.000 description 10
- 229910052987 metal hydride Inorganic materials 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- 239000007800 oxidant agent Substances 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 9
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 9
- 235000019270 ammonium chloride Nutrition 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 150000004696 coordination complex Chemical class 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 9
- 229910052697 platinum Inorganic materials 0.000 description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 9
- SGUVLZREKBPKCE-UHFFFAOYSA-N 1,5-diazabicyclo[4.3.0]-non-5-ene Chemical compound C1CCN=C2CCCN21 SGUVLZREKBPKCE-UHFFFAOYSA-N 0.000 description 8
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 150000001340 alkali metals Chemical class 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 150000001448 anilines Chemical class 0.000 description 8
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 150000001728 carbonyl compounds Chemical class 0.000 description 8
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 8
- 238000003818 flash chromatography Methods 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- 150000002739 metals Chemical class 0.000 description 8
- 235000005985 organic acids Nutrition 0.000 description 8
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 8
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 7
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 7
- 239000007818 Grignard reagent Substances 0.000 description 7
- DSRXQXXHDIAVJT-UHFFFAOYSA-N acetonitrile;n,n-dimethylformamide Chemical compound CC#N.CN(C)C=O DSRXQXXHDIAVJT-UHFFFAOYSA-N 0.000 description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 229910052759 nickel Inorganic materials 0.000 description 7
- 150000007524 organic acids Chemical class 0.000 description 7
- 229910052763 palladium Inorganic materials 0.000 description 7
- 150000003462 sulfoxides Chemical class 0.000 description 7
- 150000003573 thiols Chemical class 0.000 description 7
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 7
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 125000001188 haloalkyl group Chemical group 0.000 description 6
- 150000005171 halobenzenes Chemical class 0.000 description 6
- 229940071870 hydroiodic acid Drugs 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- 239000003999 initiator Substances 0.000 description 6
- 229910001507 metal halide Inorganic materials 0.000 description 6
- 150000005309 metal halides Chemical class 0.000 description 6
- 150000004681 metal hydrides Chemical class 0.000 description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- 238000010791 quenching Methods 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 6
- 150000007970 thio esters Chemical class 0.000 description 6
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 6
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 5
- OXPDQFOKSZYEMJ-UHFFFAOYSA-N 2-phenylpyrimidine Chemical class C1=CC=CC=C1C1=NC=CC=N1 OXPDQFOKSZYEMJ-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 239000002841 Lewis acid Substances 0.000 description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 5
- 230000003796 beauty Effects 0.000 description 5
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 5
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 5
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 5
- 125000003963 dichloro group Chemical group Cl* 0.000 description 5
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 5
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 5
- 150000004795 grignard reagents Chemical class 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- 150000007517 lewis acids Chemical class 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 230000001590 oxidative effect Effects 0.000 description 5
- 239000003444 phase transfer catalyst Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- VDNGJKWCHQTOHN-UHFFFAOYSA-N (4-chloro-2-fluoro-5-propan-2-yloxyphenyl)boronic acid Chemical compound CC(C)OC1=CC(B(O)O)=C(F)C=C1Cl VDNGJKWCHQTOHN-UHFFFAOYSA-N 0.000 description 4
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 4
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 4
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 4
- IXVHOCLKVREFTR-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)C(=O)O)Cl Chemical compound CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)C(=O)O)Cl IXVHOCLKVREFTR-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 150000007942 carboxylates Chemical class 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000006482 condensation reaction Methods 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000002198 insoluble material Substances 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 230000000802 nitrating effect Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 4
- 150000003568 thioethers Chemical class 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 239000011135 tin Substances 0.000 description 4
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 4
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 4
- 125000006083 1-bromoethyl group Chemical group 0.000 description 3
- WGKOWTDBSBTNRY-UHFFFAOYSA-N 2-(1-methyl-2H-pyridin-6-yl)pyridine Chemical compound CN1C(=CC=CC1)C1=NC=CC=C1 WGKOWTDBSBTNRY-UHFFFAOYSA-N 0.000 description 3
- RPVZESOQOOPTGU-UHFFFAOYSA-N 4,5-dichloro-6-ethylpyrimidine Chemical compound CCC1=NC=NC(Cl)=C1Cl RPVZESOQOOPTGU-UHFFFAOYSA-N 0.000 description 3
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 3
- PHMNXPYGVPEQSJ-UHFFFAOYSA-N Dimethoxane Chemical compound CC1CC(OC(C)=O)OC(C)O1 PHMNXPYGVPEQSJ-UHFFFAOYSA-N 0.000 description 3
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 235000011941 Tilia x europaea Nutrition 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 239000012752 auxiliary agent Substances 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical class C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 3
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 3
- 230000008034 disappearance Effects 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229910052741 iridium Inorganic materials 0.000 description 3
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 3
- 239000003446 ligand Chemical class 0.000 description 3
- 239000004571 lime Substances 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 3
- OSCBARYHPZZEIS-UHFFFAOYSA-N phenoxyboronic acid Chemical class OB(O)OC1=CC=CC=C1 OSCBARYHPZZEIS-UHFFFAOYSA-N 0.000 description 3
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical class [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910052703 rhodium Inorganic materials 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- 229910052707 ruthenium Inorganic materials 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003892 spreading Methods 0.000 description 3
- 230000007480 spreading Effects 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000010189 synthetic method Methods 0.000 description 3
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- CXWYTOFTBOZXGQ-UHFFFAOYSA-N (1,2-dichloro-2-diphenylphosphanylethyl)-diphenylphosphane;nickel Chemical compound [Ni].C=1C=CC=CC=1P(C=1C=CC=CC=1)C(Cl)C(Cl)P(C=1C=CC=CC=1)C1=CC=CC=C1 CXWYTOFTBOZXGQ-UHFFFAOYSA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- OOTMYKBNPFCNBY-UHFFFAOYSA-N (4-chloro-2-fluoro-5-formylphenyl)boronic acid Chemical compound OB(O)c1cc(C=O)c(Cl)cc1F OOTMYKBNPFCNBY-UHFFFAOYSA-N 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- SQZJKMBENJSKHC-UHFFFAOYSA-N 1-bromo-4-chloro-2-fluoro-5-propan-2-yloxybenzene Chemical compound C(C)(OC1=C(Cl)C=C(F)C(Br)=C1)C SQZJKMBENJSKHC-UHFFFAOYSA-N 0.000 description 2
- FPNVMCMDWZNTEU-UHFFFAOYSA-N 1-bromo-4-chloro-2-fluorobenzene Chemical compound FC1=CC(Cl)=CC=C1Br FPNVMCMDWZNTEU-UHFFFAOYSA-N 0.000 description 2
- WGOBPPNNYVSJTE-UHFFFAOYSA-N 1-diphenylphosphanylpropan-2-yl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)C(C)CP(C=1C=CC=CC=1)C1=CC=CC=C1 WGOBPPNNYVSJTE-UHFFFAOYSA-N 0.000 description 2
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- SPAMRUYRVYMHPV-UHFFFAOYSA-N 3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical group C1=CCCC2C(=O)NC(=O)C21 SPAMRUYRVYMHPV-UHFFFAOYSA-N 0.000 description 2
- 150000005697 5-halopyrimidines Chemical class 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- 101100347612 Arabidopsis thaliana VIII-B gene Proteins 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 2
- OWJMFDLPDDFQLY-UHFFFAOYSA-N COC1=NC=NC(=C1Cl)C2=CC(=C(C=C2F)Cl)C(Br)Br Chemical compound COC1=NC=NC(=C1Cl)C2=CC(=C(C=C2F)Cl)C(Br)Br OWJMFDLPDDFQLY-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 description 2
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 2
- 150000001559 benzoic acids Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 229960003280 cupric chloride Drugs 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- BILYTLYIOVUVSU-UHFFFAOYSA-N dichloro(1,3-bis(diphenylphosphino)propane)nickel Chemical compound Cl[Ni]1(Cl)P(C=2C=CC=CC=2)(C=2C=CC=CC=2)CCCP1(C=1C=CC=CC=1)C1=CC=CC=C1 BILYTLYIOVUVSU-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 2
- 229940126534 drug product Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- HQRPHMAXFVUBJX-UHFFFAOYSA-M lithium;hydrogen carbonate Chemical compound [Li+].OC([O-])=O HQRPHMAXFVUBJX-UHFFFAOYSA-M 0.000 description 2
- 229910000000 metal hydroxide Inorganic materials 0.000 description 2
- 150000004692 metal hydroxides Chemical class 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical class OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- 239000004317 sodium nitrate Substances 0.000 description 2
- 235000010344 sodium nitrate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 2
- MDCWDBMBZLORER-UHFFFAOYSA-N triphenyl borate Chemical class C=1C=CC=CC=1OB(OC=1C=CC=CC=1)OC1=CC=CC=C1 MDCWDBMBZLORER-UHFFFAOYSA-N 0.000 description 2
- IIHPVYJPDKJYOU-UHFFFAOYSA-N triphenylcarbethoxymethylenephosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)OCC)C1=CC=CC=C1 IIHPVYJPDKJYOU-UHFFFAOYSA-N 0.000 description 2
- DZGWFCGJZKJUFP-UHFFFAOYSA-N tyramine Chemical compound NCCC1=CC=C(O)C=C1 DZGWFCGJZKJUFP-UHFFFAOYSA-N 0.000 description 2
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- SMYMJHWAQXWPDB-UHFFFAOYSA-N (2,4,5-trichlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=C(Cl)C=C1Cl SMYMJHWAQXWPDB-UHFFFAOYSA-N 0.000 description 1
- RJQFJWTVUVWMJG-UHFFFAOYSA-N (2,4-difluorophenoxy)boronic acid Chemical compound OB(O)OC1=CC=C(F)C=C1F RJQFJWTVUVWMJG-UHFFFAOYSA-N 0.000 description 1
- DWSBPCLAELVSFD-UHFFFAOYSA-N (2-fluorophenoxy)boronic acid Chemical compound OB(O)OC1=CC=CC=C1F DWSBPCLAELVSFD-UHFFFAOYSA-N 0.000 description 1
- RLGKZWXCACVYRU-UHFFFAOYSA-N (2-methoxycarbonylphenoxy)boronic acid Chemical compound COC(=O)C1=CC=CC=C1OB(O)O RLGKZWXCACVYRU-UHFFFAOYSA-N 0.000 description 1
- JCYUEORYFOUSCZ-UHFFFAOYSA-N (4-chloro-2-fluoro-5-methylphenyl)boronic acid Chemical compound CC1=CC(B(O)O)=C(F)C=C1Cl JCYUEORYFOUSCZ-UHFFFAOYSA-N 0.000 description 1
- FZENHVRTOIYYIK-UHFFFAOYSA-N (4-chloro-2-fluorophenoxy)boronic acid Chemical compound OB(O)OC1=CC=C(Cl)C=C1F FZENHVRTOIYYIK-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N 1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid Chemical class C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- WJQPKVYTFUNJFI-UHFFFAOYSA-N 1,5-dichloro-2-iodo-4-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC(I)=C(Cl)C=C1Cl WJQPKVYTFUNJFI-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- KZEVSDGEBAJOTK-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[5-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CC=1OC(=NN=1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O KZEVSDGEBAJOTK-UHFFFAOYSA-N 0.000 description 1
- ZSOFNJCJMLXADB-UHFFFAOYSA-N 1-(3,3-dimethyl-2h-1-benzofuran-5-yl)ethanesulfonic acid Chemical compound OS(=O)(=O)C(C)C1=CC=C2OCC(C)(C)C2=C1 ZSOFNJCJMLXADB-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000006433 1-ethyl cyclopropyl group Chemical group [H]C([H])([H])C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006028 1-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006030 1-methyl-3-butenyl group Chemical group 0.000 description 1
- KYEACNNYFNZCST-UHFFFAOYSA-N 1-methylpyrrolidine-2,5-dione Chemical compound CN1C(=O)CCC1=O KYEACNNYFNZCST-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- XZIDTOHMJBOSOX-UHFFFAOYSA-N 2,3,6-TBA Chemical compound OC(=O)C1=C(Cl)C=CC(Cl)=C1Cl XZIDTOHMJBOSOX-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- ZCRBVVKRZYTNFM-UHFFFAOYSA-N 2-(2-chloro-4-fluorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC=C(F)C=C1Cl ZCRBVVKRZYTNFM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- GOCUAJYOYBLQRH-UHFFFAOYSA-N 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl GOCUAJYOYBLQRH-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- UPFFQWNDECRHRY-UHFFFAOYSA-N 2-[2-(dodecylamino)ethylamino]acetic acid Chemical compound CCCCCCCCCCCCNCCNCC(O)=O UPFFQWNDECRHRY-UHFFFAOYSA-N 0.000 description 1
- SXAMGRAIZSSWIH-UHFFFAOYSA-N 2-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,2,4-oxadiazol-5-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NOC(=N1)CC(=O)N1CC2=C(CC1)NN=N2 SXAMGRAIZSSWIH-UHFFFAOYSA-N 0.000 description 1
- OOLBCHYXZDXLDS-UHFFFAOYSA-N 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(Cl)C=C1Cl OOLBCHYXZDXLDS-UHFFFAOYSA-N 0.000 description 1
- ROBSGBGTWRRYSK-UHFFFAOYSA-N 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C#N)C=C1F ROBSGBGTWRRYSK-UHFFFAOYSA-N 0.000 description 1
- MPPOHAUSNPTFAJ-UHFFFAOYSA-N 2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 MPPOHAUSNPTFAJ-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N 2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid Chemical compound CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- DLFCNOTTZWKNIW-UHFFFAOYSA-N 2-chloro-5-(5-chloro-2,6-dimethylpyrimidin-4-yl)-4-fluorophenol Chemical compound CC1=C(C(=NC(=N1)C)C2=CC(=C(C=C2F)Cl)O)Cl DLFCNOTTZWKNIW-UHFFFAOYSA-N 0.000 description 1
- YMFKCMCLAUBIBY-UHFFFAOYSA-N 2-chloro-5-(5-chloro-6-ethylpyrimidin-4-yl)-4-fluorophenol Chemical compound CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)O)Cl YMFKCMCLAUBIBY-UHFFFAOYSA-N 0.000 description 1
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- BIEZUWIUHAKFHZ-UHFFFAOYSA-N 2-hydroxy-2-methylpentanoic acid Chemical compound CCCC(C)(O)C(O)=O BIEZUWIUHAKFHZ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- DNEXRQSSNZPAJJ-UHFFFAOYSA-N 2-methylbenzenecarboperoxoic acid Chemical compound CC1=CC=CC=C1C(=O)OO DNEXRQSSNZPAJJ-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- ABOOPXYCKNFDNJ-UHFFFAOYSA-N 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 ABOOPXYCKNFDNJ-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- HXUIDZOMTRMIOE-UHFFFAOYSA-M 3-oxo-3-phenylpropionate Chemical compound [O-]C(=O)CC(=O)C1=CC=CC=C1 HXUIDZOMTRMIOE-UHFFFAOYSA-M 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GCOLCOMAZNJNON-UHFFFAOYSA-N 4,5-dichloro-2,6-dimethylpyrimidine Chemical compound CC1=NC(C)=C(Cl)C(Cl)=N1 GCOLCOMAZNJNON-UHFFFAOYSA-N 0.000 description 1
- HDFLZUDBGBABBP-UHFFFAOYSA-N 4,5-dichloro-6-ethyl-2-methoxypyrimidine Chemical compound CCC1=C(C(=NC(=N1)OC)Cl)Cl HDFLZUDBGBABBP-UHFFFAOYSA-N 0.000 description 1
- SIUNBOQRQYAIJI-UHFFFAOYSA-N 4,5-dichloro-6-methylpyrimidine Chemical compound CC1=NC=NC(Cl)=C1Cl SIUNBOQRQYAIJI-UHFFFAOYSA-N 0.000 description 1
- ZIEIBGKAZYCXJQ-UHFFFAOYSA-N 4,5-dichloro-6-propylpyrimidine Chemical compound CCCC1=NC=NC(Cl)=C1Cl ZIEIBGKAZYCXJQ-UHFFFAOYSA-N 0.000 description 1
- HDCZUIBLOICQLU-UHFFFAOYSA-N 4-bromo-5-chloro-6-(trifluoromethyl)pyrimidine Chemical compound FC(F)(F)C1=NC=NC(Br)=C1Cl HDCZUIBLOICQLU-UHFFFAOYSA-N 0.000 description 1
