USPP1716P - Att ys - Google Patents
Att ys Download PDFInfo
- Publication number
- USPP1716P USPP1716P US PP1716 P USPP1716 P US PP1716P
- Authority
- US
- United States
- Prior art keywords
- medium
- peach
- average
- tree
- fruit
- Prior art date
Links
- 235000006040 Prunus persica var persica Nutrition 0.000 description 34
- 244000144730 Amygdalus persica Species 0.000 description 30
- 235000013399 edible fruits Nutrition 0.000 description 18
- 210000003414 Extremities Anatomy 0.000 description 4
- 240000005809 Prunus persica Species 0.000 description 4
- 230000035772 mutation Effects 0.000 description 4
- 230000005070 ripening Effects 0.000 description 4
- 239000004575 stone Substances 0.000 description 4
- XUCIJNAGGSZNQT-JHSLDZJXSA-N (R)-amygdalin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O[C@@H](C#N)C=2C=CC=CC=2)O1 XUCIJNAGGSZNQT-JHSLDZJXSA-N 0.000 description 2
- 229940089837 Amygdalin Drugs 0.000 description 2
- XUCIJNAGGSZNQT-IJDPOVSISA-N Amygdalin Natural products O([C@H](C#N)c1ccccc1)[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)O1 XUCIJNAGGSZNQT-IJDPOVSISA-N 0.000 description 2
- 210000004907 Glands Anatomy 0.000 description 2
- 210000000088 Lip Anatomy 0.000 description 2
- 102100019815 SRRT Human genes 0.000 description 2
- 101700037877 SRRT Proteins 0.000 description 2
- 210000003491 Skin Anatomy 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000011681 asexual reproduction Effects 0.000 description 2
- 235000020127 ayran Nutrition 0.000 description 2
- 230000034303 cell budding Effects 0.000 description 2
- 235000021185 dessert Nutrition 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 230000000644 propagated Effects 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
Images
Definitions
- the present variety is further characterized by blooming-on the average-three to four days in advance of the Redhaven peach.
- Fig. 1 is an elevation showing twigs, leaves, and two fruit of the variety.
- Fig. 2 is a sectional elevation of the fruit, with the stone exposed.
- Colon-Pink with edges darker than center of petal.
- Ventral surface -Slightly rounded throughout; lips usually unequal.
- Fibers-Few tender.
- Type.-Semi-free to free i. e. semi-free when firm ripe, and free when soft ripe. Adheres to flesh when firm ripe on both dorsal and ventral edges close to stem end.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USPP1716P (en) | Att ys | |
| USPP4436P (en) | Cherry tree | |
| USPP5388P (en) | Peach plant | |
| USPP1869P (en) | Merrill | |
| USPP4084P (en) | Nectarine tree | |
| USPP1429P (en) | Nectarine tree | |
| USPP1287P (en) | Nectarine tree | |
| USPP2747P (en) | Plum tree | |
| USPP2496P (en) | Plum tree | |
| USPP2323P (en) | Nectarine tree | |
| USPP3179P (en) | Peach tree | |
| USPP1538P (en) | Peach tree | |
| USPP1096P (en) | Nectarine tree | |
| USPP1410P (en) | Merrill | |
| USPP2996P (en) | Merrill | |
| USPP1870P (en) | Merrill | |
| USPP5342P (en) | Plum tree, Suplumfourteen | |
| USPP1098P (en) | Peach tree | |
| USPP1755P (en) | Nectarine tree | |
| USPP1247P (en) | Peach tree | |
| USPP930P (en) | Peach tree | |
| USPP2360P (en) | Peach tree | |
| USPP1420P (en) | Nectarine tree | |
| USPP1872P (en) | Merrill | |
| USPP1141P (en) | garabedian |