USPP2758P - Nectarine tree - Google Patents
Nectarine tree Download PDFInfo
- Publication number
- USPP2758P USPP2758P US PP2758 P USPP2758 P US PP2758P
- Authority
- US
- United States
- Prior art keywords
- fruit
- nectarine
- peach
- plate
- ripening
- Prior art date
Links
- 235000006029 Prunus persica var nucipersica Nutrition 0.000 title description 24
- 240000005866 Prunus persica var. nucipersica Species 0.000 title description 24
- 235000013399 edible fruits Nutrition 0.000 description 29
- 244000144730 Amygdalus persica Species 0.000 description 18
- 235000006040 Prunus persica var persica Nutrition 0.000 description 18
- 230000005070 ripening Effects 0.000 description 12
- 210000003491 Skin Anatomy 0.000 description 11
- 239000004575 stone Substances 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 7
- 241001522296 Erithacus rubecula Species 0.000 description 4
- 210000004907 Glands Anatomy 0.000 description 4
- 230000004345 fruit ripening Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 210000003323 Beak Anatomy 0.000 description 2
- 240000002787 Phlox paniculata Species 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 235000009508 confectionery Nutrition 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- JGIDSJGZGFYYNX-YUAHOQAQSA-N Indian yellow Chemical compound O1[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1=CC=C(OC=2C(=C(O)C=CC=2)C2=O)C2=C1 JGIDSJGZGFYYNX-YUAHOQAQSA-N 0.000 description 1
- 240000006236 Martynia annua Species 0.000 description 1
- 235000009071 Mesembryanthemum crystallinum Nutrition 0.000 description 1
- 102100019815 SRRT Human genes 0.000 description 1
- 101700037877 SRRT Proteins 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000011681 asexual reproduction Effects 0.000 description 1
- -1 bout Species 0.000 description 1
- 230000001488 breeding Effects 0.000 description 1
- CJOBVZJTOIVNNF-UHFFFAOYSA-N cadmium sulfide Chemical compound [Cd]=S CJOBVZJTOIVNNF-UHFFFAOYSA-N 0.000 description 1
- 230000034303 cell budding Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000000994 depressed Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 231100001004 fissure Toxicity 0.000 description 1
- 239000002223 garnet Substances 0.000 description 1
- 230000000762 glandular Effects 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
Images
Definitions
- Axial diameter From 1% to 2% inches.
- Form Relatively uniform; between globose and broadly ovoid.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USPP2758P (en) | Nectarine tree | |
| USPP2580P (en) | d- l- armstrong etal p | |
| USPP4399P (en) | Peach tree | |
| USPP2943P (en) | Nectarine tree | |
| USPP5251P (en) | Peach tree | |
| USPP2929P (en) | Nectarine tree | |
| USPP2930P (en) | Peach tree | |
| USPP2399P (en) | Peach tree | |
| USPP2213P (en) | armstrong | |
| USPP1976P (en) | Peach tree | |
| USPP1869P (en) | Merrill | |
| USPP2958P (en) | Nectarine tree | |
| USPP1485P (en) | Peach tree | |
| USPP9548P (en) | `Bev's red` peach tree | |
| USPP4398P (en) | Peach tree | |
| USPP2010P (en) | Nectarine tree | |
| USPP2240P (en) | Merrill | |
| USPP2180P (en) | Peach tree | |
| USPP1785P (en) | Peach | |
| USPP1870P (en) | Merrill | |
| USPP2783P (en) | garabedian | |
| USPP1060P (en) | Nectarine tree | |
| USPP1127P (en) | Peach tree | |
| USPP2747P (en) | Plum tree | |
| USPP1716P (en) | Att ys |