- LKTGVRWVTAJGMS-UHFFFAOYSA-N 4-chloro-6-ethyl-5-fluoropyrimidine Chemical compound CCC1=NC=NC(Cl)=C1F LKTGVRWVTAJGMS-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- XISPDFMAOWZEQG-UHFFFAOYSA-N 4h-1,4-oxazin-3-one Chemical compound O=C1COC=CN1 XISPDFMAOWZEQG-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- BYVSMDBDTBXASR-UHFFFAOYSA-N 5,6-dihydro-4h-oxazine Chemical compound C1CON=CC1 BYVSMDBDTBXASR-UHFFFAOYSA-N 0.000 description 1
- CTSLUCNDVMMDHG-UHFFFAOYSA-N 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- XDPVGONZZWDVMH-UHFFFAOYSA-N 5-chloro-4-(4-chloro-2-fluoro-5-methylphenyl)-6-methoxypyrimidine Chemical compound CC1=CC(=C(C=C1Cl)F)C2=C(C(=NC=N2)OC)Cl XDPVGONZZWDVMH-UHFFFAOYSA-N 0.000 description 1
- PFVXQPOOENAPFW-UHFFFAOYSA-N 5-chloro-4-(4-chloro-2-fluorophenyl)-6-methylpyrimidine Chemical compound CC1=NC=NC(C=2C(=CC(Cl)=CC=2)F)=C1Cl PFVXQPOOENAPFW-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- WTFUTSCZYYCBAY-SXBRIOAWSA-N 6-[(E)-C-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-N-hydroxycarbonimidoyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C/C(=N/O)/C1=CC2=C(NC(O2)=O)C=C1 WTFUTSCZYYCBAY-SXBRIOAWSA-N 0.000 description 1
- DFGKGUXTPFWHIX-UHFFFAOYSA-N 6-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]acetyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)C1=CC2=C(NC(O2)=O)C=C1 DFGKGUXTPFWHIX-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000114726 Acetes Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 101100347605 Arabidopsis thaliana VIII-A gene Proteins 0.000 description 1
- ALVDFIBNPSDSCC-UHFFFAOYSA-N B(O)(O)OC1=C(C=C(C(=C1)C2OCCO2)Cl)F Chemical compound B(O)(O)OC1=C(C=C(C(=C1)C2OCCO2)Cl)F ALVDFIBNPSDSCC-UHFFFAOYSA-N 0.000 description 1
- XITPWMDUQUPCEX-UHFFFAOYSA-N B(O)(O)OC1=C(C=CC(=C1)OC(C)C)F Chemical compound B(O)(O)OC1=C(C=CC(=C1)OC(C)C)F XITPWMDUQUPCEX-UHFFFAOYSA-N 0.000 description 1
- KGFUBIMZXSZGNA-UHFFFAOYSA-N B(O)(O)OC1=CC(=C(C=C1)Cl)OC(C)C Chemical compound B(O)(O)OC1=CC(=C(C=C1)Cl)OC(C)C KGFUBIMZXSZGNA-UHFFFAOYSA-N 0.000 description 1
- AXHORRJVCNJJGP-UHFFFAOYSA-N B(O)(O)OC1=CC(=C(C=C1Cl)Cl)OC(C)C Chemical compound B(O)(O)OC1=CC(=C(C=C1Cl)Cl)OC(C)C AXHORRJVCNJJGP-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- MBKSEWXBJAEGRI-UHFFFAOYSA-N C(=O)(O)C=1C(=CC(=C(C1)OB(O)O)F)Cl Chemical compound C(=O)(O)C=1C(=CC(=C(C1)OB(O)O)F)Cl MBKSEWXBJAEGRI-UHFFFAOYSA-N 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- HNENIHYLYUSFOF-UHFFFAOYSA-N CC(C)OC1=C(C=C(C(=C1)C2=C(C(=NC=N2)Cl)Cl)F)Cl Chemical compound CC(C)OC1=C(C=C(C(=C1)C2=C(C(=NC=N2)Cl)Cl)F)Cl HNENIHYLYUSFOF-UHFFFAOYSA-N 0.000 description 1
- NLTQXZLQELIUOK-UHFFFAOYSA-N CC1=C(C(=NC=N1)C2=C(C=C(C(=C2)C=O)Cl)F)Cl Chemical compound CC1=C(C(=NC=N1)C2=C(C=C(C(=C2)C=O)Cl)F)Cl NLTQXZLQELIUOK-UHFFFAOYSA-N 0.000 description 1
- SAZIXRNDDOLEGS-UHFFFAOYSA-N CC=1C(=C(C(=O)OO)C=CC=1)Cl Chemical compound CC=1C(=C(C(=O)OO)C=CC=1)Cl SAZIXRNDDOLEGS-UHFFFAOYSA-N 0.000 description 1
- LHNUZDBPXBMMGB-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=C(C=C(C(=C2)C=O)Cl)F)Cl Chemical compound CCC1=C(C(=NC=N1)C2=C(C=C(C(=C2)C=O)Cl)F)Cl LHNUZDBPXBMMGB-UHFFFAOYSA-N 0.000 description 1
- QPXUYAVWLRBUAS-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=C(SC(=C2Cl)C)F)Cl Chemical compound CCC1=C(C(=NC=N1)C2=C(SC(=C2Cl)C)F)Cl QPXUYAVWLRBUAS-UHFFFAOYSA-N 0.000 description 1
- VMIZDQIYJIETHI-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)N)Cl Chemical compound CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)N)Cl VMIZDQIYJIETHI-UHFFFAOYSA-N 0.000 description 1
- LAYRPEPTNPIEHK-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)OCC(=O)O)Cl Chemical compound CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)OCC(=O)O)Cl LAYRPEPTNPIEHK-UHFFFAOYSA-N 0.000 description 1
- NMPKBZRCYVATAA-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)S)Cl Chemical compound CCC1=C(C(=NC=N1)C2=CC(=C(C=C2F)Cl)S)Cl NMPKBZRCYVATAA-UHFFFAOYSA-N 0.000 description 1
- DGVSOIAPVVGVCS-UHFFFAOYSA-N CCC1=C(C(=NC=N1)C2=CC3=C(C=C2F)OCC(=O)N3)Cl Chemical compound CCC1=C(C(=NC=N1)C2=CC3=C(C=C2F)OCC(=O)N3)Cl DGVSOIAPVVGVCS-UHFFFAOYSA-N 0.000 description 1
- SSUFDOMYCBCHML-UHFFFAOYSA-N CCCCC[S](=O)=O Chemical group CCCCC[S](=O)=O SSUFDOMYCBCHML-UHFFFAOYSA-N 0.000 description 1
- NVHCUHLGBPWVRK-UHFFFAOYSA-N COC1=NC=NC(=C1Cl)C2=C(C=C(C(=C2)CBr)Cl)F Chemical compound COC1=NC=NC(=C1Cl)C2=C(C=C(C(=C2)CBr)Cl)F NVHCUHLGBPWVRK-UHFFFAOYSA-N 0.000 description 1
- JHVNGICCEZOUSQ-UHFFFAOYSA-N COC1=NC=NC(=C1Cl)C2=CC(=C(C=C2F)Cl)N Chemical compound COC1=NC=NC(=C1Cl)C2=CC(=C(C=C2F)Cl)N JHVNGICCEZOUSQ-UHFFFAOYSA-N 0.000 description 1
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 1
- 229920001393 Crofelemer Polymers 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- IIPZYDQGBIWLBU-UHFFFAOYSA-N Dinoterb Chemical compound CC(C)(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O IIPZYDQGBIWLBU-UHFFFAOYSA-N 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- BXEHUCNTIZGSOJ-UHFFFAOYSA-N Esprocarb Chemical compound CC(C)C(C)N(CC)C(=O)SCC1=CC=CC=C1 BXEHUCNTIZGSOJ-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- UWVKRNOCDUPIDM-UHFFFAOYSA-N Ethoxysulfuron Chemical compound CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 UWVKRNOCDUPIDM-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PSCXEUSWZWRCMQ-UHFFFAOYSA-N F[S](F)F Chemical compound F[S](F)F PSCXEUSWZWRCMQ-UHFFFAOYSA-N 0.000 description 1
- RXCPQSJAVKGONC-UHFFFAOYSA-N Flumetsulam Chemical compound N1=C2N=C(C)C=CN2N=C1S(=O)(=O)NC1=C(F)C=CC=C1F RXCPQSJAVKGONC-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 235000013939 Malva Nutrition 0.000 description 1
- 240000000982 Malva neglecta Species 0.000 description 1
- 235000000060 Malva neglecta Nutrition 0.000 description 1
- 240000002636 Manilkara bidentata Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GQWNECFJGBQMBO-UHFFFAOYSA-N Molindone hydrochloride Chemical compound Cl.O=C1C=2C(CC)=C(C)NC=2CCC1CN1CCOCC1 GQWNECFJGBQMBO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NEAPKZHDYMQZCB-UHFFFAOYSA-N N-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]ethyl]-2-oxo-3H-1,3-benzoxazole-6-carboxamide Chemical compound C1CN(CCN1CCNC(=O)C2=CC3=C(C=C2)NC(=O)O3)C4=CN=C(N=C4)NC5CC6=CC=CC=C6C5 NEAPKZHDYMQZCB-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- OQMBBFQZGJFLBU-UHFFFAOYSA-N Oxyfluorfen Chemical compound C1=C([N+]([O-])=O)C(OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 OQMBBFQZGJFLBU-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NBQCNZYJJMBDKY-UHFFFAOYSA-N Terbacil Chemical compound CC=1NC(=O)N(C(C)(C)C)C(=O)C=1Cl NBQCNZYJJMBDKY-UHFFFAOYSA-N 0.000 description 1
- 241000705989 Tetrax Species 0.000 description 1
- KDWQYMVPYJGPHS-UHFFFAOYSA-N Thenylchlor Chemical compound C1=CSC(CN(C(=O)CCl)C=2C(=CC=CC=2C)C)=C1OC KDWQYMVPYJGPHS-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 241000506319 Trifur Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- JZLUWZPEJDRDEO-UHFFFAOYSA-N [N].C1=CN=CN=C1 Chemical group [N].C1=CN=CN=C1 JZLUWZPEJDRDEO-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- DDBMQDADIHOWIC-UHFFFAOYSA-N aclonifen Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 244000269888 azena Species 0.000 description 1
- 125000005604 azodicarboxylate group Chemical group 0.000 description 1
- HYJSGOXICXYZGS-UHFFFAOYSA-N benazolin Chemical compound C1=CC=C2SC(=O)N(CC(=O)O)C2=C1Cl HYJSGOXICXYZGS-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- FXCLIEYDXXVEAI-UHFFFAOYSA-N benzene;dichloromethane Chemical compound ClCCl.C1=CC=CC=C1 FXCLIEYDXXVEAI-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 1
- RYVIXQCRCQLFCM-UHFFFAOYSA-N bispyribac Chemical compound COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C(O)=O)=N1 RYVIXQCRCQLFCM-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- GKPOMITUDGXOSB-UHFFFAOYSA-N but-3-yn-2-ol Chemical compound CC(O)C#C GKPOMITUDGXOSB-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- GIWUDHUYGNXFOP-UHFFFAOYSA-N calcium;sodium Chemical compound [Na+].[Ca+2] GIWUDHUYGNXFOP-UHFFFAOYSA-N 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- RAFKKJRZLDODKG-UHFFFAOYSA-N carbonic acid;propan-2-one Chemical compound CC(C)=O.OC(O)=O RAFKKJRZLDODKG-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- MJQBFSWPMMHVSM-UHFFFAOYSA-N chlorphthalim Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(CCCC2)=C2C1=O MJQBFSWPMMHVSM-UHFFFAOYSA-N 0.000 description 1
- KIEDNEWSYUYDSN-UHFFFAOYSA-N clomazone Chemical compound O=C1C(C)(C)CON1CC1=CC=CC=C1Cl KIEDNEWSYUYDSN-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- UCDHYFZYUGDETN-UHFFFAOYSA-N cyanophosphonic acid Chemical compound OP(O)(=O)C#N UCDHYFZYUGDETN-UHFFFAOYSA-N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- OILAIQUEIWYQPH-UHFFFAOYSA-N cyclohexane-1,2-dione Chemical compound O=C1CCCCC1=O OILAIQUEIWYQPH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- XXECWTBMGGXMKP-UHFFFAOYSA-L dichloronickel;2-diphenylphosphanylethyl(diphenyl)phosphane Chemical compound Cl[Ni]Cl.C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 XXECWTBMGGXMKP-UHFFFAOYSA-L 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- BWUPSGJXXPATLU-UHFFFAOYSA-N dimepiperate Chemical compound C=1C=CC=CC=1C(C)(C)SC(=O)N1CCCCC1 BWUPSGJXXPATLU-UHFFFAOYSA-N 0.000 description 1
- 150000005218 dimethyl ethers Chemical class 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- IRXRGVFLQOSHOH-UHFFFAOYSA-L dipotassium;oxalate Chemical compound [K+].[K+].[O-]C(=O)C([O-])=O IRXRGVFLQOSHOH-UHFFFAOYSA-L 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 229940088679 drug related substance Drugs 0.000 description 1
- ZCRZCMUDOWDGOB-UHFFFAOYSA-N ethanesulfonimidic acid Chemical compound CCS(N)(=O)=O ZCRZCMUDOWDGOB-UHFFFAOYSA-N 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- NTNZTEQNFHNYBC-UHFFFAOYSA-N ethyl 2-aminoacetate Chemical compound CCOC(=O)CN NTNZTEQNFHNYBC-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000006351 ethylthiomethyl group Chemical group [H]C([H])([H])C([H])([H])SC([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- IANUJLZYFUDJIH-UHFFFAOYSA-N flufenacet Chemical compound C=1C=C(F)C=CC=1N(C(C)C)C(=O)COC1=NN=C(C(F)(F)F)S1 IANUJLZYFUDJIH-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- LYINKTVZUSKQEQ-UHFFFAOYSA-N furan-3-one Chemical compound O=C1COC=C1 LYINKTVZUSKQEQ-UHFFFAOYSA-N 0.000 description 1
- 125000002425 furfuryl group Chemical group C(C1=CC=CO1)* 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 1
- 125000005280 halo alkyl sulfonyloxy group Chemical group 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000005347 halocycloalkyl group Chemical group 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- LFKYBJLFJOOKAE-UHFFFAOYSA-N imidazol-2-ylidenemethanone Chemical compound O=C=C1N=CC=N1 LFKYBJLFJOOKAE-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000006352 iso-propylthiomethyl group Chemical group [H]C([H])([H])C([H])(SC([H])([H])*)C([H])([H])[H] 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- OYIKARCXOQLFHF-UHFFFAOYSA-N isoxaflutole Chemical compound CS(=O)(=O)C1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OYIKARCXOQLFHF-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910000032 lithium hydrogen carbonate Inorganic materials 0.000 description 1
- HLRJTHWYGVQPHP-UHFFFAOYSA-M lithium;carbonic acid;hydrogen carbonate Chemical compound [Li+].OC(O)=O.OC([O-])=O HLRJTHWYGVQPHP-UHFFFAOYSA-M 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- XIGAUIHYSDTJHW-UHFFFAOYSA-N mefenacet Chemical compound N=1C2=CC=CC=C2SC=1OCC(=O)N(C)C1=CC=CC=C1 XIGAUIHYSDTJHW-UHFFFAOYSA-N 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N methyl monoether Natural products COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- NGRPRIJULFHFJL-UHFFFAOYSA-N methyl periodate Chemical compound COI(=O)(=O)=O NGRPRIJULFHFJL-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical compound [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 description 1
- KMLHBTGILXWYGG-UHFFFAOYSA-N n-prop-2-ynylethanesulfonamide Chemical compound CCS(=O)(=O)NCC#C KMLHBTGILXWYGG-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 1
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 230000001546 nitrifying effect Effects 0.000 description 1
- JCZMXVGQBBATMY-UHFFFAOYSA-N nitro acetate Chemical compound CC(=O)O[N+]([O-])=O JCZMXVGQBBATMY-UHFFFAOYSA-N 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- ONTGMLYFJLDCPR-UHFFFAOYSA-M nitronium;trifluoromethanesulfonate Chemical compound O=[N+]=O.[O-]S(=O)(=O)C(F)(F)F ONTGMLYFJLDCPR-UHFFFAOYSA-M 0.000 description 1
- KPADFPAILITQBG-UHFFFAOYSA-N non-4-ene Chemical compound CCCCC=CCCC KPADFPAILITQBG-UHFFFAOYSA-N 0.000 description 1
- NVGOPFQZYCNLDU-UHFFFAOYSA-N norflurazon Chemical compound O=C1C(Cl)=C(NC)C=NN1C1=CC=CC(C(F)(F)F)=C1 NVGOPFQZYCNLDU-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 1
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 1
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical class OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229960004109 potassium acetate Drugs 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- XYKIUTSFQGXHOW-UHFFFAOYSA-N propan-2-one;toluene Chemical compound CC(C)=O.CC1=CC=CC=C1 XYKIUTSFQGXHOW-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- WKSAUQYGYAYLPV-UHFFFAOYSA-N pyrimethamine Chemical compound CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 WKSAUQYGYAYLPV-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- ALZOLUNSQWINIR-UHFFFAOYSA-N quinmerac Chemical compound OC(=O)C1=C(Cl)C=CC2=CC(C)=CN=C21 ALZOLUNSQWINIR-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 125000005930 sec-butyloxycarbonyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229960004249 sodium acetate Drugs 0.000 description 1
- MFBOGIVSZKQAPD-UHFFFAOYSA-M sodium butyrate Chemical compound [Na+].CCCC([O-])=O MFBOGIVSZKQAPD-UHFFFAOYSA-M 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- ZNCPFRVNHGOPAG-UHFFFAOYSA-L sodium oxalate Chemical compound [Na+].[Na+].[O-]C(=O)C([O-])=O ZNCPFRVNHGOPAG-UHFFFAOYSA-L 0.000 description 1
- 229940039790 sodium oxalate Drugs 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005302 thiazolylmethyl group Chemical group [H]C1=C([H])N=C(S1)C([H])([H])* 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- UFXIRMVZNARBDL-UHFFFAOYSA-N trifluoro(morpholin-4-yl)-$l^{4}-sulfane Chemical compound FS(F)(F)N1CCOCC1 UFXIRMVZNARBDL-UHFFFAOYSA-N 0.000 description 1
- IMEVJVISCHQJRM-UHFFFAOYSA-N triflusulfuron-methyl Chemical compound COC(=O)C1=CC=CC(C)=C1S(=O)(=O)NC(=O)NC1=NC(OCC(F)(F)F)=NC(N(C)C)=N1 IMEVJVISCHQJRM-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229960003732 tyramine Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- YEIGUXGHHKAURB-VAMGGRTRSA-N viridin Chemical compound O=C1C2=C3CCC(=O)C3=CC=C2[C@@]2(C)[C@H](O)[C@H](OC)C(=O)C3=COC1=C23 YEIGUXGHHKAURB-VAMGGRTRSA-N 0.000 description 1
- 108010086097 viridin Proteins 0.000 description 1
- YEIGUXGHHKAURB-UHFFFAOYSA-N viridine Natural products O=C1C2=C3CCC(=O)C3=CC=C2C2(C)C(O)C(OC)C(=O)C3=COC1=C23 YEIGUXGHHKAURB-UHFFFAOYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/54—1,3-Diazines; Hydrogenated 1,3-diazines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N55/00—Biocides, pest repellants or attractants, or plant growth regulators, containing organic compounds containing elements other than carbon, hydrogen, halogen, oxygen, nitrogen and sulfur
- A01N55/08—Biocides, pest repellants or attractants, or plant growth regulators, containing organic compounds containing elements other than carbon, hydrogen, halogen, oxygen, nitrogen and sulfur containing boron
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/16—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with acylated ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
- C07F5/02—Boron compounds
- C07F5/025—Boronic and borinic acid compounds
Definitions
- the present invention relates to a novel 4-substituted phenyl-5-halopyrimidine derivative, a herbicide containing the same as an active ingredient, and an intermediate effective for producing the derivative.
