USRE38257E1 - Piperdine derivatives and hypotensives containing the same - Google Patents
Piperdine derivatives and hypotensives containing the same Download PDFInfo
- Publication number
- USRE38257E1 USRE38257E1 US09/248,236 US24823699A USRE38257E US RE38257 E1 USRE38257 E1 US RE38257E1 US 24823699 A US24823699 A US 24823699A US RE38257 E USRE38257 E US RE38257E
- Authority
- US
- United States
- Prior art keywords
- dibenzo
- ylidene
- cyclohepten
- piperidinyl
- hydrochloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 title claims abstract description 35
- 230000001077 hypotensive effect Effects 0.000 title description 8
- 208000001953 Hypotension Diseases 0.000 title description 5
- 208000021822 hypotensive Diseases 0.000 title description 5
- -1 piperidine compound Chemical class 0.000 claims abstract description 82
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 11
- 125000003386 piperidinyl group Chemical group 0.000 claims abstract description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 6
- 125000001544 thienyl group Chemical group 0.000 claims abstract description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims abstract description 5
- 125000002541 furyl group Chemical group 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 150000003053 piperidines Chemical class 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000006290 2-hydroxybenzyl group Chemical group [H]OC1=C(C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 4
- 125000002757 morpholinyl group Chemical group 0.000 claims 3
- 125000004193 piperazinyl group Chemical group 0.000 claims 3
- 125000004076 pyridyl group Chemical group 0.000 claims 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims 3
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 3
- 125000003118 aryl group Chemical group 0.000 abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 3
- 125000001309 chloro group Chemical group Cl* 0.000 abstract description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 abstract description 2
- 239000001257 hydrogen Substances 0.000 abstract description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 abstract description 2
- 125000001041 indolyl group Chemical group 0.000 abstract description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 abstract description 2
- 125000001624 naphthyl group Chemical group 0.000 abstract description 2
- 125000002971 oxazolyl group Chemical group 0.000 abstract description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 abstract description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 abstract description 2
- 125000000335 thiazolyl group Chemical group 0.000 abstract description 2
- 238000001819 mass spectrum Methods 0.000 description 126
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 79
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 29
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 0 *.**N1CCC(=C2CC[Y]C3=C2C=C(*)C=C3)CC1 Chemical compound *.**N1CCC(=C2CC[Y]C3=C2C=C(*)C=C3)CC1 0.000 description 7
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 7
- 239000001273 butane Substances 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- 229940093499 ethyl acetate Drugs 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 206010020772 Hypertension Diseases 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 4
- UMSVPCYSAUKCAZ-UHFFFAOYSA-N propane;hydrochloride Chemical compound Cl.CCC UMSVPCYSAUKCAZ-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000002220 antihypertensive agent Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- DLDURBOOWUYWKO-UHFFFAOYSA-N 1-(4-cyclohexylbutyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1CCCCC1 DLDURBOOWUYWKO-UHFFFAOYSA-N 0.000 description 2
- FYDMBYXBQYEOEL-UHFFFAOYSA-N 2,3-dihydro-1h-indene;hydrochloride Chemical compound Cl.C1=CC=C2CCCC2=C1 FYDMBYXBQYEOEL-UHFFFAOYSA-N 0.000 description 2
- WDBBRPYHQIKBTJ-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-propan-2-yl-2-(3,4,5-trimethoxyphenyl)pentanenitrile;hydrochloride Chemical compound Cl.COC1=C(OC)C(OC)=CC(C(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)(C#N)C(C)C)=C1 WDBBRPYHQIKBTJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- GFQMCUXQUDMCFI-UHFFFAOYSA-N Cl.OC(C(C)O)C Chemical compound Cl.OC(C(C)O)C GFQMCUXQUDMCFI-UHFFFAOYSA-N 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- LMSNZLCSZWZZGU-UHFFFAOYSA-N butan-1-ol;hydrochloride Chemical compound Cl.CCCCO LMSNZLCSZWZZGU-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- RZTAMFZIAATZDJ-UHFFFAOYSA-N felodipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC(Cl)=C1Cl RZTAMFZIAATZDJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000004526 pharmaceutical effect Effects 0.000 description 2
- OHEDMAIVEXQCOZ-UHFFFAOYSA-N piperidine;dihydrochloride Chemical compound Cl.Cl.C1CCNCC1 OHEDMAIVEXQCOZ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035488 systolic blood pressure Effects 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- CLVFGHUOJKAFCX-UHFFFAOYSA-N 1,3-dioxolane;hydrochloride Chemical compound Cl.C1COCO1 CLVFGHUOJKAFCX-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- GNXSLHALCWYJAY-UHFFFAOYSA-N 1,4-dihydropyridine-3,5-dicarboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CNC=C(C(O)=O)C1 GNXSLHALCWYJAY-UHFFFAOYSA-N 0.000 description 1
- YQKBOIZNIXXOQC-UHFFFAOYSA-N 1-(1-cyclohexylbutyl)-4-(2-methoxydibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC(OC)=CC=C3C=CC3=CC=CC=C32)CCN1C(CCC)C1CCCCC1 YQKBOIZNIXXOQC-UHFFFAOYSA-N 0.000 description 1
- JZPUFHOISSEBAS-UHFFFAOYSA-N 1-(2-cyclohexylethyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC1CCCCC1 JZPUFHOISSEBAS-UHFFFAOYSA-N 0.000 description 1
- JVWIPJBMDMEKAC-UHFFFAOYSA-N 1-(3-cyclohexylpropyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1CCCCC1 JVWIPJBMDMEKAC-UHFFFAOYSA-N 0.000 description 1
- DYGAOTRBHCHURE-UHFFFAOYSA-N 1-(5-cyclohexylpentyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC1CCCCC1 DYGAOTRBHCHURE-UHFFFAOYSA-N 0.000 description 1
- PNIUJGAQHQBPNA-UHFFFAOYSA-N 1-(6-cyclohexylhexyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCC1CCCCC1 PNIUJGAQHQBPNA-UHFFFAOYSA-N 0.000 description 1
- LLZMRIQBEBDIEE-UHFFFAOYSA-N 1-(7-cyclohexylheptyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCCC1CCCCC1 LLZMRIQBEBDIEE-UHFFFAOYSA-N 0.000 description 1
- LVKSNBSSBYYFAQ-UHFFFAOYSA-N 1-(8-cyclohexyloctyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCCCC1CCCCC1 LVKSNBSSBYYFAQ-UHFFFAOYSA-N 0.000 description 1
- NWTOZPBMGRVHQV-UHFFFAOYSA-N 1-(cyclohexylmethyl)-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC1CCCCC1 NWTOZPBMGRVHQV-UHFFFAOYSA-N 0.000 description 1
- PMHLUFLXTXBDPZ-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.ClC1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PMHLUFLXTXBDPZ-UHFFFAOYSA-N 0.000 description 1
- ZPALAFYLZOBXBY-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.ClC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 ZPALAFYLZOBXBY-UHFFFAOYSA-N 0.000 description 1
- AMWBJIBFNWGYQZ-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1=CC(Cl)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 AMWBJIBFNWGYQZ-UHFFFAOYSA-N 0.000 description 1
- OEKYYTWTCRFIER-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfanylpropan-2-yl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CCCCC1CC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CSCC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CC1CCCCC1 OEKYYTWTCRFIER-UHFFFAOYSA-N 0.000 description 1
- AODCCEJRXFCSGY-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfinylpropan-2-yl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine Chemical compound C1CCCCC1CC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CS(=O)CC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CC1CCCCC1 AODCCEJRXFCSGY-UHFFFAOYSA-N 0.000 description 1
- COMVIGQYMPURRQ-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfonylpropan-2-yl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CCCCC1CC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CS(=O)(=O)CC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CC1CCCCC1 COMVIGQYMPURRQ-UHFFFAOYSA-N 0.000 description 1
- OSKPIFGFPQFISJ-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfanylpropyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CCCCC1C(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CCSCCC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)C1CCCCC1 OSKPIFGFPQFISJ-UHFFFAOYSA-N 0.000 description 1
- XDOANLRHNCTBJZ-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfinylpropyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CCCCC1C(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CCS(=O)CCC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)C1CCCCC1 XDOANLRHNCTBJZ-UHFFFAOYSA-N 0.000 description 1
- RDSGTVKQSHCDJT-UHFFFAOYSA-N 1-[1-cyclohexyl-3-[3-cyclohexyl-3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]sulfonylpropyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CCCCC1C(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)CCS(=O)(=O)CCC(N1CCC(CC1)=C1C2=CC=CC=C2C=CC2=CC=CC=C21)C1CCCCC1 RDSGTVKQSHCDJT-UHFFFAOYSA-N 0.000 description 1
- AEKIDNAYJAXMFR-UHFFFAOYSA-N 1-[2-(benzenesulfonyl)ethyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCS(=O)(=O)C1=CC=CC=C1 AEKIDNAYJAXMFR-UHFFFAOYSA-N 0.000 description 1
- HYSPQLWXPKDCQS-UHFFFAOYSA-N 1-[2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]piperidin-1-yl]ethanone;hydrochloride Chemical compound Cl.CC(=O)N1CCCCC1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 HYSPQLWXPKDCQS-UHFFFAOYSA-N 0.000 description 1
- ZAKUASDGRBQQSZ-UHFFFAOYSA-N 1-[3-(benzenesulfinyl)propyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCS(=O)C1=CC=CC=C1 ZAKUASDGRBQQSZ-UHFFFAOYSA-N 0.000 description 1
- VAWMMDBKNLWPIN-UHFFFAOYSA-N 1-[3-(benzenesulfonyl)propyl]-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCS(=O)(=O)C1=CC=CC=C1 VAWMMDBKNLWPIN-UHFFFAOYSA-N 0.000 description 1
- SDBXEEYLDAVRNL-UHFFFAOYSA-N 1-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2,3-dihydroindene-1-carbonitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC1(C#N)C2=CC=CC=C2CC1 SDBXEEYLDAVRNL-UHFFFAOYSA-N 0.000 description 1
- SFZFJADFLUMMAI-UHFFFAOYSA-N 1-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-5,6-dimethoxy-2,3-dihydroindene-1-carbonitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC1(C#N)CCC2=C1C=C(OC)C(OC)=C2 SFZFJADFLUMMAI-UHFFFAOYSA-N 0.000 description 1
- XPFJASSOSKVKFQ-UHFFFAOYSA-N 1-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(4-fluorophenyl)ethanone Chemical compound C1=CC(F)=CC=C1CC(=O)N(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XPFJASSOSKVKFQ-UHFFFAOYSA-N 0.000 description 1
- LABCQYIKZFLAOL-UHFFFAOYSA-N 1-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]piperidin-1-yl]ethanone;hydrochloride Chemical compound Cl.C1CN(C(=O)C)CCC1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LABCQYIKZFLAOL-UHFFFAOYSA-N 0.000 description 1
- PQANFZRFUFDEBI-UHFFFAOYSA-N 1-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]piperidin-2-one;hydrochloride Chemical compound Cl.O=C1CCCCN1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PQANFZRFUFDEBI-UHFFFAOYSA-N 0.000 description 1
- NKZMBBNWKACLJD-UHFFFAOYSA-N 1-[4-[5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]pent-1-enyl]piperidin-1-yl]ethanone Chemical compound C1CN(C(=O)C)CCC1C=CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 NKZMBBNWKACLJD-UHFFFAOYSA-N 0.000 description 1
- AUXKAROWWJRBSH-UHFFFAOYSA-N 1-benzyl-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC1=CC=CC=C1 AUXKAROWWJRBSH-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- ITMFSLAXCINCAX-UHFFFAOYSA-N 1-decyl-4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCC)CCC1=C1C2=CC=CC=C2CCC2=CC=CC=C21 ITMFSLAXCINCAX-UHFFFAOYSA-N 0.000 description 1
- UYGCCRAOIKSMEM-UHFFFAOYSA-N 1-decyl-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 UYGCCRAOIKSMEM-UHFFFAOYSA-N 0.000 description 1
- VDMDQVYXXMCWLC-UHFFFAOYSA-N 1-phenylbutan-1-one;hydrochloride Chemical compound Cl.CCCC(=O)C1=CC=CC=C1 VDMDQVYXXMCWLC-UHFFFAOYSA-N 0.000 description 1
- WYCDGINBZWVNHB-UHFFFAOYSA-N 2-(3-benzoylphenyl)-5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-methylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C)(C#N)C(C=1)=CC=CC=1C(=O)C1=CC=CC=C1 WYCDGINBZWVNHB-UHFFFAOYSA-N 0.000 description 1
- QOPBKLAYDFPTOD-UHFFFAOYSA-N 2-(3-benzoylphenyl)-6-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-methylhexanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC(C)(C#N)C(C=1)=CC=CC=1C(=O)C1=CC=CC=C1 QOPBKLAYDFPTOD-UHFFFAOYSA-N 0.000 description 1
- MZHHCKMGGZLIKE-UHFFFAOYSA-N 2-(3-benzoylphenyl)-7-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-methylheptanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC(C)(C#N)C(C=1)=CC=CC=1C(=O)C1=CC=CC=C1 MZHHCKMGGZLIKE-UHFFFAOYSA-N 0.000 description 1
- JDBVSUSMMFCBCG-UHFFFAOYSA-N 2-(3-benzoylphenyl)-8-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-methyloctanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCC(C)(C#N)C(C=1)=CC=CC=1C(=O)C1=CC=CC=C1 JDBVSUSMMFCBCG-UHFFFAOYSA-N 0.000 description 1
- LBFZMCHFXRYPFA-UHFFFAOYSA-N 2-(3-chloropropyl)-5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCl)(C#N)C1=CC=CC=C1 LBFZMCHFXRYPFA-UHFFFAOYSA-N 0.000 description 1
- UFTGEWVEDWIQFJ-UHFFFAOYSA-N 2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(4-nitrophenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1C=CCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 UFTGEWVEDWIQFJ-UHFFFAOYSA-N 0.000 description 1
- XVYVXCNNNVYHPB-UHFFFAOYSA-N 2-[2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-1-(3,4-dimethoxyphenyl)-3-methylbutan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C(C(C)C)CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XVYVXCNNNVYHPB-UHFFFAOYSA-N 0.000 description 1
- YSMUGCGXCSNFGN-UHFFFAOYSA-N 2-[2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-1-(3,4-dimethoxyphenyl)pentan-1-one Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(CCC)C(=O)C1=CC=C(OC)C(OC)=C1 YSMUGCGXCSNFGN-UHFFFAOYSA-N 0.000 description 1
- FBDZPRFHCYERGB-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)-1,3-dithiane 1,1,3,3-tetraoxide;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C1(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)S(=O)(=O)CCCS1(=O)=O FBDZPRFHCYERGB-UHFFFAOYSA-N 0.000 description 1
- HEMMGCUMUZQPRY-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)dodecanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCCCCC)(C#N)C1=CC=C(OC)C(OC)=C1 HEMMGCUMUZQPRY-UHFFFAOYSA-N 0.000 description 1
- CAYUSSYCUVODDW-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)heptanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCC)(C#N)C1=CC=C(OC)C(OC)=C1 CAYUSSYCUVODDW-UHFFFAOYSA-N 0.000 description 1
- WWNKEZFRUSSRHB-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)hexanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCC)(C#N)C1=CC=C(OC)C(OC)=C1 WWNKEZFRUSSRHB-UHFFFAOYSA-N 0.000 description 1
- IUXJRHPJMRQVSN-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)nonanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCC)(C#N)C1=CC=C(OC)C(OC)=C1 IUXJRHPJMRQVSN-UHFFFAOYSA-N 0.000 description 1
- DNUFKJOJEYBLSW-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)octanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCC)(C#N)C1=CC=C(OC)C(OC)=C1 DNUFKJOJEYBLSW-UHFFFAOYSA-N 0.000 description 1
- MHQBUKLZSPLAMC-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-(3,4-dimethoxyphenyl)undecanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCCCC)(C#N)C1=CC=C(OC)C(OC)=C1 MHQBUKLZSPLAMC-UHFFFAOYSA-N 0.000 description 1
- WIMPTXXMGZDBCH-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenyl-1,3-dithiane 1,1,3,3-tetraoxide;hydrochloride Chemical compound Cl.O=S1(=O)CCCS(=O)(=O)C1(C=1C=CC=CC=1)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 WIMPTXXMGZDBCH-UHFFFAOYSA-N 0.000 description 1
- OMODEGBABXJNHS-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenyldecanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCCC)(C#N)C1=CC=CC=C1 OMODEGBABXJNHS-UHFFFAOYSA-N 0.000 description 1
- WVDKXXCOHRTWKB-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenyldodecanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCCCCC)(C#N)C1=CC=CC=C1 WVDKXXCOHRTWKB-UHFFFAOYSA-N 0.000 description 1
- CMBHBYOAUUOVJH-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenylheptanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCC)(C#N)C1=CC=CC=C1 CMBHBYOAUUOVJH-UHFFFAOYSA-N 0.000 description 1
- DUFILUYGMDSFTN-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenylhexanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCC)(C#N)C1=CC=CC=C1 DUFILUYGMDSFTN-UHFFFAOYSA-N 0.000 description 1
- HYYHKOJBDLWHNB-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenylnonanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCC)(C#N)C1=CC=CC=C1 HYYHKOJBDLWHNB-UHFFFAOYSA-N 0.000 description 1
- RRRSWXKMPRLYCL-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenyloctanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCC)(C#N)C1=CC=CC=C1 RRRSWXKMPRLYCL-UHFFFAOYSA-N 0.000 description 1
- ALWKOHLZAJWURJ-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-2-phenylundecanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCCCCCCCC)(C#N)C1=CC=CC=C1 ALWKOHLZAJWURJ-UHFFFAOYSA-N 0.000 description 1
- JGHBDHOBCNFUCH-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]aniline;dihydrochloride Chemical compound Cl.Cl.NC1=CC=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JGHBDHOBCNFUCH-UHFFFAOYSA-N 0.000 description 1
- HZHUHLYEAWFHPT-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]decanenitrile;hydrochloride Chemical compound Cl.C1CN(CCCC(CCCCCCCC)C#N)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 HZHUHLYEAWFHPT-UHFFFAOYSA-N 0.000 description 1
- VLKQJUDRHVHQCV-UHFFFAOYSA-N 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propylsulfanyl]aniline;hydrochloride Chemical compound Cl.NC1=CC=CC=C1SCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 VLKQJUDRHVHQCV-UHFFFAOYSA-N 0.000 description 1
- MOZAPHPPZAWWRD-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dimethoxyphenyl)ethanone;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(=O)CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MOZAPHPPZAWWRD-UHFFFAOYSA-N 0.000 description 1
- TUWCSUQINSDGOB-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)ethanol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC(O)C1=CC=C(F)C=C1 TUWCSUQINSDGOB-UHFFFAOYSA-N 0.000 description 1
- PMOOQGROJBSXIH-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)ethanone;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PMOOQGROJBSXIH-UHFFFAOYSA-N 0.000 description 1