- Desirable herbicide conditions include having a high herbicidal effect at a low dose, having a broad herbicidal spectrum, having an appropriate residual effect, and having sufficient safety for crops, etc.
- many of the existing herbicides do not fully satisfy these conditions.
- various studies have been made to solve such problems relating to herbicides. For example, as a compound having a structure having a nitrogen-containing hetero ring and a substituted phenyl group, a tetrahydrophthalimid ring has been proposed.
- Various studies have been made to use a compound having a structure in which a phenyl group is bonded to an N atom as an active ingredient of a herbicide.
- An object of the present invention is to provide a novel compound having a high herbicidal activity, a broad herbicidal spectrum, and high safety for crops. Disclosure of the invention
- the present inventors have conducted intensive studies on the synthesis of 4-substituted phenyl-5-halopyrimidine derivatives and their herbicidal activity in order to solve the above-mentioned problems of the herbicides. As a result, it was found that a phenyl group having a specific substituent was found.
- 5-Halopyrimidine derivatives which are substituents at the 4-position of the pyrimidine ring, are particularly characterized by a substituent on the pyrimidine ring and a substituent on the phenyl group. It has been found that a 5-halopyrimidine derivative, which is a certain combination, has a high herbicidal effect and shows sufficient safety for some important crops, thereby completing the present invention.
- the 4-substituted phenyl-5-halopyrimidine derivative according to the present invention is represented by the general formula (I).
- j and k both indicate 0, or one of them is 0 and the other is 1. Among these, it is preferable that both j and k are 0.
- Z is a halogen atom such as a fluorine atom, a chlorine atom, a bromine atom and an iodine atom, preferably a chlorine atom or a bromine atom, and particularly preferably a chlorine atom.
- R 1 and R 2 are each independently the following groups:
- a 1 is an oxygen atom, a sulfur atom, a sulfinyl group, a sulfonyl group, or a group represented by 1 NR 4 —, and the above R 4 is a hydrogen atom; or a linear or branched alkyl group, It is an alkenyl group or an alkynyl group.
- R 3 is a hydrogen atom; or a linear, branched or cyclic alkyl group, alkenyl group or alkynyl group which may be optionally substituted (the above substituents include a halogen atom and an alkoxycarbonyl group. ). ).
- alkyl group alkenyl group and alkynyl group in R 1 and R 2
- lower groups having 8 or less carbon atoms are preferred, and those having 6 or less carbon atoms are particularly preferred.
- R 1 is preferably 1) a halogen atom, 2) a linear or branched alkyl group, alkenyl group or alkynyl group which may be optionally substituted (as the substituent, a halogen atom and a hydroxyl group are preferred) . cited), or 3) - group (wherein represented by a i- R 3a, a 1 are as defined above, R 3a is (c port) alkyl group, an alkenyl or alkynyl group And more preferably a Ci—C 6 alkyl group, a C!
- —C 6 haloalkyl group or a group represented by one A la —R 3b (where A la is an oxygen atom, A sulfur atom or —NH—, and R 3b is a C 6 alkyl group or a C i —C 6 haloalkyl group.) And particularly preferably, a C 3 alkyl group, a haloalkyl group, or an alkoxy group. And a group selected from a haloalkoxy group.
- R 2 is preferably a hydrogen atom, an alkyl group, an alkoxy group or an alkylthio group, and more preferably a hydrogen atom, a Ci—C 6 alkyl group, a Ci—C 6 alkoxy group or a C—C 6 group. O, particularly preferably a hydrogen atom o
- Ar is a group represented by the following general formula (Ar-1) or (Ar-2).
- Y is a hydrogen atom or a halogen atom such as a fluorine atom, a chlorine atom, a bromine atom, or an iodine atom, and is preferably a hydrogen atom, a fluorine atom, or It is a chlorine atom, more preferably a fluorine atom.
- X is a halogen atom such as a fluorine atom, a chlorine atom, a bromine atom, an iodine atom or a cyano group, preferably a fluorine atom, a chlorine atom or a bromine atom, and more preferably a chlorine atom.
- R 5 is 1) a hydrogen atom; 2) a linear or branched alkyl group which may be optionally substituted (the above substituent includes a halogen atom, an acyloxy group and an alkoxy group. An alkylenedioxy group may be bonded to the same carbon of the group); 3) a nitro group, or 4) a compound represented by the following formulas (II) to (IV):
- a 2 represents an oxygen atom, a sulfur atom, a sulfinyl group, a sulfonyl group, or a group represented by —NR 7 —
- R 7 is 1) a hydrogen atom; 2) an optionally substituted straight-chain, branched or cyclic alkyl group, alkenyl group or alkynyl group (the above substituents include a halogen atom, an alkoxy group And phenyl groups). 3) acetyl, propionyl, butyryl, isoptyryl, valeryl, isovaleryl, 2-methylbutyryl, hexanoyl, 2,2-dimethylbutyryl, 2-ethylbutyryl, 2-methylvaleryl, 3-methylvaleryl An acyl group such as a 4-methylpareryl group;
- alkoxycarbonyl groups such as methoxycarbonyl group, ethoxycarbonyl group, proviroxycarbonyl group, isopropyloxycarbonyl group, butoxycarbonyl group, pentyloxycarbonyl group;
- R 6 is 1) a hydrogen atom; 2) a linear, branched or cyclic alkyl group, alkenyl group or alkynyl group which may be optionally substituted (the above substituent is a nitrogen atom, a cyano group , An alkoxy group, an alkylthio group, an alkylsulfonyl group, an acyl group, a phenyl group and a 3- to 6-membered heterocyclic group.);
- acyl group such as a 4-methylvaleryl group
- R 8 and R 9 each independently represent a hydrogen atom; a halogen atom such as a fluorine atom, a chlorine atom, a bromine atom, and an iodine atom. Atoms; linear or branched alkyl groups such as methyl, ethyl, propyl, isopropyl, butyl, isobutyl, sec-butyl, t-butyl; or acetyl, propionyl, It is an acyl group such as a butyryl group and an isoptyryl group.
- W 1 is an oxygen atom, a sulfur atom, or a group represented by —NR 11 —
- R 1 1 is hydrogen;.
- R 1 Q is: 1) a hydrogen atom
- An acyl group, an acyloxy group, a group represented by C ( 0) OR 12 (wherein, R 12 is a hydrogen atom, an alkyl group, an alkenyl group, or an alkynyl group, ), A phenyl group, and
- T is an oxygen atom or a group represented by N—OR 6 (wherein R 6 has the same meaning as in the general formula (II)); R 15 is a hydrogen atom or a linear or branched alkyl group.
- alkyl group alkenyl group, the alkynyl group, Ashiru group, Ashiruokishi group, an alkoxycarbonyl group, an alkoxy group, an alkyl Chiomoto, an alkylsulfonyl group, ⁇ Luque sulfonyl sulfonyl group, carbon Lower ones having a number of 8 or less are preferred, and those having 6 or less carbon atoms are particularly preferred.
- R 5 is preferably 1) a hydrogen atom; 2) a linear or branched alkyl group which may be arbitrarily substituted (the above substituents include a halogen atom, an acyloxy group and an alkoxy group. An alkylenedioxy group may be bonded to the same carbon of the alkyl group.); 3) a nitro group, or 4) a group represented by the following formulas (II) 'to (IV)'.
- ⁇ represents an oxygen atom, a sulfur atom, a sulfinyl group, or a group represented by —NR 7a — (wherein, R 7a represents a hydrogen atom, an alkyl group, an alkenyl group, an alkynyl Group, an alkoxycarbonyl group, or an (c) alkylsulfonyl group.).
- R 6a is 1) a hydrogen atom; 2) optionally substituted, linear, branched or branched Is a cyclic alkyl group, alkenyl group, or alkynyl group (the substituents include a halogen atom, a cyano group, and a phenyl group);
- W la is an oxygen atom, a sulfur atom, or a group represented by —NR 1 la — (where R R la represents a hydrogen atom or an alkyl group).
- R 1Qa is a hydrogen atom; a linear, branched or cyclic alkyl, alkenyl, or alkynyl group; or an alkyl group substituted with a phenyl group.
- L has the same meaning as described in the general formula (III), and W 2 represents an oxygen atom, a sulfur atom, or a group represented by —NR 11 lb— (in the formula, ,: R 1 is a hydrogen atom, an alkyl group, or an alkoxy group.).
- T 1 is an oxygen atom or a group represented by N—0R 6b (in the formula, R 6b is a hydrogen atom; a linear, branched or cyclic alkyl group, alkenyl group, or An alkynyl group; an alkoxycarbonylalkyl group, an alkenyloxycarbonylalkyl group or a carboxyalkyl group), and R 15 has the same meaning as that in the above formula (IV).
- R 5 is particularly preferably a hydrogen atom or a group represented by the following general formulas (II) '' to (IV).
- a 2b is an oxygen atom, a sulfur atom, or a group represented by —NR 7b — (where R 7b is a hydrogen atom, a C ⁇ —C 6 alkyl group Or 1 C 6 alkylsulfonyl group.), And particularly preferably an oxygen atom.
- R 6b is, CI- (iii port) alkyl C 6, C 2 - (C port) alkenyl group C 6, C 2 - alkynyl group C 6, C 3 - cycloalkyl group C 6, C 2 — A C 6 alkyl group or a group represented by the general formula (V) ′.
- W lb is an oxygen atom or a group represented by one NR 1 le — (wherein, R l lc is a hydrogen atom or a C i —C 4 alkyl group) R 8a is a hydrogen atom or a C i —C 4 alkyl group, R 9a is a hydrogen atom or a methyl group, R 10d is a Ci—C 6 alkyl group, C 2 — C 6 alkenyl group or C 3 —C 6 cycloalkyl group.)
- W 2a is an oxygen atom, a sulfur atom, or a group represented by —NR l ld — (wherein, R 1 is a hydrogen atom, a C 1 -C 4 alkyl group, Or a C i -C 4 alkoxy group.).
- R 1 Qc is a hydrogen atom, an alkyl group of Ci—Cs, C 2 Alkenyl group -c 6, c 2 - alkynyl group c 6, c 3 - a cycloalkyl group c 6,
- R 1Qe is a hydrogen atom or a C 6 alkyl group.
- R 13 and R 14 R 13 is preferably a hydrogen atom
- R 14 is a hydrogen atom, a chlorine atom or a methyl group.
- T 2 is a group represented by N—OR 6e (where R 6c is a C 6 alkyl group, C 2 —C 6 alkenyl group, C 2 — C 6 alkynyl group or C 3 -C 8 alkoxycarbonylalkyl group
- R 6 is Ru synonymous der and R 6 in the general formula (II).
- a hydrogen atom; or a chain, branched or cyclic alkyl group, alkenyl group or alkynyl group which may be optionally substituted, and particularly preferably a Ci—C 6 ) alkyl group, (iii port of C 2 -C 6) alkenyl group, C 2 - alkynyl group C 6, C 3 - cycloalkyl group C 6, or CH (with R 8a) C ( 0) oR 1Qc Wherein R 8a is a hydrogen atom or a C i -C 4 alkyl group, and R 10c is a C -C 6 alkyl group.
- U is a group represented by an oxygen atom, a sulfur atom or —NH—, preferably an oxygen atom or a sulfur atom, and particularly preferably an oxygen atom.
- n is 0 or 1, and preferably 1.
- the 2,4-dihalophenylboric acid derivative represented by the following general formula (VI) is an important intermediate for synthesizing the compound (I) of the present invention, and is a novel compound.
- X 1 is preferably a fluorine atom or a chlorine atom, and particularly preferably a chlorine atom.
- Y 1 is preferably a fluorine atom or a chlorine atom, and particularly preferably a fluorine atom.
- R 16 is a hydrogen atom; or a linear or branched alkyl group, or two R 16s taken together to form an ethylene group, a trimethylene group, a tetramethylene group, a pentamethylene group, a hexamethylene group, or the like. May form an alkylene group.
- a lower alkyl group having 6 or less carbon atoms is preferable, and an alkyl group having 4 or less carbon atoms is particularly preferable.
- the alkylene group preferably has 2 to 8 carbon atoms, and particularly preferably has 2 to 6 carbon atoms.
- R 16 is particularly preferably a hydrogen atom.
- R 17 is a group excluding the hydrogen atom and the methoxy group from the groups exemplified as R 5 above, and is preferably an alkyl group, a haloalkyl group, a nitro group, a group represented by —A 2c —R 6c (Wherein, A 2e is an oxygen atom or a sulfur atom, and R 6e is substituted with a linear, branched or cyclic alkyl group, alkenyl group or alkynyl group, haloalkyl group, or 1-2 phenyl groups.
- R 6 is a group other than a methyl group.
- a formyl group or a group represented by the following general formula (VI I)
- R 18 and R 19 each independently represent an alkyl group, and R 18 and R 19 And may form a C 2 -C 8 alkylene group.).
- the alkyl group, alkenyl group or alkynyl group is preferably a lower group having 8 or less carbon atoms, particularly preferably a group having 6 or less carbon atoms.
- 3-dimethylbutyl group 3,3-dimethylbutyl group, 1-ethylbutyl group, 2-ethylbutyl group, 1,1,2-trimethylpropyl group, 1-ethyl-1-methylpropyl group, 1-ethyl-2-methylpropyl group ;
- Hydroxymethyl group 1-hydroxyxethyl group, 2-hydroxyethyl group, 1-hydroxypropyl group, 1-hydroxybutyl group, 1-hydroxypentyl group, 1-hydroxyhexyl group;
- Acetyloxymethyl group 1- (acetyloxy) ethyl group, 2- (acetyloxy) ethyl group, 1- (propionyloxy) ethyl group, 2- (propionyloxy) ethyl group, 2- (butyryloxy) ethyl group Group, 2- (isobutyryloxy) ethyl group, 2- (valeryloxy) ethyl group, 2- (isovaleryloxy) ethyl group, 2- (bivaloyloxy) ethyl group, 2- (acryloyloxy) ) Ethyl group, 2- (propioyloxy) ethyl group, 2- (methacryloyloxy) ethyl group, 2- (crotonyloxy) ethyl group, 3- (acetyloxy) propyl group, 41- (acetyloxy) group Butyl group, 5- (acetyloxy) pentyl group; methoxy
- 2,2,2-Trifluoroethoxycarbonylmethyl group 1- (2,2,2-Trifluoroethoxycarbonyl) ethyl group, 1-Methyl-1- (2,2,2-Trifluoro Ethoxycarbonyl) ethyl group;
- Propargyloxycarbonylmethyl group 1- (propargyloxycarbonyl) ethyl group, 1-methyl-1- (propargyloxycarbonyl) ethyl group; carboxymethyl group, 1-carboxyethyl group, 2-carboxyethyl group, 1-carboxypropyl group, 2-carboxypropyl group, 3-carboxypropyl group, 1-carboxy-1-methylethyl group;
- Methoxymethyl group, ethoxymethyl group, propoxymethyl group isopropoxymethyl group, butoxymethyl group, 2-methoxyxyl group, 2-ethoxyxyl group, 2-propoxyethyl group, 2-isopropoxyethyl group, 2-butoxyethyl group , 3-methoxypropyl group, 4-methoxybutyl group, 5-methoxypentyl group; Dimethoxymethyl group, diethoxymethyl group, dipropoxymethyl group, diisopropoxymethyl group, dibutoxymethyl group, bis (pentyloxy) methyl group, bis
- Ethylenedioxymethyl group trimethylenedioxymethyl group, tetramethylenedioxymethyl group, benzenemethylenedioxymethyl group, hexamethylenedioxymethyl group;
- 2-oxopropyl group 1-methyl-2-oxopropyl group, 1-methyl-2-oxobutyl group, 1-ethyl-2-oxopropyl group, 1-propyl-2-oxopropyl group;
- Benzyl group 1-phenylethyl group, 2-phenylethyl group, 1-phenylpropyl group, 3-phenylpropyl group, 1-methyl-1-phenylphenyl group, diphenylmethyl group;
- 2-cycloprobenyl group 2-cyclobutenyl group, 2-cyclopentenyl group, 3-cyclopentenyl group, 2-cyclohexenyl group, 3-cyclohexenyl group;
- 2-chloroallyl group 2-bromoallyl group, 3- Chloroallyl group, 3-bromoaryl group, 2,3-dichloroallyl group, 3,3-dichloroallyl group, 2-chloro-2-butenyl group, 3-chloro-2-butenyl group;
- Ethynyl 1-propynyl, 2-propynyl, 1-butynyl, 2-butynyl, 3-butynyl, 1-methyl-2-propynyl, 1-pentynyl, 2-pentynyl, 3 _Pentynyl, 4-pentynyl, 1-methyl-3-butynyl, 1,1-dimethyl-2-propynyl, 1-hexynyl, 2-hexynyl, 3-hexynyl, 4- Hexynyl group, 5-hexynyl group.
- 3- to 6-membered heterocyclic group described in the above description of the substituent include, for example, those containing 13 oxygen atoms, sulfur atoms and / or nitrogen atoms shown below. Is mentioned.
- substituents R 5, R 6, 13 ⁇ 4 7 and 1 1 (but if a groups including phenyl group or a 3-6 membered double ring group, the phenyl group and the heterocyclic group, a fluorine atom Halogen atoms such as, chlorine, bromine, and iodine; Ci—C 4 such as methyl, ethyl, propyl, isopropyl, butyl, isobutyl, sec-butyl, and t-butyl; C i -C 4 haloalkyl group such as trifluoromethyl group; methoxy, ethoxy, propoxy, isopropoxy, butoxy, isobutoxy, sec-butoxy, t-butoxy ⁇ alkoxy group of CI- C 4 such groups; Asechiruokishi group, a propionyloxy Ruo alkoxy group, Puchiriruokishi group, I Sobuchiriruokishi group, Bruno Rerir
- the compound of the present invention represented by the general formula (I) can be produced, for example, according to any of the following production methods.
- Manufacturing method (1) R 2 N person Ar
- J is a halogen atom such as a chlorine atom, a bromine atom, or an iodine atom; a lower alkylsulfonyl group such as a methylsulfonyloxy group.
- a lower haloalkylsulfonyloxy group such as a trifluoromethylsulfonyloxy group; or an arylsulfonyloxy group such as a p-toluenesulfonyloxy group, wherein K is — B (OR 16 ) 2 (R 16 represents a hydrogen atom or an alkyl group.
- R 16 may be taken together to form an alkylene group.
- -Sn (R 20 ) 3 R 20 is an alkyl group Represents a group.
- -M 1 M 1 represents a monovalent metal atom such as lithium and sodium
- — M 2 — Q M 2 represents a divalent metal such as magnesium, zinc and copper
- Q represents a fluorine atom, a chlorine atom, a bromine atom, an iodine atom, etc. Represents a halogen atom.
- the process comprises the steps of: pyrimidines (VI II); substituted phenylboronic acids; substituted phenyltrialkyltins; substituted phenylmetal halides such as substituted phenyl Grignard reagents or substituted phenyl zinc halides.
- the compound (I-A) of the present invention is produced by coupling the compound (IX) with the compound (IX).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, usually at a temperature of from 120 to 200 ° C, preferably from 0 to 150 ° C.
- the amount of the compound used in the reaction is usually 1.0 to 3.0 equivalents, preferably 1.0 to 1.5 equivalents of the compound (IX) to 1 equivalent of the compound (VIII).
- the above reaction is preferably performed in a solvent.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; —Dimethylformamide, N-Methylpyro Water;, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane ⁇ beauty mixed solvent of two or more thereof.
- the amount of the solvent to be used is usually within 100 times, preferably 1 to 50 times, the
- the above reaction is optionally used in combination with 1) a metal or metal complex catalyst, and 2) a base.
- metal or metal complex catalyst examples include metals such as nickel, iron, ruthenium, cobalt, rhodium, iridium, palladium, and platinum; tetrakis (triphenylphosphine) palladium, tris (dibenzylideneaceton) dipalladium.
- the amount of the metal or metal complex catalyst to be used is generally 0.01 to 1.0 equivalent, preferably 0.01 to 0.5 equivalent, per 1 equivalent of compound (V
- Examples of the base include triethylamine, N, N-diisopropylethylamine, Biridine, bicholine, lutidine, collidine, N, N-Jetylaniline, 41- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4.0] — 7-indene, 1,5-diazabicyclo [4. 3.
- Nitrogen-containing organic bases such as octane; alkali metal hydroxides such as sodium hydroxide and potassium hydroxide; sodium carbonate, potassium carbonate, and carbonic acid Alkali metal or alkaline earth metal carbonates such as calcium; sodium bicarbonate, alkaline metal bicarbonates such as hydrogencarbonate lithium; sodium methoxide, sodium methoxide, potassium t-butoxide, etc. Metallic alcohols and the like.
- the amount of the base to be used is generally up to 5 equivalents, preferably up to 2 equivalents, per 1 equivalent of compound (VIII).
- phase transfer catalyst may be added to the reaction system.
- the phase transfer catalyst used include quaternary ammonium salts such as tetrabutylammonium bromide, tetrabutylammonium chloride, and benzyltriethylammonium chloride.
- the amount of the phase transfer catalyst to be used is generally within 2 equivalents, preferably within 1 equivalent, relative to 1 equivalent of the compound (VIII).
- the compound (I-C) or (I-D) of the present invention is produced by halogenating the compound (I-B) of the present invention.
- the inventive compound (IB) can be produced, for example, by the above-mentioned production method (1).
- a halogenating agent is carried out without solvent or in a solvent inert to the reaction.
- the temperature is usually in the range of 0 to 200 ° C., preferably 0 to 150 ° C.
- the halogenating agent to be used include fluorine, chlorine, bromine, iodine, N-methyl succinimide, N-prosuccinimide, N-succinimide, sulfuryl chloride and the like.
- the amount of the halogenating agent is 1.0 to 5.0, preferably 1.0 to 2.5 equivalents relative to 1 equivalent of the compound (IB).
- Suitable solvents used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; aromatic hydrocarbons such as benzene; dichloromethane; Halogenated hydrocarbons such as chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene, etc .; Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran, dioxane Ethers; esters such as ethyl acetate and butyl acetate; water; and a mixed solvent of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times, the weight of the compound (IB).
- a radical initiator may be used, if necessary.
- the radical initiator to be used include dibenzoyl peroxide, azobisisobutyronitrile (AIBN), and the like.
- AIBN azobisisobutyronitrile
- the amount of the radical initiator to be used per one equivalent of the compound (IB) is used. Is from 0.005 to 0.2 equivalent, preferably from 0.001 to 0.1 equivalent.
- the compound (I-E) of the present invention is produced by reacting the compound (I-C) of the present invention with a lower carboxylic acid or a lower carboxylic acid salt.
- the inventive compound (I-C) can be produced, for example, by the above-mentioned production method (2).
- the above reaction is carried out without solvent or in a solvent inert to the reaction, in the presence or absence of a base, usually at a temperature in the range of 0 to 200 ° C; preferably 0 to 150 ° C.
- a base usually at a temperature in the range of 0 to 200 ° C; preferably 0 to 150 ° C.
- the lower carboxylic acid or carboxylate include acetic acid, propionic acid, butyric acid, sodium salt and potassium salt thereof, and the amount of the compound (I-C) is 1 equivalent to 1 equivalent. 0 to 3.0 equivalents, preferably 1.0 to: L. 5 equivalents.
- Examples of the base include alkali metal hydroxides such as sodium hydroxide and potassium hydroxide; alkali metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; sodium hydrogen carbonate, hydrogen carbonate and the like.
- Metal hydrides such as sodium hydride and the like; and the amount of compound (I-C) is 1.0 to 3. It is 0 equivalent, preferably 1.0 to 1.5 equivalent. However, when a carboxylate is used, a base need not be used.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; nitriles such as acetonitrile; N, N-dimethylformamide, N-methylpyrrolidone; Non-dimethyl sulfoxide, sulfolane, pyridine, etc. Water, and a mixed solvent of two or more thereof. The amount of solvent used is usually within 100 times the weight of compound (I-C), Or 150 times,
- the compound (IG) of the present invention is produced by nitrating the compound (IF) of the present invention.
- the inventive compound (IF) can be produced by the above-mentioned production method (1).
- the above reaction is carried out by reacting a ditoxin with a solvent at a temperature of usually ⁇ 20 to 150 ° C., preferably ⁇ 10 to 80 ° C. in a solvent or in a solvent inert to the reaction.
- nitrifying agent examples include a mixture of nitric acid or nitrate (sodium nitrate, potassium nitrate, etc.) and sulfuric acid, nitric acid, acetyl nitrate, nitrodimethyltetrafluoroborate, nitronium trifluoromethane sulfonate. And those commonly used as nitro-lumping agents.
- the amount of the nitrating agent to be used is generally 1.03.0 equivalents, preferably 1.02.0 equivalents, per 1 equivalent of compound (IF).
- the above reaction is preferably carried out in a solvent.
- suitable solvents to be used include sulfuric acid, acetic acid, acetic anhydride, halogenated hydrocarbons (dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloromethane). Nitroalkanes (nitromethane, etc.), and mixed solvents of two or more of these.
- the amount of the solvent used is within 100 times, preferably 1 to 50 times the weight of the compound (IF).
- R 22 represents an alkyl group substituted with an alkyl group, an alkenyl group, a haloalkyl group, an alkoxyalkyl group, a cycloalkyl group, or a phenyl group. Shown.
- the compound of the present invention is converted into a substituted phenol (I-I) by cleaving the ether bond of the substituted phenyl ether (I-H).
- the substituted phenyl ethers (IH) can be produced by the production method (1).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, in the presence of an acidic reagent, at a temperature of usually ⁇ 200 ° C., preferably ⁇ 10 ° C. to 150 ° C.
- the acidic reagent include brenstead acids such as hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, and trifluoroacetic acid; and Lewis acids such as aluminum trichloride, boron trichloride, and boron tribromide.
- the amount of the acidic reagent used is usually 1 to 100 equivalents to 1 equivalent of the compound (I—H).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene; alcohols such as methanol, ethanol and propanol; N, Non-protonic polar solvents such as N-dimethylformamide, N-methylpyrrolidone, dimethyl sulfoxide, and sulfolane; water; and a mixed solvent of two or more thereof.
- the amount of the solvent to be used is usually within 100 times, preferably 150 times, the weight of the compound (I-H). Manufacturing method (6)
- the substituted anilines (I-J) are produced by reducing the nitro compound (I-G) in the compound of the present invention.
- the inventive compound (IG) can be produced by the above-mentioned production method (1) or (4).
- the above-mentioned reduction reaction is usually carried out at 20 to 200 ° in the absence of a solvent or in a solvent inert to the reaction in the presence of a metal or metal compound and an acidic reagent. , Preferably in a temperature range of 50 to 150 ° C.
- Examples of the above-mentioned metal or metal compound include metals or metal compounds usually used for the reduction reaction of a nitro group, such as iron, zinc, tin, and tin (II) chloride.
- the amount of the metal or metal compound to be used is usually 1 to 20 equivalents, preferably 2 to 10 equivalents, per 1 equivalent of compound (IG).
- the acidic reagent examples include inorganic acids such as hydrochloric acid and sulfuric acid, and organic acids such as acetic acid.