- YIELPMNHAUIZSW-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylethanol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC(O)C1=CC=CC=C1 YIELPMNHAUIZSW-UHFFFAOYSA-N 0.000 description 1
- YBPNSEMKOVVGJY-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-6,7-dimethoxyquinazolin-4-amine Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1C1=NC(N)=C(C=C(C(OC)=C2)OC)C2=N1 YBPNSEMKOVVGJY-UHFFFAOYSA-N 0.000 description 1
- NFUXQFUSJAZFHW-UHFFFAOYSA-N 2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl cyclohexanecarboxylate;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCOC(=O)C1CCCCC1 NFUXQFUSJAZFHW-UHFFFAOYSA-N 0.000 description 1
- TXRCCNTXLXOMLX-UHFFFAOYSA-N 2-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]-1h-indole;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CC1=CC2=CC=CC=C2N1 TXRCCNTXLXOMLX-UHFFFAOYSA-N 0.000 description 1
- XZCIAFZJBHBXFA-UHFFFAOYSA-N 2-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]benzonitrile;hydrochloride Chemical compound Cl.N#CC1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XZCIAFZJBHBXFA-UHFFFAOYSA-N 0.000 description 1
- NCYGIFDOHAAOBM-UHFFFAOYSA-N 2-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC1=CC=CC=N1 NCYGIFDOHAAOBM-UHFFFAOYSA-N 0.000 description 1
- MOHRTPBVAZTTFR-UHFFFAOYSA-N 2-amino-n-[2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]benzenesulfonamide;hydrochloride Chemical compound Cl.NC1=CC=CC=C1S(=O)(=O)NCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MOHRTPBVAZTTFR-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- SDNWHAWTMJHXRT-UHFFFAOYSA-N 2-chloro-4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2-nitrophenyl)prop-2-enyl]piperidine Chemical compound [O-][N+](=O)C1=CC=CC=C1C=CCN(CC1)C(Cl)CC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SDNWHAWTMJHXRT-UHFFFAOYSA-N 0.000 description 1
- KFLSPUIGVVYTNY-UHFFFAOYSA-N 2-cyclohexyl-4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butanoic acid Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(C(=O)O)C1CCCCC1 KFLSPUIGVVYTNY-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- HXZKOZGNEDZAQX-UHFFFAOYSA-N 3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenol;hydrochloride Chemical compound Cl.OC1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 HXZKOZGNEDZAQX-UHFFFAOYSA-N 0.000 description 1
- NLGAQRPBJJMSQX-UHFFFAOYSA-N 3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC=CC1=CC=CN=C1 NLGAQRPBJJMSQX-UHFFFAOYSA-N 0.000 description 1
- DXTDQILXUAGKJR-UHFFFAOYSA-N 3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]aniline;dihydrochloride Chemical compound Cl.Cl.NC1=CC=CC(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 DXTDQILXUAGKJR-UHFFFAOYSA-N 0.000 description 1
- PNEGGBOSHHITIU-UHFFFAOYSA-N 3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1=CC=CN=C1 PNEGGBOSHHITIU-UHFFFAOYSA-N 0.000 description 1
- RBHKENZDYVZXCY-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dimethoxyphenyl)propan-1-one;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(=O)CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 RBHKENZDYVZXCY-UHFFFAOYSA-N 0.000 description 1
- ULPKYKVMMCCAGH-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)propan-1-ol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(O)C1=CC=C(F)C=C1 ULPKYKVMMCCAGH-UHFFFAOYSA-N 0.000 description 1
- XSXGZAOXEWXHRM-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)propan-1-one;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XSXGZAOXEWXHRM-UHFFFAOYSA-N 0.000 description 1
- OOFRASNVMVTWRJ-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylbutan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1C(C)CC(=O)C1=CC=CC=C1 OOFRASNVMVTWRJ-UHFFFAOYSA-N 0.000 description 1
- JKHDKHUOFKUNHB-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylpropan-1-ol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(O)C1=CC=CC=C1 JKHDKHUOFKUNHB-UHFFFAOYSA-N 0.000 description 1
- YRXAEELMAMPOFR-UHFFFAOYSA-N 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylpropan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(=O)C1=CC=CC=C1 YRXAEELMAMPOFR-UHFFFAOYSA-N 0.000 description 1
- WPLSPGOMJNUZFT-UHFFFAOYSA-N 3-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]benzonitrile;hydrochloride Chemical compound Cl.N#CC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 WPLSPGOMJNUZFT-UHFFFAOYSA-N 0.000 description 1
- BJWHGCFFWDUTRI-UHFFFAOYSA-N 3-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC1=CC=CN=C1 BJWHGCFFWDUTRI-UHFFFAOYSA-N 0.000 description 1
- PIIYJKOPMWDBAH-UHFFFAOYSA-N 3-amino-n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]benzamide;hydrochloride Chemical compound Cl.NC1=CC=CC(C(=O)NCCN2C(CCCC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 PIIYJKOPMWDBAH-UHFFFAOYSA-N 0.000 description 1
- HFTLOWIMWCABLD-UHFFFAOYSA-N 4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3-methoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3CCC3=CC=CC=C32)=C1 HFTLOWIMWCABLD-UHFFFAOYSA-N 0.000 description 1
- WPFKPWVSPXUDRU-UHFFFAOYSA-N 4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(4-nitrophenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2CCC2=CC=CC=C21 WPFKPWVSPXUDRU-UHFFFAOYSA-N 0.000 description 1
- ISQCBVNTWWICKB-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)piperidine Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CC1CC2=CC=CC=C2CC1 ISQCBVNTWWICKB-UHFFFAOYSA-N 0.000 description 1
- ZEMMILKIKGXDER-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(2-phenoxyethyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCOC1=CC=CC=C1 ZEMMILKIKGXDER-UHFFFAOYSA-N 0.000 description 1
- UACWUBBLRYEPSE-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(2-phenylethyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC1=CC=CC=C1 UACWUBBLRYEPSE-UHFFFAOYSA-N 0.000 description 1
- ZSROQQGTFFQMFO-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(2-phenylmethoxyethyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCOCC1=CC=CC=C1 ZSROQQGTFFQMFO-UHFFFAOYSA-N 0.000 description 1
- QKCDZOCITGVCQX-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(2-phenylsulfanylethyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCSC1=CC=CC=C1 QKCDZOCITGVCQX-UHFFFAOYSA-N 0.000 description 1
- NVWGKRBQSOCGFS-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(3-phenoxypropyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCOC1=CC=CC=C1 NVWGKRBQSOCGFS-UHFFFAOYSA-N 0.000 description 1
- RBIIFDLYWKFWGB-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(3-phenylprop-2-enyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC=CC1=CC=CC=C1 RBIIFDLYWKFWGB-UHFFFAOYSA-N 0.000 description 1
- GEDIJPLDTNPASI-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(3-phenylpropyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1=CC=CC=C1 GEDIJPLDTNPASI-UHFFFAOYSA-N 0.000 description 1
- PJGRNSGKYLKOET-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(3-phenylsulfanylpropyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCSC1=CC=CC=C1 PJGRNSGKYLKOET-UHFFFAOYSA-N 0.000 description 1
- XQGHTEZIGNBVIK-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(3-piperidin-2-ylpropyl)piperidine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1CCCCN1 XQGHTEZIGNBVIK-UHFFFAOYSA-N 0.000 description 1
- NLPRTCQGCOMJOD-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(4-phenoxybutyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCOC1=CC=CC=C1 NLPRTCQGCOMJOD-UHFFFAOYSA-N 0.000 description 1
- TZALBASSYWFNFM-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(4-phenylbutyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1=CC=CC=C1 TZALBASSYWFNFM-UHFFFAOYSA-N 0.000 description 1
- JRZUKMLMPMDSOL-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(4-phenylsulfanylbutyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCSC1=CC=CC=C1 JRZUKMLMPMDSOL-UHFFFAOYSA-N 0.000 description 1
- JRPSOFAGPBCGLD-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(5-phenylpentyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC1=CC=CC=C1 JRPSOFAGPBCGLD-UHFFFAOYSA-N 0.000 description 1
- FYPGDZPMVUVWCP-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(6-phenylhexyl)piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCC1=CC=CC=C1 FYPGDZPMVUVWCP-UHFFFAOYSA-N 0.000 description 1
- ZGUZXESVJDCVHV-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(naphthalen-1-ylmethyl)piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CC1=CC=CC2=CC=CC=C12 ZGUZXESVJDCVHV-UHFFFAOYSA-N 0.000 description 1
- AVHIQNCBTJOMQQ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-(naphthalen-2-ylmethyl)piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CC1=CC=C(C=CC=C2)C2=C1 AVHIQNCBTJOMQQ-UHFFFAOYSA-N 0.000 description 1
- KXNPHDVODGBAKO-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(2,3-dimethoxy-1h-benzo[7]annulen-6-yl)methyl]piperidine Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CC1=CC2=CC(OC)=C(OC)CC2=CC=C1 KXNPHDVODGBAKO-UHFFFAOYSA-N 0.000 description 1
- PIHBRZCLNMBXIX-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(2,3-dimethoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1OC PIHBRZCLNMBXIX-UHFFFAOYSA-N 0.000 description 1
- MJEMCVFPFIDYRL-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(2-fluorophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.FC1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MJEMCVFPFIDYRL-UHFFFAOYSA-N 0.000 description 1
- LAIUUBZVSZXSEE-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(2-methoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LAIUUBZVSZXSEE-UHFFFAOYSA-N 0.000 description 1
- IVRHBXHUSBAMFC-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(2-nitrophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 IVRHBXHUSBAMFC-UHFFFAOYSA-N 0.000 description 1
- GYSYAQRDVGMNEF-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3,4,5-trimethoxyphenyl)methyl]piperidine Chemical compound COC1=C(OC)C(OC)=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 GYSYAQRDVGMNEF-UHFFFAOYSA-N 0.000 description 1
- KPDKYQPZDIZLTH-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3,4-dimethoxyphenyl)methyl]piperidine Chemical compound C1=C(OC)C(OC)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 KPDKYQPZDIZLTH-UHFFFAOYSA-N 0.000 description 1
- CGRRWUVBFGOCBS-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3,4-dimethoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 CGRRWUVBFGOCBS-UHFFFAOYSA-N 0.000 description 1
- OIKISKIICFQVKW-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3-fluorophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.FC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 OIKISKIICFQVKW-UHFFFAOYSA-N 0.000 description 1
- WFQDZTGEPPHVPV-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3-methoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 WFQDZTGEPPHVPV-UHFFFAOYSA-N 0.000 description 1
- YHNGBMFYKWEPJL-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(3-nitrophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 YHNGBMFYKWEPJL-UHFFFAOYSA-N 0.000 description 1
- OIOWYMYKUSPKOP-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(4-fluorophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 OIOWYMYKUSPKOP-UHFFFAOYSA-N 0.000 description 1
- DGFMKSOBHWIXPG-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(4-methoxyphenyl)methyl]piperidine;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DGFMKSOBHWIXPG-UHFFFAOYSA-N 0.000 description 1
- ZQAPFXQFKKTJJF-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[(4-nitrophenyl)methyl]piperidine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ZQAPFXQFKKTJJF-UHFFFAOYSA-N 0.000 description 1
- UGNALIMPHWDAIN-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[2-(2,3-dihydro-1h-inden-2-yl)ethyl]piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCC1CC2=CC=CC=C2C1 UGNALIMPHWDAIN-UHFFFAOYSA-N 0.000 description 1
- GUFCHIAIVYCCGJ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidine;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 GUFCHIAIVYCCGJ-UHFFFAOYSA-N 0.000 description 1
- VLAFRIHRUIDUEQ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2,3-dimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1OC VLAFRIHRUIDUEQ-UHFFFAOYSA-N 0.000 description 1
- ZYWKGTKFQJXWSL-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2,3-dimethoxyphenyl)propyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1OC ZYWKGTKFQJXWSL-UHFFFAOYSA-N 0.000 description 1
- MZQFHOJHNRDNKK-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2,4-dimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC(OC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MZQFHOJHNRDNKK-UHFFFAOYSA-N 0.000 description 1
- NVRCJBQFBNDQDY-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2,4-dimethoxyphenyl)propyl]piperidine;dihydrochloride Chemical compound Cl.Cl.COC1=CC(OC)=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 NVRCJBQFBNDQDY-UHFFFAOYSA-N 0.000 description 1
- MHJGMHTXASGVEP-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2,5-dimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=C(OC)C(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 MHJGMHTXASGVEP-UHFFFAOYSA-N 0.000 description 1
- CZHBXUWHVYDLBJ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2-methoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 CZHBXUWHVYDLBJ-UHFFFAOYSA-N 0.000 description 1
- SLFYKDXZPBZZEL-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2-methoxyphenyl)propyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SLFYKDXZPBZZEL-UHFFFAOYSA-N 0.000 description 1
- BEPFPWKCGMMGDN-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2-nitrophenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 BEPFPWKCGMMGDN-UHFFFAOYSA-N 0.000 description 1
- GMJOVBUYSACQGI-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(2-nitrophenyl)propyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 GMJOVBUYSACQGI-UHFFFAOYSA-N 0.000 description 1
- ZEHTVEQMMCGUSO-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(3,5-dimethoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC(OC)=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 ZEHTVEQMMCGUSO-UHFFFAOYSA-N 0.000 description 1
- ZEBGOPCGBZTRAS-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(3-methoxy-4-nitrophenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.C1=C([N+]([O-])=O)C(OC)=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 ZEBGOPCGBZTRAS-UHFFFAOYSA-N 0.000 description 1
- WZEOOLNGXSDWAK-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(3-methoxyphenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.COC1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 WZEOOLNGXSDWAK-UHFFFAOYSA-N 0.000 description 1
- PBMMZUTZSBSUOT-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-(3-nitrophenyl)prop-2-enyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 PBMMZUTZSBSUOT-UHFFFAOYSA-N 0.000 description 1
- WOYFHYVKINCDKA-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-[2-[2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-4-fluorophenyl]sulfinyl-5-fluorophenyl]propyl]piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC1=CC(F)=CC=C1S(=O)C1=CC=C(F)C=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 WOYFHYVKINCDKA-UHFFFAOYSA-N 0.000 description 1
- YLDKIOCKZUMUGD-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[3-[2-[2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]-4-fluorophenyl]sulfonyl-5-fluorophenyl]propyl]piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC1=CC(F)=CC=C1S(=O)(=O)C1=CC=C(F)C=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 YLDKIOCKZUMUGD-UHFFFAOYSA-N 0.000 description 1
- HCAHNKPPKSZOEN-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[4-(1-methylpiperidin-3-yl)butyl]piperidine;dihydrochloride Chemical compound Cl.Cl.C1N(C)CCCC1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 HCAHNKPPKSZOEN-UHFFFAOYSA-N 0.000 description 1
- XDMIBWKAVGTJBU-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[4-(2-nitrophenyl)butyl]piperidine;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XDMIBWKAVGTJBU-UHFFFAOYSA-N 0.000 description 1
- WCKQNZUVROSZFG-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[4-(4-nitrophenyl)butyl]piperidine;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 WCKQNZUVROSZFG-UHFFFAOYSA-N 0.000 description 1
- FVBFTYTYBZHVNP-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[4-(oxan-4-yl)butyl]piperidine;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1CCOCC1 FVBFTYTYBZHVNP-UHFFFAOYSA-N 0.000 description 1
- YIJWXSVJNFQHTD-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[6-[6-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-ethylcyclohexa-2,4-dien-1-yl]sulfinyl-6-ethylcyclohexa-2,4-dien-1-yl]piperidine;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1C1C=CC=CC1(CC)S(=O)C1(CC)C(N2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)C=CC=C1 YIJWXSVJNFQHTD-UHFFFAOYSA-N 0.000 description 1
- ATOJLHZPIURDNG-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ATOJLHZPIURDNG-UHFFFAOYSA-N 0.000 description 1
- OADPOTGPZKGTNA-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC(CN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 OADPOTGPZKGTNA-UHFFFAOYSA-N 0.000 description 1
- XKZBQJUXFMCSBX-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-dodecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XKZBQJUXFMCSBX-UHFFFAOYSA-N 0.000 description 1
- DOIGBGKRKGAOAQ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-heptylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DOIGBGKRKGAOAQ-UHFFFAOYSA-N 0.000 description 1
- PHHVOFSEOLXUGA-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-hexadecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PHHVOFSEOLXUGA-UHFFFAOYSA-N 0.000 description 1
- LBDPNAHLORAAKZ-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-hexylpiperidine Chemical compound C1CN(CCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LBDPNAHLORAAKZ-UHFFFAOYSA-N 0.000 description 1
- JDAARGGYVAZWLX-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-hexylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JDAARGGYVAZWLX-UHFFFAOYSA-N 0.000 description 1
- WBHIANCTJNKUMO-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-nonadecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 WBHIANCTJNKUMO-UHFFFAOYSA-N 0.000 description 1
- NLDBYMMELBMPHS-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-octylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 NLDBYMMELBMPHS-UHFFFAOYSA-N 0.000 description 1
- NFQSVSJUTBTANE-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-propylpiperidine;dihydrochloride Chemical compound Cl.Cl.C1CN(CCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 NFQSVSJUTBTANE-UHFFFAOYSA-N 0.000 description 1
- ALAVDEVMZHVXSA-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-tetradecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ALAVDEVMZHVXSA-UHFFFAOYSA-N 0.000 description 1