- the amount of the acid reagent to be used is usually 0.01 to 20 equivalents per 1 equivalent of the compound (IG). The amount is preferably 0.01 to 10 equivalents.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .
- Jethyl ether diisopropyl ether, dibutyl ether, dimethoxetane, tetrahi Ethers such as drofuran and dioxane
- esters such as ethyl acetate and butyl acetate
- ketones such as acetone and methyl ethyl ketone
- alcohols such as methanol, ethanol and propanol
- Nitriles such as cetonitrile
- non-protonic polar solvents such as N, N-dimethylformamide, N-methylpyrrolidone, dimethylsulfoxide and sulfolane
- organic acids such as acetic acid; water; and two or more of these A mixed solvent and the like can be mentioned.
- the above reaction is carried out using sodium sulfide, sodium hydrosulfide, sodium dithionite, ammonium sulfide, a hydrogen / metal catalyst (palladium-carbon, platinum
- a hydrogen / metal catalyst palladium-carbon, platinum
- Other reduction methods, such as carbon, rhodium-alumina, platinum, Raney-nickel, etc., can be used.
- This production method is by transposition of the substituted benzoic acids of the present invention compounds (iota-kappa) after induced to acid azides and Isoshiana one DOO acids, which is reacted with an alcohol (R 23 - ⁇ ) Is converted to substituted phenylcarbamic acid esters ( ⁇ -L).
- the substituted benzoic acids ( ⁇ - ⁇ ) can be produced, for example, by the above-mentioned production method (1).
- the reaction is in a solventless or in a solvent inert to the reaction, azide, a base, and alcohols - the presence of (R 23 OH), usually one 20 ⁇ 200 ° C, preferably 20 ⁇ 0.99 ° It is performed in the temperature range of C.
- the azidating agent examples include diphenyl phosphorodiazide, trimethinoresilyl Azide, sodium azide and the like can be mentioned, and the amount of the compound to be used is generally 1.0 to 3.0 equivalents, preferably 1.0 to 1.5 equivalents, per 1 equivalent of compound (I—).
- the amount of the compound to be used is generally 1.0 to: L00 equivalent, preferably 1.0 to 5.0 equivalent per 1 equivalent of compound (I-K).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene; etc .; Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N-dimethylformamide, N-methylbiamide
- Non-protonic polar solvents such as don, dimethyl sulfoxide, sulfolane, etc .; water; and a mixed solvent of two or more thereof, and preferably alcohols which are reaction reagents.
- the present production method is characterized in that the substituted phenylcarbamic acid esters (I-L) Is converted to substituted anilines (I-J).
- the substituted phenyl carbamates (I-L) can be produced, for example, by the above-mentioned production method (7).
- the above reaction is carried out in the presence of water, usually under acidic or alkaline conditions, usually at a temperature of from 20 to 200 ° C, preferably from 0 to 150 ° C.
- examples of the acidic reagent used include hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, and the like.
- the amount of the compound used is usually the compound (I-J). With respect to 1 equivalent, 1.0 to: L 00 equivalent, preferably 1.0 to 10.0 equivalent.
- the base used may be an alkali metal hydroxide such as sodium hydroxide or potassium hydroxide; an alkali metal hydroxide such as sodium carbonate, carbonated calcium carbonate, calcium carbonate or the like.
- the amount of the compound used is usually 1 equivalent of the compound (I-J). It is 1.0 to 100 equivalents, preferably 1.0 to 10.0 equivalents.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran, Ethers such as dioxane; ketones such as acetone and methyl ethyl ketone; alcohols such as methanol, ethanol and propanol; N, N-dimethylformamide, N-methylvinylidone, dimethylsulfoxide, sulfolane
- Non-protonic polar solvents such as acetic acid Organic acids; water; and mixed solvents of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-J).
- a sulfoxide (I-N) is produced by oxidizing a sulfide (IM) in the compound of the present invention.
- the sulfides (I-M) can be produced, for example, by the production method (1).
- the above reaction is usually carried out in the absence of a solvent or in a solvent inert to the reaction in the presence of an oxidizing agent, usually at a temperature of from 20 to 200 ° C (preferably from 0 to 150 ° C).
- the oxidizing agent examples include hydrogen peroxide; organic peracids such as peracetic acid and metachloroperbenzoic acid; metaperiodates such as sodium metaperiodate; halogens such as chlorine and bromine; N-chlorosuccinic acid
- the oxidizing agent usually used for the oxidation reaction of a sulfide group, such as a halide such as imide and N-bromosuccinic acid imide.
- the amount of the oxidizing agent to be used is usually 1 to 3 equivalents, preferably: 1 !, equivalent to 1 equivalent of the compound (IM). ⁇ 2 equivalents.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene; etc .; Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran Esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N, N— Dimethylformamide, N-methylpyro Non-protonic polar solvents such as lidone, dimethyl sulfoxide, and sulfolane; water; and a mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-M). Manufacturing method
- the sulfoxides (1-0) in the compound of the present invention are reacted with trifluoroacetic anhydride, and the product is hydrolyzed with a base to convert the substituted thiophenols (I-P). It is manufactured.
- the sulfoxides (I-I) can be produced by the production method (9).
- trifluoroacetic anhydride is reacted in a solvent-free or inert solvent in a temperature range of ⁇ 20 to 200 ° C., preferably 0 to 150 ° C., and then the product is treated with a base.
- a solvent-free or inert solvent in a temperature range of ⁇ 20 to 200 ° C., preferably 0 to 150 ° C.
- the amount of trifluoroacetic anhydride to be used is generally 1 to 50 equivalents, preferably 1 to 20 equivalents, per 1 equivalent of compound (1-0).
- bases examples include triethylamine, N, N-diisoprovirethylamine, 1,8-diazabicyclo [5.4.0] —7-indene, 1,5-diazabicyclo [4.3.0] — Nitrogen-containing organic bases such as 5-nonene and 1,4-diazabicyclo [2.2.2] octane; alkali metal hydroxides such as sodium hydroxide and potassium hydroxide; sodium carbonate, potassium carbonate; Alkali metal or alkaline earth metal carbonates such as calcium carbonate; sodium bicarbonate, alkaline metal bicarbonates such as hydrogen bicarbonate, etc., and the amount used is usually the compound (1_0) Is 1 The amount is 1 to 200 equivalents, preferably 1 to 100 equivalents, relative to the equivalent.
- Suitable solvents to be used include, in the first-stage reaction, aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; benzene and toluene.
- Aromatic hydrocarbons such as benzene, xylene, cumene; halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; Jethyl ether, diisopro Ethers such as bil ether, dibutyl ether, dimethoxane, tetrahydrofuran, and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methyl ethyl ketone; nitriles such as acetonitrile; N-dimethylformamide, N-methylpyrrolidone, dimethylsulfoxide, sulfo Aprotic polar solvents such as lan; and mixed solvents of two or more of these.
- halogenated hydrocarbons such as dichloromethane, chloroform, carbon
- alcohols such as methanol, ethanol, and propanol; and water, etc. No.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (1-0).
- This production method comprises the step of condensing a substituted phenol, a substituted thiophenol or a substituted aniline (I-Q) in a compound of the present invention with a halide or a sulfonate (X) to obtain the compound of the present invention (I — R).
- the above substituted phenols, substituted thiophenols, and substituted anilines (I-Q) They can be produced by the above-mentioned production methods (5), (6), (8) and (10).
- the condensation reaction is carried out in the absence of a solvent or in a solvent inert to the reaction in the presence of a base, usually at a temperature in the range of -20 to 200 ° C, preferably 0 to 150 ° C.
- the amount of the compound to be used is 1 to 10 equivalents, preferably 1 to 2 equivalents of the compound (X) to 1 equivalent of the compound (I-Q).
- Examples of the base include triethylamine, N, N-diisopropylethylamine, pyridine, bicholine, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4] 0] — 7-Pendecene, 1,5-Diazabicyclo [4. 3.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; nitriles such as acetonitrile; N, N-dimethylformamide; Non-protons such as don, dimethyl sulfoxide and sulfolane A polar solvent; water; and a mixed solvent of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-Q). Manufacturing method (1 2)
- R 24 represents an alkyl group, an alkenyl group, an alkynyl group, a cycloalkyl group, an alkylcycloalkyl group, a (cyclo Alkyl) alkyl group, cycloalkenyl group, haloalkyl group, haloalkenyl group, halocycloalkyl group, cyanoalkyl group, alkoxyalkyl group, alkylthioalkyl group, alkylsulfonylalkyl group, alkyl group substituted with phenyl group, or 3- Represents an alkyl group substituted by a 6-membered heterocyclic group, and R 25 represents a lower alkyl group.
- This production method is substituted Fuwenoru compounds of the present invention compounds (I one I) and alcohols - by dehydration condensation reaction between (R 24 OH) (XI) , to produce a substituted phenylalanine ethers (I- S) Things.
- the substituted phenols (II) can be produced, for example, by the production method described above.
- the above reaction is carried out without solvent or in a solvent inert to the reaction, in the presence of triphenylphosphine and dialkyl azodicarboxylate, usually at 120 to 200 ° C, preferably 0 to: L50 °. It is performed in the temperature range of C.
- the amount of the compound to be used is 1 to 3 equivalents, preferably 1 to 1.5 equivalents of the compound (XI) to 1 equivalent of the compound (I-I).
- the amount of triphenyl phosphine is usually compound (I- I) force 5 1, based on the equivalents, 1-3 equivalents, preferably 1 to 1.5 equivalents, the amount of Azojikarubon dialkyl typically compound (I-I) is 1 to 3 equivalents, preferably 1 to 0.5 equivalents, per 1 equivalent.
- Suitable solvents used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; benzene, Aromatic hydrocarbons such as toluene, xylene and cumene; Halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene, etc .; Jethyl ether, diisopro Ethers such as bil ether, dibutyl ether, dimethoxetane, tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methyl ethyl ketone; nitriles such as acetonitrile; N, N— Non-protonic polar solvent
- the esters (I-T) in the compound of the present invention are hydrolyzed to convert them into the carboxylic acids (I-U) in the compound of the present invention.
- the invention compound (IT) can be produced, for example, by the above-mentioned production method (1).
- the above reaction is carried out under the conditions generally carried out in the hydrolysis reaction of ordinary esters in the absence of a solvent or in a solvent inert to the reaction, usually in the range of —20 to 200 ° C., preferably 1 to 100 ° C. It is performed in the temperature range of C.
- the amount of water used in the above hydrolysis is generally 1 to 100 equivalents, preferably 1 to 50 equivalents, per 1 equivalent of compound (IT).
- examples of the acidic reagent used include hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, and the like.
- T) is 1 to 100 equivalents to 1 equivalent.
- the base used may be an alkali metal hydroxide such as sodium hydroxide or potassium hydroxide; an alkali metal hydroxide such as sodium carbonate, carbonated calcium carbonate, calcium carbonate or the like.
- Earth metal carbonates sodium hydrogen carbonate, hydrogen carbonate metal hydride and other metal hydrogen carbonates and the like.
- the amount of the compound is usually 1 to 1 equivalent of the compound (I_T). 100 equivalents.
- the above reaction is preferably carried out in a solvent.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; ketones such as acetone and methyl ethyl ketone; alcohols such as methanol, ethanol and propanol; Non-protonic polar solvents such as water and sulfolane; water And a mixed solvent of two or more of these.
- the amount of the solvent used is usually 100 times or less, preferably 1 to 50 times the weight of the compound (I-II). Manufacturing method (14)
- This production method comprises preparing an ester, a thioester or an acid amide from the carboxylic acid (I-U) in the compound of the present invention and an alcohol, a thiol or an amine (XI I). (14-a) to (14-d) below.
- the carboxylic acids (IU) can be produced, for example, by the above-mentioned production method (13).
- Carboxylic acids (I-U) are converted to acid halides with a halogenating agent such as thionyl chloride, phosphorus trichloride, phosphorus pentachloride, phosphoryl chloride, phosgene, etc., usually in the presence of a base. It is converted to esters, thioesters, and acid amides (IV) by reacting with an alcohol, thiol, or amine (XI I).
- a halogenating agent such as thionyl chloride, phosphorus trichloride, phosphorus pentachloride, phosphoryl chloride, phosgene, etc.
- Carboxylic acids (I-U) are usually converted into mixed acid anhydrides with alkyl chloroformate, trifluoroacetic anhydride or the like in the presence of a base, which is usually converted to an alcohol, thiol, Alternatively, they are converted to esters, thioesters, or acid amides (IV) by reacting with amines (XI I).
- the above-mentioned reactions (14_a) to (14-d) are usually performed in a solvent-free or inert solvent in a temperature range of -20 to 200 ° C, preferably -10 to 150 ° C.
- the amount of the amine or the amine (XI I) is usually 1 to 20 equivalents, preferably 1 to 5 equivalents to 1 equivalent of the compound (IU).
- the amount of the alcohol (XI I) used in the reaction (14-d) is usually 1 to 100 equivalents, preferably 1 to 20 equivalents, per 1 equivalent of the compound (IU).
- suitable bases include triethylamine, N, N-diisoprovirethylamine, pyridine, picoline, lutidine, collidine, N, N-Jetylaniline, 4- (Dimethylamino) pyridine, 1,8-Diazabicyclo [5.4.0] —7-Pendecene, 1,5-Diazabicyclo [4.3.0] —5-Nonene, 1, 4- Nitrogen-containing organic bases such as diazabicyclo [2.2.2] octane; alkali metal hydroxides such as sodium hydroxide and potassium hydroxide; alkali metals such as sodium carbonate, potassium carbonate and calcium carbonate or alkaline earths Metal carbonates: alkali metal bicarbonates such as sodium bicarbonate and bicarbonate lime.
- the amount of the base to be used is generally 1-3 equivalents, preferably 1-2 equivalents, per 1 equivalent of compound (IU).
- the amount of the acid catalyst used in the reaction of (14-d) is 0.001 to 10 equivalents, preferably 0.01 to 2 equivalents, per 1 equivalent of the compound (IU).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; Aromatic hydrocarbons such as benzene, toluene, xylene, and cumene; halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, and dichlorobenzene; getyl ether, diisopropyl ether And ethers such as dibutyl ether, dimethoxetane, tetrahydrofuran and dioxane; ketones such as acetone and methyl ethyl ketone; N, N-dimethylformamide, N-methylpyrrolidone, dimethylsulfoxide and sulfolane
- Non-protonic polar solvent water; mixed solvent of two or more of these And the like.
- a large excess of the alcohol (XI I) may be used as a solvent.
- the amount of solvent used is usually Within 100 times, preferably 1 to 50 times, the weight of the product (I_U), production method (15)
- the substituted aniline (I-J) in the compound of the present invention is diazotized, and then the unsaturated carboxylic acid derivative (XIV) is reacted with a metal halide to give the compound (I-W) of the present invention. It is manufactured.
- the substituted anilines (IJ) can be produced, for example, by the above-mentioned production methods (1), (6) and (8).
- the substituted aniline (I-J) is converted to an unsaturated carboxylic acid derivative (XIV), an alkyl nitrite (t-butyl nitrite, isoamyl nitrite, etc.) in a solvent or in a solvent inert to the reaction. ) And in the presence of a metal halide, usually at a temperature of from 120 to 200 ° C, preferably from 110 to 100 ° C.
- the amount of compound used is usually the compound (I- J) force s 1 eq, compound (XIV) is 1-5 0 equivalents, preferably 2-20 equivalents, alkyl nitrite is 1 to 3 Equivalent, preferably 1-2 equivalent.
- the above-mentioned metal halides are usually copper chloride (1), copper chloride (11), copper bromide (I), copper bromide (II), iodide Copper halides such as copper (I) and copper (II) iodide are used, and the amount of the compound is usually 1 to 3 equivalents, preferably 1 to 2 equivalents, per 1 equivalent of the compound (I-J). It is.