- CPUQUKWFLWGASG-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-tridecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 CPUQUKWFLWGASG-UHFFFAOYSA-N 0.000 description 1
- LUSVYSQLRHXJNI-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-undecylpiperidine;hydrochloride Chemical compound Cl.C1CN(CCCCCCCCCCC)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LUSVYSQLRHXJNI-UHFFFAOYSA-N 0.000 description 1
- PEINQEPYJUCEJO-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]-2-methoxyphenol Chemical compound C1=C(O)C(OC)=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 PEINQEPYJUCEJO-UHFFFAOYSA-N 0.000 description 1
- DTEZKHFEBGKSEW-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]aniline;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DTEZKHFEBGKSEW-UHFFFAOYSA-N 0.000 description 1
- ODPCJAVATNAKMK-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzene-1,2-diol;hydrochloride Chemical compound Cl.C1=C(O)C(O)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ODPCJAVATNAKMK-UHFFFAOYSA-N 0.000 description 1
- IVNCMEUNPSRDMJ-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzenesulfonamide;hydrochloride Chemical compound Cl.C1=CC(S(=O)(=O)N)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 IVNCMEUNPSRDMJ-UHFFFAOYSA-N 0.000 description 1
- RKELEDCUSYWXLF-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenol;hydrochloride Chemical compound Cl.C1=CC(O)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 RKELEDCUSYWXLF-UHFFFAOYSA-N 0.000 description 1
- SQWJBTVPAYUZIN-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]aniline;dihydrochloride Chemical compound Cl.Cl.C1=CC(N)=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SQWJBTVPAYUZIN-UHFFFAOYSA-N 0.000 description 1
- PHJMAIJSDBGPIO-UHFFFAOYSA-N 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1=CC=NC=C1 PHJMAIJSDBGPIO-UHFFFAOYSA-N 0.000 description 1
- CBUZHUYMUCRHOU-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(2,3,4-trimethoxyphenyl)butan-1-one Chemical compound COC1=C(OC)C(OC)=CC=C1C(=O)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 CBUZHUYMUCRHOU-UHFFFAOYSA-N 0.000 description 1
- MIIUOYILFBUPRD-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-diethoxyphenyl)butan-1-one;hydrochloride Chemical compound Cl.C1=C(OCC)C(OCC)=CC=C1C(=O)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MIIUOYILFBUPRD-UHFFFAOYSA-N 0.000 description 1
- NCAWULHEDASNJJ-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dihydro-1h-isoquinolin-2-yl)butan-1-one Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC(=O)N1CC2=CC=CC=C2CC1 NCAWULHEDASNJJ-UHFFFAOYSA-N 0.000 description 1
- UUZLLAXIOXMNOP-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dimethoxyphenyl)-2-ethylbutan-1-one Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(CC)C(=O)C1=CC=C(OC)C(OC)=C1 UUZLLAXIOXMNOP-UHFFFAOYSA-N 0.000 description 1
- XTGMBIIZLPDYEG-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dimethoxyphenyl)-2-methylbutan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)C(C)CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XTGMBIIZLPDYEG-UHFFFAOYSA-N 0.000 description 1
- JWZWNNVCFGNNHR-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-ol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(O)C1=CC=C(F)C=C1 JWZWNNVCFGNNHR-UHFFFAOYSA-N 0.000 description 1
- PPWKYFWAXFQBGQ-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PPWKYFWAXFQBGQ-UHFFFAOYSA-N 0.000 description 1
- SELUTOKEGHOLEY-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-hydroxypiperidin-1-yl)butan-1-one;hydrochloride Chemical compound Cl.C1CC(O)CCN1C(=O)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SELUTOKEGHOLEY-UHFFFAOYSA-N 0.000 description 1
- FIWCEVWCYWNPPV-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(furan-2-yl)butan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(=O)C1=CC=CO1 FIWCEVWCYWNPPV-UHFFFAOYSA-N 0.000 description 1
- OFCQFMMODNZGJR-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylbutan-1-ol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(O)C1=CC=CC=C1 OFCQFMMODNZGJR-UHFFFAOYSA-N 0.000 description 1
- DGLCXLJXRQUDFH-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-piperidin-1-ylbutan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(=O)N1CCCCC1 DGLCXLJXRQUDFH-UHFFFAOYSA-N 0.000 description 1
- GPXQJIJBXMDAQZ-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-thiophen-2-ylbutan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(=O)C1=CC=CS1 GPXQJIJBXMDAQZ-UHFFFAOYSA-N 0.000 description 1
- VLPCTQWQJKYIPS-UHFFFAOYSA-N 4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-3,4-dimethoxy-1-phenylbutan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1C(OC)C(OC)CC(=O)C1=CC=CC=C1 VLPCTQWQJKYIPS-UHFFFAOYSA-N 0.000 description 1
- XSOXVGZPTKQOHN-UHFFFAOYSA-N 4-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]benzonitrile;hydrochloride Chemical compound Cl.C1=CC(C#N)=CC=C1CN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 XSOXVGZPTKQOHN-UHFFFAOYSA-N 0.000 description 1
- TYDHNCSPWPKSDB-UHFFFAOYSA-N 4-[[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]methyl]pyridine;dihydrochloride Chemical compound Cl.Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CC1=CC=NC=C1 TYDHNCSPWPKSDB-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- PERZNCLVRBSSSG-UHFFFAOYSA-N 4-amino-n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]benzamide;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1C(=O)NCCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PERZNCLVRBSSSG-UHFFFAOYSA-N 0.000 description 1
- HAAZMOAXEMIBAJ-UHFFFAOYSA-N 4-chloro-2-methylquinazoline Chemical compound C1=CC=CC2=NC(C)=NC(Cl)=C21 HAAZMOAXEMIBAJ-UHFFFAOYSA-N 0.000 description 1
- IDNOPKVSDWDCJD-UHFFFAOYSA-N 4-cyclohexyl-1-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butan-1-one Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1C(=O)CCCC1CCCCC1 IDNOPKVSDWDCJD-UHFFFAOYSA-N 0.000 description 1
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 1
- DAPIFSLKNVUPQU-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(3,4-dimethoxyphenyl)pentan-1-one;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(=O)CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DAPIFSLKNVUPQU-UHFFFAOYSA-N 0.000 description 1
- MNEFOQATYONKIC-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)pentan-1-ol;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC(O)C1=CC=C(F)C=C1 MNEFOQATYONKIC-UHFFFAOYSA-N 0.000 description 1
- ZOZGIBRVPRPLAO-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-(4-fluorophenyl)pentan-1-one;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(=O)CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ZOZGIBRVPRPLAO-UHFFFAOYSA-N 0.000 description 1
- YNVOGXTVHOKLCC-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-1-phenylpentan-1-one;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC(=O)C1=CC=CC=C1 YNVOGXTVHOKLCC-UHFFFAOYSA-N 0.000 description 1
- HVAILSLTVNACSK-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2,2-diphenylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 HVAILSLTVNACSK-UHFFFAOYSA-N 0.000 description 1
- SRTHUKOYNAPEJH-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(1-methylpyrrol-2-yl)-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=CN1C SRTHUKOYNAPEJH-UHFFFAOYSA-N 0.000 description 1
- LYBPMSJLIDRKMP-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(1-methylpyrrol-2-yl)pentanenitrile;hydrochloride Chemical compound Cl.CN1C=CC=C1C(C#N)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LYBPMSJLIDRKMP-UHFFFAOYSA-N 0.000 description 1
- BKMNMTBOWWVDJC-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dichlorophenyl)-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=C(Cl)C(Cl)=C1 BKMNMTBOWWVDJC-UHFFFAOYSA-N 0.000 description 1
- GYUATXAMSQQIKG-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-ethylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CC)(C#N)C1=CC=C(OC)C(OC)=C1 GYUATXAMSQQIKG-UHFFFAOYSA-N 0.000 description 1
- LPZSUNSNUXKFPM-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-methylpentanenitrile;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(C)(C#N)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 LPZSUNSNUXKFPM-UHFFFAOYSA-N 0.000 description 1
- MMFJUUXUBVYYAL-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-phenylsulfanylpentanenitrile;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(C#N)(SC=1C=CC=CC=1)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MMFJUUXUBVYYAL-UHFFFAOYSA-N 0.000 description 1
- YBQDAJRBVXRTRH-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(C(C)C)(C#N)CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 YBQDAJRBVXRTRH-UHFFFAOYSA-N 0.000 description 1
- ISEAPQLOLRDZPG-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-propylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCC)(C#N)C1=CC=C(OC)C(OC)=C1 ISEAPQLOLRDZPG-UHFFFAOYSA-N 0.000 description 1
- AQKCKMKYBMXQAD-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3-methoxyphenyl)-2-propan-2-ylpentanenitrile Chemical compound COC1=CC=CC(C(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)(C#N)C(C)C)=C1 AQKCKMKYBMXQAD-UHFFFAOYSA-N 0.000 description 1
- WVTJQTNSYORKIG-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3-methylphenyl)-2-propan-2-ylpentanenitrile Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=CC(C)=C1 WVTJQTNSYORKIG-UHFFFAOYSA-N 0.000 description 1
- WJMFXFCJPDUNPX-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-[3-(trifluoromethyl)phenyl]pentanenitrile;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC(C(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)C#N)=C1 WJMFXFCJPDUNPX-UHFFFAOYSA-N 0.000 description 1
- ODJNWVKRUDFXRN-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-ethyl-2-phenylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CC)(C#N)C1=CC=CC=C1 ODJNWVKRUDFXRN-UHFFFAOYSA-N 0.000 description 1
- HBZIBWSUSKJUCR-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-methyl-2-phenylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C)(C#N)C1=CC=CC=C1 HBZIBWSUSKJUCR-UHFFFAOYSA-N 0.000 description 1
- SNRHYDDXAKIJKE-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-naphthalen-1-yl-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC(C(C)C)(C#N)C1=CC=CC2=CC=CC=C12 SNRHYDDXAKIJKE-UHFFFAOYSA-N 0.000 description 1
- DTIAEUDMPKLPEO-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-naphthalen-1-ylpentanenitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC(C#N)C1=CC=CC2=CC=CC=C12 DTIAEUDMPKLPEO-UHFFFAOYSA-N 0.000 description 1
- NSWQTVGZKLOAKG-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-naphthalen-2-yl-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC(C(C)C)(C#N)C1=CC=C(C=CC=C2)C2=C1 NSWQTVGZKLOAKG-UHFFFAOYSA-N 0.000 description 1
- WKKNOTDCTDRQIM-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-naphthalen-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1CCCC(C#N)C1=CC=C(C=CC=C2)C2=C1 WKKNOTDCTDRQIM-UHFFFAOYSA-N 0.000 description 1
- PTJVXUWGHMTTRS-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-phenylsulfanylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C#N)(C=1C=CC=CC=1)SC1=CC=CC=C1 PTJVXUWGHMTTRS-UHFFFAOYSA-N 0.000 description 1
- QPQXFADJTXUARR-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-propan-2-ylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=CC=C1 QPQXFADJTXUARR-UHFFFAOYSA-N 0.000 description 1
- HGVFRBMVDSWERM-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-propylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(CCC)(C#N)C1=CC=CC=C1 HGVFRBMVDSWERM-UHFFFAOYSA-N 0.000 description 1
- FBCUIMZRUJJFRS-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenylpentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C#N)C1=CC=CC=C1 FBCUIMZRUJJFRS-UHFFFAOYSA-N 0.000 description 1
- PRZHTHZIGFBLRZ-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-propan-2-yl-2-(1h-pyrrol-2-yl)pentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=CN1 PRZHTHZIGFBLRZ-UHFFFAOYSA-N 0.000 description 1
- ISQOIVHALCVFON-UHFFFAOYSA-N 5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-propan-2-yl-2-[3-(trifluoromethyl)phenyl]pentanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(C)C)(C#N)C1=CC=CC(C(F)(F)F)=C1 ISQOIVHALCVFON-UHFFFAOYSA-N 0.000 description 1
- IAVBANKMMHZCRG-UHFFFAOYSA-N 6-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylhexanenitrile;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(C(C)C)(C#N)CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 IAVBANKMMHZCRG-UHFFFAOYSA-N 0.000 description 1
- AOHMYUHFTUNIIG-UHFFFAOYSA-N 6-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-propan-2-ylhexanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC(C(C)C)(C#N)C1=CC=CC=C1 AOHMYUHFTUNIIG-UHFFFAOYSA-N 0.000 description 1
- SMLLCADMACDFJE-UHFFFAOYSA-N 6-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenylhexanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC(C#N)C1=CC=CC=C1 SMLLCADMACDFJE-UHFFFAOYSA-N 0.000 description 1
- COYQARJYPPDLAD-UHFFFAOYSA-N 7-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-(3,4-dimethoxyphenyl)-2-propan-2-ylheptanenitrile;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1C(C(C)C)(C#N)CCCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 COYQARJYPPDLAD-UHFFFAOYSA-N 0.000 description 1
- SXPHCFGKBLDVQV-UHFFFAOYSA-N 7-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-propan-2-ylheptanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC(C(C)C)(C#N)C1=CC=CC=C1 SXPHCFGKBLDVQV-UHFFFAOYSA-N 0.000 description 1
- IBYVQXOKJCGIFC-UHFFFAOYSA-N 7-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenylheptanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC(C#N)C1=CC=CC=C1 IBYVQXOKJCGIFC-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- YUNXFXILLCOSLZ-UHFFFAOYSA-N 8-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyl-2-propan-2-yloctanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCC(C(C)C)(C#N)C1=CC=CC=C1 YUNXFXILLCOSLZ-UHFFFAOYSA-N 0.000 description 1
- AENIVCIGAROCIS-UHFFFAOYSA-N 8-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-2-phenyloctanenitrile;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCCC(C#N)C1=CC=CC=C1 AENIVCIGAROCIS-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000015427 Angiotensins Human genes 0.000 description 1
- 108010064733 Angiotensins Proteins 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000018152 Cerebral disease Diseases 0.000 description 1
- 206010008190 Cerebrovascular accident Diseases 0.000 description 1
- 244000059224 Gaultheria adenothrix Species 0.000 description 1
- 235000001721 Gaultheria adenothrix Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010061216 Infarction Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- WQLWFOQXDARELO-UHFFFAOYSA-N ON(CCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C12)C(C1=CC=NC=C1)=O.Cl Chemical compound ON(CCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C12)C(C1=CC=NC=C1)=O.Cl WQLWFOQXDARELO-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- WDROXYYTWLVJMQ-UHFFFAOYSA-N [1-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]cyclohexyl]methanol Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1(CO)CCCCC1 WDROXYYTWLVJMQ-UHFFFAOYSA-N 0.000 description 1
- KBVXIGYQIZLPPH-UHFFFAOYSA-N [1-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]cyclohexyl]methyl acetate Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1(COC(=O)C)CCCCC1 KBVXIGYQIZLPPH-UHFFFAOYSA-N 0.000 description 1
- URUBRRZYFYWBDQ-UHFFFAOYSA-N [3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride Chemical compound Cl.COCC(=O)OC1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 URUBRRZYFYWBDQ-UHFFFAOYSA-N 0.000 description 1
- QIMAGGPYIAJBFA-UHFFFAOYSA-N [3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl] acetate;hydrochloride Chemical compound Cl.CC(=O)OC1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 QIMAGGPYIAJBFA-UHFFFAOYSA-N 0.000 description 1
- FGCHFLVDIWUZRF-UHFFFAOYSA-N [4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-(1,2,3,4-tetrahydronaphthalen-2-yl)methanone Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1C(=O)C1CC2=CC=CC=C2CC1 FGCHFLVDIWUZRF-UHFFFAOYSA-N 0.000 description 1
- DFRVXKRTIRWMOW-UHFFFAOYSA-N [4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-(2-methylphenyl)methanone Chemical compound CC1=CC=CC=C1C(=O)N(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DFRVXKRTIRWMOW-UHFFFAOYSA-N 0.000 description 1
- IHCDUCBGXZRTDZ-UHFFFAOYSA-N [4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-(3,4,5-trimethoxyphenyl)methanone Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 IHCDUCBGXZRTDZ-UHFFFAOYSA-N 0.000 description 1
- CAMNKPJTIOLUMX-UHFFFAOYSA-N [4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-naphthalen-1-ylmethanone Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1C(=O)C1=CC=CC2=CC=CC=C12 CAMNKPJTIOLUMX-UHFFFAOYSA-N 0.000 description 1
- AFFYZBUUKMPVAB-UHFFFAOYSA-N [4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]-naphthalen-2-ylmethanone Chemical compound C12=CC=CC=C2C=CC2=CC=CC=C2C1=C(CC1)CCN1C(=O)C1=CC=C(C=CC=C2)C2=C1 AFFYZBUUKMPVAB-UHFFFAOYSA-N 0.000 description 1
- ASWMKJDYQXHMEZ-UHFFFAOYSA-N [4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl] 2-methoxyacetate;hydrochloride Chemical compound Cl.C1=CC(OC(=O)COC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ASWMKJDYQXHMEZ-UHFFFAOYSA-N 0.000 description 1
- GOWAGOPWIRQRMT-UHFFFAOYSA-N [4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl] acetate;hydrochloride Chemical compound Cl.C1=CC(OC(=O)C)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 GOWAGOPWIRQRMT-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- JFYXSRAQMVJVEK-UHFFFAOYSA-N butan-1-ol;hydrochloride Chemical compound Cl.CCCCO.CCCCO JFYXSRAQMVJVEK-UHFFFAOYSA-N 0.000 description 1
- PIJXRNNCIJAUOX-UHFFFAOYSA-N butanoic acid;hydrochloride Chemical compound Cl.CCCC(O)=O PIJXRNNCIJAUOX-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 1
- LUDHATNCHWUZKK-UHFFFAOYSA-N cyclohexyl 3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propanoate;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(=O)OC1CCCCC1 LUDHATNCHWUZKK-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- DTKJMIHVMPZGQR-UHFFFAOYSA-N ethyl 2-(cyclohexylmethyl)-4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butanoate Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCC(C(=O)OCC)CC1CCCCC1 DTKJMIHVMPZGQR-UHFFFAOYSA-N 0.000 description 1
- ISZCVFOLYYVRRF-UHFFFAOYSA-N ethyl 2-cyclohexyl-5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]pentanoate;hydrochloride Chemical compound Cl.C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC(C(=O)OCC)C1CCCCC1 ISZCVFOLYYVRRF-UHFFFAOYSA-N 0.000 description 1
- FJBFGLAVQTTXFP-UHFFFAOYSA-N ethyl 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzoate;hydrochloride Chemical compound Cl.C1=CC(C(=O)OCC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 FJBFGLAVQTTXFP-UHFFFAOYSA-N 0.000 description 1