- Suitable solvents used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; benzene, Aromatic hydrocarbons such as toluene, xylene and cumene; Halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene, etc .; Jethyl ether, diisopro Ethers such as vir ether, dibutyl ether, dimethoxetane, tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methyl ethyl ketone; alcohols such as methanol, ethanol and propanol; acetonitrile And non-pro
- the compound (I-Y) of the present invention is produced by reacting the compound (I-X) of the present invention with an unsaturated carboxylic acid derivative (XIV).
- the inventive compound (I-X) can be produced, for example, by the production methods (1) and (11).
- the above reaction is usually carried out without solvent or in a solvent inert to the reaction.
- the reaction is carried out at a temperature of 0 ° C, preferably 0 to 150 ° C.
- the amount of the compound used in the reaction is usually 1 to 10 equivalents, preferably 1 to 3 equivalents of the compound (XIV) to 1 equivalent of the compound (IX).
- the above reaction is optionally used in combination with 1) a metal or metal complex catalyst, and 2) a base.
- metal or metal complex catalyst examples include metals such as nickel, iron, ruthenium, copper, rhodium, iridium, palladium, and platinum; tetrakis (triphenylphosphine) palladium, tris (dibenzylideneacetone) dipalladium , Dichlorobis (triphenylphosphine) palladium, dichloro [1,3-bis (diphenylphosphino) propane] nickel, dichloro [1,2-bis (diphenylphosphino) ethane] nickel, bis (acetylacetonato) ) Nickel, dichloro [1,1,1-bis (diphenylphosphino) phenecene] palladium or other such metals or their chlorides and triphenylphosphine, tri (o-tolyl) phosphine, 1 , 2-bis (diphenylphosphino) propane, 1, 1, 1 Bis (diphenylphosphino) metal complex
- Examples of the base include triethylamine, N, N-diisopropylethylamine, pyridine, picoline, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4.
- phase transfer catalyst may be added to the reaction system.
- phase transfer catalyst include quaternary ammonium salts such as tetrabutylammonium bromide, tetrabutylammonium chloride, and benzyltriethylammonium chloride.
- the amount of compound (IX) is within 2 equivalents, preferably within 1 equivalent, relative to 1 equivalent.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N, N— Dimethylformamide, N-methylbi mouth Water;, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane ⁇ beauty mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times, the weight of the solvent used.
- the present production method comprises reducing the compound (I-Y) of the present invention to obtain the compound of the present invention.
- (IZ) inventive compound
- the inventive compound (I-Y) can be produced, for example, by the above-mentioned production methods (1) and (16).
- This reduction reaction is carried out by hydrogenation in a solvent-free or inert solvent in the presence of a catalyst, usually at a temperature of 0 to 150 ° C, preferably 20 to 100 ° C. .
- the catalyst examples include those used in ordinary hydrogenation reactions, such as metal catalysts such as palladium-carbon, platinum-carbon, rhodium-alumina, platinum, Raney nickel, and the like. It is 0.001 to 0.2 times the weight of (I-Y).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- ethers such as Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxane, tetrahydrofuran, dioxane
- esters such as ethyl acetate and butyl acetate
- ketones such as acetone and methyl ethyl ketone Alcohols such as methanol, ethanol and propanol
- water and mixed solvents of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-Y). Manufacturing method (18)
- Examples of the acidic reagent used include mineral acids such as sulfuric acid and hydrochloric acid and silver nitrate.
- the amount of the reagent used is usually 1 equivalent of the compound (ID), and 2 to 2 in the case of a mineral acid.
- the equivalent is 100 equivalents, preferably 10 to 100 equivalents, and in the case of silver nitrate, 1 to 10 equivalents, and preferably 1 to 3 equivalents.
- the reaction is usually carried out in the absence of a solvent or in a solvent inert to the reaction in the presence of water and a base, usually at ⁇ 20 to 200 ° C., preferably at 0 to 15 Performed in a temperature range of 0 ° C.
- Examples of the base to be used include alkali metal hydroxides such as sodium hydroxide and potassium hydroxide; alkali metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; sodium hydrogen carbonate and carbonate Alkali metal bicarbonates such as hydrogen lime; Alkali metal salts of organic acids such as sodium formate, potassium formate, sodium acetate, potassium acetate, sodium oxalate and oxalate potassium; sodium methoxide, sodium Examples thereof include alkali metal alcoholates such as ethoxide, potassium t-butoxide, and the like. The amount of the alcohol is usually 1 to 5 equivalents, preferably 1 to 3 equivalents, per equivalent of (I-D). Is equivalent.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; ketones such as acetone and methyl ethyl ketone; alcohols such as methanol, ethanol and propanol; N, N-dimethylformamide, N-methylbi Non-protonic polar solvents such as mouth ridone, dimethyl sulfoxide and sulfolane; water; and a mixed solvent of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (ID).
- the keels (I-b) in the compound of the present invention are converted to the corresponding carbonyl compounds (I-a) by hydrolysis.
- the invention compound (Ib) can be produced, for example, by the production method (1).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, in the presence of an acidic reagent, usually at a temperature in the range of 0 to 200 ° (preferably 20 to 150 ° C.).
- the acidic reagent examples include hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, brenstead acid such as trifluoroacetic acid, p-toluenesulfonic acid; or aluminum trichloride, boron tribromide, Examples thereof include Lewis acids such as boron chloride and the like, and the amount to be used is generally 0.05 to 10 equivalents, preferably 0.01 to 2 equivalents, per 1 equivalent of compound (I-b). .
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene. Hydrocarbons; halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Tetrahydrofuran, dioxane, etc.
- ketones such as acetone and methylethyl ketone
- alcohols such as methanol, ethanol, and propanol
- non-protonic properties such as N, N-dimethylformamide, N-methylvinylidone, dimethylsulfoxide, and sulfolane A polar solvent
- water and a mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-b).
- the compound (I-Y) 'of the present invention is produced by reacting the compound (I-a) of the present invention with the corresponding phosphorane (XVI).
- the compound (Ia) of the present invention can be produced, for example, by the above-mentioned production methods (1), (18) and (19).
- the above reaction is carried out usually in a solvent-free or inert solvent in a temperature range of from 120 to 200 ° C, preferably from 0 to 150 ° C.
- the amount of the compound used is usually 1 to 3 equivalents of the corresponding phosphorane (XVI), preferably 1 to 1.5 equivalents to 1 equivalent of the compound (I_a).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dichlorobenzene Ethers such as butyl ether, dimethoxetane, tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methyl ethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile Aprotic polar solvents such as N, N-dimethylformamide, N-methylbipyridine, dimethylsulfoxide and sulfolane; water; and a mixed solvent of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50
- the corresponding phosphorane or ylide may be prepared in the system using the corresponding phosphonium salt and a base in place of the phosphorane (XVI).
- Corresponding phosphonate carbonions may be used as in reactions.
- the present production method is based on the compound (I-a) of the present invention and a hydroxylamine (XV II ) Or a salt thereof to produce an oxime derivative (Ic).
- the invention compound (I-a) can be produced, for example, according to the production methods (1), (18) and (19).
- the above reaction is carried out usually in a solvent-free or inert solvent in a temperature range of 120 to 200 ° C, preferably 0 to 150 ° C.
- the amount of the compound to be used is usually 1.0 to 3.0 equivalents, preferably 1.0 to 1.5 equivalents of the hydroxyamine (XVII) per 1 equivalent of the compound (Ia). is there.
- the above reaction involves hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, trifluoroacetic acid, p -Brensted acid such as toluenesulfonic acid and pyridinum p-toluenesulfonic acid; or acid reagent such as aluminum trichloride, boron tribromide, Lewis acid such as boron trichloride, or triethylamine, N, N-diisopropyle Tyramine, pyridine, bicholine, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4.0] —7-indene, 1,5-diazabicyclo [ 4.3.0] — 5-nonene, 1,4-diazabicyclo [2.2.2] octane and other nitrogen-containing organic bases; sodium hydroxide, potassium hydroxide and other alkali metal
- the amount of the acidic reagent or base to be used is generally 1 to 20 equivalents, preferably 2 to 10 equivalents, per 1 equivalent of compound (Ia).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N, N-dimethylformamide; Ridone, dimethyl sulfoxide, sulfolane, etc.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-a).
- the compound (Ic) of the present invention is produced by condensing the compound (Id) of the present invention with a halide or a sulfonate (X).
- the inventive compound (Id) can be produced, for example, by the production methods (1) and (21).
- the above reaction is carried out without solvent or in a solvent inert to the reaction in the presence of a base, usually at a temperature in the range of ⁇ 20 to 200 ° C .; preferably 0 to 150 ° C.
- the amount of the compound to be used is generally 1 to 10 equivalents, preferably 1 to 2 equivalents of the compound (X) relative to 1 equivalent of the compound (Id).
- Examples of the base include triethylamine, N, N-diisoprovirethylamine, pyridine, bicholine, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4] 0] — 7-Pendecene, 1,5-Diazabicyclo [4.3.0] — 5-Nonene, 1,4-Diazabicyclo [2.2.2]
- Nitrogen-containing organic bases such as octane; sodium hydroxide Alkali metal hydroxides such as sodium hydroxide, potassium hydroxide; alkaline metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; alkaline metals such as sodium hydrogen carbonate and hydrogen carbonate Metal hydride; metal hydrides such as sodium hydride and the like;
- the amount of the base to be used is generally 1-3 equivalents, preferably 1-2 equivalents, per 1 equivalent of compound (
- Suitable solvents used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; benzene, Aromatic hydrocarbons such as toluene, xylene and cumene; Halogenated hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, cyclobenzene, dichlorobenzene, etc .; Jethyl ether, diisopro Ethers such as virether, dibutylether, dimethoxetane, tetrahydrofuran, and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethylketone; nitriles such as acetonitrile; N, N-dimethylform Non-protonic polar
- the compound of the present invention (Ie) is produced by reducing and simultaneously cyclizing a nitro compound (XVIII).
- the above reduction reaction is usually carried out in the absence of a solvent or in a solvent inert to the reaction, in the presence of a metal or metal compound, and an acidic reagent, at a temperature of usually 20 to 200 ° (preferably 50 to 150 °). .
- Examples of the above-mentioned metal or metal compound include metals or metal compounds usually used in the reduction reaction of a nitro group, such as iron, zinc, tin and tin (II) chloride.
- the amount of the metal or metal compound to be used is generally 1 to 20 equivalents, preferably 2 to 10 equivalents, per 1 equivalent of compound (XVI II).
- Examples of the acidic reagent include inorganic acids such as hydrochloric acid and sulfuric acid, and organic acids such as acetic acid.
- the amount of the acid reagent to be used is generally 0.01 to 20 equivalents to 1 equivalent of the compound (XVIII). And preferably 0.01 to 10 equivalents.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitritols such as acetonitrile; , N-dimethylformamide, N-methylbi mouth Water; organic acids such as acetic acid;, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane and solvent mixtures of two or more of these, and the like.
- the amount used is usually within 100
- the above reaction is carried out using sodium sulfide, sodium hydrosulfide, sodium nitrite, ammonium sulfide, a hydrogen / metal catalyst (palladium-carbon, platinum Other reduction methods can be used, such as carbon, rhodium-alumina, platinum, Raney nickel, etc.). Manufacturing method (2 4)
- the compound (If) of the present invention is produced by condensing the compound (Ie) of the present invention with a halide or a sulfonate (X).
- the inventive compound (Ie) can be produced, for example, by the above-mentioned production methods (1) and (23).
- the condensation reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, in the presence of a base, usually at a temperature in the range of 120 to 200 ° C, preferably 0 to 150 ° C.
- the amount of the compound to be used is 1 to 10 equivalents, preferably 1 to 2 equivalents of the compound (X) to 1 equivalent of the compound (I-e).
- Examples of the above bases include triethylamine, N, N-diisoprovirethylamine, pyridine, bicholine, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4] 0] — 7-Pendecene, 1,5-Diazabicyclo [4.3.0] — 5-Nonene, 1,4-Diazabicyclo [2.2.2]
- Nitrogen-containing organic bases such as octane; sodium hydroxide Alkali metal hydroxides such as potassium hydroxide and potassium hydroxide; Alkali metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; Alkali metals such as sodium hydrogen carbonate and potassium hydrogen carbonate Metal hydride; metal hydride such as sodium hydride;
- the amount of the base to be used is generally 1-3 equivalents, preferably 1-2 equivalents, per 1 equivalent of compound (I
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahi Ethers such as drofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; nitriles such as acetonitrile; N, N-dimethylformamid And non-protonic polar solvents such as N-methylpyrrolidone, dimethylsulfoxide, and sulfolane; water; and a mixed solvent of two or more of these.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-e).
- a 11 represents an oxygen atom, a sulfur atom or a —NR 4 — group of A 1 And R 4 have the same meanings as described above.
- the compound (Ih) of the present invention is produced from the compound (Ig) of the present invention and an alcohol, thiol or amine (XIX).
- the invention compound (Ig) can be produced, for example, by the above-mentioned production method (1).
- the condensation reaction is carried out in the absence of a solvent or in a solvent inert to the reaction in the presence of a base, usually at a temperature in the range of -20 to 200 ° C, preferably 0 to 150 ° C.
- the amount of the compound to be used is 1 to 20 equivalents, preferably 1 to 5 equivalents of the compound (XIX) per 1 equivalent of the compound (Ig).
- Examples of the above base include triethylamine, N, N-diisoprovirethylamine, pyridine, picoline, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4] 0] —7-Pendecene, 1,5-Diazabicyclo [4.3.0] — 5-Nonene, 1,4-Diazabicyclo [2.2.2] Octane and other nitrogen-containing organic bases; sodium hydroxide Alkali metal hydroxides, such as potassium hydroxide and potassium hydroxide; alkaline metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate, calcium carbonate; sodium hydrogen carbonate, charcoal Metal hydrides such as hydrogen oxyhydrogen and the like; metal hydrides such as sodium hydrogen hydride and the like.
- the amount of the base to be used is generally 1-3 equivalents, preferably 1-2 equivalents, per 1 equivalent of compound (Ig
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene; etc .; Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; nitriles such as acetonitrile; N, N-dimethylformamide; Non-protons such as don, dimethyl sulfoxide and sulfolane Polar solvent; water; and mixed solvents of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (I-g). Manufacturing method (26)
- R 1 ′ is an alkyl group, an alkenyl group, an alkynyl group, or a trialkylsilylethynyl group.
- This production method comprises reacting a substituted phenylpyrimidine (I-g) with the corresponding R 1 — H (XX) or a metal salt thereof R 1 — K (XXI) to obtain the substituted phenyl pyrimidine (I-g).
- R 1 — H (XX) or a metal salt thereof R 1 — K (XXI) to obtain the substituted phenyl pyrimidine (I-g).
- R 1 — H (XX) or a metal salt thereof R 1 — K (XXI) to obtain the substituted phenyl pyrimidine (I-g).
- — I) is manufactured.
- substituted phenylpyrimidi The compounds (Ig) can be produced, for example, by the above-mentioned production method (1).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, usually at a temperature of from 120 to 200 ° C, preferably from 0 to 150 ° C.
- the amount of the compound used in the reaction is usually 1.0 to 3.0 equivalents, preferably 1.0 to 1.0 equivalent of the compound (XX) or (XXI) per 1 equivalent of the compound (I-g). 5 equivalents.
- Examples of the base include triethylamine, N, N-diisopropylethylamine, pyridine, picoline, lutidine, collidine, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5.4.0] ] — 7-Pendecene, 1,5-Diazabicyclo [4. 3.
- metal halide, metal or metal complex catalyst examples include copper iodide, copper chloride, or zinc chloride; nickel, iron, ruthenium, cobalt, rhodium, iridium, noradium, platinum, and other metals; tetrakis (triphenyl).
- Rifenyl phosphine tri- (o-tolyl) phosphine, 1,2-bi (Diphenyl phosphine Ino) propane, 1, 1, One-bis (diphenyl phosphine b Roh)
- Examples include metal complexes formed with ligands such as phenethylene, dibenzylideneacetone, and acetylacetone.