- GBIPWMOMIAZUPX-UHFFFAOYSA-N ethyl n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]carbamate;hydrochloride Chemical compound Cl.C1=CC(NC(=O)OCC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 GBIPWMOMIAZUPX-UHFFFAOYSA-N 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- JXYZHMPRERWTPM-UHFFFAOYSA-N hydron;morpholine;chloride Chemical compound Cl.C1COCCN1 JXYZHMPRERWTPM-UHFFFAOYSA-N 0.000 description 1
- QSJAHJYXDRUZMY-UHFFFAOYSA-N hydron;thiomorpholine;chloride Chemical compound Cl.C1CSCCN1 QSJAHJYXDRUZMY-UHFFFAOYSA-N 0.000 description 1
- 230000007574 infarction Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- BWTYTBOOIGCFML-UHFFFAOYSA-N methyl 1-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]cyclohexane-1-carboxylate Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCC1(C(=O)OC)CCCCC1 BWTYTBOOIGCFML-UHFFFAOYSA-N 0.000 description 1
- PVZUGFGTDCWRKG-UHFFFAOYSA-N methyl 1-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]cyclohexane-1-carboxylate Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCC1(C(=O)OC)CCCCC1 PVZUGFGTDCWRKG-UHFFFAOYSA-N 0.000 description 1
- PQUCOLZMVKZBAO-UHFFFAOYSA-N methyl 1-[5-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]pentyl]cyclohexane-1-carboxylate Chemical compound C1CC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)CCN1CCCCCC1(C(=O)OC)CCCCC1 PQUCOLZMVKZBAO-UHFFFAOYSA-N 0.000 description 1
- YSPQHSFVIFAKGM-UHFFFAOYSA-N methyl 2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 YSPQHSFVIFAKGM-UHFFFAOYSA-N 0.000 description 1
- SHXNWZRIHSNUFR-UHFFFAOYSA-N methyl 3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=CC(C=CCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 SHXNWZRIHSNUFR-UHFFFAOYSA-N 0.000 description 1
- SSJCWQZYBXKTSJ-UHFFFAOYSA-N methyl 4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]benzoate;hydrochloride Chemical compound Cl.C1=CC(C(=O)OC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SSJCWQZYBXKTSJ-UHFFFAOYSA-N 0.000 description 1
- ZNPNKEYTKWZCGB-UHFFFAOYSA-N methyl n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]carbamate;hydrochloride Chemical compound Cl.C1=CC(NC(=O)OC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ZNPNKEYTKWZCGB-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- MLTVOILRKVFNOF-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-1-formyl-2h-pyridine-4-carboxamide;hydrochloride Chemical compound Cl.C1=CN(C=O)CC=C1C(=O)NCCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 MLTVOILRKVFNOF-UHFFFAOYSA-N 0.000 description 1
- IXQJPRLBJLAWGF-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-2,4-dimethoxybenzamide;hydrochloride Chemical compound Cl.COC1=CC(OC)=CC=C1C(=O)NCCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 IXQJPRLBJLAWGF-UHFFFAOYSA-N 0.000 description 1
- CUTNZELWEWYCNX-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-2-nitrobenzamide;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1C(=O)NCCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 CUTNZELWEWYCNX-UHFFFAOYSA-N 0.000 description 1
- QGGYGFUTWFZZON-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-3-nitrobenzamide;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC(C(=O)NCCN2C(CCCC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 QGGYGFUTWFZZON-UHFFFAOYSA-N 0.000 description 1
- UEHMRWUTVDMSOP-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-4-nitrobenzamide;hydrochloride Chemical compound Cl.C1=CC([N+](=O)[O-])=CC=C1C(=O)NCCN(CCCC1)C1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 UEHMRWUTVDMSOP-UHFFFAOYSA-N 0.000 description 1
- PSQSLLGPGKUBBQ-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]cyclohexanecarboxamide;hydrochloride Chemical compound Cl.C1CCCC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)N1CCNC(=O)C1CCCCC1 PSQSLLGPGKUBBQ-UHFFFAOYSA-N 0.000 description 1
- ODLCQJAYXNDBDF-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]pyridine-3-carboxamide;hydrochloride Chemical compound Cl.C1CCCC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)N1CCNC(=O)C1=CC=CN=C1 ODLCQJAYXNDBDF-UHFFFAOYSA-N 0.000 description 1
- MOSHTZGZUKYGPP-UHFFFAOYSA-N n-[2-[2-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]pyridine-4-carboxamide;hydrochloride Chemical compound Cl.C1CCCC(=C2C3=CC=CC=C3C=CC3=CC=CC=C32)N1CCNC(=O)C1=CC=NC=C1 MOSHTZGZUKYGPP-UHFFFAOYSA-N 0.000 description 1
- UKGWVWFQWRSVNC-UHFFFAOYSA-N n-[2-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrochloride Chemical compound Cl.C=1C=CC=C(SCCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)C=1NC(=O)C=CC1=CC=CC=C1 UKGWVWFQWRSVNC-UHFFFAOYSA-N 0.000 description 1
- QOLXTUDFRUQXME-UHFFFAOYSA-N n-[2-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]ethyl]-2-nitrobenzenesulfonamide;hydrochloride Chemical compound Cl.[O-][N+](=O)C1=CC=CC=C1S(=O)(=O)NCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 QOLXTUDFRUQXME-UHFFFAOYSA-N 0.000 description 1
- GKKZYGIHPLQQKG-UHFFFAOYSA-N n-[3-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]phenyl]acetamide;hydrochloride Chemical compound Cl.CC(=O)NC1=CC=CC(CCCN2CCC(CC2)=C2C3=CC=CC=C3C=CC3=CC=CC=C32)=C1 GKKZYGIHPLQQKG-UHFFFAOYSA-N 0.000 description 1
- NQJQVPRLULPIDV-UHFFFAOYSA-N n-[4-[3-[4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2CCC2=CC=CC=C21 NQJQVPRLULPIDV-UHFFFAOYSA-N 0.000 description 1
- DYMMUWXYIFDFEY-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]-2,2,2-trifluoroacetamide;hydrochloride Chemical compound Cl.C1=CC(NC(=O)C(F)(F)F)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 DYMMUWXYIFDFEY-UHFFFAOYSA-N 0.000 description 1
- FCIZDKIEMFTAIE-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide;dihydrochloride Chemical compound Cl.Cl.C1=CC(NC(=O)C)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 FCIZDKIEMFTAIE-UHFFFAOYSA-N 0.000 description 1
- SWWXGUVGEFIKPZ-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]butanamide;hydrochloride Chemical compound Cl.C1=CC(NC(=O)CCC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 SWWXGUVGEFIKPZ-UHFFFAOYSA-N 0.000 description 1
- BNMZKXLQJWVNSW-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]methanesulfonamide;hydrochloride Chemical compound Cl.C1=CC(NS(=O)(=O)C)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 BNMZKXLQJWVNSW-UHFFFAOYSA-N 0.000 description 1
- PRGNJCQOVLZVCG-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]prop-1-enyl]phenyl]propanamide;hydrochloride Chemical compound Cl.C1=CC(NC(=O)CC)=CC=C1C=CCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PRGNJCQOVLZVCG-UHFFFAOYSA-N 0.000 description 1
- ZYTJATAJWZZOSO-UHFFFAOYSA-N n-[4-[3-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]propyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1CCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 ZYTJATAJWZZOSO-UHFFFAOYSA-N 0.000 description 1
- PFONNDRGLDKEGZ-UHFFFAOYSA-N n-[4-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]cyclohexyl]acetamide Chemical compound C1CC(NC(=O)C)CCC1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 PFONNDRGLDKEGZ-UHFFFAOYSA-N 0.000 description 1
- JKIPTVLZNQLSQU-UHFFFAOYSA-N n-[5-[4-[4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidin-1-yl]butyl]-2-methoxyphenyl]acetamide Chemical compound C1=C(NC(C)=O)C(OC)=CC=C1CCCCN(CC1)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JKIPTVLZNQLSQU-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/32—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring
- C07C255/42—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being further bound to other hetero atoms
- C07C255/43—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms having cyano groups bound to acyclic carbon atoms of a carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being further bound to other hetero atoms the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/30—Ortho- or ortho- and peri-condensed systems containing three rings containing seven-membered rings
- C07C2603/32—Dibenzocycloheptenes; Hydrogenated dibenzocycloheptenes
Definitions
- the present invention relates to a piperidine derivative and hypotensives containing the same.
- one object of the present invention is to provide an effective hypotensive agent which is relatively simple to prepare at low cost.
- A is a fused aromatic ring;
- R is hydrogen, chloro or methoxy;
- X is (CH 2 ) n , which may be substituted, in which n is 0 or an integer of 1 to 10, —CH ⁇ CH—, —C ⁇ C—, —O—, —S—, —NH—, —N(COCH 3 )—, —N(COOC 2 H 5 )—, —N(CHO)—, —N(CH 3 )—, —CO—, —SO—, or —SO 2 —;
- Y is —CH ⁇ CH—, —CH 2 CH 2 —, —CH 2 CO—, —O—, —S—, —NH—, —OCH 2 —, —SCH 2 —, —NHCH 2 —, —CH(OH)CH 2 —or —CH (OH) CH (OH) —; and Q is substituted or unsubstituted n-hexy
- piperidine derivatives of the formula (I) above are effective as hypotensive agents.
- the present piperidine derivative exhibits excellent hypotensive action, its method of synthesis is simple and its derivatives can be easily prepared.
- the fused aromatic ring (A) is a fused benzene, thiophene, pyridine or the like ring.
- substituents X and Q may be substituted by at least one substituent selected from the group consisting of H(CH2)n, wherein n is 1 to 10, C 1 (CH 2 ) 3 , allyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxy, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, e
- the method of administration of the present piperidine derivative when used as a hypotensive include oral and parenteral routes. Dose is determined depending upon age, body weight and condition of the patient and route of administration. Daily dose is generally 0.01 to 2000 mg/kg for oral administration. In the case of parenteral administration, the daily dose is 0.01 to 1000 mg/kg.
- the present piperidine derivative may be prepared in the form of ordinary preparations such as for example, tablets, powders, capsules, solutions, sugar—coated tablets or depots, which may be prepared in a conventional manner using conventional preparation aids.
- tablets can be obtained by mixing the piperidine derivative of the present invention diluents (e.g., lactose, calcium carbonate or calcium phosphate), binders (e.g., gum arabic, corn starch or gelatin), swelling agents (e.g., alginic acid, corn starch or pregelinated starch), sweeteners (e.g., sucrose or saccharin), flavors (e.g., peppermint, Gaultheria adenothrix oil or cherry), lubricating and wetting agents (e.g., magnesium stearate, talc or carboxymethyl cellulose).
- diluents e.g., lactose, calcium carbonate or calcium phosphate
- binders e.g., gum arabic, corn starch or gelatin
- swelling agents e.g., alginic acid, corn starch or pregelinated starch
- sweeteners e.g., sucrose or saccharin
- flavors e
- test animals As test animals, four male spontaneously hypertensive rats (weight 400 to 440 g) that were sufficiently adapted for feeding and in which hypertension was confirmed were used.
- Physiological saline aqueous solution containing 2.5% Nicolle and 2.5% ethanol of sample was intravenously administered by bolus injection at a dose of 1 ml per 1 kg of body weight.
- Systolic blood pressure after administration was measured by the indirect (tail-cuff) method.
- the piperidine derivatives of the present invention possess hypotensive activity and are usable as hypotensives and therefore, they can be expected to provide an excellent hypotensive effect. Accordingly, the present invention is extremely useful, particularly in the pharmaceutical industry.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Abstract
wherein A is a fused aromatic ring; R is hydrogen, chloro or methoxy; X is (CH2)n, which may be substituted, in which n is 0 or an integer of 1 to 10, —CH≡CH—, —C≡C—, —O—, —S—, —NH—, —N(COCH3)—, —N(COOC2H5)—, —N(CHO)—, —N(CH3)—, —CO—, —SO—, or —SO2—; Y is —CH≡CH—, —CH2CH2—, —CH2CO—, —O—, —S—, —NH—, —OCH2—, —SCH2—, —NHCH2—, —CH(OH)CH2— or —CH(OH)CH(OH)—; and Q is substituted or unsubstituted n-hexyl, carboxypropyl, ethoxycarbonylpropyl, cyanopropyl, cyclohexyl, phenyl, indanyl, naphthyl, tetrahydronaphthyl, benzocycloheptyl, piperidinyl, tetrahydroisoquinolinyl, indolyl, pyrolyl, furyl, thienyl, thiazolyl, oxazolyl or N-methylpyrolyl, wherein any one or more of the —(CH2)-groups of the hexyl, carboxypropyl, ethoxycarbonylpropyl and cyanopropyl groups may be replaced by —CH≡CH—, —C≡C—, —O—, —S—, —NH—, —N(COCH3), —N(COC2H5)—, —N(CHO)—, —N(CH3), —CO—, —SO— or —SO2—, and wherein one or more of the —(CH2)-groups in X and Q may be substituted by —(CH2)4— or —(CH2)5— thereby forming a ring structure.
Description
This application is a reissue application of application Ser. No. 08/269,628, filed Jul. 1, 1994, now U.S. Pat. No. 5,393,890 which in turn is a continuation of application Ser. No. 08/072,458, filed Jun. 7, 1993, now abandoned, which is a continuation of application Ser. No. 07/655,775, filed Feb. 15, 1991, now U.S. Pat. No. 5,250,681, which is a continuation of application Ser. No. 07/443,438, filed Nov. 30, 1989, now abandoned, which is a continuation of application Ser. No. 07/354,880, filed May 22, 1989, now U.S. Pat. No. 5,231,105, which is a continuation of application Ser. No. 07/201,911, filed Jun. 2, 1988, now abandoned.
The present invention relates to a piperidine derivative and hypotensives containing the same.
It is said that there are about 13,000,000 patients with hypertension in Japan and its frequency of occurrence in individuals becomes greater with advancing age. Further, as the age of a given population increases, increased attention is directed to hypertension which becomes more and more of a dangerous factor in severe heart and cerebral diseases represented by cardiac infarction and cerebral apoplexy. In recent years, calcium antagonists or angiotensin convertase inhibitors have been widely used as excellent primary selection drugs for treatment of hypertension. But the pharmaceutical effects or safety of these hypotensives have recently come into question.
A need therefore continues to exist for new hypotensive agents which exhibit excellent pharmaceutical effects and safety which can be industrially prepared at low cost and in a simple manner.
Accordingly, one object of the present invention is to provide an effective hypotensive agent which is relatively simple to prepare at low cost.
Briefly, this object and other objects of the present invention as hereinafter will become more readily apparent can be attained by a piperidine derivative of formula (I):
wherein A is a fused aromatic ring; R is hydrogen, chloro or methoxy; X is (CH2)n, which may be substituted, in which n is 0 or an integer of 1 to 10, —CH≡CH—, —C≡C—, —O—, —S—, —NH—, —N(COCH3)—, —N(COOC2H5)—, —N(CHO)—, —N(CH3)—, —CO—, —SO—, or —SO2—; Y is —CH≡CH—, —CH2CH2—, —CH2CO—, —O—, —S—, —NH—, —OCH2—, —SCH2—, —NHCH2—, —CH(OH)CH2—or —CH (OH) CH (OH) —; and Q is substituted or unsubstituted n-hexyl, carboxypropyl, ethoxycarbonylpropyl, cyanopropyl, cyclohexyl, phenyl, indanyl, naphthyl, tetrahydronaphthyl, benzocycloheptyl, piperidinyl, tetrahydroisoquinolinyl, indolyl, pyrolyl, furyl, thienyl, thiazolyl, oxazolyl or N-methylpyrolyl, wherein any one or more of the —(CH2)-groups of the hexyl, carboxypropyl, ethoxycarbonylpropyl and cyanopropyl groups may be replaced by —CH≡CH—, —C≡C—, —O—, —S—, —NH—, —N (COCH3), —N(COC2H5)—, —N(CHO)—, —N(CH3)—, —CO—, —SO— or —SO2—, and wherein one or more of the —(CH2)-groups in X and Q may be substituted by —(CH2)4— or —(CH2)5— thereby forming a ring structure.
It has now been discovered that piperidine derivatives of the formula (I) above are effective as hypotensive agents. The present piperidine derivative exhibits excellent hypotensive action, its method of synthesis is simple and its derivatives can be easily prepared.
In formula (I), the fused aromatic ring (A) is a fused benzene, thiophene, pyridine or the like ring. Further, in formula (I) above, substituents X and Q may be substituted by at least one substituent selected from the group consisting of H(CH2)n, wherein n is 1 to 10, C1(CH2)3, allyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxy, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl.
The method of administration of the present piperidine derivative when used as a hypotensive, include oral and parenteral routes. Dose is determined depending upon age, body weight and condition of the patient and route of administration. Daily dose is generally 0.01 to 2000 mg/kg for oral administration. In the case of parenteral administration, the daily dose is 0.01 to 1000 mg/kg. The present piperidine derivative may be prepared in the form of ordinary preparations such as for example, tablets, powders, capsules, solutions, sugar—coated tablets or depots, which may be prepared in a conventional manner using conventional preparation aids. For example, tablets can be obtained by mixing the piperidine derivative of the present invention diluents (e.g., lactose, calcium carbonate or calcium phosphate), binders (e.g., gum arabic, corn starch or gelatin), swelling agents (e.g., alginic acid, corn starch or pregelinated starch), sweeteners (e.g., sucrose or saccharin), flavors (e.g., peppermint, Gaultheria adenothrix oil or cherry), lubricating and wetting agents (e.g., magnesium stearate, talc or carboxymethyl cellulose).
Having now generally described this invention, a further understanding can be obtained by reference to certain specific examples which are provided herein for purposes of illustration only and are not intended to be limited unless otherwise specified.
Unless otherwise indicated, the developing conditions for silica gel TLC procedures were under chloroform/methanol−9/1. Mass spectra (MS) were performed in the FD mode (m/z) and nuclear magnetic resonance spectra (NMR) were measured using tetramethylsilane as the internal standard and CDCl3 as the solvent.
A solution of 273 mg (1 mmol) of 4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-hexylpiperidine, 165 mg (1 mmol) of 1-bromohexane, 745 mg (5 mmols) of sodium iodide and 414 mg (3 mmols) of potassium carbonate in 20 ml of methyl isobutyl ketone was stirred and refluxed at 120° C. overnight on an oil bath. After the reaction, the mixture was washed by adding 20 ml of water thereto. Then the organic phase was separated and the solvent was distilled off under reduced pressure. After purifying by silica gel column chromatography (eluent: methanol/chloroform, 1/100-1/50), the product was converted into the hydrochloride with an equimolar hydrogen chloride/dioxane solution.
Amount yielded 180 mg
Yield 46%
TLC Rf=0.68
MS 357 (M+)
NMR 0.83 (3H, t), 1.2-1.4 (6H, m), 1.7-1.9 (2H, m), 2.31 (2H, dd), 2.53 (2H, d), 2.7-2.8 (2H, m), 3.14 (2H, dd), 3.38 (2H, dd), 3.38 (2H, d), 6.92 (2H, s), 7.2-7.4 (8H, m)
Hereafter procedures were carried out in manner similar to Example 1.