- the amount of the metal halide, metal or metal complex catalyst used is usually 0.001 to 3.0 equivalents, preferably 0.05 to 3.0 equivalents: 1 equivalent of the compound (I-g). It is.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, and dichlorobenzene; getyl ether, diisopropyl ether, dibutyl ether, dimethyl ether Ethers such as toxetane, tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N-dimethylformamide, N-methylbi mouth Water;, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane ⁇ beauty mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (Ig)
- the present production method comprises the steps of removing a trialkylsilyl group of a substituted phenyltrialkylsilylethynylpyrimidine (Ij) to obtain a substituted phenyltrialkylsilyl ethynylpyrimidine. (I-k).
- the substituted phenyltrialkylsilylethyl-2-virimidine (I-1j) can be produced, for example, by the above-mentioned production method (26).
- the above reaction is carried out without solvent or in a solvent inert to the reaction, in the presence of a base, usually at a temperature in the range of -20 to 200 ° C, preferably 0 to 150 ° C.
- the base examples include tetrabutylammonium fluoride (TBAF), triethylamine, pyridine, picoline, N, N-getylaniline, 4- (dimethylamino) pyridine, 1,8-diazabicyclo [5,4,0] — Nitrogen-containing organic bases such as 7-ndecene, 1,5-diazabicyclo [4,3,0] -5-nonene, 1,4-diazabicyclo [2,2,2] octane; sodium hydroxide, hydroxide hydroxide Alkali metal hydroxides such as sodium carbonate, potassium carbonate, calcium carbonate and the like; Alkali metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; Alkali metal salts of organic acids such as sodium acetate and potassium acetate; Alkali metal hydrides such as sodium hydride; sodium fluoride, potassium fluoride, calcium fluoride The amount of the compound is usually 1.0 to 3.0 equivalents, preferably
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; benzene, toluene, xylene, cumene and the like.
- Aromatic hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, and dichlorobenzene; getyl ether, diisopropyl: ter, dibutyl ether, dimethyl Ethers such as toxetane, tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; , ⁇ -dimethylformamide, ⁇ -methylpi Water; Li, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane ⁇ beauty mixed solvent of two or more thereof.
- the amount of solvent used is usually It is within 100 times, preferably 1 to 50 times the weight
- R 29 represents a hydrogen atom or a lower alkyl group.
- a substituted alkenyl pyrimidine (Im) is produced by reducing a substituted alkynyl pyrimidine (1-1) in the compound of the present invention.
- the substituted alkynylpyrimidines (1-1) can be produced, for example, by the production methods (1) and (27).
- This reduction reaction is carried out by hydrogenation in a solvent-free or inert solvent in the presence of a catalyst, usually at a temperature in the range of 0 to 150 ° C, preferably 20 to 100 ° C. .
- the catalyst examples include those used in ordinary hydrogenation reactions, such as metal catalysts such as palladium-one-carbon, platinum-one-carbon, rhodium-alumina, platinum, Raney nickel, and the like. It is 0.001 to 0.2 times the weight of (I-1).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- ethers such as Jethyl ether, diisopropyl ether, dibutyl ether, dimethoxane, tetrahydrofuran, and dioxane
- esters such as ethyl acetate and butyl acetate
- ketones such as acetone and methyl ethyl ketone Alcohols such as methanol, ethanol and propanol
- water and mixed solvents of two or more of these.
- the amount of the solvent is usually 1100 times, preferably 1 to 20 times the weight of (1-1). Manufacturing method (29)
- R 3Q and R 31 each independently represent a hydrogen atom or a lower alkyl group.
- the compound (1-0) of the present invention is produced by halogenating the substituted phenylpyrimidines (In) in the compound of the present invention.
- the substituted phenylpyrimidine (In) can be produced, for example, by the above-mentioned production method (1).
- the above reaction is carried out without solvent or in a solvent inert to the reaction, in the presence of a halogenating agent, usually at a temperature of 0 to 200 ° C, preferably 0 to 150 ° C.
- a halogenating agent usually at a temperature of 0 to 200 ° C, preferably 0 to 150 ° C.
- the halogenating agent include the same halogenating agents as exemplified in the production method (2).
- the amount of the halogenating agent to be used is usually 1 equivalent of the compound (In) and 1 equivalent of the halogenating agent. 0 3.0 equivalents, preferably 1.0 1.5 equivalents.
- the above reaction is preferably carried out in a solvent.
- Suitable solvents to be used include those exemplified in the production method (2), and the amount used is usually 100 parts by weight of the compound (I-n). It is up to 150 times, preferably 150 times.
- a radical initiator may be used as necessary.
- the radical initiator used include dibenzoyl peroxide, azobisisobutyronitrile (AIBN), and the like.
- the amount of the compound (I-n) used per equivalent of the radical initiator is used. Is 0.0005 0.2 equivalent, preferably 0.001 to 0.1 equivalent. Manufacturing method (30)
- the compound (I-P) of the present invention is produced by reacting the compound (I-o) of the present invention with a lower carboxylate or a lower carboxylic acid.
- the inventive compound (Io) can be produced, for example, according to the production methods (1) and (29).
- the compound of the present invention (IP) is hydrolyzed.
- the compound (Iq) of the present invention is produced.
- the inventive compound (IP) can be produced, for example, by the aforementioned production methods (1) and (30).
- the present production method is a method for preparing a hydroxyl group of the compound (I-q) of the present invention.
- the compound (1-0) of the present invention is produced by halogenation.
- the inventive compound (Iq) can be produced by the production methods (1) and (31).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction, in the presence or absence of a base, in the presence of a halogenating agent, usually —20 to 200 ° C., preferably 0 to 1 ° C. It is performed in a temperature range of 50 ° C.
- halogenating agent examples include tetrabutylammonium fluoride (TB AF), sulfur tetrafluoride, getylamino sulfur trifluoride, morpholino sulfur trifluoride, thionyl chloride, phosphorus trichloride, phosphorus pentachloride, hydrochloric acid, Phosphorus oxychloride, hydrobromic acid, phosphorus tribromide, thionyl bromide, etc. are generally used in amounts of 1.0 to 3.0 equivalents per 1 equivalent of (I-q). Preferably it is 1.0 to 2.0 equivalents.
- suitable bases to be used include triethylamine, N, N-diisopropylethylamine, pyridine, picolin, lutidine, collidine, N, N-getylaniline, 4- ( Dimethylamino) pyridin, 1,8-diazabicyclo [5.4.0] — 7-indene, 1,5-diazabicyclo [4.3.0] — 5-nonene, 1,4-diazabicyclo [2.2.2] ]
- Nitrogen-containing organic bases such as octane; alkaline metal hydroxides such as sodium hydroxide and potassium hydroxide; alkali metal or alkaline earth metal carbonates such as sodium carbonate, potassium carbonate and calcium carbonate; Examples thereof include alkali metal hydrogencarbonates such as sodium hydrogencarbonate and potassium hydrogencarbonate, and the amount of (I-q) used is usually 3 equivalents or less, preferably 2 equivalents or less per equivalent of (I-q).
- the above reaction is preferably performed in a solvent.
- suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, dichlorobenzene, etc .; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran, Ethers such as dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; nitriles such as acetonitrile; N, N-dimethylformamide, N-methylpyrrolidone, dimethyl sulfoxide; Non-proton properties such as sulfolane A polar solvent; water; and a mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times the weight of the compound (Iq). Manufacturing method (33)
- a sulfoxide (I_s) is produced by oxidizing a sulfide (I-r) in the compound of the present invention.
- the sulfides (Ir) can be produced, for example, by the production methods (1) and (25) described above.
- sulfones (It) are produced by oxidizing sulfoxides (Is) in the compound of the present invention.
- the sulfoxides (Is) can be produced, for example, according to the production methods (1) and (33).
- the above reaction can be carried out under the same conditions as in the sulfide oxidation reaction as described in Production method (9).
- the present production method comprises oxidizing a pyrimidine nitrogen atom of the compound (Iu) of the present invention,
- the present invention is to produce the compound (IV) of the present invention.
- the invention compound (Iu) can be produced, for example, by the above-mentioned production method (1).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction in the presence of an oxidizing agent, usually at a temperature in the range of ⁇ 20 to 200 ° C., preferably 0 to 150 ° C.
- the oxidizing agent examples include hydrogen peroxide; peracids such as peracetic acid and methyl chloroperbenzoic acid; methyl periodate such as sodium metaperiodate; halogens such as chlorine and bromine; Examples include halogen compounds such as —chlorosuccinic acid imide and N-bromosuccinic acid imide.
- the amount of the oxidizing agent to be used is generally 1 to 30 equivalents, preferably 1 to 2 equivalents, per 1 equivalent of compound (I-u).
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons such as dichloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, chlorobenzene, and dichlorobenzene; getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane; Ethers such as tetrahydrofuran and dioxane; esters such as ethyl acetate and butyl acetate; ketones such as acetone and methylethyl ketone; alcohols such as methanol, ethanol and propanol; nitriles such as acetonitrile; N-dimethylformamide, N-methylbi mouth Water;, dimethyl sulfoxide, non pro ton polar solvents such as sulfolane ⁇ beauty mixed solvent of two or more thereof.
- the amount of the solvent used is usually within 100 times, preferably 1 to 50 times, the weight of the compound (Iu)
- the substituted phenylboric acids (compound (IX), wherein K is —B (OR 16 ) 2 ), which is an intermediate in the production method (1), may be produced, for example, according to any of the following production methods Can be. Manufacturing method (36) Mg
- R 16 excludes a hydrogen atom.
- R 32 represents a lower alkyl group.
- a borate ester such as trimethyl borate is allowed to act on a substituted phenylglyaryl reagent (IX-A) or a substituted phenyllithium reagent (IX-B) prepared from a substituted halobenzene (XXI I).
- XXI I substituted phenyl borate
- VI I-B substituted phenyl borate
- the above reaction is performed in the following three steps 1) to 3).
- 1 to 10 equivalents, preferably 1 to 2 equivalents of metal magnesium or alkyllithium is added to 1 equivalent of compound (XXIII), usually at -50 to 200 ° C.
- the substituted phenyl Grignard reagent (IX-A) or the substituted phenyl lithium reagent (IX-B) is prepared by operating in a temperature range of -20 to 80 ° C.
- Solvents used in the above reactions 1) and 2) include aliphatic hydrocarbons such as hexane, heptane, octane, and cyclohexane; aromatic hydrocarbons such as benzene, toluene, xylene, and cumene; Ethers such as getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran, and dioxane; and a mixed solvent of two or more thereof.
- the amount of the compound is usually the compound (XXI It is within 100 times, preferably 1 to 50 times the weight of I).
- Examples of the solvent used in the above reaction 3) include, in addition to those described above, alcohols such as methanol and ethanol; water, and the like.
- the amount of the solvent is usually 100 parts by weight of the compound (XXII I). It is within 1 times, preferably 1 to 50 times.
- the compound (VII-D) of the present invention is produced by nitrating the compound (VII-C).
- the compound (VIIC) of the present invention can be produced, for example, by the above-mentioned production method (36).
- the above reaction is carried out usually in the absence of a solvent or in a solvent inert to the reaction.
- the reaction is carried out at 0 ° C, preferably at a temperature in the range of -50 ° C to 0 ° C, by reacting the diluent.
- the compound of the present invention (VIIF) is produced by oxidizing the compound of the present invention (VIII-II).
- the compound (VII-II) of the present invention can be produced, for example, by the above-mentioned production method (36).
- the above reaction is carried out usually in the absence of a solvent or in a solvent inert to the reaction.
- the reaction is carried out by operating the oxidizing agent at a temperature of 0 ° C, preferably 0 to 150 ° C.
- Examples of the oxidizing agent include those usually used for the oxidation reaction of an alkyl group such as sodium dichromate and potassium permanganate.
- the amount of the oxidizing agent usually, the compound (VII-E) per 1 equivalent, It is 1 to 10 equivalents, preferably 1 to 3 equivalents.
- the above reaction is preferably performed under basic or acidic conditions.
- Examples of the base used include sodium hydroxide, potassium hydroxide and the like, and examples of the acidic reagent used include sulfuric acid and the like.
- the above reaction is preferably carried out in a solvent such as water or acetic acid.
- the amount of the reaction is usually within 100 times, preferably 1 to 50 times the weight of compound (VI I-E). Manufacturing method (39)
- This production method produces an ester, a thioester, or an acid amide (VII-F ') from the carboxylic acid (VII-F) in the compound of the present invention and an alcohol, thiol, or amine (XII). Things.
- the present production method comprises halogenating the compound (VII-H) of the present invention to obtain the compound of the present invention. (VII_I) or (VII-J).
- the compound (VII-H) in the invention compound can be produced, for example, by the above-mentioned production method (36).
- the present production method corresponds by hydrolyzing the compound (VII-J) of the present invention. It is converted into a carbonyl compound (VII-K).
- the inventive compound (VII-J) can be produced, for example, by the above-mentioned production method (40).
- the carbonyl compound (VII-K) in the compound of the present invention is converted to a compound (VII-L) by ketalization.
- the compound (VI I-K) can be produced, for example, according to the production method (41).
- the above reaction is carried out in the absence of a solvent or in a solvent inert to the reaction with the corresponding alcohol in the presence of an acidic reagent, usually at a temperature of 0 to 200 ° C, preferably 0 to 150 ° C. .
- the alcohols include monohydric alcohols such as methanol, ethanol, propanol, and butanol, and dihydric alcohols such as ethylene glycol, 1,3-propanediol, and 1,4-butanediol.
- the amount of the compound to be used is generally 1 to 30 equivalents, preferably 1 to 10 equivalents, per 1 equivalent of compound (VII-K).
- the acidic reagent examples include hydrochloric acid, hydrobromic acid, hydroiodic acid, sulfuric acid, brenstead acid such as trifluoroacetic acid, p-toluenesulfonic acid; or aluminum trichloride, boron tribromide, A Lewis acid such as boron chloride and the like can be used.
- the amount of the compound to be used is generally 0.005 to 10 equivalents, preferably 0.005 to 0.2 equivalent, per 1 equivalent of compound (VII-K). is there.
- Suitable solvents to be used include aliphatic hydrocarbons such as hexane, heptane, octane and cyclohexane; and aromatic hydrocarbons such as benzene, toluene, xylene and cumene.
- Hydrocarbons Chloromethane, chloroform, carbon tetrachloride, 1,2-dichloroethane, benzene, dichlorobenzene Halogenated hydrocarbons such as ethylene; ethers such as getyl ether, diisopropyl ether, dibutyl ether, dimethoxetane, tetrahydrofuran, and dioxane; alcohols such as methanol, ethanol, and propanol; and a mixed solvent of two or more of these And the like.
- the amount of the solvent to be used is usually within 100 times, preferably 1 to 50 times the amount of the compound (VII-K).
- substituted phenyltrialkyltins (compound (IX) in which K is Sn (R 20 ) 3 ), which is an intermediate compound of production method (1), may be, for example, as described below.
- a substituted phenyl Grignard reagent (IX-A) or a substituted phenyl lithium reagent (IX-B) was prepared from the substituted halobenzenes (XX II) in the same manner as described in the production method (36). After that, it can be produced by reacting trialkyltin chlorides.
- (XVI II) which is a starting compound of the production method (23) is produced by reacting the compound (IG) with the compound (XXIII) in the presence of a base, for example, as described below. can do.
- the compound of the present invention has isomers such as optical isomers, diastereomers, and isomers depending on the structure.
- the present invention includes all of these. Each of these isomers can be obtained by isolation from a mixture or by selective production according to a known method.
- each isomer may be used alone or as a mixture of isomers.
- the drug substance When the compound of the present invention is used as a herbicide, the drug substance may be applied as it is, but it is usually used in the form of a wettable powder, a granule, an emulsion, a flowable and the like using an appropriate auxiliary agent. .
- the content of the compound of the present invention in the preparation varies depending on the form of the preparation. In general, for example, 1 to 90% by weight for a wettable powder, 0.1 to 30% by weight for a granule, and 1 to 50% for an emulsion. 5% by weight is appropriate for flowables.