Amount yielded 300 mg
Yield 72%
TLC Rf=0.71
MS 385 (M+)
NMR 0.85 (3H, t), 1.2-1.4 (10H, m), 1.7-2.0 (2H, m), 2.30 (2H, dd), 2.53 (2H, d), 2.7-2.9 (2H, m), 3.13 (2H, dd), 3.38 (2H, d), 6.90 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 300 mg
Yield 67%
TLC Rf=0.75
MS 413 (M+)
NMR 0.85 (3H, t), 1.2-1.4 (14H, m), 1.7-1.9 (2H, m), 2.33 (2H, dd), 2.54 (2H, d), 2.7-2.8 (2H, m), 3.15 (2H, dd), 3.39 (2H, d), 6.92 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 1.10 g
Yield 92%
TLC Rf=0.78
MS 441 (M+)
NMR 0.85 (3H, t), 1.1-1.5 (18H, m), 1.7-1.9 (2H, m), 2.32 (2H, dd), 2.54 (2H, d), 2.7-2.8 (2H, m), 3.12 (2H, dd), 3.36 (2H, d), 6.93 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 1.20 g
Yield 95%
TLC Rf=0.78
MS 469 (M+)
NMR 0.82 (3H, t), 1.1-1.5 (22H, m), 1.7-1.9 (2H, m), 2.33 (2H, dd), 2.55 (2H, d), 2.7-2.8 (2H, m), 3.15 (2H, dd), 3.40 (2H, d), 6.92 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 1.18 g
Yield 88%
TLC Rf=0.80
MS 497 (M+)
NMR 0.80 (3H, t), 1.1-1.6 (26H, m), 1.7-1.9 (2H, m), 2.33 (2H, dd), 2.58 (2H, d), 2.7-2.8 (2H, m), 3.20 (2H, dd), 3.40 (.2H, d), 6.88 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 520 mg
Yield 51%
TLC Rf=0.75
MS 369 (M+)
NMR 0.8-2.1 (11H, m), 2.42 (2H, dd), 2.65 (2H, d), 2.78 (2H, d), 3.20 (2H, dd), 3.42 (2H, d), 6.91 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 780 mg
Yield 74%
TLC Rf=0.75
MS 383 (M+)
NMR 0.8-2.1 (13H, m), 2.45 (2H, dd), 2.67 (2H, d), 2.7-2.9 (2H, m), 3.0 (2H, dd), 3.48 (2H, d), 6.94 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 1.02 g
Yield 94%
TLC Rf=0.77
MS 397 (M+)
NMR 0.8-2.1 (15H, m), 2.47 (2H, dd), 2.68 (2H, d), 2.7-2.9 (2H, m), 3.0 (2H, dd), 3.49 (2H, d), 6.94 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 815 mg
Yield 72%
TLC Rf=0.78
MS 411 (M+)
NMR 0.8-2.1 (17H, m), 2.28 (2H, dd), 2.52 (2H, 2.7-2.9 (2H, m), 3.08 (2H, dd), 3.35 (2H, d), 6.92 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 750 mg
Yield 65%
TLC Rf=0.80
MS 411 (M+)
NMR 0.8-2.1 (19H, m), 2.25 (2H, dd), 2.68 (2H, d), 2.7-2.9 (2H, m), 3.12 (2H, dd), 3.38 (2H, d), 6.92 (2H, s), 7.1-7.4 (8H, m)
Amount yielded 320 mg
Yield 80%
TLC Rf=0.42
MS 363 (M+)
NMR 2.28 (2H, dd), 2.52 (2H, d), 3.14 (2H, dd), 3.31 (2H, d), 4.01 (2H, d), 6.90 (2H, s), 7.1-7.6 (13H, m)
Amount yielded 310 mg
Yield 75%
TLC Rf=0.45
MS 377 (M+)
NMR 2.28 (2H, dd), 2.51 (2H, d), 3.0-3.3 (6H, m), 3.47 (2H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 330 mg
Yield 77%
TLC Rf=0.50
MS 391 (M+)
NMR 2.1-2.4 (4H, m), 2.51 (2H, d), 2.65 (2H, t), 2.7-2.9 (2H, m), 3.12 (2H, dd), 3.38 (2H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 180 mg
Yield 41%
TLC Rf=0.50
MS 405 (M+)
NMR 1.4-1.9 (4H, m), 2.28 (2H, dd), 2.52 (2H, d), 2.61 (2H, t), 2.7-2.8 (2H, m), 3.12 (2H, .dd), 3.35 (2H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 110 mg
Yield 24%,
TLC Rf=0.55
MS 419 (M+)
NMR 1.2-1.9 (6H, m), 2.25 (2H, dd), 2.52 (2H, d), 2.60 (2H, t), 2.7-2.8 (2H, m), 3.08 (2H, dd), 3.35 (2H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 315 mg
Yield 67%
TLC Rf=0.56
MS 433 (M+)
NMR 1.1-1.9 (8H, m), 2.26 (2H, dd), 2.56 (2H, d), 2.61 (2H, t), 2.7-2.8 (2H, m), 3.10 (2H, dd), 3.35 (2H, d), 6.91 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 267 mg
Yield 55%
TLC Rf=0.56
MS 447 (M+)
NMR 1.1-1 (10H, m), 2.25 (2H, dd), 2.55 (2H, d), 2.65 (2H, t), 2.7-2.8 (2H, m), 3.07 (2H, dd), 3.32 (2H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
Amount yielded 1.95 g
Yield 55%
TLC Rf=0.56
MS 393 (M+)
NMR (fee base) 2.1-2.5 (2H, m), 2.58 (2H, t), 2.6-2.7 (2H, m), 4.05 (2H, t), 6.89 (2H, d), 6.92 (2H, s), 7.1-7.4 (11H, m)
Amount yielded 2.15 g
Yield 48%
TLC Rf=0.58
MS 407 (M+)
NMR (free base) 1.97 (2H, tt), 2.1-2.5 (6H, m), 2.54 (2H, t), 2.6-2.7 (2H, m), 3.97 (2H, dd), 6.86 (2H, d), 6.90 (2H, s), 7.1-7.4 (11H, m)
Amount yielded 1.18 g
Yield 86%
TLC Rf=0.61
MS 421 (M+)
NMR (free base) 1.8-2.7 (14H, m), 3.96 (2H, t), 6.87 (2H, d), 6.90 (2H, s), 7.1-7.4 (11H, m)
Amount yielded 0.97 g
Yield 87%
TLC Rf=0.55
MS 409 (M+)
NMR (free base) 2.0-2.6 (10H, m), 2.78 (2H, t), 6.86 (2H, s), 7.1-7.4 (11H, m)
Amount yielded 0.85 g
Yield 74%
TLC Rf=0.62
MS 423 (M+)
NMR (free base) 1.73 (2H, tt), 2.0-2.6 (10H, m), 2.80 (2H, t), 6.88 (2H, d), 7.1-7.4 (11H, m)
Amount yielded 0.85 g
Yield 72%
TLC Rf=0.62
MS 437 (M+)
NMR (free base) 1.6-2.6 (14H, m), 2.80 (2H, t), 6.88 (2H, d), 7.1-7.4 (11H, m)
TLC Rf=0.72
MS 502 (M+)
TLC Rf=0.51
MS 472 (M+)
TLC Rf=0.68
MS 544 (M+)
TLC Rf=0.85
MS 462 (M+)
TLC Rf=0.91
MS 498 (M+)
TLC Rf=0.78
MS 450 (M+)
TLC Rf=0.92
MS 532 (M+)
NMR 0.77 (3H, d), 1.18 (3H, d), 1.6-3.3 (15H, m), 3.86 (3H, s), 3.92 (3H, s), 6.8-7.4 (11H, m)
TLC Rf=0.78
MS 457 (M+)
TLC Rf=0.62
MS 473 (M+)
TLC Rf=0.84
MS 439 (M+)
TLC Rf=0.84
MS 420 (M+)
TLC Rf=0.55
MS 435 (M+)
1-(3-(2-Cinnamoylaminophenylthio)-1-propyl)-4-(5H-dibenzo[a,d]-cyclohepten-5-ylidene)piperidine hydrochloride
TLC Rf=0.66
MS 568 (M+)
NMR (free base) 1.74 (2H, tt), 2.0-2.6 (8H, m), 2.80 (2H, t), 6.59 (1H, d), 6.88 (2H, s), 7.0-7.6 (16H, m), 7.75 (1H, d), 8.5 (1H, d), 8.68 (1H, bs)
TLC Rf=0.84
MS 389 (M+)
NMR (free base) 2.1-2.7 (8H, m), 3.15 (2H, d), 6.25 (1H, td), 6.47 (1H, d), 6.90 (2H, s), 7.1-7.4 (13H, m)
TLC Rf=0.80
MS 563 (M+)
TLC Rf=0.48
MS 573 (M+)
TLC Rf=0.48
MS 573 (M+)
TLC Rf=0.94
MS 540 (M+)
TLC Rf=0.88
MS 548 (M+)
TLC Rf=0.74
MS 506 (M+)
TLC Rf=0.61
MS 479 (M+)
TLC Rf=0.86
MS 430 (M+)
TLC Rf=0.88
MS 472 (M+)
TLC Rf=0.81
MS 546 (M+)
TLC Rf=0.84
MS 444 (M+)
TLC Rf=0.84
MS 486 (M+)
TLC Rf=0.86
MS 560 (M+)
TLC Rf=0.92
MS 506 (M+)
TLC Rf=0.81
MS 538 (M+)
TLC Rf=0.91
MS 598 (M+)
TLC Rf=0.85
MS 580 (M+)
TLC Rf=0.90
MS 522 (M+)
TLC Rf=0.85
MS 480 (M+)
TLC Rf=0.87
MS 522 (M+)
TLC Rf=0.72
MS 498 (M+)
TLC Rf=0.75
MS 540 (M+)
TLC Rf=0.84
MS 472 (M+)
TLC Rf=0.88
MS 514 (M+)
TLC Rf=0.82
MS 574 (M+)
TLC Rf=0.90
MS 456 (M+)
TLC Rf=0.85
MS 516 (M+)
TLC Rf=0.61
MS 433 (M+)
TLC Rf=0.71
MS 475 (M+)
TLC Rf=0.55
MS 461 (M+)
TLC Rf=0.51
MS 550 (M+)
TLC Rf=0.88
MS 562 (M+)
TLC Rf=0.52
MS 564 (M+)
TLC Rf=0.91
MS 576 (M+)
TLC Rf=0.52
MS 578 (M+)
TLC Rf=0.90
MS 590 (M+)
TLC Rf=0.61
MS 592 (M+)
TLC Rf=0.91
MS 544 (M+)
TLC Rf=0.85
MS 504 (M+)
TLC Rf=0.92
MS 458 (M+)
TLC Rf=0.90
MS 518 (M+)
TLC Rf=0.93
MS 472 (M+)
TLC Rf=0.91
MS 532 (M+)
TLC Rf=0.95
MS 486 (M+)
TLC Rf=0.90
MS 546 (M+)
TLC Rf=0.95
MS 500 (M+)
TLC Rf=0.92
MS 560 (M+)
TLC Rf=0.95
MS 514 (M+)
TLC Rf=0.92
MS 574 (M+)
TLC Rf=0.95
MS 528 (M+)
TLC Rf=0.91
MS 588 (M+)
TLC Rf=0.94
MS 542 (M+)
TLC Rf=0.94
MS 602 (M+)
TLC Rf=0.95
MS 556 (M+)
TLC Rf=0.93
MS 616 (M+)
TLC Rf=0.95
MS 570 (M+)
TLC Rf=0.94
MS 630 (M+)
TLC Rf=0.71
MS 391 (M+)
TLC Rf=0.36
MS 393 (M+)
TLC Rf=0.74
MS 405 (M+)
TLC Rf=0.35
MS 407 (M+)
TLC Rf=0.75
MS 419 (M+)
TLC Rf=0.39
MS 421 (M+)
TLC Rf=0.76
MS 433 (M+)
TLC Rf=0.78
MS 447 (M+)
TLC Rf=0.80
MS 409 (M+)
TLC Rf=0.44
MS 411 (M+)
TLC Rf=0.80
MS 423 (M+)
TLC Rf=0.44
MS 425 (M+)
TLC Rf=0.45
MS 439 (M+)
TLC Rf=0.84
MS 451 (M+)
TLC Rf=0.51
MS 453 (M+)
TLC Rf=0.75
MS 381 (M+)
TLC Rf=0.79
MS 381 (M+)
TLC Rf=0.61
MS 381 (M+)
TLC Rf=0.83
MS 431 (M+)
TLC Rf=0.82
MS 431 (M+)
TLC Rf=0.79
MS 431 (M+)
TLC Rf=0.61
MS 393 (M+)
TLC Rf=0.61
MS 393 (M+)
TLC Rf=0.52
MS 393 (M+)
TLC Rf=0.80
MS 453 (M+)
TLC Rf=0.86
MS 440 (M+)
TLC Rf=0.82
MS 488 (M+)
TLC Rf=0.75
MS 500 (M+)
TLC Rf=0.68
MS 481 (M+)
TLC Rf=0.82
MS 437 (M+)
TLC Rf=0.66
MS 562 (M+)
| MD | TLC | |||
| exp | compound | (M+) | (Rf) | solvent |
| 127 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl-1-(4-fluorophenyl)ethane hydrochloride | 395 | 0.55 | B |
| 128 | 1-(2-Chlorobenzyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 397 | 0.68 | B |
| 129 | 1-(3-Chlorobenzyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 397 | 0.58 | B |
| 130 | 1-(4-Chlorobenzyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 397 | 0.58 | B |
| 131 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-methylbenyl)piperidine hydrochloride | 377 | 0.74 | B |
| 132 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-methylbenyl)piperidine hydrochloride | 377 | 0.71 | B |
| 133 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-methylbenyl)piperidine hydrochloride | 377 | 0.65 | B |
| 134 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-heptylpiperidine hydrochloride | 371 | 0.70 | B |
| 135 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-nondecylpiperidine hydrochloride | 399 | 0.75 | B |
| 136 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-undecylpiperidine hydrochloride | 427 | 0.75 | B |
| 137 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-tridecylpiperidine hydrochloride | 455 | 0.78 | B |
| 138 | 1-(2-Aminobenzy)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine dihydrochloride | 392 | 0.38 | B |
| 139 | 1-(3-Aminobenzy)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine dihydrochloride | 392 | 0.23 | B |
| 140 | 1-(4-Aminobenzy)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine dihydrochloride | 392 | 0.26 | B |
| 141 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-nitrobenzyl)piperidine hydrochloride | 422 | 0.85 | B |
| 142 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-nitrobenzyl)piperidine hydrochloride | 422 | 0.82 | B |
| 143 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-nitrobenzyl)piperidine hydrochloride | 422 | 0.83 | B |
| 144 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-(3-fluorophenyl)-2-isopropylvaleronitrile | 500 | 0.71 | B |
| hydrochloride | ||||
| 145 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-isopropyl-2-(3-methoxyphenyl)valeronitrile | 512 | 0.64 | B |
| hydrochloride | ||||
| 146 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-isopropyl-2-(3-methylphenyl)valeronitrile | 496 | 0.68 | B |
| hydrochloride | ||||
| 147 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-isopropyl-2-(2- | 549 | 0.78 | B |
| trifluoromethylphenyl)valeronitrile hydrochloride | ||||
| 148 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-isopropyl-2-(4- | 540 | 0.77 | B |
| trifluoromethylphenyl)valeronitrile hydrochloride | ||||
| 149 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-ethyl-2-(3- | 526 | 0.77 | B |
| trifluoromethylphenyl)valeronitrile hydrochloride | ||||
| 150 | 2-Butyl-5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-(3- | 554 | 0.80 | B |
| trifluoromethylphenyl)valeronitrile hydrochloride | ||||
| 151 | 5-(4-(5H-Dibenzo[ac]cyclohepten-5-ylidene)-1-piperidinyl)-2-hexyl-2-(3- | 582 | 0.80 | B |
| trifluoromethylphenyl)valeronitrile hydrochloride | ||||
| 152 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-phenyl-1-butene hydrochloride | 403 | 0.51 | B |
| 153 | 1-Benzyloxy-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethane hydrochloride | 407 | 0.58 | B |
| 154 | 1-Cyclohexyl-6-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)hexane hydrochloride | 439 | 0.62 | B |
| 155 | 1-Cyclohexyl-7-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)heptane hydrochloride | 453 | 0.65 | B |
| 156 | 1-Cyclohexyl-8-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)octane hydrochloride | 467 | 0.68 | B |
| 157 | 1-(4-Cyclohexylbutanoyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine | 425 | 0.75 | B |
| 158 | 1-(2-Cyanobenzyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 388 | 0.83 | B |
| 159 | 1-(3-Cyanobenzyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 388 | 0.85 | B |
| 160 | 1-(4-Cyanobenzyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 388 | 0.70 | B |
| 161 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-Picolyl)piperidine dihydrochloride | 364 | 0.58 | B |
| 162 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-Picolyl)piperidine dihydrochloride | 364 | 0.53 | B |
| 163 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-Picolyl)piperidine dihydrochloride | 364 | 0.44 | B |
| 164 | 1-Decanolyl-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine | 427 | 0.75 | B |
| 165 | 1-Cyano-3-[4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 340 | 0.58 | B |
| 166 | 1-Cyano-4-[4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 354 | 0.52 | B |
| 167 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethoxyacetophenone hydrochloride | 451 | 0.85 | B |
| 168 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethoxypropiophenone hydrochloride | 465 | 0.61 | B |
| 169 | 5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethoxyvalerophenone hydrochloride | 193 | 0.64 | B |
| 170 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′,5′-trimethoxybutyrophenone | 509 | 0.82 | B |
| hydrochloride | ||||
| 171 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2′,3′,4′-trimethoxybutyrophenone | 509 | 0.86 | B |
| hydrochloride | ||||
| 172 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-4′-trimethoxybutyrophenone | 449 | 0.61 | B |
| hydrochloride | ||||
| 173 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2,3-dimethoxybenzyl)piperidine hydrochloride | 423 | 0.63 | B |
| 174 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4-dimethoxybenzyl)piperidine hydrochloride | 423 | 0.73 | B |
| 175 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4-dimethoxybenzyl)piperidine | 437 | 0.58 | B |
| 176 | 1-Cyclohexyl-3,(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propylketone hydrochloride | 425 | 0.51 | B |
| 177 | 2-Cyclohexyl-5,(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)valeronitrile hydrochloride | 436 | 0.60 | B |
| 178 | 1-(4-(3-Chloro-5H-dibenzo[a,d]cyclohepten-5-ylidene-1-piperidinyl)-4-cyclohexylbutane hydrochloride | 445 | 0.62 | B |
| 179 | 1-Cyclohexyl-(4-(3-methoxy-5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane hydrochloride | 441 | 0.59 | B |
| 180 | 4,9-Dihydro-4-(1-(4-cyclohexylbutyl)-4-piperidinylidene-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one | 433 | 0.45 | B |
| hydrochloride | ||||
| 181 | 1-(4-Cyclohexylbutyl-4-(9-xantylidene)piperidine hydrochloride | 401 | 0.64 | B |
| 182 | 1-(4-Cyclohexylbutyl-4-(9-thioxantylidene)piperidine hydrochloride | 417 | 0.65 | B |
| 183 | 6,11-Dihydro-11-(1-(4-cyclohexylbutyl)-4-piperidinylidene-5H-dibenzop[5,6]cycloheptal[1,2-b]pyridine | 414 | 0.41 | B |
| dihydrochloride | ||||
| 184 | 4-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-methoxybenzyl)piperidine hydrochloride | 395 | 0.73 | B |
| 185 | 1-Decyl-4-(10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 415 | 0.52 | B |
| 186 | 1-Cyclohexyl-4-(10,11-Dihydro-5H-dibenzo[a,d]cycloheptan-5-ylidene)-1-piperidinyl)butane | 413 | 0.67 | B |
| hydrochloride | ||||
| 187 | 4-(4-(10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethoxy- | 481 | 0.66 | B |
| butyrophenone hydrochloride | ||||
| 188 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4,5-trimethoxybenzyl)piperidine | 453 | 0.69 | B |
| 189 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4,5-trimethoxybenzoyl)piperidine | 467 | 0.71 | B |
| 190 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-methylbenzoyl)piperidine | 391 | 0.73 | B |
| 191 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-(4-fluorophenyl)acetyl)piperidine | 409 | 0.76 | B |
| 192 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-dimethoxycinnamoyl)piperidine | 463 | 0.73 | B |
| 193 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-dimethoxycinnamyl)piperidine hydrochloride | 449 | 0.46 | B |
| 194 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-diethoxybutyrophenone hydrochloride | 501 | 0.49 | B |
| 195 | 1-(4-(4-Aminophenyl)butyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidine)piperidine dihydrochloride | 420 | 0.34 | B |
| 196 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-(4-nitrophenyl)butyl)piperidine hydrochloride | 450 | 0.50 | B |
| 197 | 1-(4-(4-Acetylaminophenyl)butyl-4-(5H-dibenzo[a,d]cyclohepten-5-ylidine)piperidine dihydrochloride | 462 | 0.48 | B |
| 198 | 4-(4-5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethylbutyrophenone hydrochloride | 447 | 0.53 | B |
| 199 | Ethyl 4-(4-(5H-dibanzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyrate hydrochloride | 387 | 0.51 | B |
| 200 | 4-((4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyric acid | 359 | 0.15 | B |
| 201 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(-3-(3′,4′-dimethoxyphenyl)propyl)piperidine hydrochloride | 451 | 0.60 | B |
| 202 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-(3′,4′-dimethoxyphenyl)propanoyl)piperidine | 465 | 0.78 | B |
| 203 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)piperidine hydrochloride | 426 | 0.60 | B |
| 204 | N-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)-1,2,3,4-tetrahydroisoquinoline | 474 | 0.42 | B |
| hydrochloride | ||||
| 205 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3,4-dimethoxy)phenyl-1-hydroxybutane | 481 | 0.38 | B |
| hydrochloride | ||||
| 206 | 1-Acetoxy-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-(3,4-dimethoxy)phenylButane | 523 | 0.49 | B |
| hydroxybutane hydrochloride | ||||
| 207 | 1-butyl-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3,4-dimethoxy)phenyl-1- | 537 | 0.45 | B |
| hydroxybutane hydroxybutane hydrochloride | ||||
| 208 | 1-(4-Methoxyxyxlohexyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 441 | 0.55 | B |
| hydroxybutane hydrochloride | ||||
| 209 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyl)piperidine | 412 | 0.03 | B |
| dihydroxybutane hydrochloride | ||||
| 210 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-N-imidazolylmethyl)cinnamyl)piperidine | 469 | 0.44 | B |
| dihydroxybutane hydrochloride | ||||
| 211 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-naphthoyl)piperidine | 427 | 0.88 | B |
| 212 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-naphthylmethyl)piperidine hydrochloride | 413 | 0.94 | B |
| 213 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(1-naphthoyl)piperidine | 427 | 0.59 | B |
| 214 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(1-naphthylmethyl)piperidine hydrochloride | 413 | 0.83 | B |
| 215 | 2-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyl)cyclohexanone hydrochloride | 426 | 0.50 | B |
| (H+ | ||||
| 216 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)-4-hydroxypiperidine hydrochloride | 442 | 0.58 | B |
| 217 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)-4-ethoxyxarbonpiperidine | 499 | 0.26 | B |
| hydrochloride | ||||
| 218 | Cyclohexyl 3-(4-(5H-Dibenzo[a,d]cyclohpetan-5-ylidene)-1-piperidinyl)propylether hydrochloride | 413 | 0.48 | B |
| 219 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-butyl)-1-methoxycarbonylcyclohexane | 470 | 0.55 | B |
| hydrochloride | (H+) | |||
| 220 | Ethyl 2-cyclohexyl-5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)valerate hydrochloride | 483 | 0.65 | B |
| 221 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-(3′,4′-dimethoxyphenyl)butyl)piperidine hydrochloride | 465 | 0.66 | B |
| 222 | 2-(3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propyl-2-(3,4-dimethoxyphenyl)- | 523 | 0.54 | B |
| 1,3-dioxolane hydrochloride | ||||
| 223 | 1-Carboxyl-1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butylcyclohexane hydrochloride | 456 | 0.38 | B |
| (H+) | ||||
| 224 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(1,2,3,4-tetrahydro-2-naphthoyl)piperidine | 431 | 0.90 | B |
| 225 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(1,2,3,4-tetrahydro-2-naphthylmethyl)piperidine | 417 | 0.55 | B |
| 226 | N-(3,(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propanoyl)cyclohexylamine hydrochloride | 426 | 0.64 | B |
| 227 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl cyclohexanecarboxylate hydrochloride | 427 | 0.71 | B |
| 228 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-cyclohexylbutane hydrochloride | 431 | 0.74 | B |
| 229 | 4-(4-(5H-Dibenzo[a,d]thiepin-5-ylidene)-1-piperidinyl)-3+,4+-dimethoxybutyrophenone hydrochloride | 499 | 0.46 | B |
| 230 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-nitrocinnamyl)piperidine hydrochloride | 434 | 0.70 | B |
| 231 | 1-(4-Aminocinnamyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 404 | 0.36 | B |