- These preparations containing the compound of the present invention are applied as they are or diluted with water before application.
- Auxiliaries used in the preparation of drug products include, for example, solid carriers such as kaolin, bentonite, talc, diatomaceous earth, white carbon, starch; water, alcohols (methanol, ethanol, propanol, butanol, Ethylene glycol, etc.), Ketones (acetone, methyl ethyl ketone, cyclohexanone, isophorone, etc.), Ethers (getyl ether, dioxane, cellosolves, etc.), Aliphatic hydrocarbons (kerosene, kerosene, etc.) ), Aromatic hydrocarbons (benzene, toluene, xylene, cumene, solvent naphtha, methylnaphthylene, etc.), halogenated hydrocarbons (dichloroethane, carbon tetrachloride, trichlorobenzene, etc.), acid amides (dimethylformamide) , Dimethyl
- an adjuvant such as a spreading agent is added to the spray liquid to improve the adhesiveness and spreadability and enhance the herbicidal effect. Is also good.
- auxiliary agents such as spreading agents used include surfactants (the above-mentioned nonionic surfactants, cationic surfactants, anionic surfactants, amphoteric surfactants), paraffin, and polyvinyl acetate. , Polyacrylates, ethylene glycol, polyethylene glycol, crop oils (mineral oils, animal and vegetable oils, etc.), liquid fertilizers and the like. These adjuvants may be used in combination of two or more if necessary.
- auxiliary agents used such as spreading agents, varies depending on the type, but it is usually appropriate to add 0.01 to 5% by weight to the spray liquid. Depending on the type of adjuvant, it may be added in advance as a component in the drug product.
- the application amount of the compound of the present invention varies depending on conditions such as the structure of the compound, the target weed, the treatment time, the treatment method, and the properties of the soil.
- the amount of the active ingredient per hectare is usually 2 to 2000 g, and is preferably 2 to 2000 g. A range of 5 to 1000 grams is appropriate.
- the weeds targeted by the compound of the present invention include, for example, Shiroza, Akaza, Inuyu-de, Haruyu-de, Inubu, Aobu, Hakobe, Hotokenoza, Ichibi, Ona Momi, Malva Asagao, Dwarf Asagao, Seiyokarashina , Broadleaf weeds such as jaemgra, sayeosumire, oroshigiku, kosendangusa, and narrow leaf weeds such as mehishiba, ohishiba, inubie and enocologusa.
- broadleaf weeds such as Kikasigusa, Azena, Konagi, Abnome, Mizohakobe, Heramoda power, Omodaka, Patricia, etc.
- narrow leaf weeds such as Yuinubie, Yumagayari, Hoyurui and Mizugayari are mentioned.
- the compound of the present invention can be used for soil treatment, foliage treatment and flooding treatment in upland fields and paddy fields.
- the above weeds can be controlled by any treatment method.
- the compound of the present invention has little effect on cultivated crops such as corn, wheat, barley, rice, soybean and the like in both soil treatment and foliage treatment, and is a selective herbicide in cultivation of these crops. It can be used as
- the herbicide containing the compound of the present invention as an active ingredient can be mixed and applied with other pesticides such as insecticides, fungicides, and plant growth regulators used in the same field, and fertilizers. In order to further stabilize the herbicidal effect, it can be mixed and applied with other herbicides.
- the respective preparations may be mixed at the time of application, or may be applied as a preparation containing both in advance. Examples of the herbicides that can be suitably mixed and applied with the compound of the present invention include the following.
- Triazine herbicides are Triazine herbicides:
- Example 1 the present invention will be described more specifically with reference to examples of the present invention. However, the present invention is not limited to the following examples unless it exceeds the gist.
- Example 1 the present invention is not limited to the following examples unless it exceeds the gist.
- 4,5-Dichloro-6-ethylpyrimidine (0.40 g, 2.24 mmol), tetrakis (triphenylphosphine) palladium in a 4 mL solution of 4-chloro-3-isopropoxyphenylboric acid (0.48 g, 2.24 mmol) in toluene (0) (0.26 g, 0.22 mmol), ethanol (1 mL), sodium carbonate (0.24 g, 2.24 mmol) and water (2 mL) were added, and the mixture was heated to 105 ° C for 4.5 hours with stirring.
- Carbonic acid rim (0.31 g) was added to a 5-mL solution of 5-ku-guchi- 4- (4-ku-guchi- 2-fluoro-5-hydroxy xyphenyl) -6-ethylpyrimidine (0.53 g, 1.85 mmol) in acetone. , 2.22 mmol) and methyl bromoacetate (0.34 g, 2.22 mmol), and the mixture was heated under reflux with stirring for 5 hours. After acetone was distilled off under reduced pressure, a saturated aqueous solution of ammonium chloride was added, and the mixture was extracted with ethyl acetate.
- N, N-dimethylformamide of ethyl acrylate (1.00 g, 10.0 mmol), triethylamine (0.56 g, 5.5 mmol), triphenylphosphine (0.26 g, 1.0 mmol), and palladium acetate (0.11 g, 0.49 mmol)
- 5-chloro-4- (4-chloro-2-fluoro-5-trifluoromethylsulfonyloxyphenyl) -6-ethylpyrimidine (2.10 g, 5.0 mmol). The mixture was stirred for 24 hours while heating at 120 ° C.
- Ethyl triphenylphosphoranylidene acetate (1.20 g, 3.5 mmol) was added to dilute hydrochloric acid (concentrated hydrochloric acid 0.29 g, distilled water 17 mL), and the mixture was heated to 60 ° C.
- a solution of Kulamin-T (0.94 g, 4.1 mmol) in water (7 mL) was slowly added thereto, and the mixture was further stirred at 60 ° C for 10 minutes.
- Ethyl acetate was added thereto and cooled to room temperature. The organic layer was washed with water and then with saturated saline, dried over anhydrous sodium sulfate, and concentrated under reduced pressure.
- Iron powder (l.OOg), acetic acid (0.5 mL) and water (2.0 mL) were charged into a 100 mL three-necked flask equipped with a mechanical stirrer, and the mixture was stirred at 60 ° C for 20 minutes while heating. Then, N-methylbilysine (10.0 mL) was added, and the temperature was raised to 80 ° C.
- Ethyl 4- (5-chloro-6-ethylpyrimidine-4-yl) -5-fluoro-2--2-nitrophenoxacetate (1.00 g, 2.6 mmol) was slowly added thereto over 5 minutes. After completion, the mixture was stirred at 80 ° C for 3.5 hours.
- aqueous sodium hydroxide solution prepared from 4.3 g of sodium hydroxide and 290 mL of water
- aqueous sodium hydroxide solution was placed in a 1-L three-necked flask equipped with a mechanical stirrer and a thermometer, followed by 4-chloro-2-fluoro-5-methylphenylborane.
- Acid (10.00 g, 0.053 mol) was added and the temperature was raised to 35 ° C.
- an aqueous solution of potassium permanganate (18.50 g, 0.12 mol) (220 mL) was slowly added dropwise over 1.5 hours while maintaining the internal temperature at 35-40 ° C. After completion of the dropwise addition, the mixture was further stirred at 50 ° C for 3 hours.
- Table 1-12 The compounds of the present invention obtained by any of the above Examples are exemplified in Table 1-12.
- Table 13 shows their physical properties and NMR spectrum data. Further, a method for producing a starting compound other than the above-mentioned 5-substituted-2,4-dihaphenylphenylboric acid will be described as a reference example.
- the analytical values of this compound were as follows.
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
Abstract
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
AU64718/00A AU6471800A (en) | 1999-08-05 | 2000-08-03 | 4-(substituted phenyl)-5-halopyrimidine derivatives and herbicides containing the same as the active ingredient |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP22224899 | 1999-08-05 | ||
JP11/222248 | 1999-08-05 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2001010843A1 true WO2001010843A1 (fr) | 2001-02-15 |
Family
ID=16779429
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/JP2000/005222 WO2001010843A1 (fr) | 1999-08-05 | 2000-08-03 | Derives de 4-(phenyl substitue)-5-halopyrimidine et herbicides contenant ces derives comme ingredients actifs |
Country Status (2)
Country | Link |
---|---|
AU (1) | AU6471800A (fr) |
WO (1) | WO2001010843A1 (fr) |
Cited By (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2001068613A1 (fr) * | 2000-03-17 | 2001-09-20 | Nissan Chemical Industries, Ltd. | Dérivés pyrimidinone et herbicides |
JP2003034682A (ja) * | 2000-09-19 | 2003-02-07 | Sumitomo Chem Co Ltd | ピリミジン化合物及びその用途 |
KR101350071B1 (ko) * | 2006-01-13 | 2014-01-14 | 다우 아그로사이언시즈 엘엘씨 | 6-(다-치환 아릴)-4-아미노피콜리네이트 및 그의제초제로서의 용도 |
WO2023169984A1 (fr) * | 2022-03-11 | 2023-09-14 | Syngenta Crop Protection Ag | Composés herbicides |
WO2023222589A1 (fr) * | 2022-05-20 | 2023-11-23 | Syngenta Crop Protection Ag | Composés herbicides |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS6422858A (en) * | 1987-07-16 | 1989-01-25 | Mitsui Toatsu Chemicals | Fluorine-containing pyrimidine derivative and its preparation |
WO1993015074A1 (fr) * | 1992-01-29 | 1993-08-05 | E.I. Du Pont De Nemours And Company | Composes herbicides phenylheterocycliques substitues |
GB2277928A (en) * | 1993-05-12 | 1994-11-16 | Merck Patent Gmbh | Cyclohexyl- and cyclohexylethyl- fluorobiphenyls and liquid-crystalline compositions thereof |
WO1998011070A1 (fr) * | 1996-09-12 | 1998-03-19 | Basf Aktiengesellschaft | Procede pour la preparation de (2'-fluorophenyl)-3-halopyridines |
-
2000
- 2000-08-03 WO PCT/JP2000/005222 patent/WO2001010843A1/fr active Application Filing
- 2000-08-03 AU AU64718/00A patent/AU6471800A/en not_active Abandoned
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS6422858A (en) * | 1987-07-16 | 1989-01-25 | Mitsui Toatsu Chemicals | Fluorine-containing pyrimidine derivative and its preparation |
WO1993015074A1 (fr) * | 1992-01-29 | 1993-08-05 | E.I. Du Pont De Nemours And Company | Composes herbicides phenylheterocycliques substitues |
GB2277928A (en) * | 1993-05-12 | 1994-11-16 | Merck Patent Gmbh | Cyclohexyl- and cyclohexylethyl- fluorobiphenyls and liquid-crystalline compositions thereof |
WO1998011070A1 (fr) * | 1996-09-12 | 1998-03-19 | Basf Aktiengesellschaft | Procede pour la preparation de (2'-fluorophenyl)-3-halopyridines |
Non-Patent Citations (1)
Title |
---|
KONDO Y. ET AL.: "Studies on pyrimidin derivatives. XLI.", CHEMICAL AND PHARMACEUTICAL BULLETIN, vol. 37, no. 10, 1989, pages 2814 - 2816, XP002933782 * |
Cited By (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2001068613A1 (fr) * | 2000-03-17 | 2001-09-20 | Nissan Chemical Industries, Ltd. | Dérivés pyrimidinone et herbicides |
JP2003034682A (ja) * | 2000-09-19 | 2003-02-07 | Sumitomo Chem Co Ltd | ピリミジン化合物及びその用途 |
KR101350071B1 (ko) * | 2006-01-13 | 2014-01-14 | 다우 아그로사이언시즈 엘엘씨 | 6-(다-치환 아릴)-4-아미노피콜리네이트 및 그의제초제로서의 용도 |
WO2023169984A1 (fr) * | 2022-03-11 | 2023-09-14 | Syngenta Crop Protection Ag | Composés herbicides |
WO2023222589A1 (fr) * | 2022-05-20 | 2023-11-23 | Syngenta Crop Protection Ag | Composés herbicides |
Also Published As
Publication number | Publication date |
---|---|
AU6471800A (en) | 2001-03-05 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US7256298B2 (en) | Pyrazole derivatives and process for the production thereof | |
ES2642189T3 (es) | Pirazolilpirrolinonas y su uso como herbicidas | |
JP2004107228A (ja) | 双環性ピリミジノン誘導体及びこれを有効成分とする除草剤 | |
WO2004029060A1 (fr) | Nouveaux herbicides, leur utilisation, nouveaux derives de thienopyrimidine, leurs intermediaires, et methode de production desdits composes | |
WO1989011782A1 (fr) | ALKOXY-1,2,4-TRIAZOLO[1,5-c]PYRIMIDINE-2-SULFONAMIDES, LEUR PROCEDE DE PREPARATION ET INTERMEDIAIRES | |
EP0203428A1 (fr) | Benzoyl-4-alkyl(alcényl)-1-pyrazoles comme herbicides | |
WO1997035851A1 (fr) | Derives de benzene a substitution heterocyclique et herbicides | |
WO1996033994A1 (fr) | Derives amino-substitues, leur procede de preparation et herbicide | |
WO2002038550A1 (fr) | Dérivés de la pyrimidine et herbicides les contenant | |
WO2004110149A1 (fr) | Utilisation de derives de l'isoindolinone comme insecticides | |
WO1997028127A1 (fr) | Derives de pyridone et herbicides | |
WO2001010843A1 (fr) | Derives de 4-(phenyl substitue)-5-halopyrimidine et herbicides contenant ces derives comme ingredients actifs | |
BE897301A (fr) | Derives du n-phenylpoyrazole herbicides | |
JP2946656B2 (ja) | ウラシル誘導体および除草剤 | |
JPH09188676A (ja) | 新規ウラシル誘導体、およびこれを有効成分とする除草剤 | |
JP2000016982A (ja) | キノリン誘導体及びこれを有効成分とする除草剤 | |
JPH1121274A (ja) | ベンゾイルシクロヘキサンジオン誘導体および除草剤 | |
JP2001106675A (ja) | 4−置換フェニル−5−ハロピリミジン誘導体及びこれを有効成分とする除草剤 | |
JPH11292720A (ja) | 縮合イミダゾリノン誘導体を含有する除草剤 | |
WO2001004101A1 (fr) | Compositions d'uracile et leurs utilisations | |
WO1995012582A1 (fr) | Nouveau derive de pyrimidine disubstitue en positions 4 et 5 et herbicide | |
JPH1121280A (ja) | 新規なベンゼン誘導体および除草剤 | |
JP2762505B2 (ja) | 縮合ヘテロ環誘導体、その製法及び除草剤 | |
JP2003238538A (ja) | 新規4−置換フェニル−5−ハロピリミジン誘導体及びこれを有効成分とする除草剤 | |
US6365753B1 (en) | Phthalimides and herbicide containing the same as active component |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
AK | Designated states |
Kind code of ref document: A1 Designated state(s): AE AG AL AM AT AU AZ BA BB BG BR BY BZ CA CH CN CR CU CZ DE DK DM DZ EE ES FI GB GD GE GH GM HR HU ID IL IN IS KE KG KP KR KZ LC LK LR LS LT LU LV MA MD MG MK MN MW MX MZ NO NZ PL PT RO RU SD SE SG SI SK SL TJ TM TR TT TZ UA UG US UZ VN YU ZA ZW |
|
AL | Designated countries for regional patents |
Kind code of ref document: A1 Designated state(s): GH GM KE LS MW MZ SD SL SZ TZ UG ZW AM AZ BY KG KZ MD RU TJ TM AT BE CH CY DE DK ES FI FR GB GR IE IT LU MC NL PT SE BF BJ CF CG CI CM GA GN GW ML MR NE SN TD TG |
|
121 | Ep: the epo has been informed by wipo that ep was designated in this application | ||
DFPE | Request for preliminary examination filed prior to expiration of 19th month from priority date (pct application filed before 20040101) | ||
REG | Reference to national code |
Ref country code: DE Ref legal event code: 8642 |
|
122 | Ep: pct application non-entry in european phase |