| 232 | 1-(4-Acetylaminocinnamyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)piperidine dihydrochloride | 446 | 0.27 | B |
| 233 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-furyl)-1-butanone hydrochloride | 409 | B | |
| 234 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-thienyl)-1-butanone hydrochloride | 425 | B | |
| 235 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propyl(2-tetrahydropyranyl)ether | 415 | 0.55 | B |
| hydrochloride | ||||
| 236 | Cyclohexyl 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propionate hydrochloride | 427 | 0.71 | B |
| 237 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl-4-nitrobenzamide hydrochloride | 465 | 0.49 | H |
| 238 | 2-Cyclohexyl-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyric acid | 455 | 0.26 | B |
| 239 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propyl phenylsulphoxide hydrochloride | 409 | 0.29 | H |
| 240 | 2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl-5′,6′-dimethoxyindan hydrochloride | 477 | 0.41 | B |
| 241 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propyl phenylsulphone hydrochloride | 441 | 0.36 | B |
| 242 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl-3′,4′-dimethoxybenzamide hydrochloride | 480 | 0.44 | G |
| 243 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl cyclohexanecarboxamide hydrochloride | 426 | 0.75 | B |
| 244 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl isonicotinamide hydrochloride | 421 | 0.20 | B |
| 245 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)morpholine hydrochloride | 428 | 0.31 | C |
| 246 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butanoyl)thiomorpholine hydrochloride | 444 | 0.43 | C |
| 247 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(4-notrophenyl)propane hydrochloride | 436 | 0.34 | H |
| 248 | 1-(4-Aminophenyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane dihydrochloride | 406 | 0.13 | B |
| 249 | 1-(4-Acetylaminophenyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane | 448 | 0.43 | B |
| dihydrochloride | ||||
| 250 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-nitrophenyl)propane hydrochloride | 436 | 0.53 | H |
| 251 | 1-(2-Aminophenyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane dihydrochloride | 406 | 0.52 | B |
| 252 | 1-(2-Acetylaminophenyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane | 448 | 0.51 | B |
| dihydrochloride | ||||
| 253 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethylphenylsulphoxide hydrochloride | 425 | 0.20 | H |
| 254 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl phenylsulphone hydrochloride | 455 | 0.71 | B |
| 255 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-nitrophenyl)butane hydrochloride | 450 | 0.49 | H |
| 256 | Cyclohexyl-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propylsulphide hydrochloride | 430 | 0.17 | J |
| (H+) | ||||
| 257 | Cyclohexyl-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propylsulphoxide hydrochloride | 445 | 0.51 | B |
| 258 | Cyclohexyl-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propylsulphone hydrochloride | 462 | 0.28 | H |
| (H+) | ||||
| 259 | Ethyl 2-cyclohexylmethyl-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyrate | 483 | 0.70 | B |
| hydrochloride | ||||
| 260 | 1-(4-acetylamino-1-cyclohexyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 468 | 0.43 | B |
| hydrochloride | ||||
| 261 | 2-(2-4-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)-5′,6′-dimethoxy-1-indanone | 477 | 0.41 | B |
| hydrochloride | ||||
| 262 | Ethyl 2-(2-cyclohexylethyl-3-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propionate | 483 | 0.74 | B |
| hydrochloride | ||||
| 263 | Cyclohexylmethyl-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylsulfone hydrochloride | 461 | 0.94 | B |
| 264 | Cyclohexylmethyl-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethylsulfoxide | 441 | 0.48 | B |
| hydrochloride | (H+) | |||
| 265 | Cyclohexylmethyl-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethylsulfide hydrochloride | 429 | 0.85 | B |
| 266 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-4-amino-6,7-dimethoxyquinazoline | 476 | 0.34 | B |
| dihydrochloride | ||||
| 267 | N-Acetyl-N-(3-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propylcyclohexylamine | 454 | 0.35 | B |
| hydrochloride | ||||
| 268 | N-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-2-piperidone hydrochloride | 426 | 0.39 | B |
| 269 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-1-ethoxycarbonxylcyclohexane | 483 | 0.82 | B |
| hydrochloride | ||||
| 270 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3-pyridyl)propane dihydrochloride | 392 | 0.44 | B |
| 271 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′-dimethoxybutyrophenone N-oxide | 477 | 0.45 | B |
| (M-18) | ||||
| 272 | 1-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-1-hydroxymethylcyclohexane | 441 | 0.55 | B |
| hydrochloride | ||||
| 273 | 1-Acetoxymethyl-1-(4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)cyclohexane | 483 | 0.86 | B |
| hydrochloride | ||||
| 274 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-methyl-3′,4′-dimethoxybutyrophenone | 493 | 0.22 | B |
| hydrochloride | ||||
| 275 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-(2-propyl)-3′,4′-dimethoxybutyrophenone | 521 | 0.28 | H |
| hydrochloride | ||||
| 276 | 2-Allyl-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-3′,4′dimethoxybutyrophenone | 519 | 0.30 | H |
| hydrochloride | ||||
| 277 | 4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-(1-propyl)-3′,4′-dimethoxybutyrophenone | 521 | 0.38 | H |
| hydrochloride | ||||
| 278 | 4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-ethyl-3′,4′-dimethoxybutyrophenone | 507 | 0.33 | H |
| hydrochloride | ||||
| 279 | Cyclohexylmethyl-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-2-ethyl)ether hydrochloride | 413 | 0.73 | B |
| 280 | 1-(n-Acetyl-3-piperidinyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 440 | 0.75 | B |
| 281 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3-piperidinyl)propane dihydrochloride | 398 | 0.16 | A |
| 282 | 1-(3-Acetylamino-4-methoxyphenyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 492 | 0.58 | B |
| hydrochloride | ||||
| 283 | 4-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)cyclohexane hydrochloride | 425 | 0.63 | B |
| 284 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-pyridyl)-1-propane hydrochloride | 390 | 0.66 | H |
| 285 | 2,6-Dimethyl-4-(4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butyl)-5-methyl-1,4- | 528 | 0.30 | F |
| dihydropyrydine-3,5-dicarboxylate hydrochloride | ||||
| 286 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2,3-dimethoxyphenyl)propane hydrochloride | 451 | 0.68 | H |
| 287 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methyl-5′,6′-dimethoxyindan hydrochloride | 463 | 0.59 | H |
| 288 | 2,6-Dimethyl-4-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-5-methylpyrydine- | 527 | 0.68 | B |
| 3,5-dicarboxylate dihydrochloride | ||||
| 289 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(4-pyridyl)propane dihydrochloride | 392 | 0.37 | B |
| 290 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl-3-nitrobenzamide hydrochloride | 466 | 0.48 | D |
| (H+) | ||||
| 291 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl-2-nitrobenzamide hydrochloride | 466 | D | |
| (H+) | ||||
| 292 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethyl-2,4-dimethoxybenzamide hydrochloride | 481 | 0.31 | D |
| (H+) | ||||
| 293 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-pyrolle)-1-butane hydrochloride | 409 | B | |
| (H+) | ||||
| 294 | 1-(N-Acetyl-2-piperidinyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 440 | 0.30 | B |
| 295 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(N-methyl-3-piperidinyl)butane dihydrochloride | 426 | 0.07 | B |
| 296 | 1-(1-(4-Hydroxy)cyclohexyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane hydrochloride | 427 | 0.45 | B |
| 297 | 1-(1-(4-Cyano)cyclohexyl)-4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane hydrochloride | 436 | 0.55 | F |
| 298 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-methoxyphenyl)propane hydrochloride | 421 | 0.81 | B |
| 299 | 1-(1-(3-Methoxy)cyclohexyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 441 | 0.71 | B |
| hydrochloride | ||||
| 300 | 1-(1-(3-Hydroxyoxy)cyclohexyl)-4-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 427 | 0.47 | B |
| hydrochloride | ||||
| 301 | 3-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)cyclohexanoe hydrochloride | 425 | 0.70 | B |
| 302 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-nitrocinnamyl)piperidinyl hydrochloride | 434 | 0.91 | B |
| 303 | 1-(2-Aminocinnamyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine hydrochloride | 404 | 0.62 | B |
| 304 | 1-(2-Acetylaminocinnamyl)-4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine hydrochloride | 446 | 0.55 | B |
| 305 | 4-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)tetrahydropyran hydrochloride | 413 | 0.69 | B |
| 306 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-nitrocinnamyl)piperidine hydrochloride | 984 | 0.90 | B |
| 307 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2-piperidinyl)propane dihydrochloride | 398 | 0.07 | A |
| 308 | 1-(N-acetyl-4-piperidinyl)-3-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 440 | 0.23 | H |
| 309 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane dihydrochloride | 398 | 0.03 | B |
| 310 | 2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)indane hydrochloride | 417 | 0.59 | B |
| 311 | 4-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ehtyl)-2,4,5,6-tetramethyl- | 524 | 0.68 | B |
| 1,4-dihydropyridino-3,5-dicarboxylate hydrochloride | ||||
| 312 | 4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(N-ethoxycarbonyl-3-piperidinyl)butane | 484 | 0.64 | B |
| hydrochloride | ||||
| 313 | 1-(5-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-pentyl)-1-methoxycarbonylcyclohexane | 483 | 0.72 | B |
| hydrochloride | ||||
| 314 | 1-(3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-propyl)-1-methoxycarbonylcyclohexane | 455 | 0.75 | B |
| hydrochloride | ||||
| 315 | 1-(3-Aminophenyl)-3-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane dihydrochloride | 993 | 0.62 | B |
| 316 | 1-(3-Acetylaminophenyl)-3-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane hydrochloride | 994 | 0.48 | B |
| 317 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3,4,5-trimethoxyphenyl)propane | 481 | 0.65 | B |
| dihydrochloride | ||||
| 318 | 2-(3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)-5,6-dimethoxy- | 491 | 0.21 | H |
| 1,2,34-tetrahydronaphthalene hydrochloride | ||||
| 319 | 6-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methyl-2,3-dimethoxybenzocycloheptene | 491 | 0.56 | H |
| hydrochloride | ||||
| 320 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4,5-trimethoxycinnamyl)piperdine hydrochloride | 479 | 0.69 | B |
| 321 | 1-(N-Acetyl-4-piperidinyl)-5-(4-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-pentene | 466 | 0.33 | B |
| dihydrochloride | ||||
| 322 | 2-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-3,4,5,6-tetrmethyl- | 1000 | 0.30 | B |
| 1,4-dihydropyridine-3,5-dicarboxylate hydrochloride | ||||
| 323 | 2-(4-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-butyl)-3,4-5,6-tetramethylpyridine- | 550 | 0.43 | B |
| 3,5-dicarboxylate hydrochloride | ||||
| 324 | 1-(1-(4-Methoxy)cyclohecyl)-3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)propane | 427 | 0.48 | B |
| hydrochloride | ||||
| 325 | (5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-nitrocinnamyl)piperidine hydrochloride | 454 | 0.89 | B |
| 326 | 1-(4-Aminocinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine dihydrochloride | 424 | 0.65 | B |
| 327 | 1-(4-Acetylaminominocinnamyl)-4-(5H-Dibenzo[a,d]thiepiz-5-ylidene)-1-piperidine hydrochloride | 466 | 0.58 | B |
| 328 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(2,4-dimethoxyphenyl)propane dihydrochloride | 451 | 0.64 | B |
| 329 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methyl-4′-nitroindan hydrochloride | 448 | 0.49 | I |
| 330 | 4′-Amino-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methylindan hydrochloride | 418 | 0.38 | H |
| 331 | 4′Acetylamino-2(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-Piperidinyl)methylindan hydrochloride | 460 | 0.33 | B |
| 332 | 2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methyl-5′-nitroindan hydrochloride | 448 | 0.51 | I |
| 333 | 5′-Amino2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methylindan hydrochloride | 418 | 0.34 | B |
| 334 | 5′-acetylamino-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)methylindan hydrochloride | 460 | 0.29 | H |
| 335 | 4-Amino-N-(2-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylbenzamide hydrochloride | 435 | B | |
| 336 | 3-Amino-N-(2-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylbenzamide hydrochloride | 435 | B | |
| 337 | 1-Formyl-N-(2-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylisonipecotinamide hydrochloride | 455 | B | |
| 338 | 1-Formyl-N-(2-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylisonicotinamide hydrochloride | 455 | B | |
| 339 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylnicotinamide hydrochloride | 421 | 0.42 | B |
| 340 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethnicotinamide N-oxide hydrochloride | 437 | 0.27 | D |
| (H+) | ||||
| 341 | N-(2-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)ethylisonicotinamide N-oxide hydrochloride | 437 | 0.30 | D |
| (H+) | ||||
| 342 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2,4-dimethoxycinnamyl)piperidine hydrochloride | 449 | 0.73 | B |
| 343 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2,5-dimethoxycinnamyl)piperidine hydrochloride | 449 | 0.73 | B |
| 344 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2,3-dimethoxycinnamyl)piperidine hydrochloride | 449 | 0.90 | B |
| 345 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,5-dimethoxycinnamyl)piperidine hydrochloride | 449 | 0.74 | B |
| 346 | 1-(4-Cyanocinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine hydrochloride | 414 | 0.70 | B |
| 347 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-methoxycinnamyl)piperidine hydrochloride | 419 | 0.87 | B |
| 348 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-methoxycinnamyl)piperidine hydrochloride | 419 | 0.89 | B |
| 349 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine hydrochloride | 419 | 0.85 | B |
| 350 | 4-(10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-nitrocinnamyl)piperidine hydrochloride | 436 | 0.93 | B |
| 351 | 1-(4-Aminocinnamyl)-4-(10,11-dihydro-5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine dihydrochloride | 406 | 0.64 | B |
| 352 | 1-(4-Acetylaminocinnamyl)-4-(10,11 dihydro-5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine | 448 | 0.54 | B |
| dihydrochloride | ||||
| 353 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-4-fluorocinnamyl)piperidine hydrochloride | 407 | 0.88 | B |
| 354 | 2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)-4′-nitroindan hydrochloride | 462 | 0.34 | H |
| 355 | 4′-Amino-2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)indan hydrochloride | 432 | 0.53 | B |
| 356 | 4′-Caetylamino-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)indan hydrochloride | 474 | 0.24 | B |
| 357 | 2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)-5′-nitroindan hydrochloride | 462 | 0.31 | H |
| 358 | 5′-Amino-2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)indan dihydrochloride | 432 | 0.23 | H |
| 359 | 5′-Acetylamino-2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)indan dihydrochloride | 474 | 0.05 | H |
| 360 | 2-(2-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-ethyl)-5′-methanesulfonylaminoindan | 510 | 0.11 | H |
| hydrochloride | ||||
| 361 | 1-(Cyclohexyl-4-(4-(10,11-dihydroxy-5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)butane | 445 | 0.84 | B |
| 362 | 3-(4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidinyl)-1-(3-pyridyl)-1-propene dihydrochloride | 390 | 0.44 | B |
| 363 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-hydroxycinnamyl)piperidine hydrochloride | 406 | 0.55 | B |
| (H+) | ||||
| 364 | 1-(4-Acetoxycinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 447 | 0.87 | B |
| 365 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-hydroxy-3-methoxycinnamyl)piperidine hydrochloridine | 435 | 0.63 | B |
| 366 | 1-(4-Acetoxy-3-methoxycinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-piperidine hydrochloride | 477 | 0.83 | B |
| 367 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-hydroxycinnamyl)piperidine hydrochloride | 405 | 0.45 | B |
| 368 | 1-(3-Acetoxycinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 447 | 0.80 | B |
| 369 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-(2-methoxyacetoxy)cinnamyl)piperidine hydrochloride | 477 | 0.65 | B |
| 370 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-propanoylaminocinnamyl)piperidine hydrochloride | 460 | 0.21 | H |
| 371 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-ethoxycarbonylaminocinnamyl)piperidine hydrochloride | 476 | 0.20 | H |
| 372 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-methanesulfonylaminocinnamyl)piperidine hydrochloride | 482 | 0.44 | B |
| 373 | 1-(N,N-Bis(methanesulfonyl)amminocinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine | 560 | 0.88 | B |
| hydrochloride | ||||
| 374 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-methoxycarbonylcinnamyl)piperidine hydrochloride | 447 | 0.55 | B |
| 375 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-methoxycarbonylcinnamyl)piperidine hydrochloride | 447 | 0.48 | H |
| 376 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-methoxycarbonylcinnamyl)piperidine hydrochloride | 447 | 0.50 | B |
| 377 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-3-methoxy-2-nitrocinnamyl)piperidine hydrochloride | 464 | 0.30 | H |
| 378 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-methoxycarbonylaminocinnamyl)piperidine hydrochloride | 462 | 0.53 | B |
| 379 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-pivaloy)aminocinnamyl)piperidine hydrochloride | 488 | 0.51 | B |
| 380 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-trifluoroacetylaminocinnamyl)piperidine hydrochloride | 500 | 0.44 | B |
| 381 | 1-(4-Butanoylaminocinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 474 | 0.50 | B |
| 382 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-ethoxycarbonylcinnamyl)piperidine hydrochloride | 477 | 0.85 | B |
| 383 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(4-(2-methoxyacetoxy)cinnamyl)piperidine hydrochloride | 477 | 0.45 | B |
| 384 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3,4-dihydroxycinnamyl)piperidine hydrochloride | 422 | 0.35 | B |
| (H+) | ||||
| 385 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(2-indolylmethyl)piperidine hydrochloride | 402 | 0.67 | H |
| 386 | 1-(4-Aminosulfonylcinnamyl)-4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)piperidine hydrochloride | 468 | 0.48 | B |
| (H+) | ||||
| 387 | 4-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-1-(3-methoxy-4-nitrocinnamyl)piperidine hydrochloride | 464 | 0.29 | H |
| solvent: solvent for TLC | ||||
| A: chloroform/methanol = 4/1 | ||||
| B: chloroform/methanol = 9/1 | ||||
| C: chloroform/methanol = 20/1 | ||||
| D: chloroform/methanol = 25/1 | ||||
| E: chloroform/methanol = 50/1 | ||||
| F: ethylacetate/hexane = 5/1 | ||||
| G: ethylacetate/hexane = 3/1 | ||||
| H: ethylacetate/hexane = 1/1 | ||||
| I: ethylacetate/hexane = 1/2 | ||||
| G: ethylacetate/hexane = 1/5 | ||||
As test animals, four male spontaneously hypertensive rats (weight 400 to 440 g) that were sufficiently adapted for feeding and in which hypertension was confirmed were used.
Physiological saline aqueous solution containing 2.5% Nicolle and 2.5% ethanol of sample was intravenously administered by bolus injection at a dose of 1 ml per 1 kg of body weight. Systolic blood pressure after administration was measured by the indirect (tail-cuff) method.
The results are shown below.
| Decrease in systolic blood pressure | ||
| Dose | (mmHg) time after administration (hour) |
| Compound | (mg/kg) | 0.5 | 4 |
| 1 | 10 | −67 | 1 |
| 2 | 10 | −125 | −34 |
| 3 | 3 | −110 | −22 |
| 4 | 10 | −76 | 0 |
| 5 | 10 | −56 | −20 |
| 7 | 10 | −57 | −15 |
| 8 | 10 | −95 | −21 |
| 9 | 10 | −91 | −19 |
| 10 | 10 | −129 | −21 |
| 11 | 10 | −166 | |
| 12 | 10 | −27 | 1 |
| 13 | 10 | −47 | 4 |
| 14 | 10 | −105 | −10 |
| 15 | 10 | −130 | −136 |
| 16 | 10 | −114 | −30 |
| 17 | 10 | −84 | −16 |
| 20 | 10 | −37 | 2 |
| 23 | 10 | −34 | 10 |
| 25 | 10 | −8 | −7 |
| 28 | 10 | −52 | 4 |
| 31 | 10 | −61 | −11 |
| 37 | 10 | −78 | −36 |
| 38 | 10 | −140 | −76 |
| 42 | 10 | −66 | −14 |
| 45 | 10 | −147 | −38 |
| 52 | 10 | −23 | −9 |
| 59 | 10 | −87 | −21 |
| 60 | 10 | −121 | −48 |
| 100 | 10 | −35 | −5 |
| 101 | 10 | −89 | −14 |
| 107 | 10 | −88 | −11 |
| 108 | 10 | −126 | −50 |
| 111 | 10 | −98 | −13 |
| 112 | 10 | −16 | 0 |
| 113 | 1 | −151 | −81 |
| 115 | 10 | −53 | −19 |
| 116 | 10 | −36 | −12 |
| 117 | 10 | −143 | −25 |
| 118 | 10 | −129 | −24 |
| 119 | 10 | −34 | −5 |
| 120 | 3 | −17 | −12 |
| 121 | 10 | −42 | −19 |
| 122 | 10 | −120 | −62 |
| 123 | 10 | −55 | −7 |
| 124 | 10 | −90 | −20 |
| 125 | 10 | −93 | −14 |
| 126 | 10 | −87 | −19 |
| 128 | 10 | −129 | −8 |
| 129 | 10 | −17 | −1 |
| 130 | 10 | −42 | 9 |
| 131 | 10 | −116 | 2 |
| 132 | 10 | −106 | −5 |
| 133 | 3 | −146 | −84 |
| 134 | 10 | −115 | −30 |
| 135 | 10 | −132 | −50 |
| 136 | 10 | −100 | −40 |
| 138 | 10 | −129 | −33 |
| 139 | 10 | −139 | −89 |
| 140 | 3 | −113 | −101 |
| 142 | 10 | −43 | 0 |
| 149 | 10 | −116 | −32 |
| 150 | 10 | −110 | −47 |
| 151 | 10 | −81 | −43 |
| 154 | 10 | −131 | −105 |
| 155 | 10 | −131 | −105 |
| 156 | 10 | −110 | −42 |
| 157 | 10 | −32 | −13 |
| 158 | 10 | −8 | 7 |
| 159 | 10 | −27 | −12 |
| 160 | 10 | −3 | −10 |
| 161 | 10 | −64 | −12 |
| 162 | 10 | −62 | −3 |
| 163 | 10 | −1 | 4 |
| 164 | 10 | −91 | −22 |
| 165 | 10 | −22 | 12 |
| 166 | 10 | −45 | 6 |
| 168 | 10 | −108 | 0 |
| 169 | 10 | −130 | −4 |
| 171 | 10 | −122 | −8 |
| 172 | 10 | −115 | −25 |
| 173 | 10 | −98 | −25 |
| 174 | 10 | −8 | −16 |
| 175 | 10 | −87 | −1 |
| 176 | 10 | −105 | −10 |
| 180 | 10 | −25 | −24 |
| 181 | 10 | −56 | −27 |
| 182 | 10 | −11 | −6 |
| 184 | 10 | −16 | −4 |
| 185 | 10 | −66 | −10 |
| 186 | 10 | −95 | −12 |
| 187 | 10 | −47 | −9 |
| 188 | 10 | −94 | −12 |
| 189 | 10 | −72 | −15 |
| 190 | 10 | −11 | −15 |
| 191 | 10 | −29 | −20 |
| 192 | 10 | −25 | −36 |
| 193 | 10 | −124 | −59 |
| 194 | 10 | −59 | −17 |
| 195 | 10 | −100 | −51 |
| 196 | 10 | −145 | −81 |
| 197 | 10 | −51 | −26 |
| 198 | 10 | −124 | −25 |
| 199 | 10 | −15 | −24 |
| 200 | 10 | −10 | −24 |
| 201 | 10 | −118 | −21 |
| 202 | 10 | −54 | −16 |
| 203 | 3 | −123 | −58 |
| 204 | 10 | −141 | −84 |
| 205 | 10 | −22 | −4 |
| 206 | 10 | −61 | −27 |
| 207 | 10 | −98 | −43 |
| 208 | 10 | −131 | −19 |
| 209 | 10 | −49 | −13 |
| 210 | 1 | −78 | −69 |
| 212 | 10 | −155 | |
| 213 | 10 | −82 | 3 |
| 214 | 10 | −126 | −21 |
| 215 | 10 | −128 | −14 |
| 216 | 3 | −2 | −27 |
| 217 | 10 | −18 | −20 |
| 218 | 10 | −97 | −11 |
| 219 | 10 | −104 | −33 |
| 220 | 10 | −148 | −54 |
| 221 | 10 | −70 | −13 |
| 222 | 10 | −94 | −5 |
| 224 | 10 | −69 | −61 |
| 225 | 10 | −115 | −31 |
| 226 | 10 | −131 | −16 |
| 228 | 3 | −112 | −14 |
| 229 | 3 | −77 | −14 |
| 230 | 3 | −131 | −91 |
| 231 | 3 | −132 | −115 |
| 232 | 1 | −92 | −85 |
| 233 | 10 | −35 | −1 |
| 234 | 10 | −96 | −2 |
| 235 | 10 | −99 | −5 |
| 236 | 10 | −10 | −15 |
| 237 | 10 | −65 | −14 |
| 238 | 10 | −14 | −5 |
| 239 | 10 | −68 | −15 |
| 240 | 3 | −118 | −5 |
| 241 | 10 | −73 | −4 |
| 242 | 10 | −28 | 7 |
| 243 | 10 | −111 | −31 |
| 244 | 10 | −19 | 4 |
| 245 | 10 | −34 | −10 |
| 246 | 10 | −34 | −4 |
| 247 | 10 | −119 | −40 |
| 248 | 10 | −101 | −92 |
| 249 | 10 | −121 | −100 |
| 250 | 10 | −136 | −30 |
| 251 | 10 | −110 | −24 |
| 252 | 10 | −23 | −5 |
| 253 | 10 | −12 | 1 |
| 255 | 10 | −62 | 2 |
| 256 | 10 | −60 | −11 |
| 257 | 10 | −70 | −13 |
| 258 | 10 | −74 | −10 |
| 259 | 10 | −46 | −5 |
| 260 | 10 | −51 | −10 |
| 261 | 10 | −123 | −11 |
| 262 | 10 | −16 | −3 |
| 264 | 10 | −38 | −5 |
| 265 | 10 | −61 | −11 |
| 266 | 10 | −133 | −77 |
| 267 | 10 | −40 | 0 |
| 268 | 10 | −29 | 13 |
| 269 | 10 | 143 | −71 |
| 270 | 10 | −18 | 2 |
| 271 | 10 | −17 | −13 |
| 272 | 10 | −76 | −3 |
| 273 | 10 | −37 | 5 |
| 274 | 10 | −102 | −21 |
| 275 | 10 | −66 | −20 |
| 276 | 10 | −24 | −1 |
| 277 | 10 | −27 | 0 |
| 278 | 10 | −64 | 2 |
| 279 | 3 | −83 | −24 |
| 280 | 10 | −50 | −11 |
| 281 | 10 | −31 | −5 |
| 282 | 10 | −72 | −15 |
| 283 | 10 | −112 | 4 |
| 284 | 3 | −151 | −40 |
| 285 | 10 | −62 | −7 |
| 286 | 10 | −134 | −40 |
| 287 | 10 | −83 | −16 |
| 288 | 10 | −92 | −14 |
| 289 | 3 | −20 | 10 |
| 290 | 3 | −15 | 15 |
| 291 | 3 | −8 | 15 |
| 292 | 3 | −31 | 3 |
| 293 | 10 | −122 | 4 |
| 294 | 3 | −17 | 7 |
| 295 | 3 | −36 | 1 |
| 296 | 10 | −109 | −14 |
| 297 | 10 | −129 | −57 |
| 298 | 10 | −111 | −31 |
| 299 | 10 | −134 | −45 |
| 300 | 10 | −97 | −22 |
| 301 | 10 | −100 | −12 |
| 302 | 10 | −83 | −41 |
| 303 | 3 | −90 | −19 |
| 304 | 10 | −49 | −5 |
| 305 | 10 | −95 | −9 |
| 306 | 10 | −138 | −37 |
| 307 | 10 | −62 | −20 |
| 308 | 3 | −27 | −5 |
| 310 | 10 | −90 | −18 |
| 311 | 10 | −90 | −18 |
| 312 | 10 | −115 | −11 |
| 313 | 10 | −154 | −85 |
| 314 | 10 | −61 | −11 |
| 315 | 10 | −43 | −3 |
| 316 | 1 | −100 | 8 |
| 317 | 10 | −118 | −14 |
| 318 | 10 | −83 | −57 |
| 319 | 10 | −104 | −20 |
| 320 | 10 | −147 | −113 |
| 321 | 10 | −60 | −4 |
| 322 | 10 | −100 | −16 |
| 323 | 10 | −117 | −11 |
| 324 | 10 | −137 | −46 |
| 325 | 10 | −115 | −100 |
| 326 | 1 | −125 | −102 |
| 327 | 3 | −10 | −43 |
| 328 | 10 | −125 | −87 |
| 329 | 10 | −34 | −7 |
| 330 | 10 | −93 | −25 |
| 331 | 10 | −62 | −14 |
| 332 | 10 | −111 | −57 |
| 343 | 3 | −83 | −45 |
| 344 | 1 | −123 | −35 |
| 345 | 3 | −120 | −95 |
| 346 | 3 | −142 | −121 |
| 347 | 3 | −116 | −53 |
| 348 | 3 | −105 | −12 |
| 349 | 1 | −48 | −43 |
| 350 | 10 | −136 | −85 |
| 351 | 3 | −70 | −21 |
| 352 | 3 | −93 | −60 |
| 353 | 10 | −147 | −138 |
| 354 | 3 | −89 | −8 |
| 363 | 3 | −120 | |
| 364 | 1 | −113 | |
| 365 | 3 | −80 | −56 |
| 366 | 3 | −152 | −113 |
| 367 | 10 | −98 | −63 |
| 368 | 3 | −110 | −68 |
| 369 | 10 | −101 | −83 |
| 370 | 10 | −99 | −69 |
| 374 | 3 | −119 | 11 |
| 375 | 1 | −126 | −70 |
| 376 | 3 | −106 | −77 |
| 377 | 1 | −151 | −73 |
| 378 | 1 | −106 | −90 |
| 379 | 1 | −118 | −59 |
| 380 | 0.3 | −141 | |
| 381 | 3 | −136 | |
| 382 | 3 | −129 | −74 |
| 383 | 3 | −112 | −86 |
| 334 | 3 | −130 | −93 |
| 385 | 10 | −123 | −96 |
| 386 | 10 | −83 | −96 |
| 387 | 10 | −112 | −50 |
From the foregoing results, it is understood that the piperidine derivatives of the present invention possess hypotensive activity and are usable as hypotensives and therefore, they can be expected to provide an excellent hypotensive effect. Accordingly, the present invention is extremely useful, particularly in the pharmaceutical industry.
Having now fully described the invention, it will be apparent to one of ordinary skill in the art that many changes and modifications can be made thereto without departing from the spirit or scope of the invention as set forth herein.
Claims (13)
wherein:
A is pyridine;
R is —H, —Cl or —OCH3;
X is —(CH2)n—, —CO—(CH2)3, —CONH—(CH2)2, —NHCO—(CH2)2, or —CH≡CH—(CH2)2—; and
n is an integer of from 3 to 5;
Y is —CH≡CH—, —(CH2)2, —OCH2—, —SCH2—, or —O—; and
Q is —CN, substituted or unsubstituted cyclohexyl, substituted or unsubstituted piperidinyl, substituted or unsubstituted piperazinyl, substituted or unsubstituted phenyl, substituted or unsubstituted furyl, substituted or unsubstituted thienyl, substituted or unsubstituted pyrrolyl, substituted or unsubstituted pyridyl, substituted or unsubstituted morpholinyl, or substituted or unsubstituted thiomorpholinyl, wherein when Q is substituted, the substituent(s) is/are selected from the group consisting of HCH2n wherein n is an integer of 1 to 10, ClCH23, allyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxyl, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl, and wherein when X and/or Q contain CH2 groups, one or more of the CH2 groups in X and/or Q may be substituted by CH24 CH25, thereby forming a ring structure.
2. The piperidine compound of claim 1 , wherein the hydrogen atoms of one or more of the —CH2— groups in X and Q are substituted by CH24 or CH25, thereby forming a ring structure.
3. The piperidine compound of claim 1 , wherein Q is substituted by at least one substituent selected from the group consisting of HCH2n wherein n is an integer of 1 to 10, ClCH23, allyl, phenyl, isopropyl; hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxyl, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl.
4. The piperidine compound of claim 1 , wherein X is —CONH—(CH2)2.
5. The piperidine compound of claim 1 , wherein Y is —CH≡CH—.
6. The piperidine compound of claim 1 , wherein Y is —(CH2)2—.
7. The piperidine compound of claim 1 , wherein Q is substituted or unsubstituted piperidinyl.
8. The piperidine compound of claim 1 , wherein X is —CONH—(CH2)2, and Q is substituted or unsubstituted piperidinyl.
wherein:
R is —H, —Cl or —OCH3;
X is —(CH2)n—, —CO—(CH2)3, —CONH—(CH2)2, —NHCO—(CH2)2, or —CH≡CH—(CH2)2—; and
n is an integer of from 3 to 5;
Y is —CH≡CH—, —(CH2)2—, —OCH2—, —SCH2—; and
Q is —CN, substituted or unsubstituted piperidinyl, substituted or unsubstituted piperazinyl, substituted or unsubstituted thienyl, substituted or unsubstituted morpholinyl, or substituted or unsubstituted thiomorpholinyl, wherein when Q is substituted, the substituent(s) is/are selected from the group consisting of HCH2n wherein n is an integer of 1 to 10, ClCH23, allyl, formyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hdyroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl, and wherein when X and/or Q contain CH2groups, one or more of the CH2 groups in X and/or Q may be substituted by CH24 or CH25, thereby forming a ring structure.
10. The piperidine compound of claim 9 , wherein X is —CONH—(CH2)2, Y is —CH≡CH—, and Q is N-formylpiperidinyl.
wherein:
R is —H, —Cl or —OCH3;
X is —CO—(CH2)3, —CONH—(CH2)2, —NHCO—(CH2)2, or —CH≡CH— (CH2)2—; and
Q is —CN, substituted or unsubstituted cyclohexyl, substituted or unsubstituted piperidinyl, substituted or unsubstituted piperazinyl, substituted or unsubstituted phenyl, substituted or unsubstituted furyl, substituted or unsubstituted thienyl, substituted or unsubstituted pyrrolyl, substituted or unsubstituted pyridyl, substituted or unsubstituted morpholinyl, or substituted or unsubstituted thiomorpholinyl, wherein when Q is substituted, the substituent(s) is/are selected from the group consisting of HCH2n wherein n is an integer of 1 to 10, ClCH23, allyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxyl, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl, and wherein when X and/or Q contain CH2 groups, one or more of the CH2 groups in X and/or Q may be substituted by CH24 or CH25 thereby forming a ring structure.
wherein:
R is —H, —Cl or —OCH3;
X is —(CH2)n—;
n is an integer of from 3 to 5; and
Q is —CN, substituted or unsubstituted phenyl, substituted or unsubstituted furyl, substituted or unsubstituted thienyl, substituted or unsubstituted pyrrolyl, substituted or unsubstituted pyridyl, wherein when Q is substituted, the substituent(s) is/are selected from the group consisting of HCH2n wherein n is an integer of 1 to 10, ClCH23, allyl, phenyl, isopropyl, hydroxy, methoxy, ethoxy, fluoro, chloro, acetoxy, 2-methoxyacetoxy, ethoxycarboxyl, carboxyl, methoxycarbonyl, ethoxycarbonyl, cyano, imidazolylmethyl, trifluoromethyl, benzoyl, 2-hydroxybenzyl, nitro, amino, acetylamino, propanoylamino, butanoylamino, pivaloylamino, trifluoromethylamino, methoxycarbonylamino, ethoxycarbonylamino, cinnamoylamino, methanesulfonylamino, N,N-bis(methanesulfonyl)amino, aminocarbonyl, aminosulfonyl, hydroxymethyl and acetoxymethyl, and wherein one or more of the CH2 groups in X may be substituted by CH24 or CH25 thereby forming a ring structure.
13. The piperidine compounds of claim 10 , wherein R is —H.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/248,236 USRE38257E1 (en) | 1988-06-02 | 1999-02-10 | Piperdine derivatives and hypotensives containing the same |
Applications Claiming Priority (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US20191188A | 1988-06-02 | 1988-06-02 | |
| JP30346188 | 1988-11-30 | ||
| JP6405989 | 1989-03-16 | ||
| JP1-64059 | 1989-03-16 | ||
| JP63-303461 | 1989-03-16 | ||
| US07/354,880 US5231105A (en) | 1987-06-02 | 1989-05-22 | Ethylamine derivatives and antihypertensives containing the same |
| US44343889A | 1989-11-30 | 1989-11-30 | |
| US07/655,775 US5250681A (en) | 1988-06-02 | 1991-02-15 | Piperidine derivatives and hypotensives containing the same |
| US7245893A | 1993-06-07 | 1993-06-07 | |
| US08/269,628 US5393890A (en) | 1988-06-02 | 1994-07-01 | Piperidine derivatives and hypotensives containing the same |
| US09/248,236 USRE38257E1 (en) | 1988-06-02 | 1999-02-10 | Piperdine derivatives and hypotensives containing the same |
Related Parent Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US08/269,628 Reissue US5393890A (en) | 1988-06-02 | 1994-07-01 | Piperidine derivatives and hypotensives containing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USRE38257E1 true USRE38257E1 (en) | 2003-09-23 |
Family
ID=27565055
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US08/269,628 Ceased US5393890A (en) | 1988-06-02 | 1994-07-01 | Piperidine derivatives and hypotensives containing the same |
| US09/248,236 Expired - Lifetime USRE38257E1 (en) | 1988-06-02 | 1999-02-10 | Piperdine derivatives and hypotensives containing the same |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US08/269,628 Ceased US5393890A (en) | 1988-06-02 | 1994-07-01 | Piperidine derivatives and hypotensives containing the same |
Country Status (1)
| Country | Link |
|---|---|
| US (2) | US5393890A (en) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040142972A1 (en) * | 2001-10-16 | 2004-07-22 | Hypnion, Inc. | CNS target modulators |
| US20050080265A1 (en) * | 2001-10-16 | 2005-04-14 | Edgar Dale M. | Treatment of CNS disorders using CNS target modulators |
| US20050143348A1 (en) * | 2003-12-10 | 2005-06-30 | Edgar Dale M. | Doxepin analogs and methods of use thereof |
| US20050239838A1 (en) * | 2004-04-23 | 2005-10-27 | Dale Edgar | Methods of treating sleep disorders |
| US20050256165A1 (en) * | 2003-12-10 | 2005-11-17 | Edgar Dale M | Doxepin analogs and methods of use thereof |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5508280A (en) * | 1990-05-18 | 1996-04-16 | Merrell Pharmaceuticals, Inc. | 5H-Dibenzo (A,D) cycloheptenes as muscarinic receptor antagonists |
| US5661152A (en) * | 1993-10-15 | 1997-08-26 | Schering Corporation | Tricyclic sulfonamide compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| US5719148A (en) * | 1993-10-15 | 1998-02-17 | Schering Corporation | Tricyclic amide and urea compounds useful for inhibition of g-protein function and for treatment of proliferative diseases |
| US6365588B1 (en) | 1993-10-15 | 2002-04-02 | Schering Corporation | Tricyclic amide and urea compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| US6524832B1 (en) * | 1994-02-04 | 2003-02-25 | Arch Development Corporation | DNA damaging agents in combination with tyrosine kinase inhibitors |
| TW366343B (en) * | 1994-04-20 | 1999-08-11 | Ajinomoto Kk | Piperidine derivatives and anti-platelet agents containing the same |
| US5684013A (en) * | 1995-03-24 | 1997-11-04 | Schering Corporation | Tricyclic compounds useful for inhibition of g-protein function and for treatment of proliferative diseases |
| US5700806A (en) * | 1995-03-24 | 1997-12-23 | Schering Corporation | Tricyclic amide and urea compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| US5801175A (en) | 1995-04-07 | 1998-09-01 | Schering Corporation | Tricyclic compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| US5874442A (en) * | 1995-12-22 | 1999-02-23 | Schering-Plough Corporation | Tricyclic amides useful for inhibition of G-protein function and for treatment of proliferative disease |
| US5994364A (en) * | 1996-09-13 | 1999-11-30 | Schering Corporation | Tricyclic antitumor farnesyl protein transferase inhibitors |
| US5958890A (en) * | 1996-09-13 | 1999-09-28 | Schering Corporation | Tricyclic compounds useful for inhibition of G-protein function and for treatment of proliferative diseases |
| US6030982A (en) * | 1996-09-13 | 2000-02-29 | Schering Corporationm | Compounds useful for inhibition of farnesyl protein transferase |
| US5985879A (en) * | 1996-09-13 | 1999-11-16 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6040305A (en) * | 1996-09-13 | 2000-03-21 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US5861395A (en) * | 1996-09-13 | 1999-01-19 | Schering Corporation | Compounds useful for inhibition of farnesyl proteins transferase |
| US5945429A (en) * | 1996-09-13 | 1999-08-31 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6071907A (en) * | 1996-09-13 | 2000-06-06 | Schering Corporation | Tricyclic compounds useful as FPT inhibitors |
| US6130229A (en) * | 1996-10-09 | 2000-10-10 | Schering Corporation | Tricyclic compounds having activity as RAS-FPT inhibitors |
| US6689789B2 (en) | 1997-06-17 | 2004-02-10 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6218401B1 (en) | 1997-06-17 | 2001-04-17 | Schering Corporation | Phenyl-substituted tricyclic inhibitors of farnesyl-protein transferase |
| US6051582A (en) * | 1997-06-17 | 2000-04-18 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6211193B1 (en) | 1997-06-17 | 2001-04-03 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6159984A (en) | 1997-06-17 | 2000-12-12 | Schering Corporation | Farnesyl protein transferase inhibitors |
| US6239140B1 (en) | 1997-06-17 | 2001-05-29 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6228865B1 (en) | 1997-06-17 | 2001-05-08 | Schering Corporation | Compounds useful for inhibition of farnesyl protein transferase |
| US6576639B1 (en) | 1997-06-17 | 2003-06-10 | Schering Corporation | Compounds for the inhibition of farnesyl protein transferase |
| US6632455B2 (en) | 1997-12-22 | 2003-10-14 | Schering Corporation | Molecular dispersion composition with enhanced bioavailability |
| US6316462B1 (en) | 1999-04-09 | 2001-11-13 | Schering Corporation | Methods of inducing cancer cell death and tumor regression |
| US7342016B2 (en) * | 2000-08-30 | 2008-03-11 | Schering Corporation | Farnesyl protein transferase inhibitors as antitumor agents |
| US20100166804A1 (en) * | 2007-05-23 | 2010-07-01 | Dennis Penn | Methods |
| WO2009142772A2 (en) * | 2008-05-23 | 2009-11-26 | Mastcell Pharmaceuticals, Inc. | Methods and treatment for allergies and inflammation associated with gastrointestinal diseases |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1153977A (en) | 1967-01-05 | 1969-06-04 | Smith Kline French Lab | 9-Cycloalkyl-Lower Alkyl-Piperidylidene Derivatives of Xanthenes and Thioxanthenes |
| US4031222A (en) | 1975-12-22 | 1977-06-21 | Merck & Co., Inc. | Trifluoromethylthio (and sulfonyl) derivatives of cyproheptadine analogs |
| US4073912A (en) | 1976-10-12 | 1978-02-14 | Smithkline Corporation | Piperidylidene derivatives of benzo-fused xanthenes, thioxanthenes and dibenzoxepins and antipsychotic use thereof |
| EP0005607A1 (en) | 1978-05-12 | 1979-11-28 | Kefalas A/S | Xanthone and thioxanthone derivatives, their preparation and pharmaceutical compositions containing them |
| US4356184A (en) | 1980-06-04 | 1982-10-26 | G. D. Searle & Co. | Anti-allergic or antihypertensive 1-piperidinylmethyl benzenamines |
| US4912222A (en) | 1988-06-17 | 1990-03-27 | Fisons Corporation | Antihistamines related to cyproheptadine |
| US5229400A (en) | 1990-10-05 | 1993-07-20 | Ajinomoto Co., Inc. | Piperidine compounds and their use as antiarrhythmic agents |
| US5231105A (en) | 1987-06-02 | 1993-07-27 | Ajinomoto Co., Inc. | Ethylamine derivatives and antihypertensives containing the same |
-
1994
- 1994-07-01 US US08/269,628 patent/US5393890A/en not_active Ceased
-
1999
- 1999-02-10 US US09/248,236 patent/USRE38257E1/en not_active Expired - Lifetime
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1153977A (en) | 1967-01-05 | 1969-06-04 | Smith Kline French Lab | 9-Cycloalkyl-Lower Alkyl-Piperidylidene Derivatives of Xanthenes and Thioxanthenes |
| US4031222A (en) | 1975-12-22 | 1977-06-21 | Merck & Co., Inc. | Trifluoromethylthio (and sulfonyl) derivatives of cyproheptadine analogs |
| US4073912A (en) | 1976-10-12 | 1978-02-14 | Smithkline Corporation | Piperidylidene derivatives of benzo-fused xanthenes, thioxanthenes and dibenzoxepins and antipsychotic use thereof |
| EP0005607A1 (en) | 1978-05-12 | 1979-11-28 | Kefalas A/S | Xanthone and thioxanthone derivatives, their preparation and pharmaceutical compositions containing them |
| US4356184A (en) | 1980-06-04 | 1982-10-26 | G. D. Searle & Co. | Anti-allergic or antihypertensive 1-piperidinylmethyl benzenamines |
| US5231105A (en) | 1987-06-02 | 1993-07-27 | Ajinomoto Co., Inc. | Ethylamine derivatives and antihypertensives containing the same |
| US4912222A (en) | 1988-06-17 | 1990-03-27 | Fisons Corporation | Antihistamines related to cyproheptadine |
| US5229400A (en) | 1990-10-05 | 1993-07-20 | Ajinomoto Co., Inc. | Piperidine compounds and their use as antiarrhythmic agents |
Non-Patent Citations (1)
| Title |
|---|
| White, Chemical Patent Practice, pp. 240-241, 1998. * |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040142972A1 (en) * | 2001-10-16 | 2004-07-22 | Hypnion, Inc. | CNS target modulators |
| US20050080265A1 (en) * | 2001-10-16 | 2005-04-14 | Edgar Dale M. | Treatment of CNS disorders using CNS target modulators |
| US7317026B2 (en) | 2001-10-16 | 2008-01-08 | Hypnion, Inc. | CNS target modulators |
| US7355042B2 (en) | 2001-10-16 | 2008-04-08 | Hypnion, Inc. | Treatment of CNS disorders using CNS target modulators |
| US20050143348A1 (en) * | 2003-12-10 | 2005-06-30 | Edgar Dale M. | Doxepin analogs and methods of use thereof |
| US20050256165A1 (en) * | 2003-12-10 | 2005-11-17 | Edgar Dale M | Doxepin analogs and methods of use thereof |
| US7411069B2 (en) | 2003-12-10 | 2008-08-12 | Hypnion, Inc. | Doxepin analogs and methods of use thereof |
| US7482460B2 (en) | 2003-12-10 | 2009-01-27 | Hypnion, Inc. | Doxepin analogs and methods of use thereof |
| US20050239838A1 (en) * | 2004-04-23 | 2005-10-27 | Dale Edgar | Methods of treating sleep disorders |
| US7524864B2 (en) | 2004-04-23 | 2009-04-28 | Hypnion, Inc. | Methods of treating sleep disorders |
Also Published As
| Publication number | Publication date |
|---|---|
| US5393890A (en) | 1995-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5393890A (en) | Piperidine derivatives and hypotensives containing the same | |
| CA1303042C (en) | Piperazinyl-pyridines and piperazinyl-imidazoles and their use as anti-dysrhythmia agents | |
| RU2232156C2 (en) | Compounds of n,n-substituted cyclic amine | |
| US5534525A (en) | Lactam derivatives | |
| HUT66081A (en) | Process for preparing pyridine and pyridine n-oxide derivatives of diaryl methyl piperidines or piperazines and pharmaceutical compositions containing them | |
| NO329065B1 (en) | Derivatives of N- [phenyl (piperidin-2yl) methyl] benzamide and the use of the same in therapeutics | |
| JPWO2004011430A1 (en) | Sodium channel inhibitor | |
| US5250681A (en) | Piperidine derivatives and hypotensives containing the same | |
| EP0449186A2 (en) | N-aralkyl piperidine derivatives as psychotropic drugs | |
| JP2943188B2 (en) | Piperidine derivative and hypotensor containing same derivative | |
| JP2935541B2 (en) | Fused heterocyclic compound | |
| NZ228895A (en) | Phenyl-substituted piperidine derivatives and pharmaceutical compositions | |
| CA2063030C (en) | Substituted n-phenylpiperidines and drugs therefrom | |
| US20020016337A1 (en) | Heterocyclic analgesic compounds and methods of use thereof | |
| US6867221B2 (en) | Cyclic amine compounds and pharmaceutical composition containing the same | |
| KR20050114641A (en) | Nitrogenous heterocyclic derivative having 2,6-disubstituted styryl | |
| US8222418B2 (en) | Piperidines and related compounds for the treatment of dementia | |
| US4542132A (en) | Cardiac stimulating cyclic sulfonamido substituted 4-piperidino-quinazoline derivatives, compositions, and method of use therefor | |
| US3763168A (en) | N-(3-quinuclidinyl) acylanilides | |
| JP4276070B2 (en) | Cyclic amine compound | |
| JPH0657693B2 (en) | Muscarinic receptor antagonist | |
| US5296485A (en) | Substituted N-phenylpiperidines and drugs therefrom | |
| JPH04282366A (en) | Phenylpiperidylamine | |
| DK175505B1 (en) | 1-substituted 3- (1- [cyano or carbamoyl] -1,1-diphenylmethyl) piperidine compounds and their use in the manufacture of a medicament for the treatment of disorders associated with altered motility and / or smooth muscle tone ..... .. | |
| EP0532629B1 (en) | 1-piperidinyl alkanoylarylsulfonamide derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| CC | Certificate of correction | ||
| FPAY | Fee payment |
Year of fee payment: 12 |





